diff options
Diffstat (limited to 'test/files')
232 files changed, 20956 insertions, 0 deletions
diff --git a/test/files/jvm/JavaInteraction.check b/test/files/jvm/JavaInteraction.check new file mode 100644 index 0000000000..fb9d3cdd8c --- /dev/null +++ b/test/files/jvm/JavaInteraction.check @@ -0,0 +1,4 @@ +p.x = 5 +p.c = java.awt.Color[r=255,g=0,b=0] +p.getX() = 5.0 +p.getC() = java.awt.Color[r=255,g=0,b=0] diff --git a/test/files/jvm/JavaInteraction.scala b/test/files/jvm/JavaInteraction.scala new file mode 100644 index 0000000000..ee86e83dbd --- /dev/null +++ b/test/files/jvm/JavaInteraction.scala @@ -0,0 +1,24 @@ +//############################################################################ +// Test Java interaction +//############################################################################ +// $Id$ + +import java.awt.Color; +import java.awt.Point; + +class ColoredPoint(x: Int, y: Int, c_ : Color) extends Point(x, y) { + val c: Color = c_; + def getC(): Color = c; +} + +object Test { + def main(args: Array[String]): Unit = { + val p = new ColoredPoint(5, 7, Color.RED); + System.out.println("p.x = " + p.x); + System.out.println("p.c = " + p.c); + System.out.println("p.getX() = " + p.getX()); + System.out.println("p.getC() = " + p.getC()); + } +} + +//############################################################################ diff --git a/test/files/jvm/serialization.check b/test/files/jvm/serialization.check new file mode 100644 index 0000000000..c2728a5401 --- /dev/null +++ b/test/files/jvm/serialization.check @@ -0,0 +1,100 @@ +x1 = List() +y1 = List() +x1 eq y1: true - y1 eq x1: true + +x2 = None +y2 = None +x2 eq y2: true - y2 eq x2: true + +x3 = Array[1,2,3] +y3 = Array[1,2,3] +arrayEquals(x3, y3): true + +x4 = <na> +y4 = <na> +x4(2): 4 - y4(2): 4 + +x = List((buffers,20),(layers,2),(title,3)) +y = List((buffers,20),(layers,2),(title,3)) +x equals y: true - y equals x: true + +x = {buffers -> 20, layers -> 2, title -> 3} +y = {buffers -> 20, layers -> 2, title -> 3} +x equals y: true - y equals x: true + +x = {1} +y = {1} +x equals y: true - y equals x: true + +x = {5, 3} +y = {5, 3} +x equals y: true - y equals x: true + +x = Queue(a,b,c) +y = Queue(a,b,c) +x equals y: true - y equals x: true + +x = Stack(c, b, a) +y = Stack(c, b, a) +x equals y: true - y equals x: true + +x = {42 -> FortyTwo} +y = {42 -> FortyTwo} +x equals y: true - y equals x: true + +x = {0, 2} +y = {0, 2} +x equals y: true - y equals x: true + +x = {title -> 3, buffers -> 20, layers -> 2} +y = {title -> 3, buffers -> 20, layers -> 2} +x equals y: true - y equals x: true + +x = {0, 8, 9} +y = {0, 8, 9} +x equals y: true - y equals x: true + +x = {title, buffers, layers} +y = {title, buffers, layers} +x equals y: true - y equals x: true + +x = LinkedList(2, 3) +y = LinkedList(2, 3) +x equals y: true - y equals x: true + +x = Queue(20, 2, 3) +y = Queue(20, 2, 3) +x equals y: true - y equals x: true + +x = Stack(20, 2, 3) +y = Stack(20, 2, 3) +x equals y: true - y equals x: true + +x = <html><title>title</title><body></body></html> +y = <html><title>title</title><body></body></html> +x equals y: true - y equals x: true + +x = <html><body><table cellspacing="0" cellpadding="2"><tr><th>Last Name</th><th>First Name</th></tr><tr><td>Tom</td><td>20</td></tr><tr><td>Bob</td><td>22</td></tr><tr><td>James</td><td>19</td></tr></table></body></html> +y = <html><body><table cellspacing="0" cellpadding="2"><tr><th>Last Name</th><th>First Name</th></tr><tr><td>Tom</td><td>20</td></tr><tr><td>Bob</td><td>22</td></tr><tr><td>James</td><td>19</td></tr></table></body></html> +x equals y: true - y equals x: true + +x = Tim +y = Tim +x equals y: true - y equals x: true + +x = Bob +y = Bob +x equals y: true - y equals x: true + +x = John +y = John +x equals y: true - y equals x: true + +x = Bill +y = Bill +x equals y: true - y equals x: true + +x = Paul +y = Paul +x equals y: true - y equals x: true + diff --git a/test/files/jvm/serialization.scala b/test/files/jvm/serialization.scala new file mode 100644 index 0000000000..f55af0d46f --- /dev/null +++ b/test/files/jvm/serialization.scala @@ -0,0 +1,316 @@ +//############################################################################ +// Serialization +//############################################################################ +// $Id$ + +import java.lang.System; + +object EqualityTest { + def check[A, B](x: A, y: B): Unit = { + System.out.println("x = " + x); + System.out.println("y = " + y); + System.out.println( + "x equals y: " + (x equals y) + " - y equals x: " + (y equals x)); + System.out.println(); + } +} + +object Serialize { + def write[A](o: A): Array[Byte] = { // throws Exception + val ba = new java.io.ByteArrayOutputStream(512); + val out = new java.io.ObjectOutputStream(ba); + out.writeObject(o); + out.close(); + ba.toByteArray() + } + def read[A](buffer: Array[Byte]): A = { // throws Exception + val in = + new java.io.ObjectInputStream(new java.io.ByteArrayInputStream(buffer)); + in.readObject().asInstanceOf[A] + } +} + +//############################################################################ +// Test classes in package "scala" + +[serializable] +object Test1_scala { + private def arrayToString[A](arr: Array[A]): String = + List.fromArray(arr).mkString("Array[",",","]"); + private def arrayEquals[A, B](a1: Array[A], a2: Array[B]) = + (a1.length == a2.length) && + (Iterator.range(0, a1.length) forall { i => a1(i) == a2(i) }); + val x1 = Nil; + val x2 = None; + val x3 = Array(1, 2, 3); + val x4 = x: Int => 2 * x; + + try { + val y1: List[All] = Serialize.read(Serialize.write(x1)); + val y2: Option[All] = Serialize.read(Serialize.write(x2)); + val y3: Array[Int] = Serialize.read(Serialize.write(x3)); + val y4: Function[Int, Int] = Serialize.read(Serialize.write(x4)); + + System.out.println("x1 = " + x1); + System.out.println("y1 = " + y1); + System.out.println("x1 eq y1: " + (x1 eq y1) + " - y1 eq x1: " + (y1 eq x1)); + System.out.println(); + System.out.println("x2 = " + x2); + System.out.println("y2 = " + y2); + System.out.println("x2 eq y2: " + (x2 eq y2) + " - y2 eq x2: " + (y2 eq x2)); + System.out.println(); + System.out.println("x3 = " + arrayToString(x3)); + System.out.println("y3 = " + arrayToString(y3)); + System.out.println("arrayEquals(x3, y3): " + arrayEquals(x3, y3)); + System.out.println(); + System.out.println("x4 = <na>"); + System.out.println("y4 = <na>"); + System.out.println("x4(2): " + x4(2) + " - y4(2): " + y4(2)); + System.out.println(); + } + catch { + case e: Exception => + e.printStackTrace(); + System.out.println("Error in Test1_scala: " + e); + } +} + +//############################################################################ +// Test classes in package "scala.collection.immutable" +[serializable] +object Test2_immutable { + import scala.collection.immutable.{BitSet,ListMap,ListSet,Queue,Stack, + TreeSet,TreeMap}; + + val x1 = List( + Pair("buffers", 20), + Pair("layers", 2), + Pair("title", 3) + ); + + val x2 = new ListMap[String, Int] + .incl(Pair("buffers", 20)) + .incl(Pair("layers", 2)) + .incl(Pair("title", 3)); + + val x3 = new BitSet(4, Array(2), true); + + val x4 = new ListSet[Int]().incl(3).incl(5); + + val x5 = new Queue("a", "b", "c"); + + val x6 = new Stack().push("a", "b", "c"); + + val x7 = new TreeMap[Int, String] + 42 -> "FortyTwo"; + + val x8 = new TreeSet[Int]().incl(2).incl(0); + + try { + val y1: List[Pair[String, Int]] = Serialize.read(Serialize.write(x1)); + val y2: ListMap[String, Int] = Serialize.read(Serialize.write(x2)); + val y3: BitSet = Serialize.read(Serialize.write(x3)); + val y4: ListSet[Int] = Serialize.read(Serialize.write(x4)); + val y5: Queue[String] = Serialize.read(Serialize.write(x5)); + val y6: Stack[String] = Serialize.read(Serialize.write(x6)); + val y7: TreeMap[Int, String] = Serialize.read(Serialize.write(x7)); + val y8: TreeSet[Int] = Serialize.read(Serialize.write(x8)); + + EqualityTest.check(x1, y1); + EqualityTest.check(x2, y2); + EqualityTest.check(x3, y3); + EqualityTest.check(x4, y4); + EqualityTest.check(x5, y5); + EqualityTest.check(x6, y6); + EqualityTest.check(x7, y7); + EqualityTest.check(x8, y8); + } + catch { + case e: Exception => + System.out.println("Error in Test2_immutable: " + e); + } +} + +//############################################################################ +// Test classes in package "scala.collection.mutable" + +object Test3_mutable { + import scala.collection.mutable.{BitSet,HashMap,HashSet,LinkedList, + Queue,Stack}; + + val x1 = new HashMap[String, Int]; + x1 ++= Test2_immutable.x1; + + val x2 = new BitSet(); + x2.set(0); + x2.set(8); + x2.set(9); + + val x3 = new HashSet[String]; + x3 ++= Test2_immutable.x1.map(p => p._1); + + val x4 = new LinkedList[Int](2, null); + x4.append(new LinkedList(3, null)); + + val x5 = new Queue[Int]; + x5 ++= Test2_immutable.x1.map(p => p._2); + + val x6 = new Stack[Int]; + x6 ++= x5; + + try { + val y1: HashMap[String, Int] = Serialize.read(Serialize.write(x1)); + val y2: BitSet = Serialize.read(Serialize.write(x2)); + val y3: HashSet[String] = Serialize.read(Serialize.write(x3)); + val y4: LinkedList[Int] = Serialize.read(Serialize.write(x4)); + val y5: Queue[Int] = Serialize.read(Serialize.write(x5)); + val y6: Stack[Int] = Serialize.read(Serialize.write(x6)); + + EqualityTest.check(x1, y1); + EqualityTest.check(x2, y2); + EqualityTest.check(x3, y3); + EqualityTest.check(x4, y4); + EqualityTest.check(x5, y5); + EqualityTest.check(x6, y6); + } + catch { + case e: Exception => + System.out.println("Error in Test3_mutable: " + e); + } +} + +//############################################################################ +// Test classes in package "scala.xml" + +object Test4_xml { + import scala.xml.{Elem}; + + val x1 = <html><title>title</title><body></body></html>; + + case class Person(name: String, age: Int); + + class AddressBook(a: Person*) { + private val people: List[Person] = a.toList; + def toXHTML = + <table cellpadding="2" cellspacing="0"> + <tr> + <th>Last Name</th> + <th>First Name</th> + </tr> + { for (val p <- people) yield + <tr> + <td> { p.name } </td> + <td> { p.age.toString() } </td> + </tr> } + </table>; + } + + val people = new AddressBook( + Person("Tom", 20), + Person("Bob", 22), + Person("James", 19)); + + val x2 = + <html> + <body> + { people.toXHTML } + </body> + </html>; + + try { + val y1: scala.xml.Elem = Serialize.read(Serialize.write(x1)); + val y2: scala.xml.Elem = Serialize.read(Serialize.write(x2)); + + EqualityTest.check(x1, y1); + EqualityTest.check(x2, y2); + } + catch { + case e: Exception => + System.out.println("Error in Test4_xml: " + e); + } +} + +//############################################################################ +// Test user-defined classes WITHOUT nesting + +[serializable] +class Person(_name: String) { + private var name = _name; + override def toString() = name; + override def equals(that: Any): Boolean = + that.isInstanceOf[Person] && + (name == that.asInstanceOf[Person].name); +} + +[serializable] +class Employee(_name: String) { + private var name = _name; + override def toString() = name; +} +[serializable] +object bob extends Employee("Bob"); + +object Test5 { + val x1 = new Person("Tim"); + val x2 = bob; + + try { + val y1: Person = Serialize.read(Serialize.write(x1)); + val y2: Employee = Serialize.read(Serialize.write(x2)); + + EqualityTest.check(x1, y1); + EqualityTest.check(x2, y2); + } + catch { + case e: Exception => + System.out.println("Error in Test5: " + e); + } +} + +//############################################################################ +// Test user-defined classes WITH nesting + +[serializable] +object Test6 { + [serializable] + object bill extends Employee("Bill") { + val x = paul; + } + [serializable] + object paul extends Person("Paul") { + val x = 4; // bill; => StackOverflowException !!! + } + val x1 = new Person("John"); + val x2 = bill; + val x3 = paul; + + try { + val y1: Person = Serialize.read(Serialize.write(x1)); + val y2: Employee = Serialize.read(Serialize.write(x2)); + val y3: Person = Serialize.read(Serialize.write(x3)); + + EqualityTest.check(x1, y1); + EqualityTest.check(x2, y2); + EqualityTest.check(x3, y3); + } + catch { + case e: Exception => + System.out.println("Error in Test6: " + e); + } +} + +//############################################################################ +// Test code + +object Test { + def main(args: Array[String]): Unit = { + Test1_scala; + Test2_immutable; + Test3_mutable; + Test4_xml; + Test5; + Test6 + } +} + +//############################################################################ + diff --git a/test/files/neg/abstract.check b/test/files/neg/abstract.check new file mode 100644 index 0000000000..1f888dcceb --- /dev/null +++ b/test/files/neg/abstract.check @@ -0,0 +1,7 @@ +abstract.scala:5 error: malformed type: A.this.T#T + def foo1 = bar().bar(); + ^ +abstract.scala:7 error: malformed type: A#T + def foo3 = baz().bar(); + ^ +two errors found diff --git a/test/files/neg/abstract.scala b/test/files/neg/abstract.scala new file mode 100644 index 0000000000..41cfc81309 --- /dev/null +++ b/test/files/neg/abstract.scala @@ -0,0 +1,9 @@ +trait A { + type T <: A; + def baz(): A; + def bar(): T; + def foo1 = bar().bar(); + def foo2 = bar().baz(); + def foo3 = baz().bar(); + def foo4 = baz().baz(); +} diff --git a/test/files/neg/variances.check b/test/files/neg/variances.check new file mode 100644 index 0000000000..82d992048b --- /dev/null +++ b/test/files/neg/variances.check @@ -0,0 +1,4 @@ +variances.scala:2 error: covariant type a occurs in contravariant position in type Vector[a] of value x + def append(x: Vector[a]): Vector[a] + ^ +one error found diff --git a/test/files/neg/variances.scala b/test/files/neg/variances.scala new file mode 100644 index 0000000000..ebcba21611 --- /dev/null +++ b/test/files/neg/variances.scala @@ -0,0 +1,4 @@ +trait Vector[+a] { + def append(x: Vector[a]): Vector[a] +} + diff --git a/test/files/pos/304.scala b/test/files/pos/304.scala new file mode 100644 index 0000000000..607a115db2 --- /dev/null +++ b/test/files/pos/304.scala @@ -0,0 +1,5 @@ +object O { + def f1 = -1; + def f2 = 0-1; + def f3 = f1 + f2; +} diff --git a/test/files/pos/A.scala b/test/files/pos/A.scala new file mode 100644 index 0000000000..fc50379d88 --- /dev/null +++ b/test/files/pos/A.scala @@ -0,0 +1,8 @@ +trait A extends java.lang.Object {} + +object test { + + def x: A = x; + +} + diff --git a/test/files/pos/List1.scala b/test/files/pos/List1.scala new file mode 100644 index 0000000000..1321d95c20 --- /dev/null +++ b/test/files/pos/List1.scala @@ -0,0 +1,45 @@ +object lists { + + abstract class List[a] { + def isEmpty: Boolean; + def head: a; + def tail: List[a]; + def prepend(x: a) = Cons[a](x, this); + } + + def Nil[b] = new List[b] { + def isEmpty: Boolean = true; + def head = error("head of Nil"); + def tail = error("tail of Nil"); + } + + def Cons[c](x: c, xs: List[c]): List[c] = new List[c] { + def isEmpty = false; + def head = x; + def tail = xs; + } + + def foo = { + val intnil = Nil[Int]; + val intlist = intnil.prepend(1).prepend(1+1); + val x: Int = intlist.head; + val strnil = Nil[String]; + val strlist = strnil.prepend("A").prepend("AA"); + val y: String = strlist.head; + () + } + + class IntList() extends List[Int] { + def isEmpty: Boolean = false; + def head: Int = 1; + def foo: List[Int] { def isEmpty: Boolean; def head: Int; def tail: List[Int] } = Nil[Int]; + def tail0: List[Int] = foo.prepend(1).prepend(1+1); + def tail: List[Int] = Nil[Int].prepend(1).prepend(1+1); + } + + def foo2 = { + val il1 = new IntList(); + val il2 = il1.prepend(1).prepend(2); + () + } +} diff --git a/test/files/pos/MailBox.scala b/test/files/pos/MailBox.scala new file mode 100644 index 0000000000..b1ea818f60 --- /dev/null +++ b/test/files/pos/MailBox.scala @@ -0,0 +1,83 @@ +package test; + +import scala.concurrent._; + +class MailBox { + private class LinkedList[a] { + var elem: a = _; + var next: LinkedList[a] = null; + } + + private def insert[a](l: LinkedList[a], x: a): LinkedList[a] = { + l.next = new LinkedList[a]; + l.next.elem = x; + l.next.next = l.next; + l + } + + private abstract class Receiver { + def isDefined(msg: Any): boolean; + var msg: Any = null; + } + + private val sent = new LinkedList[Any]; + private var lastSent = sent; + private val receivers = new LinkedList[Receiver]; + private var lastReceiver = receivers; + + def send(msg: Any): unit = synchronized { + var r = receivers; + var r1 = r.next; + while (r1 != null && !r1.elem.isDefined(msg)) { + r = r1; r1 = r1.next; + } + if (r1 != null) { + r.next = r1.next; r1.elem.msg = msg; r1.elem.notify(); + } else { + lastSent = insert(lastSent, msg); + } + } + + def receive[a](f: PartialFunction[Any, a]): a = { + val msg: Any = synchronized { + var s = sent; + var s1 = s.next; + while (s1 != null && !f.isDefinedAt(s1.elem)) { + s = s1; s1 = s1.next + } + if (s1 != null) { + s.next = s1.next; s1.elem + } else { + val r = insert(lastReceiver, new Receiver { + def isDefined(msg: Any) = f.isDefinedAt(msg); + }); + lastReceiver = r; + r.elem.wait(); + r.elem.msg + } + } + f(msg) + } + + def receiveWithin[a](msec: long)(f: PartialFunction[Any, a]): a = { + val msg: Any = synchronized { + var s = sent; + var s1 = s.next; + while (s1 != null && !f.isDefinedAt(s1.elem)) { + s = s1; s1 = s1.next ; + } + if (s1 != null) { + s.next = s1.next; s1.elem + } else { + val r = insert(lastReceiver, new Receiver { + def isDefined(msg: Any) = f.isDefinedAt(msg); + }); + lastReceiver = r; + r.elem.wait(msec); + if (r.elem.msg == null) r.elem.msg = TIMEOUT; + r.elem.msg + } + } + f(msg) + } +} diff --git a/test/files/pos/S1.scala b/test/files/pos/S1.scala new file mode 100644 index 0000000000..68706e3dd3 --- /dev/null +++ b/test/files/pos/S1.scala @@ -0,0 +1,13 @@ +/* This is probably no bug, I just don't understand why +** type inference does not find the right instantiation of foo. +** Currently it reports: +** +** S1.scala:12: inferred type arguments [S1] do not conform to +** method foo's type parameter bounds [T <: S1.this.type] +** foo(this); +** ^ +*/ +class S1() { + def foo[T <: this.type](x: T) = x; + foo[this.type](this); +} diff --git a/test/files/pos/S3.scala b/test/files/pos/S3.scala new file mode 100644 index 0000000000..1e0f0288b1 --- /dev/null +++ b/test/files/pos/S3.scala @@ -0,0 +1,14 @@ +/* Why does this code fail? b has type a.type, so the third +** declaration in S3 should be okay... The compiler writes instead: +** +** found : S3.this.b.type (with underlying type S3) +** required: S3.this.a.type +** val c: a.type = b; +** ^ +** Without declaration 3, everything is fine. +*/ +class S3() { + val a = new S3(); + val b: a.type = a; + val c: a.type = b; +} diff --git a/test/files/pos/S5.scala b/test/files/pos/S5.scala new file mode 100644 index 0000000000..f0b66a6e68 --- /dev/null +++ b/test/files/pos/S5.scala @@ -0,0 +1,30 @@ +/* Here's a fragment of a Scala encoding for the Keris module system; +** the compiler claims: +** +** S5.scala:28: value n in class N of type N.this._N.n +** cannot override value n in class M of type M.this._N.n +** val system = new M() with N() {} +** ^ +** To me it seems like the code is perfectly fine... +*/ +abstract class M() { + val _N: N; + val n: _N.n; + val _M: M = this; + val m: _M.m = new _M.m(); + class m() { + // module body of M + } +} +trait N { + val _N: N = this; + val n: _N.n = new _N.n(); + val _M: M; + val m: _M.m; + class n() { + // module body of N + } +} +object O { + val system = new M() with N {} +} diff --git a/test/files/pos/S8.scala b/test/files/pos/S8.scala new file mode 100644 index 0000000000..50f1df27a2 --- /dev/null +++ b/test/files/pos/S8.scala @@ -0,0 +1,19 @@ +/* I believe this code is correct, but the compiler rejects it: +** +** S8.scala:18: type mismatch; +** found : M.x.A +** required: M.x.a.B +** val y: x.a.B = new x.A(); //correct? +** ^ +** For a given value x of type S8, type x.A should be +** a subtype of x.a.B. +*/ +class S8() { + val a: S8 = this; + class A() extends a.B() {} + class B() {} +} +object M { + val x = new S8(); + val y: x.a.B = new x.A(); //correct? +} diff --git a/test/files/pos/X.scala b/test/files/pos/X.scala new file mode 100644 index 0000000000..2edf010efd --- /dev/null +++ b/test/files/pos/X.scala @@ -0,0 +1,14 @@ +abstract class A() { + + var x: Int + +} + +abstract class B() extends A() { + + var xx: Int = 0; + + def x = xx; + def x_=(y: Int) = xx = y; +} + diff --git a/test/files/pos/Z.scala b/test/files/pos/Z.scala new file mode 100644 index 0000000000..c1367e46b9 --- /dev/null +++ b/test/files/pos/Z.scala @@ -0,0 +1,10 @@ +trait X { + val elem: Int = 1 +} + +object test { + + def g(x: X) = x.elem; + def f(x: Object) = x.toString(); + +} diff --git a/test/files/pos/abstract.scala b/test/files/pos/abstract.scala new file mode 100644 index 0000000000..533f996931 --- /dev/null +++ b/test/files/pos/abstract.scala @@ -0,0 +1,9 @@ +abstract class C() { + type t; + def copy(x: t): t = x; +} + +class D() extends C() { + type t = Int; + System.out.println(copy(1)); +} diff --git a/test/files/pos/aliases.scala b/test/files/pos/aliases.scala new file mode 100644 index 0000000000..b746a35861 --- /dev/null +++ b/test/files/pos/aliases.scala @@ -0,0 +1,25 @@ +abstract class C() { + + type t <: C; + + val x: t; + val y: x.type; + val z: x.type; + val u: z.type; + + val xt: x.t; + val yt: y.t; + val zt: z.t; + val ut: z.t; + + def fx(a: x.t): Unit; + def fy(a: y.t): Unit; + def fz(a: z.t): Unit; + def fu(a: u.t): Unit; + + fx(xt); fx(yt); fx(zt); fx(ut); + fy(xt); fy(yt); fy(zt); fy(ut); + fz(xt); fz(yt); fz(zt); fz(ut); + fu(xt); fu(yt); fu(zt); fu(ut); + +} diff --git a/test/files/pos/all.lst b/test/files/pos/all.lst new file mode 100644 index 0000000000..db9b9813dd --- /dev/null +++ b/test/files/pos/all.lst @@ -0,0 +1,143 @@ +304.scala +A.scala +List1.scala +MailBox.scala +S1.scala +S3.scala +S5.scala +S8.scala +X.scala +Z.scala +abstract.scala +aliases.scala +arrays2.scala +attributes.scala +bug082.scala +bug1.scala +bug115.scala +bug116.scala +bug119.scala +bug121.scala +bug123.scala +bug124.scala +bug151.scala +bug159.scala +bug160.scala +bug17.scala +bug175.scala +bug177.scala +bug183.scala +bug193.scala +bug2.scala +bug20.scala +bug201.scala +bug204.scala +bug210.scala +bug211.scala +bug229.scala +bug245.scala +bug267.scala +bug287.scala +bug289.scala +bug29.scala +bug295.scala +bug30.scala +bug304.scala +bug31.scala +bug318.scala +bug32.scala +bug342.scala +bug348plus.scala +bug359.scala +bug36.scala +bug360.scala +bug361.scala +bug372.scala +bug39.scala +bug49.scala +bug53.scala +bug54.scala +bug61.scala +bug64.scala +bug66.scala +bug68.scala +bug69.scala +bug76.scala +bug81.scala +bug85.scala +bug91.scala +bug93.scala +cls.scala +cls1.scala +clsrefine.scala +compile.scala +compound.scala +constfold.scala +context.scala +eta.scala +exceptions.scala +expressions-current.scala +gui.scala +imports.scala +infer.scala +infer2.scala +lambda.scala +lambdalift.scala +lambdalift1.scala +localmodules.scala +matthias1.scala +matthias3.scala +matthias4.scala +matthias5.scala +maxim1.scala +michel1.scala +michel2.scala +michel3.scala +michel4.scala +michel5.scala +michel6.scala +mixins.scala +modules.scala +modules1.scala +moduletrans.scala +nested.scala +null.scala +orderedpoints.scala +override.scala +partialfun.scala +patterns.scala +patterns1.scala +patterns2.scala +patterns3.scala +philippe1.scala +philippe2.scala +philippe3.scala +philippe4.scala +pmbug.scala +propagate.scala +rebind.scala +refine.scala +reftest.scala +scall.bat +scoping1.scala +scoping2.scala +scoping3.scala +seqtest2.scala +simplelists.scala +stable.scala +strings.scala +test1.scala +test2.scala +test4.scala +test4a.scala +test4refine.scala +test5.scala +test5refine.scala +testcast.scala +thistype.scala +thistypes.scala +traits.scala +valdefs.scala +viewtest1.scala +viewtest2.scala +viewtest3.scala diff --git a/test/files/pos/arrays2.scala b/test/files/pos/arrays2.scala new file mode 100644 index 0000000000..6f4a09a401 --- /dev/null +++ b/test/files/pos/arrays2.scala @@ -0,0 +1,11 @@ +case class C(); + +object arrays2 { + + def main(args: Array[String]): Unit = { + val a: Array[Array[C]] = new Array[Array[C]](2); + a(0) = new Array[C](2); + a(0)(0) = new C(); + } +} + diff --git a/test/files/pos/attributes.scala b/test/files/pos/attributes.scala new file mode 100644 index 0000000000..ab30e2cdeb --- /dev/null +++ b/test/files/pos/attributes.scala @@ -0,0 +1,74 @@ +/* $Id$ */ + +[serializable] class C1; +[serializable,volatile] class C2; +[serializable][volatile] class C3; +[serializable][volatile,serializable] class C4; + +[serializable] trait T1; +[serializable,volatile] trait T2; +[serializable][volatile] trait T3; +[serializable][volatile,serializable] trait T4; + +[serializable] object O1 extends C1; +[serializable,volatile] object O2 extends C2; +[serializable][volatile] object O3 extends C3; +[serializable][volatile,serializable] object O4 extends C4; + +object O5 { + final val n = 2; + [SerialVersionUID(0)] class C1; + [SerialVersionUID(n)] class C2; + [SerialVersionUID(0),SerialVersionUID(n)] class C3; + [SerialVersionUID(0)][SerialVersionUID(n)] class C4; +} + +abstract class A1 { + [serializable] var y1: C1; + [serializable,volatile] var y2: C2; + [serializable][volatile] var y3: C3; + [serializable][volatile,serializable] var y4: C4; + + [serializable] def foo1: C1; + [serializable,volatile] def foo2: C2; + [serializable][volatile] def foo3: C3; + [serializable][volatile,serializable] def foo4: C4; +} + +object O6 { + [serializable] val x1 = new C1; + [serializable,volatile] val x2 = new C2; + [serializable][volatile] val x3 = new C3; + [serializable][volatile,serializable] val x4 = new C4; + + [serializable] var y1: C1 = _; + [serializable,volatile] var y2: C2 = _; + [serializable][volatile] var y3: C3 = _; + [serializable][volatile,serializable] var y4: C4 = _; + + [serializable] private def foo1 = x1; + [serializable,volatile] private def foo2 = x2; + [serializable][volatile] protected def foo3 = x3; + [serializable][volatile,serializable] protected def foo4 = x4; +} + +object myAttrs { + class a1 extends scala.Attribute; + class a2(x: Int) extends scala.Attribute; + class a3(x: a1) extends scala.Attribute; +} +object O7 { + class a1 extends scala.Attribute; + class a2(x: Int) extends scala.Attribute; + class a3(x: a1) extends scala.Attribute; + final val x = new a1; + [a1] class C1; + [a1,a2(77)] class C2; + [a1][a2(88)] class C3; + [a1][a2(88),a3(null)] class C4; + + [myAttrs.a1] class A1; + [myAttrs.a1,myAttrs.a2(99)] class A2; + [myAttrs.a1][myAttrs.a2(99)] class A3; + [myAttrs.a1][myAttrs.a2(99),myAttrs.a3(null)] class A4; +} diff --git a/test/files/pos/bug082.scala b/test/files/pos/bug082.scala new file mode 100644 index 0000000000..594c9fdc86 --- /dev/null +++ b/test/files/pos/bug082.scala @@ -0,0 +1,18 @@ + +object Main { + + def min0[A](less: (A, A) => Boolean, xs: List[A]): Option[A] = xs match { + case List() => None + case List(x) => Some(x) +// case x :: Nil => Some(x) + case y :: ys => min0(less, ys) match { + case Some(m) => if (less(y, m)) Some(y) else Some(m) + } + } + + def min(xs: List[Int]) = min0((x: Int, y: Int) => x < y, xs); + + def main(args: Array[String]) = + System.out.println(min(List())); + +} diff --git a/test/files/pos/bug1.scala b/test/files/pos/bug1.scala new file mode 100644 index 0000000000..bdf33ef20d --- /dev/null +++ b/test/files/pos/bug1.scala @@ -0,0 +1,8 @@ +object Exceptions { + + class CubeException(s: String) extends java.lang.RuntimeException(s); + + def main(args: Array[String]) = + System.out.println(new CubeException("test")); + +} diff --git a/test/files/pos/bug115.scala b/test/files/pos/bug115.scala new file mode 100644 index 0000000000..a250e3c090 --- /dev/null +++ b/test/files/pos/bug115.scala @@ -0,0 +1,9 @@ +class S[A](f: A => A, x: A) { + System.out.println(f(x)); +} +class T[B](f: B => B, y: B) extends S(x: B => f(x), y) { +} +object Test extends Application { + new T[Int](x => x * 2, 1); + val f = new S(x: Int => x, 1); +} diff --git a/test/files/pos/bug116.scala b/test/files/pos/bug116.scala new file mode 100644 index 0000000000..b02c81f0b7 --- /dev/null +++ b/test/files/pos/bug116.scala @@ -0,0 +1,8 @@ +// $Id$ + +class C { + def this(x: Int) = { + this(); + class D extends C; + } +} diff --git a/test/files/pos/bug119.scala b/test/files/pos/bug119.scala new file mode 100644 index 0000000000..e3f0993862 --- /dev/null +++ b/test/files/pos/bug119.scala @@ -0,0 +1,7 @@ +class K[E] { + case class A(v:E){}; +} + +class K2 extends K[int] { + val A(v) = A(42); +} diff --git a/test/files/pos/bug121.scala b/test/files/pos/bug121.scala new file mode 100644 index 0000000000..78ddc41ee5 --- /dev/null +++ b/test/files/pos/bug121.scala @@ -0,0 +1,3 @@ +class Bug121_B(b: Array[Byte]) { + def get(x: Int): Byte = return b(x); +} diff --git a/test/files/pos/bug123.scala b/test/files/pos/bug123.scala new file mode 100644 index 0000000000..79f0c907a3 --- /dev/null +++ b/test/files/pos/bug123.scala @@ -0,0 +1,3 @@ +class M{ + val 1 = 1; +} diff --git a/test/files/pos/bug124.scala b/test/files/pos/bug124.scala new file mode 100644 index 0000000000..9aed6786f6 --- /dev/null +++ b/test/files/pos/bug124.scala @@ -0,0 +1,5 @@ +class N{ + val F: Any => Any = (x:Any) => F(x); + val f:(Any => Any) = (x:Any) => f(x); + val g: Any => Any = (x:Any) => g(x); +} diff --git a/test/files/pos/bug151.scala b/test/files/pos/bug151.scala new file mode 100644 index 0000000000..86667b49f7 --- /dev/null +++ b/test/files/pos/bug151.scala @@ -0,0 +1,6 @@ +abstract class Foo { + type T; + def foo(a: T): Int = 0; + val foo: Foo = null; + def a: foo.T = a; +} diff --git a/test/files/pos/bug159.scala b/test/files/pos/bug159.scala new file mode 100644 index 0000000000..ef6eba5255 --- /dev/null +++ b/test/files/pos/bug159.scala @@ -0,0 +1,22 @@ +object foo { + + // the problem seems to appear only + // if "val _" is in the body of a case + def cooked( ckd:StringBuffer ):Unit = + 'a' match { + case '-' => + val _ = ckd.append( '_' ); + case 'v' => + val _ = ckd.append( '_' ); + } + +} +object foo1 { + def f():Unit = { + 1 match { + case 2 => val _ = 1; + case 3 => val _ = 2; + case 4 => val _ = 2; + } + } +} diff --git a/test/files/pos/bug160.scala b/test/files/pos/bug160.scala new file mode 100644 index 0000000000..f1c36ebeae --- /dev/null +++ b/test/files/pos/bug160.scala @@ -0,0 +1,5 @@ +// $Id$ + +class Foo(s:String) { + def this() = { this("DEFAULT") } +} diff --git a/test/files/pos/bug17.scala b/test/files/pos/bug17.scala new file mode 100644 index 0000000000..a83eefe972 --- /dev/null +++ b/test/files/pos/bug17.scala @@ -0,0 +1,21 @@ +class Quantity { + def getValue = 0; + def connect(c: Constraint) = c.newValue; +} + +abstract class Constraint(q: Quantity) { + def newValue: Unit; + q connect this +} + +class Adder(q: Quantity) extends Constraint(q) { + def newValue = System.out.println(q.getValue); +} + +object Main { + def main(args: Array[String]): Unit = { + val x = new Quantity; + new Adder(x); + () + } +} diff --git a/test/files/pos/bug175.scala b/test/files/pos/bug175.scala new file mode 100644 index 0000000000..2ef26589c2 --- /dev/null +++ b/test/files/pos/bug175.scala @@ -0,0 +1,5 @@ +// $Id$ + +abstract class C { + def this(x: Unit) = { this() } +} diff --git a/test/files/pos/bug177.scala b/test/files/pos/bug177.scala new file mode 100644 index 0000000000..9bd913f179 --- /dev/null +++ b/test/files/pos/bug177.scala @@ -0,0 +1,10 @@ +// $Id$ + +class A { + def foo = { + object Y { + def bar = 1; + } + Y.bar + } +} diff --git a/test/files/pos/bug183.scala b/test/files/pos/bug183.scala new file mode 100644 index 0000000000..4804eb3828 --- /dev/null +++ b/test/files/pos/bug183.scala @@ -0,0 +1,6 @@ +// $Id$ + +object Test { + new Foo(0); + class Foo(x: Int); +} diff --git a/test/files/pos/bug193.scala b/test/files/pos/bug193.scala new file mode 100644 index 0000000000..9b1c82f45f --- /dev/null +++ b/test/files/pos/bug193.scala @@ -0,0 +1,74 @@ +// $Id$ + +trait Test { + + def fun_00(x: Int): Unit = { + (0: Any) == 0; + (0 ) == 0; + (0: Any) != 0; + (0 ) != 0; + () + } + + def fun_i0(x: Int): Unit = { + (x: Any) == 0; + (x ) == 0; + (x: Any) != 0; + (x ) != 0; + () + } + + def fun_o0(x: Object): Unit = { + (x: Any) == 0; + (x ) == 0; + (x: Any) != 0; + (x ) != 0; + () + } + + def fun_0i(y: Int): Unit = { + (0: Any) == y; + (0 ) == y; + (0: Any) != y; + (0 ) != y; + () + } + + def fun_0o(y: Object): Unit = { + (0: Any) == y; + (0 ) == y; + (0: Any) != y; + (0 ) != y; + () + } + + def fun_ii(x: Int, y: Int): Unit = { + (x: Any) == y; + (x ) == y; + (x: Any) != y; + (x ) != y; + () + } + def fun_io(x: Int, y: Object): Unit = { + (x: Any) == y; + (x ) == y; + (x: Any) != y; + (x ) != y; + () + } + def fun_oi(x: Object, y: Int): Unit = { + (x: Any) == y; + (x ) == y; + (x: Any) != y; + (x ) != y; + () + } + def fun_oo(x: Object, y: Object): Unit = { + (x: Any) == y; + (x ) == y; + (x: Any) != y; + (x ) != y; + () + } + +} diff --git a/test/files/pos/bug2.scala b/test/files/pos/bug2.scala new file mode 100644 index 0000000000..4c58ed3f4f --- /dev/null +++ b/test/files/pos/bug2.scala @@ -0,0 +1,6 @@ +object main { + def main(args: Array[String]) = { + val b = true; + while (b == true) { } + } +} diff --git a/test/files/pos/bug20.scala b/test/files/pos/bug20.scala new file mode 100644 index 0000000000..bdf33ef20d --- /dev/null +++ b/test/files/pos/bug20.scala @@ -0,0 +1,8 @@ +object Exceptions { + + class CubeException(s: String) extends java.lang.RuntimeException(s); + + def main(args: Array[String]) = + System.out.println(new CubeException("test")); + +} diff --git a/test/files/pos/bug201.scala b/test/files/pos/bug201.scala new file mode 100644 index 0000000000..53dac21ef0 --- /dev/null +++ b/test/files/pos/bug201.scala @@ -0,0 +1,7 @@ +class C[a] { def f: a = f; } +class D[b] { class E extends C[b]; } +object Test { + val d = new D[int]; + def e = new d.E; + e.f; +} diff --git a/test/files/pos/bug204.scala b/test/files/pos/bug204.scala new file mode 100644 index 0000000000..23d36523e9 --- /dev/null +++ b/test/files/pos/bug204.scala @@ -0,0 +1,7 @@ +class A { + object B { + def f() = { + class C extends A {}; new C : A + } + } +} diff --git a/test/files/pos/bug210.scala b/test/files/pos/bug210.scala new file mode 100644 index 0000000000..20450335f4 --- /dev/null +++ b/test/files/pos/bug210.scala @@ -0,0 +1,17 @@ +trait Lang1 { + trait Exp; + trait Visitor { def f(left: Exp): unit; } + class Eval1: Visitor extends Visitor { + def f(left: Exp) = (); + } +} + +trait Lang2 extends Lang1 { + class Eval2: Visitor extends Eval1; +} +/* +object Main with Application { + val lang2 = new Lang2 {}; + val eval = new lang2.Eval2; +} +*/ diff --git a/test/files/pos/bug211.scala b/test/files/pos/bug211.scala new file mode 100644 index 0000000000..8c5cf1dc1e --- /dev/null +++ b/test/files/pos/bug211.scala @@ -0,0 +1,8 @@ +trait A; +trait B; +class Foo: (A with B) extends A with B; +object Test extends Application { + new Foo(); + System.out.println("bug211 completed"); +} + diff --git a/test/files/pos/bug229.scala b/test/files/pos/bug229.scala new file mode 100644 index 0000000000..2bceea0782 --- /dev/null +++ b/test/files/pos/bug229.scala @@ -0,0 +1,3 @@ +class Test extends java.util.ArrayList { + override def add(index: int, element: java.lang.Object): unit = {} +} diff --git a/test/files/pos/bug245.scala b/test/files/pos/bug245.scala new file mode 100644 index 0000000000..b33dd9914f --- /dev/null +++ b/test/files/pos/bug245.scala @@ -0,0 +1,18 @@ +class Value {} + +object Test { + + implicit def view(v: Value): int = 0; + + def foo(i: Int): Int = 0; + + def fun0 : Value = null; + def fun0(i: Int ): Value = null; + + def fun1(i: Int ): Value = null; + def fun1(l: Long): Value = null; + + foo(fun0 ); + foo(fun1(new Value)); + +} diff --git a/test/files/pos/bug267.scala b/test/files/pos/bug267.scala new file mode 100644 index 0000000000..d99b1fa1fc --- /dev/null +++ b/test/files/pos/bug267.scala @@ -0,0 +1,55 @@ +package expAbstractData; + +/** A base class consisting of + * - a root trait (i.e. abstract class) `Exp' with an `eval' function + * - an abstract type `exp' bounded by `Exp' + * - a concrete instance class `Num' of `Exp' for numeric literals + */ +trait Base { + type exp <: Exp; + + trait Exp { + def eval: int + } + class Num(v: int): exp extends Exp { + val value = v; + def eval = value + } +} + +object testBase extends Application with Base { + type exp = Exp; + val term = new Num(2); + System.out.println(term.eval); +} + +/** Data extension: An extension of `Base' with `Plus' expressions + */ +trait BasePlus extends Base { + class Plus(l: exp, r: exp): exp extends Exp { + val left = l; + val right = r; + def eval = left.eval + right.eval + } +} + +/** Operation extension: An extension of `Base' with 'show' methods. + */ +trait Show extends Base { + type exp <: Exp1; + + trait Exp1 extends Exp { + def show: String; + } + class Num1(v: int): (exp with Num1) extends Num(v) with Exp1 { + def show = value.toString(); + } +} + +/** Operation extension: An extension of `BasePlus' with 'show' methods. + */ +trait ShowPlus extends BasePlus with Show { + class Plus1(l: exp, r: exp): (exp with Plus1) extends Plus(l, r) with Exp1 { + def show = left.show + " + " + right.show + } +} diff --git a/test/files/pos/bug287.scala b/test/files/pos/bug287.scala new file mode 100644 index 0000000000..81a01951b2 --- /dev/null +++ b/test/files/pos/bug287.scala @@ -0,0 +1,12 @@ +object testBuf { + class mystream extends java.io.BufferedOutputStream(new java.io.FileOutputStream("/dev/null")) { + def w( x:String ):Unit = { + val foo = new Array[byte](2); + + // write( byte[] ) is defined in FilterOutputStream, the superclass of BufferedOutputStream + super.write( foo ); // error + + super.write( foo, 0, foo.length ); // this works however + } + } +} diff --git a/test/files/pos/bug289.scala b/test/files/pos/bug289.scala new file mode 100644 index 0000000000..2fb91510d2 --- /dev/null +++ b/test/files/pos/bug289.scala @@ -0,0 +1,7 @@ +// $Id$ + +class A { + object B; +} + +object C extends A; diff --git a/test/files/pos/bug29.scala b/test/files/pos/bug29.scala new file mode 100644 index 0000000000..1b33c6cffd --- /dev/null +++ b/test/files/pos/bug29.scala @@ -0,0 +1,3 @@ +object Main { + def f[a]: List[List[a]] = for (val l1 <- Nil; val l2 <- Nil) yield l1; +} diff --git a/test/files/pos/bug295.scala b/test/files/pos/bug295.scala new file mode 100644 index 0000000000..22c7beff4d --- /dev/null +++ b/test/files/pos/bug295.scala @@ -0,0 +1,2 @@ +object Test extends java.rmi.server.UnicastRemoteObject { +} diff --git a/test/files/pos/bug30.scala b/test/files/pos/bug30.scala new file mode 100644 index 0000000000..6d28e18c0d --- /dev/null +++ b/test/files/pos/bug30.scala @@ -0,0 +1,9 @@ +trait A { + def f(x: int): unit; + def f(x: String): unit; +} + +class B extends A { + def f(x: int): unit = (); + def f(x: String): unit = (); +} diff --git a/test/files/pos/bug304.scala b/test/files/pos/bug304.scala new file mode 100644 index 0000000000..76da44157d --- /dev/null +++ b/test/files/pos/bug304.scala @@ -0,0 +1,5 @@ +object O { + def f1 = -1; + def f2 = 0-1; + def f3 = -f1; +} diff --git a/test/files/pos/bug31.scala b/test/files/pos/bug31.scala new file mode 100644 index 0000000000..92f33bfd02 --- /dev/null +++ b/test/files/pos/bug31.scala @@ -0,0 +1,29 @@ +object Main { + + trait Ensure[a] { + def ensure(postcondition: a => Boolean): a + } + + def require[a](precondition: => Boolean)(command: => a): Ensure[a] = + if (precondition) + new Ensure[a] { + def ensure(postcondition: a => Boolean): a = { + val result = command; + if (postcondition(result)) result + else error("Assertion error") + } + } + else + error("Assertion error"); + + def arb[a](s: List[a]) = + require (! s.isEmpty) { + s.head + } ensure (result => s contains result); + + def main(args: Array[String]) = { + val s = List(1, 2); + System.out.println(arb(s)) + } + +} diff --git a/test/files/pos/bug318.scala b/test/files/pos/bug318.scala new file mode 100644 index 0000000000..1b9fa4a4b3 --- /dev/null +++ b/test/files/pos/bug318.scala @@ -0,0 +1,11 @@ +// $Id$ + +object Test { + def fun: Int = { + object o { + def a: Int = 1; + class C { def b: Int = a; } + } + 0 + } +} diff --git a/test/files/pos/bug32.scala b/test/files/pos/bug32.scala new file mode 100644 index 0000000000..4354727d1a --- /dev/null +++ b/test/files/pos/bug32.scala @@ -0,0 +1,17 @@ +import java.io._; + +class PromptStream(s: OutputStream) extends PrintStream(s) { + override def println() = super.println(); +} + +object Main { + + val out = new PromptStream(System.out); + + System.setOut(out); + + def main(args: Array[String]) = + //out.println("hello world"); + () + +} diff --git a/test/files/pos/bug342.scala b/test/files/pos/bug342.scala new file mode 100644 index 0000000000..2e72ef220b --- /dev/null +++ b/test/files/pos/bug342.scala @@ -0,0 +1,9 @@ +object Main extends Application { + +//object Foo extends Enumeration { // 1: OK ! + object Foo extends Enumeration(0, "Bar") { // 2 + val Bar = Value + } + import Foo._; + Console.println(Bar) +} diff --git a/test/files/pos/bug348plus.scala b/test/files/pos/bug348plus.scala new file mode 100644 index 0000000000..30fa1576af --- /dev/null +++ b/test/files/pos/bug348plus.scala @@ -0,0 +1,24 @@ +// bug #348 + +trait Foo { + type bar <: Bar; + abstract class Bar; + case class Baz(r:bar) extends Bar; + case object NoBar extends Bar; +} +object Test extends Application { + object ConcreteFooBar extends Foo { // if moved to toplevel, it works + type bar = Bar; + } + def foo = { + import ConcreteFooBar._ ; + Baz( NoBar ) + } +} + +// bug #367 + +object Bla { + def foo(): Unit = (return null).equals(null); +} + diff --git a/test/files/pos/bug359.scala b/test/files/pos/bug359.scala new file mode 100644 index 0000000000..6ce4640998 --- /dev/null +++ b/test/files/pos/bug359.scala @@ -0,0 +1,30 @@ +// $Id$ + +object Bug359 { + class C; + def f1(xs: List[C]): C = { + g { + xs => + if (false) { + f1(xs) + } else { + val a: C = null; + val b: C = null; + if (xs.isEmpty) a else b + } + } + } + def f2(xs: List[C]): C = { + g { + xs => + if (false) { + val a: C = null; + val b: C = null; + if (xs.isEmpty) a else b + } else { + f2(xs); + } + } + } + private def g(op: List[C] => C): C = null; +} diff --git a/test/files/pos/bug36.scala b/test/files/pos/bug36.scala new file mode 100644 index 0000000000..1d923b0017 --- /dev/null +++ b/test/files/pos/bug36.scala @@ -0,0 +1,8 @@ +object m { + + val xs: List[int] = Nil; + def f(i: int) = 0; + val v = xs map f; + + def m() = {} +} diff --git a/test/files/pos/bug360.scala b/test/files/pos/bug360.scala new file mode 100644 index 0000000000..0fcb5cb161 --- /dev/null +++ b/test/files/pos/bug360.scala @@ -0,0 +1,11 @@ +// $Id$ + +abstract class Bug360A: Bug360C { + def f: String = "hello"; +} +trait Bug360B: Bug360C { + object d { + System.out.println(f); + } +} +abstract class Bug360C extends Bug360A with Bug360B; diff --git a/test/files/pos/bug361.scala b/test/files/pos/bug361.scala new file mode 100644 index 0000000000..f48c906246 --- /dev/null +++ b/test/files/pos/bug361.scala @@ -0,0 +1,18 @@ +// $Id$ + +class Bug361Global extends Bug361Trees; + +abstract class Bug361Trees: Bug361Global { + + abstract class Tree { + var pos: int = 0; + } + + object posAssigner { + def atPos[T <: Tree](pos: int, tree: T): T = { + tree.pos = pos; tree + } + } + + def atPos[T <: Tree](pos: int)(tree: T): T = posAssigner.atPos(pos, tree); +} diff --git a/test/files/pos/bug372.scala b/test/files/pos/bug372.scala new file mode 100644 index 0000000000..d16585abbe --- /dev/null +++ b/test/files/pos/bug372.scala @@ -0,0 +1,4 @@ +// $Id$ + +class Bug372Names; +class Bug372Symbols: (Bug372Symbols with Bug372Names); diff --git a/test/files/pos/bug39.scala b/test/files/pos/bug39.scala new file mode 100644 index 0000000000..a131bc0450 --- /dev/null +++ b/test/files/pos/bug39.scala @@ -0,0 +1,6 @@ +abstract class Extensible[A, This <: Extensible[A, This]](x: A, xs: This): This { + def mkObj(x: A, xs: This): This; +} +class Fixed[A](x: A, xs: Fixed[A]) extends Extensible[A, Fixed[A]](x, xs) { + def mkObj(x: A, xs: Fixed[A]) = new Fixed(x, xs); +} diff --git a/test/files/pos/bug49.scala b/test/files/pos/bug49.scala new file mode 100644 index 0000000000..913ce06e00 --- /dev/null +++ b/test/files/pos/bug49.scala @@ -0,0 +1,3 @@ +class C1(x: Object) {}; + +class C2 extends C1({ class A extends Object {}; (new A) : Object }) {}; diff --git a/test/files/pos/bug53.scala b/test/files/pos/bug53.scala new file mode 100644 index 0000000000..44763ef144 --- /dev/null +++ b/test/files/pos/bug53.scala @@ -0,0 +1,7 @@ +object bug { + def foobar[c]: Int = { + class Foo { def foo: Bar = new Bar(); } + class Bar { def bar: c = bar; } + 0 + } +} diff --git a/test/files/pos/bug54.scala b/test/files/pos/bug54.scala new file mode 100644 index 0000000000..3dc8e161fd --- /dev/null +++ b/test/files/pos/bug54.scala @@ -0,0 +1,4 @@ +class A { + case class B(x: C) extends A {} + class C {} +} diff --git a/test/files/pos/bug61.scala b/test/files/pos/bug61.scala new file mode 100644 index 0000000000..dd3f94f30c --- /dev/null +++ b/test/files/pos/bug61.scala @@ -0,0 +1,10 @@ +object O { + + class testClass ; + + case class testA() extends testClass ; // works if you leave away "extends..." + // or if you write TestA + def ga( x:testClass ) = x match { + case testA() => () + } +} diff --git a/test/files/pos/bug64.scala b/test/files/pos/bug64.scala new file mode 100644 index 0000000000..c2ce4bf6d0 --- /dev/null +++ b/test/files/pos/bug64.scala @@ -0,0 +1,6 @@ +object B { + def main(Args:Array[String]) = { + val Pair(_,x) = Pair(1,2); + x + 1; + } +} diff --git a/test/files/pos/bug66.scala b/test/files/pos/bug66.scala new file mode 100644 index 0000000000..2153264e7a --- /dev/null +++ b/test/files/pos/bug66.scala @@ -0,0 +1,7 @@ +class GBTree[A, B] /*with Map[A, B, GBTree[A,B]]*/ { + abstract class Tree[A,B]; + case class Node[A,B](key:A,value:B,smaller:Node[A,B],bigger:Node[A,B]) + extends Tree[A,B]; + case class Nil[A,B]() extends Tree[A,B]; + +} diff --git a/test/files/pos/bug68.scala b/test/files/pos/bug68.scala new file mode 100644 index 0000000000..beb2c7c0ab --- /dev/null +++ b/test/files/pos/bug68.scala @@ -0,0 +1,6 @@ +class E { + def f() = { + val (_::l1) = List(1,2,3); + l1.tail; + } +} diff --git a/test/files/pos/bug69.scala b/test/files/pos/bug69.scala new file mode 100644 index 0000000000..113820613f --- /dev/null +++ b/test/files/pos/bug69.scala @@ -0,0 +1,11 @@ +object testCQ { + // why does this not work directly + case class Thing( name:String, contains:List[ Thing ] ); + + /* ... but this one does? + abstract class T; + case class Thing2( name:String, contains:List[ T ] ) extends T; + */ + +} + diff --git a/test/files/pos/bug76.scala b/test/files/pos/bug76.scala new file mode 100644 index 0000000000..5419cf5154 --- /dev/null +++ b/test/files/pos/bug76.scala @@ -0,0 +1,9 @@ +// This is extracted from a test file => don't add a new test file. +object bug { + def foo(i: => Int): Int = 0; + + def bar: Int = { + var i: Int = 0; + foo (i); + } +} diff --git a/test/files/pos/bug81.scala b/test/files/pos/bug81.scala new file mode 100644 index 0000000000..20fd604974 --- /dev/null +++ b/test/files/pos/bug81.scala @@ -0,0 +1,4 @@ +class A { + val b: A#B = new B; + class B {} +} diff --git a/test/files/pos/bug85.scala b/test/files/pos/bug85.scala new file mode 100644 index 0000000000..e018afb6ee --- /dev/null +++ b/test/files/pos/bug85.scala @@ -0,0 +1,8 @@ +object A { + case class B(c: C) { + class C; + } + class C; + val b: B = new B(new C()); + val c: C = b.c; +} diff --git a/test/files/pos/bug91.scala b/test/files/pos/bug91.scala new file mode 100644 index 0000000000..54c821b41c --- /dev/null +++ b/test/files/pos/bug91.scala @@ -0,0 +1,6 @@ +class Bug { + def main(args: Array[String]) = { + var msg: String = null; // no bug if "null" instead of "_" + val f: PartialFunction[Any, unit] = { case 42 => msg = "coucou" }; + } +} diff --git a/test/files/pos/bug93.scala b/test/files/pos/bug93.scala new file mode 100644 index 0000000000..d648d773b0 --- /dev/null +++ b/test/files/pos/bug93.scala @@ -0,0 +1,4 @@ +object Bug { + def f(cond: => Boolean) = while (cond == false) {}; + // no bug with "false == cond" +} diff --git a/test/files/pos/cls.scala b/test/files/pos/cls.scala new file mode 100644 index 0000000000..54104ae692 --- /dev/null +++ b/test/files/pos/cls.scala @@ -0,0 +1,17 @@ +import scala._; + +package scalac.util { + +class A[X1, X2](x1: X1, x2: X2) {} +class B[Y](y1: Y, y2: Y) extends A[Y, Y](y1, y2) { + def f(x: Y, xs: B[Y]): Unit = {} + def g() = f(y1, this); +} + +object test { + val b: B[Int] = new B[Int](1, 2); + val a: A[Int, Int] = b; + val a1 = new A(1, "hello"); + val b1 = new B(1, "hello"); +} +}
\ No newline at end of file diff --git a/test/files/pos/cls1.scala b/test/files/pos/cls1.scala new file mode 100644 index 0000000000..20ac12d59a --- /dev/null +++ b/test/files/pos/cls1.scala @@ -0,0 +1,9 @@ +package test; + +trait A { + type T; + + trait B extends A { + type T = A.this.T; + } +} diff --git a/test/files/pos/clsrefine.scala b/test/files/pos/clsrefine.scala new file mode 100644 index 0000000000..d63923b5e6 --- /dev/null +++ b/test/files/pos/clsrefine.scala @@ -0,0 +1,40 @@ +import scala._; + +package scalac.util { + +trait A { + type X1; + type X2; + val x1: X1; + val x2: X2; +} +trait B extends A { + type Y; + val y1, y2: Y; + type X1 = Y; + type X2 = Y; + val x1 = y1; + val x2 = y2; + def f(x: Y, xs: B): Unit = {} + def g() = f(y1, this); +} + +object test { + val b: B { type Y = Int } = new B { + type Y = Int; + val y1, y2 = 1; + } + val a: A { type X1 = Int; type X2 = Int } = b; + val a1 = new A { + type X1 = Int; + type X2 = String; + val x1 = 1; + val x2 = "hello" + } + val b1 = new B { + type Y = Any; + val y1 = 1; + val y2 = "hello"; + } +} +}
\ No newline at end of file diff --git a/test/files/pos/code.scala b/test/files/pos/code.scala new file mode 100644 index 0000000000..05c6e4a779 --- /dev/null +++ b/test/files/pos/code.scala @@ -0,0 +1,3 @@ +class Test { + val fun: reflect.TypedCode[int => int] = x => x + 1; +} diff --git a/test/files/pos/collections.scala b/test/files/pos/collections.scala new file mode 100644 index 0000000000..4f45a42786 --- /dev/null +++ b/test/files/pos/collections.scala @@ -0,0 +1,15 @@ +package mixins; + +import scala.collection.mutable._; + +class Collections extends HashSet[Int] with ObservableSet[Int,Collections] { + override def +=(elem: Int): Unit = super.+=(elem); + override def -=(elem: Int): Unit = super.-=(elem); + override def clear: Unit = super.clear; + +} + +object collections extends Collections; + +//class Collections1 extends HashSet[Int] with ObservableSet[Int,Collections1]; +//object collections1 extends Collections1; diff --git a/test/files/pos/compile.scala b/test/files/pos/compile.scala new file mode 100644 index 0000000000..3ed733fd40 --- /dev/null +++ b/test/files/pos/compile.scala @@ -0,0 +1,150 @@ +//############################################################################ +// Compile Time Bugs & Test Cases +//############################################################################ +// $Id$ + +import java.lang.System; // to avoid name clash with .NET's library + +//############################################################################ +// Test 0 + +/* +class Test0Foo[X]; + +object Test0Test { + type Gen[A] = Test0Foo[A]; + class Tic(g: Test0Test.Gen[Int]); + class Tac(g: Gen[Int]); +} + +//############################################################################ +// Test 1 - Single types in lambda lift + +object Test1 { + def main(args: Array[String]): Unit = { + List[args.type](args); + } + def foo[X]: Any = { + def bar(x: X) = List(x); + 0 + } +} + +//############################################################################ +// Test 2 - Local variables owned by other local variables + +class Test2_1(i: Int) { + val t = { + val x = { + val y = { + val z = i; + z; + }; + }; + }; + val x = { + val y = { + val z = i; + z; + }; + }; + val y = { + val z = i; + z; + }; + val z2_1 = i; +} + +class Test2_2(i: Int) { + { + val t = { + val x = { + val y = { + val z = i; + z; + }; + }; + }; + val x = { + val y = { + val z = i; + z; + }; + }; + val y = { + val z = i; + z; + }; + val z2_2 = i; + 0 + } +} + +class Test2_3() { + + def this(i: Int) = { + this(); + val t = { + val x = { + val y = { + val z = i; + z; + }; + }; + }; + val x = { + val y = { + val z = i; + z; + }; + }; + val y = { + val z = i; + z; + }; + val z2_3 = i; + } + + def test(i: Int): Int = { + val t = { + val x = { + val y = { + val z = i; + z; + }; + }; + }; + val x = { + val y = { + val z = i; + z; + }; + }; + val y = { + val z = i; + z; + }; + val z_test = i; + 0 + } + +} +*/ +//############################################################################ +// Test 3 - Super Calls with Mixins + +class Test3Foo; + +trait Test3A[T] { + def fun: T = fun; +} + +class Test3B extends Test3A[Test3Foo]; + +trait Test3M extends Test3A[Test3Foo] { + override def fun: Test3Foo = super.fun; +} + +class Test3C extends Test3B with Test3M; + +//############################################################################ diff --git a/test/files/pos/compile1.scala b/test/files/pos/compile1.scala new file mode 100644 index 0000000000..3f06abbaa9 --- /dev/null +++ b/test/files/pos/compile1.scala @@ -0,0 +1,35 @@ +//############################################################################ +// Compile Time Bugs & Test Cases +//############################################################################ +// $Id$ + +import java.lang.System; // to avoid name clash with .NET's library + +//############################################################################ +// Test 0 + +class Test2_2(i: Int) { + { + val t = { + val x = { + val y = { + val z = i; + z; + }; + }; + }; + val x = { + val y = { + val z = i; + z; + }; + }; + val y = { + val z = i; + z; + }; + val z2_2 = i; + 0 + } +} + diff --git a/test/files/pos/compound.scala b/test/files/pos/compound.scala new file mode 100644 index 0000000000..60890f9102 --- /dev/null +++ b/test/files/pos/compound.scala @@ -0,0 +1,9 @@ +abstract class A { type T } + +abstract class B { val xz: Any } + +abstract class Test { + var yy: A with B { type T; val xz: T } = null; + var xx: A with B { type T; val xz: T } = null; + xx = yy; +} diff --git a/test/files/pos/constfold.scala b/test/files/pos/constfold.scala new file mode 100644 index 0000000000..2eb31b4086 --- /dev/null +++ b/test/files/pos/constfold.scala @@ -0,0 +1,14 @@ +object A { + val x = 2; + val y = x.asInstanceOf[byte]; + val z = 1.0 / 2; + val s = "z is " + z; +} + +object Test extends Application { + + System.out.println(A.x); + System.out.println(A.y); + System.out.println(A.z); + System.out.println(A.s); +} diff --git a/test/files/pos/context.scala b/test/files/pos/context.scala new file mode 100644 index 0000000000..ada6a57463 --- /dev/null +++ b/test/files/pos/context.scala @@ -0,0 +1,34 @@ +class Context { + object symwrap extends SymbolWrapper { + val context: Context.this.type = Context.this + } + object typewrap extends TypeWrapper { + val context: Context.this.type = Context.this + } + object symbols extends symwrap.Symbols; + object types extends typewrap.Types; +} + +abstract class SymbolWrapper { + val context: Context; + import context._; + + class Symbols: context.symbols.type { + abstract class Symbol { + def typ: types.Type; + def sym: Symbol = typ.sym; + } + } +} + +abstract class TypeWrapper { + val context: Context; + import context._; + + class Types: context.types.type { + abstract class Type { + def sym: symbols.Symbol; + def typ: Type = sym.typ; + } + } +} diff --git a/test/files/pos/eta.scala b/test/files/pos/eta.scala new file mode 100644 index 0000000000..7d862f67b1 --- /dev/null +++ b/test/files/pos/eta.scala @@ -0,0 +1,5 @@ +object test { + +def sum(f: Int => Int)(x: Int, y: Int): Int = 0; +def g = sum; +}
\ No newline at end of file diff --git a/test/files/pos/exceptions.scala b/test/files/pos/exceptions.scala new file mode 100644 index 0000000000..819368244d --- /dev/null +++ b/test/files/pos/exceptions.scala @@ -0,0 +1,20 @@ +import java.io._; + +object Test { + + //def error[a](x: String):a = new java.lang.RuntimeException(x) throw; + + def main(args: Array[String]): Unit = { + try { + try { + System.out.println("hi!"); + error("xx"); + } finally { + System.out.println("ho!") + } + } catch { + case ex: IOException => System.out.println("io exception!"); + case ex => System.out.println(ex); + } + } +} diff --git a/test/files/pos/expressions-current.scala b/test/files/pos/expressions-current.scala new file mode 100644 index 0000000000..b343dbf68b --- /dev/null +++ b/test/files/pos/expressions-current.scala @@ -0,0 +1,63 @@ +package test; + +abstract class Lang { + trait Visitor { + def caseNum(n: int): unit; + } + + abstract class Exp { + def visit(v: visitor): unit; + } + + type visitor <: Visitor; + + class Num(n: int) extends Exp { + def visit(v: visitor): unit = v.caseNum(n); + } + + class Eval(result: Ref[int]): visitor extends Visitor { + def caseNum(n: int) = result.elem = n; + } +} + +abstract class Lang2 extends Lang { + trait Visitor2 extends Visitor { + def casePlus(left: Exp, right: Exp): unit; + } + + type visitor <: Visitor2; + + class Plus(l: Exp, r: Exp) extends Exp { + def visit(v: visitor): unit = v.casePlus(l, r); + } + + class Eval2(result: Ref[int]): visitor extends Eval(result) with Visitor2 { + def casePlus(l: Exp, r: Exp) = + result.elem = { l.visit(this); result.elem } + { r.visit(this); result.elem } + } + + class Show2(result: Ref[String]): visitor extends Visitor2 { + def caseNum(n: int) = result.elem = n.toString(); + def casePlus(l: Exp, r: Exp) = + result.elem = + "(" + { l.visit(this); result.elem } + + "+" + { r.visit(this); result.elem }+ ")"; + } +} + +object Main { + + def main(args: Array[String]) = { + object l1 extends Lang { type visitor = Visitor } + val e1: l1.Exp = new l1.Num(42); + + val iref = new Ref(0); + System.out.println("eval: " + { e1.visit(new l1.Eval(iref)); iref.elem }); + + object l2 extends Lang2 { type visitor = Visitor2 } + val e2: l2.Exp = new l2.Plus(new l2.Num(5), new l2.Num(37)); + val sref = new Ref(""); + System.out.println("eval: " + { e2.visit(new l2.Eval2(iref)); iref.elem }); + System.out.println("show: " + { e2.visit(new l2.Show2(sref)); sref.elem }); + } +} diff --git a/test/files/pos/failed.lst b/test/files/pos/failed.lst new file mode 100644 index 0000000000..b5b75eb35c --- /dev/null +++ b/test/files/pos/failed.lst @@ -0,0 +1,3 @@ +bug123.scala +exceptions.scala +context.scala diff --git a/test/files/pos/gui.scala b/test/files/pos/gui.scala new file mode 100644 index 0000000000..b40759fb01 --- /dev/null +++ b/test/files/pos/gui.scala @@ -0,0 +1,99 @@ +object Geom { + trait Shape; + case class Point(x: int, y: int) extends Shape; + case class Rectangle(ll: Point, ur: Point) extends Shape { + def inset(delta: int) = + Rectangle(Point(ll.x - delta, ll.y - delta), Point(ur.x + delta, ur.y + delta)); + } +} + +object Color { + type Color = int; + val black = 0x000000; + val grey = 0x808080; +} + +trait Screen { + type Color = int; + def drawRect(r: Geom.Rectangle, c: Color): unit; + def fillRect(r: Geom.Rectangle, c: Color): unit; +} + +object DummyScreen extends Screen { + def drawRect(r: Geom.Rectangle, c: Color): unit = + System.out.println("draw " + r + " with " + c); + def fillRect(r: Geom.Rectangle, c: Color): unit = + System.out.println("fill " + r + " with " + c); +} + +object GUI { + + object Controller { + def addMouseCtl(c: MouseCtl) = () + } + + trait Glyph { + def getRect: Geom.Rectangle; + def setLoc(p: Geom.Point): unit; + def draw() = System.out.println("draw " + this); + } + + class Label(scr: Screen, p: Geom.Point, name: String) extends Glyph { + private var origin = p; + def getRect = Geom.Rectangle(origin, origin).inset(10); + def setLoc(p: Geom.Point) = { origin = p } + } + + trait Ctl { + def getGlyph: Glyph; + def enable(b: Boolean): this.type; + } + + trait MouseCtl extends Ctl { + def mouseDown(p: Geom.Point): unit; + } + + abstract class Button(scr: Screen, p: Geom.Point, name: String) + extends Glyph with MouseCtl { + var enabled: boolean = false; + val label = new Label(scr, p, name); + + /* Glyph methods */ + override def draw(): unit = { + if (enabled) scr.drawRect(getRect, Color.black) + else scr.fillRect(getRect, Color.grey); + label.draw(); + } + def setLoc(p: Geom.Point) = label.setLoc(p); + def getRect = label.getRect.inset(-2); + + /* Ctl methods */ + def enable(b: boolean): this.type = { enabled = b; draw(); this } + def getGlyph = label; + final def mouseDown(p: Geom.Point): unit = + if (enabled) doit() else System.out.println("button is disabled"); + + /* deferred method to be specified by client */ + def doit(): unit; + } +} + +object GUIClient { + + class Application { + def quit() = System.out.println("application exited"); + } + + class QuitButton (scr: Screen, p: Geom.Point, name: String, a: Application) + extends GUI.Button(scr, p, name) { + def doit(): unit = a.quit(); + } + + def main(args: Array[String]) = { + val b = new QuitButton( + DummyScreen, Geom.Point(1, 1), "quit", new Application); + b.draw(); + b.enable(true).mouseDown(Geom.Point(1, 2)); + } +} + diff --git a/test/files/pos/imports.scala b/test/files/pos/imports.scala new file mode 100644 index 0000000000..65ea090436 --- /dev/null +++ b/test/files/pos/imports.scala @@ -0,0 +1,16 @@ +package test; + +import java.lang.{System => S} + +object test { + import S.out.{print => p, println => print} + + val foo = 1; + + p("hello"); print("world"); S.out.println("!"); + S.out.flush(); +} +object test1 { + import test._; + foo +}
\ No newline at end of file diff --git a/test/files/pos/infer.scala b/test/files/pos/infer.scala new file mode 100644 index 0000000000..24871458b3 --- /dev/null +++ b/test/files/pos/infer.scala @@ -0,0 +1,11 @@ +object test { + class List[+a] { + def ::[b >: a](x: b): List[b] = new Cons(x, this); + } + case class Cons[a, b <: a](x: a, xs: List[b]) extends List[a]; + case object Nil extends List[All]; + def nil[n]: List[n] = Nil; + def cons[a](x: a, xs: List[a]): List[a] = null; + val x: List[Int] = Nil.::(1); + val y: List[Int] = nil.::(1); +} diff --git a/test/files/pos/infer2.scala b/test/files/pos/infer2.scala new file mode 100644 index 0000000000..66f3d76544 --- /dev/null +++ b/test/files/pos/infer2.scala @@ -0,0 +1,10 @@ +object test { + + def f[a, b <: a](x: b): a = x: a; + def g[a >: b, b](x: b): a = x: a; + + val x: int = f(1); + val y: String = g("") + +} + diff --git a/test/files/pos/lambda.scala b/test/files/pos/lambda.scala new file mode 100644 index 0000000000..187b3f9783 --- /dev/null +++ b/test/files/pos/lambda.scala @@ -0,0 +1,8 @@ +object test { + + def apply[a,b](f: a => b): a => b = x: a => f(x); + + def twice[a](f: a => a): a => a = x: a => f(f(x)); + + def main = apply[Int,Int](twice[Int](x: Int => x))(1); +}
\ No newline at end of file diff --git a/test/files/pos/lambdalift.scala b/test/files/pos/lambdalift.scala new file mode 100644 index 0000000000..ae5799a6f8 --- /dev/null +++ b/test/files/pos/lambdalift.scala @@ -0,0 +1,15 @@ +import scala._; + +object test { + + def f(x: Int) = { + def g() = h(); + def h() = x; + g(); + class inner() { + def g() = h(); + def h() = x; + } + g() + new inner().g(); + } +}
\ No newline at end of file diff --git a/test/files/pos/lambdalift1.scala b/test/files/pos/lambdalift1.scala new file mode 100644 index 0000000000..d9172f51eb --- /dev/null +++ b/test/files/pos/lambdalift1.scala @@ -0,0 +1,17 @@ +import scala._; + +object test { + + def f[a <: java.lang.Object](x: a) = { + def print() = java.lang.System.out.println(x); + class A() { + def g() = { + class B() { + def h() = print() + } + new B().h() + } + } + new A().g() + } +}
\ No newline at end of file diff --git a/test/files/pos/localmodules.scala b/test/files/pos/localmodules.scala new file mode 100644 index 0000000000..8ed34f455a --- /dev/null +++ b/test/files/pos/localmodules.scala @@ -0,0 +1,22 @@ +package test; + +object main { + + class a { + + object b { + + trait c {} + def foo(x: c): c = { System.out.println("foo(" + x + ")"); x } + + } + + def bar(x: b.c): a.this.b.c = { b.foo(x); x } + } + + def main(args: Array[String]) = { + val aa = new a; + val xx: aa.b.c = null; + System.out.println(aa.bar(xx)); + } +} diff --git a/test/files/pos/matthias1.scala b/test/files/pos/matthias1.scala new file mode 100644 index 0000000000..a923a529fe --- /dev/null +++ b/test/files/pos/matthias1.scala @@ -0,0 +1,15 @@ +class A() { + class B() { + def foo(x: B) = 0 + } +} +object test { + def main = { + val a = new A(); + val b = new a.B(); + val c = new a.B(); + val d = b.foo(c); + () + } +} + diff --git a/test/files/pos/matthias3.scala b/test/files/pos/matthias3.scala new file mode 100644 index 0000000000..6e86afeca6 --- /dev/null +++ b/test/files/pos/matthias3.scala @@ -0,0 +1,13 @@ + +abstract class A() { + val y: A; +} +class B() extends A() { + val x = this; + val y: x.type = x; +} +abstract class C() { + val b: B = new B(); + val a: A { val y: b.type }; +} + diff --git a/test/files/pos/matthias4.scala b/test/files/pos/matthias4.scala new file mode 100644 index 0000000000..c6ce79d682 --- /dev/null +++ b/test/files/pos/matthias4.scala @@ -0,0 +1,84 @@ +/* +object A requires B { + B.X getX() { + return B.getX(); + } + void setX(B.X x) {} +} +object B { + class X {} + X getX() { + return new X(); + } + void setX(X x) {} +} +object C requires B { + object A; + void test() { + A.setX(B.getX()); + } +} +*/ + +trait _a extends Object with _b { + val a: _a; + val A: A; + type A <: a.AObject; + trait AObject { + def getX(): B.X; + def setX(x: B.X): Unit; + } +} +trait a123 extends Object with _a with _b { + val a: this.type = this; + val A: A = new A(); + class A() extends AObject { + def getX(): B.X = B.getX(); + def setX(x: B.X) = B.setX(x); + } +} + +trait _b { + val b: _b; + val B: B; + type B <: b.BObject; + trait BObject { + type X; + def getX(): X; + def setX(x: X): Unit; + } +} +abstract class b() extends Object with _b { + val b: this.type = this; + val B: B = new B(); + class B() extends BObject { + class X() {} + def getX(): X = new X(); + def setX(x: X) = (); + } +} + +trait _m { + val m: _m; + val M: M; + type M <: m.MObject; + trait MObject {} +} +abstract class m() extends Object with _m with _b { + val m: this.type = this; + val M: M = new M(); + class M() extends MObject with a123 with Linker { + def test() = { + val x: B.X = B.getX(); + A.setX(x); + } + } + trait Linker { + val b: m.this.b.type = m.this.b; + val B: m.this.B.type = m.this.B; + type B = m.this.B; + val m: m.this.m.type = m.this.m; + val M: m.this.M.type = m.this.M; + type M = m.this.M; + } +} diff --git a/test/files/pos/matthias5.scala b/test/files/pos/matthias5.scala new file mode 100644 index 0000000000..0dcb7f833d --- /dev/null +++ b/test/files/pos/matthias5.scala @@ -0,0 +1,12 @@ +abstract class A() { + val y: A; +} +class B() extends A() { + val x = this; + val y: x.type = x; +} +abstract class C() { + val b: B = new B(); + val a: A { val y: b.type }; +} + diff --git a/test/files/pos/maxim1.scala b/test/files/pos/maxim1.scala new file mode 100644 index 0000000000..58916beb8a --- /dev/null +++ b/test/files/pos/maxim1.scala @@ -0,0 +1,5 @@ +object test { + def f(x: Int)(y: Int) = x + y; + def y: Int => Int = f(2); + def main = y(1); +} diff --git a/test/files/pos/michel1.scala b/test/files/pos/michel1.scala new file mode 100644 index 0000000000..f930a682ef --- /dev/null +++ b/test/files/pos/michel1.scala @@ -0,0 +1,9 @@ +class A[Ta] (a : Ta) { + def f = 1 +} + +trait C {} + +class B[Tb] (b : Tb) extends A[Tb] (b) with C { + def g = 2 +} diff --git a/test/files/pos/michel2.scala b/test/files/pos/michel2.scala new file mode 100644 index 0000000000..e6976b0f40 --- /dev/null +++ b/test/files/pos/michel2.scala @@ -0,0 +1,16 @@ +object Test { + + trait A extends Object { + def f : Int = 1 + } + + class B extends Object with A { + override def f : Int = super[A].f + } + + def main(args: Array[String]) = + System.out.println(new B().f); +} + + + diff --git a/test/files/pos/michel3.scala b/test/files/pos/michel3.scala new file mode 100644 index 0000000000..0e85295bfb --- /dev/null +++ b/test/files/pos/michel3.scala @@ -0,0 +1,3 @@ +abstract class A() { + val v : Int +}
\ No newline at end of file diff --git a/test/files/pos/michel4.scala b/test/files/pos/michel4.scala new file mode 100644 index 0000000000..2390be5d26 --- /dev/null +++ b/test/files/pos/michel4.scala @@ -0,0 +1,7 @@ +class A() { + val f : Int = 2 +} + +class B() extends A() { + override val f : Int = super.f +}
\ No newline at end of file diff --git a/test/files/pos/michel5.scala b/test/files/pos/michel5.scala new file mode 100644 index 0000000000..345ae04d9d --- /dev/null +++ b/test/files/pos/michel5.scala @@ -0,0 +1,5 @@ +trait A[Ta] { } + +class B() extends Object with A[Int] { + val x : Int = 2 +}
\ No newline at end of file diff --git a/test/files/pos/michel6.scala b/test/files/pos/michel6.scala new file mode 100644 index 0000000000..b32e8bed75 --- /dev/null +++ b/test/files/pos/michel6.scala @@ -0,0 +1,6 @@ +object M { + def f(x: Int): Unit = {} + + def g(): Int => Unit = + if (0 == 0) f else g() + } diff --git a/test/files/pos/mixins.scala b/test/files/pos/mixins.scala new file mode 100644 index 0000000000..2b403a25e8 --- /dev/null +++ b/test/files/pos/mixins.scala @@ -0,0 +1,22 @@ +package mixins; +abstract class Super { + def foo: int; +} +trait Mixin extends Super { + abstract override def foo = super.foo; +} +trait MixinSub extends Super with Mixin { + abstract override def foo: int = super.foo; +} +trait MixinSubSub extends MixinSub { + abstract override def foo = super.foo; +} +class Sub extends Super { + def foo: int = 1 +} +class Base extends Sub with MixinSubSub { + override def foo = super.foo; +} +trait Mixin1 extends Sub with MixinSubSub {} +class Base1 extends Mixin1 {} + diff --git a/test/files/pos/modules.scala b/test/files/pos/modules.scala new file mode 100644 index 0000000000..8168a42d3c --- /dev/null +++ b/test/files/pos/modules.scala @@ -0,0 +1,14 @@ +package scala { + + object a { + + object b { + + trait c {} + def foo(x: c): c = bar(x) + + } + + def bar(x: b.c): b.c = x + } +} diff --git a/test/files/pos/modules1.scala b/test/files/pos/modules1.scala new file mode 100644 index 0000000000..3da14af4fe --- /dev/null +++ b/test/files/pos/modules1.scala @@ -0,0 +1,14 @@ +package scala { + + object a { + + object b { + + trait c {} + def foo(x: c): c = bar(x) + + } + + def bar(x: b.c): a.b.c = { b.foo(x); x } + } +} diff --git a/test/files/pos/moduletrans.scala b/test/files/pos/moduletrans.scala new file mode 100644 index 0000000000..51538417ed --- /dev/null +++ b/test/files/pos/moduletrans.scala @@ -0,0 +1,8 @@ +object m1 { + + class m() { + def f() = 5 + } + final val m: m = new m() + +} diff --git a/test/files/pos/nested.scala b/test/files/pos/nested.scala new file mode 100644 index 0000000000..b038fce39d --- /dev/null +++ b/test/files/pos/nested.scala @@ -0,0 +1,29 @@ +// A non-trivial example of nested classes (mostly to test +// ExplicitOuterClasses). + +class A(pa : Int) { + def a1 = pa; + class B(pb : Int) { + def b1 = pa+pb+a1; + class C(pc : Int) extends A(b1) { + def c1 = pc+pb+pa + } + val c1 = new C(66) + } +} + +trait M { + val x : Int; + def m1 = x +} + +class A1(x0 : Int) extends A(x0) with M { + val x = x0; + class D() extends B(42) { + val c2 = new C(66); + class E() extends C(5) { + def e1 = c1+b1+a1; + def e2 = new D(); + } + } +} diff --git a/test/files/pos/null.scala b/test/files/pos/null.scala new file mode 100644 index 0000000000..59f88ee0e0 --- /dev/null +++ b/test/files/pos/null.scala @@ -0,0 +1,3 @@ +object M { + val x: Boolean = null == null; +}
\ No newline at end of file diff --git a/test/files/pos/ok.lst b/test/files/pos/ok.lst new file mode 100644 index 0000000000..d9065d1c25 --- /dev/null +++ b/test/files/pos/ok.lst @@ -0,0 +1,138 @@ +304.scala +A.scala +List1.scala +MailBox.scala +S1.scala +S3.scala +S5.scala +S8.scala +X.scala +Z.scala +abstract.scala +aliases.scala +arrays2.scala +attributes.scala +bug082.scala +bug1.scala +bug115.scala +bug116.scala +bug119.scala +bug121.scala +bug124.scala +bug151.scala +bug159.scala +bug160.scala +bug17.scala +bug175.scala +bug177.scala +bug183.scala +bug193.scala +bug2.scala +bug20.scala +bug201.scala +bug204.scala +bug210.scala +bug211.scala +bug229.scala +bug245.scala +bug267.scala +bug287.scala +bug289.scala +bug29.scala +bug295.scala +bug30.scala +bug304.scala +bug31.scala +bug318.scala +bug32.scala +bug342.scala +bug348plus.scala +bug359.scala +bug36.scala +bug360.scala +bug361.scala +bug372.scala +bug39.scala +bug49.scala +bug53.scala +bug54.scala +bug61.scala +bug64.scala +bug66.scala +bug68.scala +bug69.scala +bug76.scala +bug81.scala +bug91.scala +bug93.scala +cls.scala +cls1.scala +clsrefine.scala +compile.scala +compound.scala +constfold.scala +eta.scala +expressions-current.scala +gui.scala +imports.scala +infer.scala +infer2.scala +lambda.scala +lambdalift.scala +lambdalift1.scala +localmodules.scala +matthias1.scala +matthias3.scala +matthias4.scala +matthias5.scala +maxim1.scala +michel1.scala +michel2.scala +michel3.scala +michel4.scala +michel5.scala +michel6.scala +mixins.scala +modules.scala +modules1.scala +moduletrans.scala +nested.scala +null.scala +orderedpoints.scala +override.scala +partialfun.scala +patterns.scala +patterns1.scala +patterns2.scala +patterns3.scala +philippe1.scala +philippe2.scala +philippe3.scala +philippe4.scala +pmbug.scala +propagate.scala +rebind.scala +refine.scala +reftest.scala +scoping1.scala +scoping2.scala +scoping3.scala +seqtest2.scala +simplelists.scala +stable.scala +strings.scala +test1.scala +test2.scala +test4.scala +test4a.scala +test4refine.scala +test5.scala +test5refine.scala +testcast.scala +thistype.scala +thistypes.scala +traits.scala +valdefs.scala +viewtest1.scala +viewtest2.scala +viewtest3.scala diff --git a/test/files/pos/orderedpoints.scala b/test/files/pos/orderedpoints.scala new file mode 100644 index 0000000000..7e56a663fe --- /dev/null +++ b/test/files/pos/orderedpoints.scala @@ -0,0 +1,30 @@ +package test; + +class Point1(x: int) extends Object with Ordered[Point1] { + val xCoord = x; + def compareTo [b >: Point1 <% Ordered[b]](that: b): int = that match { + case that1: Point1 => this.xCoord.compareTo(that1.xCoord) + case _ => -that.compareTo(this) + } +} +class Point2(x: int, y: int) extends Point1(x) with Ordered[Point2] {} +/* + val yCoord = y; + override def compareTo [b >: Point2 <% Ordered[b]](that: b): int = that match { + case that1: Point2 => + val r = super.compareTo(that1); + if (r == 0) this.yCoord.compareTo(that1.yCoord) else r + case _ => -that.compareTo(this) + } +} +object Test extends Application { + val p1 = new Point1(1); + val q1 = new Point1(2); + System.out.println(p1 < q1); + val p2 = new Point2(1, 2); + val q2 = new Point2(1, 3); + System.out.println(p2 < q2); + System.out.println(p1 < q2); + System.out.println(p2 < q1); +} +*/ diff --git a/test/files/pos/override.scala b/test/files/pos/override.scala new file mode 100644 index 0000000000..9f068b8ecd --- /dev/null +++ b/test/files/pos/override.scala @@ -0,0 +1,14 @@ +trait A extends Object { + def f = 1; + val x: A; +} + +trait B extends Object { + def f = 2; +} + +trait C extends Object with A with B { + override def f = super[B].f; + val a: A; + val x: a.type = a; +} diff --git a/test/files/pos/partialfun.scala b/test/files/pos/partialfun.scala new file mode 100644 index 0000000000..21e4d0a096 --- /dev/null +++ b/test/files/pos/partialfun.scala @@ -0,0 +1,10 @@ +object partialfun { + + def applyPartial[b](f: PartialFunction[Option[String], b])(x: Option[String]) = + if (f.isDefinedAt(x)) f(x) else "<undefined>"; + + applyPartial { + case Some(xxx) => xxx + } (None); + +}
\ No newline at end of file diff --git a/test/files/pos/patterns.scala b/test/files/pos/patterns.scala new file mode 100644 index 0000000000..93907e7d52 --- /dev/null +++ b/test/files/pos/patterns.scala @@ -0,0 +1,27 @@ +trait Option[+a] {} +case class Some[a](x: a) extends Option[a] { + override def toString(): String = "Some(" + x + ")"; + override def equals(that: Any): Boolean = that match { + case Some(x) => this.x == x + case _ => false + } + override def hashCode(): scala.Int = getClass().hashCode() * 41 + x.hashCode(); +} +case object None extends Option[All] { + override def toString(): String = "None"; + override def equals(that: Any) = that match { + case None => true + case _ => false + } + override def hashCode(): scala.Int = getClass().hashCode(); +} + +object test { + + def println(str: String): Unit = java.lang.System.out.println(str); + + def print(opt: Option[String]) = opt match { + case Some(x) => println(x); + case None => println("nothing"); + } +} diff --git a/test/files/pos/patterns1.scala b/test/files/pos/patterns1.scala new file mode 100644 index 0000000000..fa542e7b06 --- /dev/null +++ b/test/files/pos/patterns1.scala @@ -0,0 +1,13 @@ +trait Option[+a] {} +case class Some[a](x: a) extends Option[a]; +case object None extends Option[All]; + +object test { + + def println(str: String): Unit = java.lang.System.out.println(str); + + def print(opt: Option[String]) = opt match { + case Some(x) => println(x); + case None => println("nothing"); + } +}
\ No newline at end of file diff --git a/test/files/pos/patterns2.scala b/test/files/pos/patterns2.scala new file mode 100644 index 0000000000..93dcedbcf8 --- /dev/null +++ b/test/files/pos/patterns2.scala @@ -0,0 +1,16 @@ +trait Option {} +case class Choice(a: Option, b: Option) extends Option; +case class Some(x: java.lang.String) extends Option; +case object None extends Option; + +object test { + + def f(opt: Option) = opt match { + case Choice(Some("one"), Some(x)) => 1; + case Choice(Some("two"), None) => 1; + case Choice(y, Some("two")) => 2; + case Choice(Some(z), a) => 3; + case Some(b) => 4; + case None => 5; + } +}
\ No newline at end of file diff --git a/test/files/pos/patterns3.scala b/test/files/pos/patterns3.scala new file mode 100644 index 0000000000..001bd8989f --- /dev/null +++ b/test/files/pos/patterns3.scala @@ -0,0 +1,5 @@ +object M { + + val Tuple2(Tuple2(x, y), _) = Tuple2(Tuple2(1, 2), 3); + +} diff --git a/test/files/pos/philippe1.scala b/test/files/pos/philippe1.scala new file mode 100644 index 0000000000..3cace0e116 --- /dev/null +++ b/test/files/pos/philippe1.scala @@ -0,0 +1,8 @@ +object test { + def id[a](xs: Array[a]): Array[a] = xs; + + def main(args: Array[String]): Unit = { + val res: Array[String] = id(args); + () + } +}
\ No newline at end of file diff --git a/test/files/pos/philippe2.scala b/test/files/pos/philippe2.scala new file mode 100644 index 0000000000..0dc896ebfd --- /dev/null +++ b/test/files/pos/philippe2.scala @@ -0,0 +1,7 @@ + +import scala._; +class m1() { + def n() = 0; + def foo(i: Int)(j: Int): Unit = (); + val bar = foo(n()); +} diff --git a/test/files/pos/philippe3.scala b/test/files/pos/philippe3.scala new file mode 100644 index 0000000000..9442583997 --- /dev/null +++ b/test/files/pos/philippe3.scala @@ -0,0 +1,40 @@ + +class Foo(x: Int) {} +case class Bar(y: Int) extends Foo(y); + + +trait T {} +trait U {} +class C() {} + + +trait T1; +trait T2 {} +trait T5 extends T; +trait T6 extends T {} +trait T7 extends T with U; +trait T8 extends T with U {} + +class C1(); +class C2() {} +class C5() extends C(); +class C6() extends C() {} +class C7() extends C() with U; +class C8() extends C() with U {} + +case class D1(); +case class D2() {} +case class D5() extends C(); +case class D6() extends C() {} +case class D7() extends C() with U; +case class D8() extends C() with U {} + +object M1; +object M2 {} +object M5 extends C(); +object M6 extends C() {} +object M7 extends C() with U; +object M8 extends C() with U {} + + + diff --git a/test/files/pos/philippe4.scala b/test/files/pos/philippe4.scala new file mode 100644 index 0000000000..c9b1cdaeb0 --- /dev/null +++ b/test/files/pos/philippe4.scala @@ -0,0 +1,3 @@ +trait Foo[t <: Foo[t]]: t { + def foo(that: t): Boolean; +} diff --git a/test/files/pos/pmbug.scala b/test/files/pos/pmbug.scala new file mode 100644 index 0000000000..7d94e7a8bd --- /dev/null +++ b/test/files/pos/pmbug.scala @@ -0,0 +1,8 @@ +object Test { + + def flatten[a](l: List[List[a]]): List[a] = l match { + case Nil => Nil + case head :: tail => head ::: flatten(tail) + } + +} diff --git a/test/files/pos/propagate.scala b/test/files/pos/propagate.scala new file mode 100644 index 0000000000..84f4f5d6d2 --- /dev/null +++ b/test/files/pos/propagate.scala @@ -0,0 +1,17 @@ +class C { + + def f[a](x: a): a = { + + class D() { + def g(x: a) = f(x): a; + } + + new D().g(x); + + } + +} + + + + diff --git a/test/files/pos/rebind.scala b/test/files/pos/rebind.scala new file mode 100644 index 0000000000..3b7b27ac34 --- /dev/null +++ b/test/files/pos/rebind.scala @@ -0,0 +1,13 @@ +abstract class Foo { + class Inner { + def inner: int = 1; + } + def foo: Inner; +} +trait Bar { + type Inner; + def foo: Inner = foo; +} +class Test extends Foo with Bar { + System.out.println(foo.inner); +} diff --git a/test/files/pos/refine.scala b/test/files/pos/refine.scala new file mode 100644 index 0000000000..5d175f26f5 --- /dev/null +++ b/test/files/pos/refine.scala @@ -0,0 +1,6 @@ +object test { + + val x: Object { def t(): String } = new Object { + def t(): String = "1"; + } +} diff --git a/test/files/pos/reftest.scala b/test/files/pos/reftest.scala new file mode 100644 index 0000000000..f709f70897 --- /dev/null +++ b/test/files/pos/reftest.scala @@ -0,0 +1,4 @@ +import scala._; +object test { + val x: Ref[Int] = new Ref(1); +}
\ No newline at end of file diff --git a/test/files/pos/scall.bat b/test/files/pos/scall.bat new file mode 100755 index 0000000000..ba9ce6f131 --- /dev/null +++ b/test/files/pos/scall.bat @@ -0,0 +1,50 @@ +scalac -prompt A.scala;
+scalac -prompt IntSet.scala;
+scalac -prompt List1.scala;
+scalac -prompt Rational.scala;
+scalac -prompt X.scala;
+scalac -prompt Y.scala;
+scalac -prompt Z.scala;
+scalac -prompt abstract.scala;
+scalac -prompt cls.scala;
+scalac -prompt cls1.scala;
+scalac -prompt clsrefine.scala;
+scalac -prompt cours1.scala;
+scalac -prompt cours2.scala;
+scalac -prompt cours2a.scala;
+scalac -prompt cours2b.scala;
+scalac -prompt cours2c.scala;
+scalac -prompt eta.scala;
+scalac -prompt exceptions.scala;
+scalac -prompt imports.scala;
+scalac -prompt lambda.scala;
+scalac -prompt lambdalift.scala;
+scalac -prompt lambdalift1.scala;
+scalac -prompt matthias1.scala;
+scalac -prompt maxim1.scala;
+scalac -prompt michel1.scala;
+scalac -prompt michel2.scala;
+scalac -prompt michel3.scala;
+scalac -prompt michel4.scala;
+scalac -prompt michel5.scala;
+scalac -prompt modules.scala;
+scalac -prompt modules1.scala;
+scalac -prompt moduletrans.scala;
+scalac -prompt nested.scala;
+scalac -prompt override.scala;
+scalac -prompt patterns.scala;
+scalac -prompt patterns2.scala;
+scalac -prompt philippe1.scala;
+scalac -prompt philippe2.scala;
+scalac -prompt reftest.scala;
+scalac -prompt sort1.scala;
+scalac -prompt sqrt.scala;
+scalac -prompt stable.scala;
+scalac -prompt strings.scala;
+scalac -prompt test1.scala;
+scalac -prompt test2.scala;
+scalac -prompt test4.scala;
+scalac -prompt test4a.scala;
+scalac -prompt test4refine.scala;
+scalac -prompt test5.scala;
+scalac -prompt test5refine.scala;
diff --git a/test/files/pos/scoping1.scala b/test/files/pos/scoping1.scala new file mode 100644 index 0000000000..23daf024fe --- /dev/null +++ b/test/files/pos/scoping1.scala @@ -0,0 +1,12 @@ +object This extends Application { + trait A { + def foo(): unit; + } + class C: A { + def bar() = this.foo(); + } + class D extends C with A { + def foo() = () + } + val c: C = new D; +} diff --git a/test/files/pos/scoping2.scala b/test/files/pos/scoping2.scala new file mode 100644 index 0000000000..39f3ef5f0e --- /dev/null +++ b/test/files/pos/scoping2.scala @@ -0,0 +1,14 @@ +object That { + trait A { + type T <: I; + trait I {} + } + trait B { + type T <: J; + trait J {} + } + trait C extends A with B { + type T <: I with J; + } +} + diff --git a/test/files/pos/scoping3.scala b/test/files/pos/scoping3.scala new file mode 100644 index 0000000000..4ebc7f6378 --- /dev/null +++ b/test/files/pos/scoping3.scala @@ -0,0 +1,20 @@ +object CI { + trait TreeDisplay { + type TreeNode <: ITreeNode; + trait ITreeNode { + def display(): unit; + } + } + trait TreeDisplayExp { + def getRoot(): TreeNode; + type TreeNode <: ITreeNodeExp; + trait ITreeNodeExp {} + } + trait TreeDisplayFinal extends TreeDisplay with TreeDisplayExp { + type TreeNode <: ITreeNode with ITreeNodeExp; + } + abstract class SimpleTreeDisplay: TreeDisplayFinal extends +TreeDisplay { + def display() = { this.getRoot().display(); } + } +} diff --git a/test/files/pos/seqtest2.scala b/test/files/pos/seqtest2.scala new file mode 100644 index 0000000000..903b270c95 --- /dev/null +++ b/test/files/pos/seqtest2.scala @@ -0,0 +1,13 @@ +object test { + + val b = List(1, 2, 3); + + def main(args: Array[String]) = + System.out.println( + b match { + case List(1, 2, 3) => true; + case _ => false; + } + ) + +} diff --git a/test/files/pos/simplelists.scala b/test/files/pos/simplelists.scala new file mode 100644 index 0000000000..73b04a8762 --- /dev/null +++ b/test/files/pos/simplelists.scala @@ -0,0 +1,17 @@ + abstract class List[+a] { + def head: a; + def tail: List[a]; + def cons[b >: a](x: b): List[b] = new Cons[b, a](x, this); + } + + object Nil extends List[All] { + def error(msg: String): All = throw new java.lang.Error(msg); + def head: All = error("Nil.head"); + def tail: List[All] = error("Nil.tail"); + } + + class Cons[c, d <: c](x: c, xs: List[d]) extends List[c] { + def head: c = x; + def tail: List[c] = xs; + } + diff --git a/test/files/pos/stable.scala b/test/files/pos/stable.scala new file mode 100644 index 0000000000..267a36fe5c --- /dev/null +++ b/test/files/pos/stable.scala @@ -0,0 +1,11 @@ +trait Base { + val x: Int; + val y: Int; + var z: Int; +} + +class Sub() extends Base { + val x: Int = 1; + val y: Int = 2; + var z: Int = 3; +} diff --git a/test/files/pos/strings.scala b/test/files/pos/strings.scala new file mode 100644 index 0000000000..3bf40e3dda --- /dev/null +++ b/test/files/pos/strings.scala @@ -0,0 +1,6 @@ +// martin 1-3-2002: it seems there is a problem with the way Serializable is loaded. +object test { + + def f() = "hello".concat("world"); + +} diff --git a/test/files/pos/test1.scala b/test/files/pos/test1.scala new file mode 100644 index 0000000000..a36d2436ec --- /dev/null +++ b/test/files/pos/test1.scala @@ -0,0 +1,5 @@ +object test { + + def f() = 5; + +} diff --git a/test/files/pos/test2.scala b/test/files/pos/test2.scala new file mode 100644 index 0000000000..fe36d07f1b --- /dev/null +++ b/test/files/pos/test2.scala @@ -0,0 +1,5 @@ +import scala._; +object test2 { + def f(x: Int): Int = 'a'; + def g(x: Int) = f(f(x)); +}
\ No newline at end of file diff --git a/test/files/pos/test4.scala b/test/files/pos/test4.scala new file mode 100644 index 0000000000..4fe65a8f19 --- /dev/null +++ b/test/files/pos/test4.scala @@ -0,0 +1,47 @@ +package test; + +trait C {} +trait D {} +trait E {} + +object test { + def c: C = c; + def d: D = d; + def e: E = e; +} + +import test._; + +trait S extends ooo.I[D] { + def bar: E = foo(c,d); +} + +class O[X]() { + trait I[Y] { + def foo(x: X, y: Y): E = e; + } + val i:I[E] = null; + val j:I[X] = null; +} + +object ooo extends O[C]() { + + def main = { + val s: S = null; + import s._; + foo(c,d); + ooo.i.foo(c,e); + ooo.j.foo(c,c); + bar + } +} + +class Main() { + val s: S = null; + import s._; + foo(c,d); + ooo.i.foo(c,e); + ooo.j.foo(c,c); + bar; +} + diff --git a/test/files/pos/test4a.scala b/test/files/pos/test4a.scala new file mode 100644 index 0000000000..ada0ba4e5f --- /dev/null +++ b/test/files/pos/test4a.scala @@ -0,0 +1,16 @@ +trait C {} + +class O[X]() { + trait I[Y] { + def foo(y: Y): Y = y; + } + val j:I[X] = null; +} + +object o extends O[C]() { + def c: C = c; + def main = { + o.j.foo(c); + } +} + diff --git a/test/files/pos/test4refine.scala b/test/files/pos/test4refine.scala new file mode 100644 index 0000000000..6710962934 --- /dev/null +++ b/test/files/pos/test4refine.scala @@ -0,0 +1,49 @@ +trait C {} +trait D {} +trait E {} + +object test { + def c: C = c; + def d: D = d; + def e: E = e; +} + +import test._; + +trait S extends o.I { + type Y = D; + def bar: E = foo(c,d); +} + +abstract class O() { + type X; + abstract trait I { + type Y; + def foo(x: X, y: Y): E = e; + } + val i:I { type Y = E } = null; + val j:I { type Y = X } = null; +} + +object o extends O() { + type X = C; + + def main = { + val s: S = null; + import s._; + foo(c,d); + o.i.foo(c,e); + o.j.foo(c,c); + bar + } +} + +class Main() { + val s: S = null; + import s._; + foo(c,d); + o.i.foo(c,e); + o.j.foo(c,c); + bar; +} + diff --git a/test/files/pos/test5.scala b/test/files/pos/test5.scala new file mode 100644 index 0000000000..4dbafc9ac3 --- /dev/null +++ b/test/files/pos/test5.scala @@ -0,0 +1,68 @@ +import scala._; + +object test { + + trait F[If] {} + + def f[Jf](h: Jf):F[Jf] = f[Jf](h); + + trait G[Ig] {} + + def g[Jg](h: Jg):G[Jg] = g[Jg](h); + + class M[P]() { + abstract class I[X]() { + // Methods to check the type X and P as seen from instances of I + def chk_ix(x: X): Unit = (); + def chk_ip(p: P): Unit; + + // Value with type X as seen from instances of I + def val_ix: X = val_ix; + } + + val i:I[G[P]] = null; + + // Values with types P and i.X as seen from instances of M + def val_mp: P = val_mp; + def val_mix: G[P] = g[P](val_mp); + } + + class N[Q]() extends M[F[Q]]() { + val j:J[G[Q]] = null; + + abstract class J[Y]() extends I[G[Y]]() { + // Values with types Y and X as seen from instances of J + def val_jy: Y = val_jy; + def val_jx: G[Y] = g[Y](val_jy); + + // Check type P + chk_ip(val_mp); + chk_ip(val_np); + } + + // Values with types Q, X.P, i.X, j.Y and j.X as seen from instances of N + def val_nq: Q = val_nq; + def val_np: F[Q] = f[Q](val_nq); + def val_nix: G[F[Q]] = g[F[Q]](val_np); + def val_njy: G[Q] = g[Q](val_nq); + def val_njx: G[G[Q]] = g[G[Q]](val_njy); + + // Check type i.P + i.chk_ip(val_mp); + i.chk_ip(val_np); + + // Check type j.P + j.chk_ip(val_mp); + j.chk_ip(val_np); + + // Check type i.X + i.chk_ix(i.val_ix); + i.chk_ix(val_mix); + i.chk_ix(val_nix); + + // Check j.X + j.chk_ix(j.val_ix); + j.chk_ix(j.val_jx); + j.chk_ix(val_njx); + } +} diff --git a/test/files/pos/test5refine.scala b/test/files/pos/test5refine.scala new file mode 100644 index 0000000000..95670faa05 --- /dev/null +++ b/test/files/pos/test5refine.scala @@ -0,0 +1,75 @@ +import scala._; + +object test { + + abstract trait F { type If; } + + def f[Jf](h: Jf):F { type If = Jf } = f[Jf](h); + + abstract trait G { type Ig; } + + def g[Jg](h: Jg):G { type Ig = Jg } = g[Jg](h); + + abstract class M() { + type P; + abstract class I() { + type X; + + // Methods to check the type X and P as seen from instances of I + def chk_ix(x: X): Unit = {} + def chk_ip(p: P): Unit = {} + + // Value with type X as seen from instances of I + def val_ix: X = val_ix; + } + + val i: I { type X = G { type Ig = P } } = null; + + // Values with types P and i.X as seen from instances of M + def val_mp: P = val_mp; + def val_mix: G { type Ig = P } = g[P](val_mp); + } + + abstract class N() extends M() { + type Q; + type P = F { type If = Q }; + val j:J { type Y = G { type Ig = Q } } = null; + + abstract class J() extends I() { + type Y; + type X = G { type Ig = Y; }; + // Values with types Y and X as seen from instances of J + def val_jy: Y = val_jy; + def val_jx: G { type Ig = Y; } = g[Y](val_jy); + + // Check type P + chk_ip(val_mp); + chk_ip(val_np); + } + + // Values with types Q, X.P, i.X, j.Y and j.X as seen from instances of N + def val_nq: Q = val_nq; + def val_np: F { type If = Q } = f[Q](val_nq); + def val_nix: G { type Ig = F { type If = Q } } = g[F { type If = Q }](val_np); + def val_njy: G { type Ig = Q; } = g[Q](val_nq); + def val_njx: G { type Ig = G { type Ig = Q }} = g[G { type Ig = Q; }](val_njy); + + // Check type i.P + i.chk_ip(val_mp); + i.chk_ip(val_np); + + // Check type j.P + j.chk_ip(val_mp); + j.chk_ip(val_np); + + // Check type i.X + i.chk_ix(i.val_ix); + i.chk_ix(val_mix); + i.chk_ix(val_nix); + + // Check j.X + j.chk_ix(j.val_ix); + j.chk_ix(j.val_jx); + j.chk_ix(val_njx); + } +}
\ No newline at end of file diff --git a/test/files/pos/testcast.scala b/test/files/pos/testcast.scala new file mode 100644 index 0000000000..631b2c922b --- /dev/null +++ b/test/files/pos/testcast.scala @@ -0,0 +1,26 @@ +package test; + +class A; + +class B extends A { + def foo: int = 1; +} + +object B { + def view(x: B): B1 = null; +} + +class B1 { + def bar: int = 1 +} + +object C { + implicit def view(x: A): B1 = null; +} +object Test { + import C.view; + + val b: B = null; + + System.out.println(b.bar); +} diff --git a/test/files/pos/thistype.scala b/test/files/pos/thistype.scala new file mode 100644 index 0000000000..8c0ba209be --- /dev/null +++ b/test/files/pos/thistype.scala @@ -0,0 +1,14 @@ +object Test { + + class Ctl { + def enable: this.type = { System.out.println("enable"); this } + } + + class MouseCtl extends Ctl { + def mouseDown(x: int, y: int): unit = { System.out.println("mouse down"); } + } + + def main(args: Array[String]) = + new MouseCtl().enable.mouseDown(1, 2); + +} diff --git a/test/files/pos/thistypes.scala b/test/files/pos/thistypes.scala new file mode 100644 index 0000000000..4a68ba3e65 --- /dev/null +++ b/test/files/pos/thistypes.scala @@ -0,0 +1,8 @@ +trait B { + trait I {} + def foo: B.this.I; +} + +trait C extends B { + def foo: C.this.I; +}
\ No newline at end of file diff --git a/test/files/pos/traits.scala b/test/files/pos/traits.scala new file mode 100644 index 0000000000..5fdf4b342e --- /dev/null +++ b/test/files/pos/traits.scala @@ -0,0 +1,42 @@ +object Test { + type Color = int; + trait Shape { + override def equals(other: Any) = true; + } + trait Bordered extends Shape { + val thickness: int; + override def equals(other: Any) = other match { + case that: Bordered => this.thickness == that.thickness; + case _ => false + } + } + trait Colored extends Shape { + val color: Color; + override def equals(other: Any) = other match { + case that: Colored => this.color == that.color; + case _ => false + } + } + trait BorderedColoredShape extends Shape with Bordered with Colored { + override def equals(other: Any) = other match { + case that: BorderedColoredShape => + super.equals(that) && + super[Bordered].equals(that) && + super[Colored].equals(that) + case _ => false + } + } + + val bcs1 = new BorderedColoredShape { + val thickness = 1; + val color = 0; + } + val bcs2 = new BorderedColoredShape { + val thickness = 2; + val color = 0; + } + System.out.println(bcs1 == bcs1); + System.out.println(bcs1 == bcs2); +} + + diff --git a/test/files/pos/valdefs.scala b/test/files/pos/valdefs.scala new file mode 100644 index 0000000000..85ffa132b7 --- /dev/null +++ b/test/files/pos/valdefs.scala @@ -0,0 +1,16 @@ +object test { + + abstract class Base() { + val x: String; + val y = 1.0; + } + + case class Sub() extends Base() { + val x = "hello"; + override val y = 2.0; + } + + abstract class Sub2() extends Base() { + override val Pair(x, y) = Pair("abc", 2.0); + } +} diff --git a/test/files/pos/variances.scala b/test/files/pos/variances.scala new file mode 100644 index 0000000000..7dc56b0225 --- /dev/null +++ b/test/files/pos/variances.scala @@ -0,0 +1,8 @@ +abstract class P[+a, +b] { // SLS, Example 4.4.2 + def fst: a; + def snd: b +} + +trait Vector[+a] { // SLS, Example 4.4.3 b) + def append[b >: a](x: Vector[b]): Vector[b] +} diff --git a/test/files/pos/viewtest1.scala b/test/files/pos/viewtest1.scala new file mode 100644 index 0000000000..0a59fdad58 --- /dev/null +++ b/test/files/pos/viewtest1.scala @@ -0,0 +1,41 @@ +package test; + +trait Ordered[a] { + def < (x: a): boolean; +} + +object O { + implicit def view (x: String): Ordered[String] = new Ordered[String] { + def < (y: String) = x.compareTo(y) < 0; + } +} + +object Empty extends Tree[All]; +case class Node[c <% Ordered[c]](elem: c, l: Tree[c], r: Tree[c]) extends Tree[c]; + +trait Tree[+a <% Ordered[a]] { + def insert[b >: a <% Ordered[b]](x: b): Tree[b] = this match { + case Empty => new Node(x, Empty, Empty) + case Node(elem, l, r) => + if (x == elem) this + else if (x < elem) Node(elem, l insert x, r) + else Node(elem, l, r insert x); + } + def elements: List[a] = this match { + case Empty => List() + case Node(elem, l, r) => + l.elements ::: List(elem) ::: r.elements + } +} + +object Test { + import O.view; + + def main(args: Array[String]) = { + var t: Tree[String] = Empty; + for (val s <- args) { + t = t insert s + } + System.out.println(t.elements) + } +} diff --git a/test/files/pos/viewtest2.scala b/test/files/pos/viewtest2.scala new file mode 100644 index 0000000000..1958696c1f --- /dev/null +++ b/test/files/pos/viewtest2.scala @@ -0,0 +1,117 @@ +package test; + +/** A trait for totally ordered data. + */ +trait Ordered[+a] { + + /** Result of comparing `this' with operand `that'. + * returns `x' where + * x < 0 iff this < that + * x == 0 iff this == that + * x > 0 iff this > that + */ + def compareTo [b >: a <% Ordered[b]](that: b): int; + + def < [b >: a <% Ordered[b]](that: b): boolean = (this compareTo that) < 0; + + def > [b >: a <% Ordered[b]](that: b): boolean = (this compareTo that) > 0; + + def <= [b >: a <% Ordered[b]](that: b): boolean = (this compareTo that) <= 0; + + def >= [b >: a <% Ordered[b]](that: b): boolean = (this compareTo that) >= 0; +} + + +object O { + + implicit def view1(x: String): Ordered[String] = new Ordered[String] { + def compareTo [b >: String <% Ordered[b]](y: b): int = y match { + case y1: String => x compareTo y1; + case _ => -(y compareTo x) + } + } + implicit def view2(x: char): Ordered[char] = new Ordered[char] { + def compareTo [b >: char <% Ordered[b]](y: b): int = y match { + case y1: char => x - y1; + case _ => -(y compareTo x) + } + } + + implicit def view3[a <% Ordered[a]](x: List[a]): Ordered[List[a]] = + new Ordered[List[a]] { + def compareTo [b >: List[a] <% Ordered[b]](y: b): int = y match { + case y1: List[a] => compareLists(x, y1); + case _ => -(y compareTo x) + } + private def compareLists(xs: List[a], ys: List[a]): int = { + if (xs.isEmpty && ys.isEmpty) 0 + else if (xs.isEmpty) -1 + else if (ys.isEmpty) 1 + else { + val s = xs.head compareTo ys.head; + if (s != 0) s + else compareLists(xs.tail, ys.tail) + } + } + } + + implicit def view4[a](x: a): a = x; +} + +trait Tree[+a <% Ordered[a]] { + def insert[b >: a <% Ordered[b]](x: b): Tree[b]; + def elements: List[a] +} + +object Empty extends Tree[All] { + def insert[b >: All <% Ordered[b]](x: b): Tree[b] = new Node(x, Empty, Empty); + def elements: List[All] = List(); +} + +class Node[a <% Ordered[a]](elem: a, l: Tree[a], r: Tree[a]) extends Tree[a] { + def insert[b >: a <% Ordered[b]](x: b): Tree[b] = + if (x == elem) this + else if (x < elem) new Node(elem, l insert x, r) + else new Node(elem, l, r insert x); + def elements: List[a] = + l.elements ::: List(elem) ::: r.elements +} + +case class Str(elem: String) extends Ordered[Str] { + def compareTo[b >: Str <% Ordered[b]](that: b): int = that match { + case that1: Str => this.elem compareTo that1.elem + case _ => -(that compareTo this) + } +} + +object Test { + import O._; + + private def toCharList(s: String): List[Char] = + if (s.length() == 0) List() + else s.charAt(0) :: toCharList(s.substring(1)); + + def main(args: Array[String]) = { + { + var t: Tree[String] = Empty; + for (val s <- args) { + t = t insert s + } + System.out.println(t.elements) + } + { + var t: Tree[Str] = Empty; + for (val s <- args) { + t = t insert Str(s) + } + System.out.println(t.elements) + } + { + var t: Tree[List[char]] = Empty; + for (val s <- args) { + t = t insert toCharList(s) + } + System.out.println(t.elements) + } + } +} diff --git a/test/files/pos/viewtest3.scala b/test/files/pos/viewtest3.scala new file mode 100644 index 0000000000..89e32e48a8 --- /dev/null +++ b/test/files/pos/viewtest3.scala @@ -0,0 +1,59 @@ +package testview; + +trait Tree[+a <% Ordered[a]] { + def insert[b >: a <% Ordered[b]](x: b): Tree[b]; + def elements: List[a] +} + +object Empty extends Tree[All] { + def insert[b >: All <% Ordered[b]](x: b): Tree[b] = new Node(x, Empty, Empty); + def elements: List[All] = List(); +} + +class Node[a <% Ordered[a]](elem: a, l: Tree[a], r: Tree[a]) extends Tree[a] { + def insert[b >: a <% Ordered[b]](x: b): Tree[b] = + if (x == elem) this + else if (x < elem) new Node(elem, l insert x, r) + else new Node(elem, l, r insert x); + def elements: List[a] = + l.elements ::: List(elem) ::: r.elements +} + +case class Str(elem: String) extends Ordered[Str] { + def compareTo[b >: Str <% Ordered[b]](that: b): int = that match { + case that1: Str => this.elem compareTo that1.elem + case _ => -(that compareTo this) + } +} + +object Test { +// import O.view; + + private def toCharList(s: String): List[Char] = + if (s.length() == 0) List() + else s.charAt(0) :: toCharList(s.substring(1)); + + def main(args: Array[String]) = { + { + var t: Tree[String] = Empty; + for (val s <- args) { + t = t insert s + } + System.out.println(t.elements) + } + { + var t: Tree[Str] = Empty; + for (val s <- args) { + t = t insert Str(s) + } + System.out.println(t.elements) + } + { + var t: Tree[List[char]] = Empty; + for (val s <- args) { + t = t insert toCharList(s) + } + System.out.println(t.elements) + } + } +} diff --git a/test/files/run/Course-2002-01.check b/test/files/run/Course-2002-01.check new file mode 100644 index 0000000000..17b30bf3c2 --- /dev/null +++ b/test/files/run/Course-2002-01.check @@ -0,0 +1,34 @@ +232 +667 +11 +10 +62.8318 +62.8318 +62.8318 +4.0 +81.0 +256.0 +25.0 +1 +737.0 +1.0 +0.0 +1.0 +76.0 +1.4142156862745097 +1.7321428571428572 +2.0000000929222947 +1.4142156862745097 +1.7321428571428572 +2.0000000929222947 +1.4142156862745097 +1.7321428571428572 +2.0000000929222947 +sqrt(2) = 1.4142135623746899 +sqrt(2) = 1.4142135623746899 +cbrt(2) = 1.2599210500177698 +1 +1 1 +1 2 1 +1 3 3 1 +1 4 6 4 1 diff --git a/test/files/run/Course-2002-01.scala b/test/files/run/Course-2002-01.scala new file mode 100644 index 0000000000..b31d1016fd --- /dev/null +++ b/test/files/run/Course-2002-01.scala @@ -0,0 +1,240 @@ +//############################################################################ +// Programmation IV - 2002 - Week 01 +//############################################################################ +// $Id$ + +object M0 { + + //########################################################################## + + Console.println(87 + 145); + Console.println(1000 - 333); + Console.println(5 + 2 * 3); + + //########################################################################## + + def size = 2; + def pi = 3.14159; + def radius = 10; + def circumference = 2 * pi * radius; + + Console.println(5 * size); + Console.println(2 * pi * radius); + Console.println(circumference); + Console.println((2 * pi) * radius); + + //########################################################################## + + def square(x: Double) = x * x; + + Console.println(square(2)); + Console.println(square(5 + 4)); + Console.println(square(square(4))); + + //########################################################################## + + def sumOfSquares(x: Double, y: Double) = square(x) + square(y); + + Console.println(sumOfSquares(3, 2+2)); + + //########################################################################## + + def loop: Int = loop; + def first(x: Int, y: Int) = x; + def constOne(x: Int, y: => Int) = 1; + + Console.println(constOne(1, loop)); + + //########################################################################## + + def abs(x: Double) = if (x >= 0) x else -x; + + Console.println(abs(737)); + Console.println(abs(1)); + Console.println(abs(0)); + Console.println(abs(-1)); + Console.println(abs(-76)); + + //########################################################################## + + def sqrtIter0(guess: Double, x: Double): Double = + if (isGoodEnough0(guess, x)) guess + else sqrtIter0(improve0(guess, x), x); + + def improve0(guess: Double, x: Double) = + (guess + x / guess) / 2; + + def isGoodEnough0(guess: Double, x: Double) = + abs(square(guess) - x) < 0.001; + + def sqrt0(x: Double) = sqrtIter0(1.0, x); + + Console.println(sqrt0(2)); + Console.println(sqrt0(3)); + Console.println(sqrt0(4)); + + //########################################################################## + + def sqrt1(x: Double) = { + def sqrtIter1(guess: Double, x: Double): Double = + if (isGoodEnough1(guess, x)) guess + else sqrtIter1(improve1(guess, x), x); + + def improve1(guess: Double, x: Double) = + (guess + x / guess) / 2; + + def isGoodEnough1(guess: Double, x: Double) = + abs(square(guess) - x) < 0.001; + + sqrtIter1(1.0, x) + } + + Console.println(sqrt1(2)); + Console.println(sqrt1(3)); + Console.println(sqrt1(4)); + + //########################################################################## + + def sqrt2(x: Double) = { + def sqrtIter2(guess: Double): Double = + if (isGoodEnough2(guess)) guess + else sqrtIter2(improve2(guess)); + + def improve2(guess: Double) = + (guess + x / guess) / 2; + + def isGoodEnough2(guess: Double) = + abs(square(guess) - x) < 0.001; + + sqrtIter2(1.0) + } + + Console.println(sqrt2(2)); + Console.println(sqrt2(3)); + Console.println(sqrt2(4)); + + //########################################################################## +} + +//############################################################################ + +object M1 { + def abs(x: Double) = if (x >= 0) x else -x; + + def sqrt(x: Double): Double = { + def sqrtIter(prev: Double, guess: Double): Double = + if (isGoodEnough(prev, guess)) guess + else sqrtIter(guess, improve(guess)); + + def improve(guess: Double) = (guess + x / guess) / 2; + + def isGoodEnough(prev: Double, guess: Double) = + abs(prev - guess) / guess < 0.001; + + sqrtIter(1.0, improve(1.0)) + } + + Console.println("sqrt(2) = " + sqrt(2)); +} + +//############################################################################ + +object M2 { + def abs(x: Double) = if (x >= 0) x else -x; + + def sqrt(x:Double):Double = { + def sqrtIter(guess:Double):Double = { + val next = improve(guess); + if (isGoodEnough(guess,next)) next + else sqrtIter(next) + } + + def improve(guess:Double) = (guess+x/guess)/2; + + def isGoodEnough(prev:Double,guess:Double) = abs(prev-guess)/guess<0.001; + + sqrtIter(1.0) + } + + Console.println("sqrt(2) = " + sqrt(2)); +} + +//############################################################################ + +object M3 { + def abs(x: Double) = if (x >= 0) x else -x; + + def cbrt(x:Double):Double = { + def cbrtIter(guess:Double):Double = { + val next = improve(guess); + if (isGoodEnough(guess,next)) next + else cbrtIter(next) + } + + def improve(y:Double) = (x/(y*y)+2*y)/3; + + def isGoodEnough(prev:Double,guess:Double) = abs(prev-guess)/guess<0.001; + + cbrtIter(1.0) + } + + Console.println("cbrt(2) = " + cbrt(2)); +} + +//############################################################################ + +object M4 { + def pascal(c: Int, l: Int): Int = + if (c <= 0 || c >= l) 1 + else pascal(c - 1, l - 1) + pascal(c, l - 1); + + Console.print(pascal(0,0)); + Console.println; + + Console.print(pascal(0,1)); + Console.print(' '); + Console.print(pascal(1,1)); + Console.println; + + Console.print(pascal(0,2)); + Console.print(' '); + Console.print(pascal(1,2)); + Console.print(' '); + Console.print(pascal(2,2)); + Console.println; + + Console.print(pascal(0,3)); + Console.print(' '); + Console.print(pascal(1,3)); + Console.print(' '); + Console.print(pascal(2,3)); + Console.print(' '); + Console.print(pascal(3,3)); + Console.println; + + Console.print(pascal(0,4)); + Console.print(' '); + Console.print(pascal(1,4)); + Console.print(' '); + Console.print(pascal(2,4)); + Console.print(' '); + Console.print(pascal(3,4)); + Console.print(' '); + Console.print(pascal(4,4)); + Console.println; +} + +//############################################################################ + +object Test { + def main(args: Array[String]): Unit = { + M0; + M1; + M2; + M3; + M4; + () + } +} + +//############################################################################ diff --git a/test/files/run/Course-2002-02.check b/test/files/run/Course-2002-02.check new file mode 100644 index 0000000000..7d96950711 --- /dev/null +++ b/test/files/run/Course-2002-02.check @@ -0,0 +1,187 @@ +7 +120 + +10.0 +100.0 +2.083333333333333 +3025.7687714031754 +pi = 3.1659792728432152 + +10.0 +100.0 +2.083333333333333 +3025.7687714031754 +pi = 3.1659792728432152 + +10.0 +100.0 +2.083333333333333 +3025.7687714031754 +pi = 3.1659792728432152 + +10.0 +100.0 +2.083333333333333 +3025.7687714031754 +pi = 3.1659792728432152 + +10.0 +100.0 +2.083333333333333 +3025.7687714031754 +pi = 3.1659792728432152 + +10.0 +100.0 +2.083333333333333 +3025.7687714031754 +pi = 3.1659792728432152 + +10.0 +100.0 +2.083333333333333 +3025.7687714031754 +pi = 3.1659792728432152 + +pi = 3.181104885577714 +pi = 3.181104885577714 + +10.0 +100.0 +2.083333333333333 +3025.7687714031754 +pi = 3.1659792728432152 +pi = 3.181104885577714 +pi = 3.181104885577714 + +1.5 +1.4166666666666665 +1.4142156862745097 +1.4142135623746899 +sqrt(2) = 1.4142135623746899 + +1.5 +1.4166666666666665 +1.4142156862745097 +1.4142135623746899 +sqrt(2) = 1.4142135623746899 + +1 + 2 + .. + 5 = 15.0 +1 * 2 * .. * 5 = 120.0 + +1^2 + 2^2 + .. + 5^2 = 55.0 +1^2 * 2^2 * .. * 5^2 = 14400.0 + +factorial(0) = 1.0 +factorial(1) = 1.0 +factorial(2) = 2.0 +factorial(3) = 6.0 +factorial(4) = 24.0 +factorial(5) = 120.0 + +1 + 2 + .. + 5 = 15.0 +1 * 2 * .. * 5 = 120.0 + +1^2 + 2^2 + .. + 5^2 = 55.0 +1^2 * 2^2 * .. * 5^2 = 14400.0 + +factorial(0) = 1.0 +factorial(1) = 1.0 +factorial(2) = 2.0 +factorial(3) = 6.0 +factorial(4) = 24.0 +factorial(5) = 120.0 + +1 + 2 + .. + 5 = 15.0 +1 * 2 * .. * 5 = 120.0 + +1^2 + 2^2 + .. + 5^2 = 55.0 +1^2 * 2^2 * .. * 5^2 = 14400.0 + +factorial(0) = 1.0 +factorial(1) = 1.0 +factorial(2) = 2.0 +factorial(3) = 6.0 +factorial(4) = 24.0 +factorial(5) = 120.0 + +fib(0) = 0 +fib(1) = 1 +fib(2) = 1 +fib(3) = 2 +fib(4) = 3 +fib(5) = 5 +fib(6) = 8 +fib(7) = 13 +fib(8) = 21 +fib(9) = 34 +fib(0) = 0 +fib(1) = 1 +fib(2) = 1 +fib(3) = 2 +fib(4) = 3 +fib(5) = 5 +fib(6) = 8 +fib(7) = 13 +fib(8) = 21 +fib(9) = 34 +power(0,0) = 1.0 +power(0,1) = 0.0 +power(0,2) = 0.0 +power(0,3) = 0.0 +power(0,4) = 0.0 +power(0,5) = 0.0 +power(0,6) = 0.0 +power(0,7) = 0.0 +power(0,8) = 0.0 + +power(1,0) = 1.0 +power(1,1) = 1.0 +power(1,2) = 1.0 +power(1,3) = 1.0 +power(1,4) = 1.0 +power(1,5) = 1.0 +power(1,6) = 1.0 +power(1,7) = 1.0 +power(1,8) = 1.0 + +power(2,0) = 1.0 +power(2,1) = 2.0 +power(2,2) = 4.0 +power(2,3) = 8.0 +power(2,4) = 16.0 +power(2,5) = 32.0 +power(2,6) = 64.0 +power(2,7) = 128.0 +power(2,8) = 256.0 + +power(3,0) = 1.0 +power(3,1) = 3.0 +power(3,2) = 9.0 +power(3,3) = 27.0 +power(3,4) = 81.0 +power(3,5) = 243.0 +power(3,6) = 729.0 +power(3,7) = 2187.0 +power(3,8) = 6561.0 + +power(4,0) = 1.0 +power(4,1) = 4.0 +power(4,2) = 16.0 +power(4,3) = 64.0 +power(4,4) = 256.0 +power(4,5) = 1024.0 +power(4,6) = 4096.0 +power(4,7) = 16384.0 +power(4,8) = 65536.0 + +power(5,0) = 1.0 +power(5,1) = 5.0 +power(5,2) = 25.0 +power(5,3) = 125.0 +power(5,4) = 625.0 +power(5,5) = 3125.0 +power(5,6) = 15625.0 +power(5,7) = 78125.0 +power(5,8) = 390625.0 + diff --git a/test/files/run/Course-2002-02.scala b/test/files/run/Course-2002-02.scala new file mode 100644 index 0000000000..435b84484f --- /dev/null +++ b/test/files/run/Course-2002-02.scala @@ -0,0 +1,550 @@ +//############################################################################ +// Programmation IV - 2002 - Week 02 +//############################################################################ +// $Id$ + +object M0 { + def gcd(a: Int, b: Int): Int = if (b == 0) a else gcd(b, a % b); + def factorial(n: Int): Int = if (n == 0) 1 else n * factorial(n - 1); + + Console.println(gcd(14,21)); + Console.println(factorial(5)); + Console.println; +} + +//############################################################################ + +object M1 { + def cube(x: Int): Double = x * x * x; + + def sumInts(a: Int, b: Int): Double = if (a > b) 0 + else a + sumInts(a + 1, b); + + def sumCubes(a: Int, b: Int): Double = if (a > b) 0 + else cube(a) + sumCubes(a + 1, b); + + def sumReciprocals(a: Int, b: Int): Double = if (a > b) 0 + else 1.0/a + sumReciprocals(a + 1, b); + + def sumPi(n: Int): Double = { + def element(x: Int): Double = 4.0/(4*x+1) - 4.0/(4*x-1); + def sumElements(a: Int, b: Int): Double = + if (a > b) 0 + else element(a) + sumElements(a + 1, b); + 4 + sumElements(1,n) + } + + Console.println(sumInts(1,4)); + Console.println(sumCubes(1,4)); + Console.println(sumReciprocals(1,4)); + Console.println(sumCubes(1, 10) + sumReciprocals(10, 20)); + Console.println("pi = " + sumPi(20)); + Console.println; +} + +//############################################################################ + +object M2 { + def id(x: Int): Double = x; + def cube(x: Int): Double = x * x * x; + def reciprocal(x: Int): Double = 1.0/x; + + def sum(f: Int => Double, a: Int, b: Int): Double = + if (a > b) 0 + else f(a) + sum(f, a + 1, b); + + def sumInts(a: Int, b: Int): Double = sum(id, a, b); + def sumCubes(a: Int, b: Int): Double = sum(cube, a, b); + def sumReciprocals(a: Int, b: Int): Double = sum(reciprocal, a, b); + def sumPi(n: Int): Double = { + def element(x: Int): Double = 4.0/(4*x+1) - 4.0/(4*x-1); + 4 + sum(element, 1, n) + } + + Console.println(sumInts(1,4)); + Console.println(sumCubes(1,4)); + Console.println(sumReciprocals(1,4)); + Console.println(sumCubes(1, 10) + sumReciprocals(10, 20)); + Console.println("pi = " + sumPi(20)); + Console.println; +} + +//############################################################################ + +object M3 { + def sum(f: Int => Double, a: Int, b: Int): Double = + if (a > b) 0 + else f(a) + sum(f, a + 1, b); + + def sumInts(a: Int, b: Int): Double = sum((xXXXXX => xXXXXX), a, b); + def sumCubes(a: Int, b: Int): Double = sum((x => x * x * x), a, b); + def sumReciprocals(a: Int, b: Int): Double = sum((x => 1.0/x), a, b); + def sumPi(n: Int): Double = 4 + sum((x => 4.0/(4*x+1) - 4.0/(4*x-1)), 1, n); + + Console.println(sumInts(1,4)); + Console.println(sumCubes(1,4)); + Console.println(sumReciprocals(1,4)); + Console.println(sumCubes(1, 10) + sumReciprocals(10, 20)); + Console.println("pi = " + sumPi(20)); + Console.println; +} + +//############################################################################ + +object M4 { + def sum(f: Int => Double): (Int, Int) => Double = { + def sumF(a: Int, b: Int): Double = + if (a > b) 0 + else f(a) + sumF(a + 1, b); + sumF + } + + def sumInts = sum(x => x); + def sumCubes = sum(x => x * x * x); + def sumReciprocals = sum(x => 1.0/x); + def sumPi = (n: Int => 4 + sum(x => 4.0/(4*x+1) - 4.0/(4*x-1))(1, n)); + + Console.println(sumInts(1,4)); + Console.println(sumCubes(1,4)); + Console.println(sumReciprocals(1,4)); + Console.println(sumCubes(1, 10) + sumReciprocals(10, 20)); + Console.println("pi = " + sumPi(20)); + Console.println; +} + +//############################################################################ + +object M5 { + def sum(f: Int => Double): (Int, Int) => Double = { (a, b) => + if (a > b) 0 + else f(a) + sum(f)(a + 1, b) + } + + def sumInts = sum(x => x); + def sumCubes = sum(x => x * x * x); + def sumReciprocals = sum(x => 1.0/x); + def sumPi = (n: Int => 4 + sum(x => 4.0/(4*x+1) - 4.0/(4*x-1))(1, n)); + + Console.println(sumInts(1,4)); + Console.println(sumCubes(1,4)); + Console.println(sumReciprocals(1,4)); + Console.println(sumCubes(1, 10) + sumReciprocals(10, 20)); + Console.println("pi = " + sumPi(20)); + Console.println; +} + +//############################################################################ + +object M6 { + def sum(f: Int => Double)(a: Int, b: Int): Double = + if (a > b) 0 + else f(a) + sum(f)(a + 1, b); + + def sumInts: (Int, Int) => Double = sum(x => x); + def sumCubes: (Int, Int) => Double = sum(x => x * x * x); + def sumReciprocals: (Int, Int) => Double = sum(x => 1.0/x); + def sumPi = (n: Int => 4 + sum(x => 4.0/(4*x+1) - 4.0/(4*x-1))(1, n)); + + Console.println(sumInts(1,4)); + Console.println(sumCubes(1,4)); + Console.println(sumReciprocals(1,4)); + Console.println(sumCubes(1, 10) + sumReciprocals(10, 20)); + Console.println("pi = " + sumPi(20)); + Console.println; +} + +//############################################################################ + +object M7 { + def sum(f: Int => Double)(a: Int, b: Int): Double = { + def iter(a: Int, result: Double): Double = + if (a > b) result + else iter(a + 1, f(a) + result); + iter(a, 0) + } + + def sumInts: (Int, Int) => Double = sum(x => x); + def sumCubes: (Int, Int) => Double = sum(x => x * x * x); + def sumReciprocals: (Int, Int) => Double = sum(x => 1.0/x); + def sumPi = (n: Int => 4 + sum(x => 4.0/(4*x+1) - 4.0/(4*x-1))(1, n)); + + Console.println(sumInts(1,4)); + Console.println(sumCubes(1,4)); + Console.println(sumReciprocals(1,4)); + Console.println(sumCubes(1, 10) + sumReciprocals(10, 20)); + Console.println("pi = " + sumPi(20)); + Console.println; +} + +//############################################################################ + +object M8 { + def product(f: Int => Double)(a: Int, step: Int, b: Int): Double = + if (a > b) 1 + else f(a) * product(f)(a + step, step, b); + + def productPi = (n: Int => product(x=>4.0*x*x/(2*x-1)/(2*x-1))(1,1,n)/n); + + val pi = 2 * product(x => x * x)(2, 2, 40) / product(x => x * x)(1, 2,40)/40; + + Console.println("pi = " + productPi(20)); + Console.println("pi = " + pi); + Console.println; +} + +//############################################################################ + +object M9 { + def accumulate[t](combiner: (t, t) => t, nullValue: t, f: Int => t, + next: Int => Int)(a: Int, b: Int): t = if (a > b) nullValue + else combiner(f(a), accumulate(combiner, nullValue, f, next)(next(a), b)); + + def inc(x: Int) = x + 1; + + def sum(f: Int => Double): (Int, Int) => Double = accumulate((x: Double, y: Double) => x + y, + 0d, f, inc); + def product(f: Int => Double): (Int, Int) => Double = accumulate((x: Double, y: Double) => x * y, + 1d, f, inc); + + def sumInts = sum(x => x); + def sumCubes = sum(x => x * x * x); + def sumReciprocals = sum(x => 1.0/x); + def sumPi = (n: Int => 4 + sum(x => 4.0/(4*x+1) - 4.0/(4*x-1))(1, n)); + + def productPi = (n: Int => product(x=>4.0*x*x/(2*x-1)/(2*x-1))(1,n)/n); + + val pi = 2*product(x => 2*x*2*x)(1,20)/product(x =>(2*x-1)*(2*x-1))(1,20)/40; + + Console.println(sumInts(1,4)); + Console.println(sumCubes(1,4)); + Console.println(sumReciprocals(1,4)); + Console.println(sumCubes(1, 10) + sumReciprocals(10, 20)); + Console.println("pi = " + sumPi(20)); + Console.println("pi = " + productPi(20)); + Console.println("pi = " + pi); + Console.println; +} + +//############################################################################ + +object MA { + val tolerance = 0.0001; + def abs(x: Double) = if (x < 0) -x else x; + def isCloseEnough(x: Double, y: Double) = abs((x - y) / x) < tolerance; + def fixedPoint(f: Double => Double)(firstGuess: Double) = { + def iterate(guess: Double): Double = { + val next = f(guess); + Console.println(next); + if (isCloseEnough(guess, next)) next + else iterate(next) + } + iterate(firstGuess) + } + def sqrt(x: Double) = fixedPoint(y => (y + x / y) / 2)(1.0); + + Console.println("sqrt(2) = " + sqrt(2)); + Console.println +} + +//############################################################################ + +object MB { + val tolerance = 0.0001; + def abs(x: Double) = if (x < 0) -x else x; + def isCloseEnough(x: Double, y: Double) = abs((x - y) / x) < tolerance; + def fixedPoint(f: Double => Double)(firstGuess: Double) = { + def iterate(guess: Double): Double = { + val next = f(guess); + Console.println(next); + if (isCloseEnough(guess, next)) next + else iterate(next) + } + iterate(firstGuess) + } + def averageDamp(f: Double => Double)(x: Double) = (x + f(x)) / 2; + def sqrt(x: Double) = fixedPoint(averageDamp(y => x/y))(1.0); + + Console.println("sqrt(2) = " + sqrt(2)); + Console.println +} + +//############################################################################ + +object MC { + def sum(f: Int => Double)(a: Int, b: Int): Double = { + def iter(a: Int, result: Double): Double = { + if (a > b) result + else iter(a + 1, result + f(a)) + } + iter(a, 0) + } + + def product(f: Int => Double)(a: Int, b: Int): Double = { + def iter(a: Int, result: Double): Double = { + if (a > b) result + else iter(a + 1, result * f(a)) + } + iter(a, 1) + } + + def factorial(n: Int) = product(x => x)(1 , n); + + Console.println( + "1 + 2 + .. + 5 = " + sum(x => x)(1, 5)); + Console.println( + "1 * 2 * .. * 5 = " + product(x => x)(1, 5)); + Console.println; + + Console.println( + "1^2 + 2^2 + .. + 5^2 = " + sum(x => x*x)(1, 5)); + Console.println( + "1^2 * 2^2 * .. * 5^2 = " + product(x => x*x)(1, 5)); + Console.println; + + Console.println( + "factorial(0) = " + factorial(0)); + Console.println( + "factorial(1) = " + factorial(1)); + Console.println( + "factorial(2) = " + factorial(2)); + Console.println( + "factorial(3) = " + factorial(3)); + Console.println( + "factorial(4) = " + factorial(4)); + Console.println( + "factorial(5) = " + factorial(5)); + Console.println; +} + +//############################################################################ + +object MD { + def reduce(op: (Double,Double) => Double, zero:Double)(f: Int => Double)(a: Int,b: Int): Double = { + def iter(a: Int, result: Double): Double = { + if (a > b) result + else iter(a + 1, op(result, f(a))) + } + iter(a, zero) + } + + def plus (x:Double,y:Double) = x+y; + val sum: (Int => Double) => (Int, Int) => Double = reduce(plus , 0); + def times(x:Double,y:Double) = x*y; + val product: (Int => Double) => (Int, Int) => Double = reduce(times, 1); + + def factorial(n: Int) = product(x => x)(1 , n); + + Console.println( + "1 + 2 + .. + 5 = " + sum(x => x)(1, 5)); + Console.println( + "1 * 2 * .. * 5 = " + product(x => x)(1, 5)); + Console.println; + + Console.println( + "1^2 + 2^2 + .. + 5^2 = " + sum(x => x*x)(1, 5)); + Console.println( + "1^2 * 2^2 * .. * 5^2 = " + product(x => x*x)(1, 5)); + Console.println; + + Console.println( + "factorial(0) = " + factorial(0)); + Console.println( + "factorial(1) = " + factorial(1)); + Console.println( + "factorial(2) = " + factorial(2)); + Console.println( + "factorial(3) = " + factorial(3)); + Console.println( + "factorial(4) = " + factorial(4)); + Console.println( + "factorial(5) = " + factorial(5)); + Console.println; +} + +//############################################################################ + +object ME { + def reduce(op: (Double,Double) => Double, zero:Double)(f: Int => Double)(a: Int,b: Int): Double = { + def iter(a: Int, result: Double): Double = { + if (a > b) result + else iter(a + 1, op(result, f(a))) + } + iter(a, zero) + } + + def sum: (Int => Double) => (Int, Int) => Double = reduce((x,y) => x + y, 0); + def product: (Int => Double) => (Int, Int) => Double = reduce((x,y) => x * y, 1); + + def factorial(n: Int) = product(x => x)(1 , n); + + Console.println( + "1 + 2 + .. + 5 = " + sum(x => x)(1, 5)); + Console.println( + "1 * 2 * .. * 5 = " + product(x => x)(1, 5)); + Console.println; + + Console.println( + "1^2 + 2^2 + .. + 5^2 = " + sum(x => x*x)(1, 5)); + Console.println( + "1^2 * 2^2 * .. * 5^2 = " + product(x => x*x)(1, 5)); + Console.println; + + Console.println( + "factorial(0) = " + factorial(0)); + Console.println( + "factorial(1) = " + factorial(1)); + Console.println( + "factorial(2) = " + factorial(2)); + Console.println( + "factorial(3) = " + factorial(3)); + Console.println( + "factorial(4) = " + factorial(4)); + Console.println( + "factorial(5) = " + factorial(5)); + Console.println; +} + +//############################################################################ + +object MF { + def fib(x: Int): Int = + if (x <= 1) x + else fib(x - 2) + fib(x - 1); + + Console.println("fib(0) = " + fib(0)); + Console.println("fib(1) = " + fib(1)); + Console.println("fib(2) = " + fib(2)); + Console.println("fib(3) = " + fib(3)); + Console.println("fib(4) = " + fib(4)); + Console.println("fib(5) = " + fib(5)); + Console.println("fib(6) = " + fib(6)); + Console.println("fib(7) = " + fib(7)); + Console.println("fib(8) = " + fib(8)); + Console.println("fib(9) = " + fib(9)); +} + +//############################################################################ + +object MG { + def fib(x: Int) = { + def loop(n: Int, prev: Int, fibn: Int): Int = + if (n == x) fibn + else loop(n + 1, fibn, fibn + prev); + if (x == 0) 0 else loop(1, 0, 1) + } + + Console.println("fib(0) = " + fib(0)); + Console.println("fib(1) = " + fib(1)); + Console.println("fib(2) = " + fib(2)); + Console.println("fib(3) = " + fib(3)); + Console.println("fib(4) = " + fib(4)); + Console.println("fib(5) = " + fib(5)); + Console.println("fib(6) = " + fib(6)); + Console.println("fib(7) = " + fib(7)); + Console.println("fib(8) = " + fib(8)); + Console.println("fib(9) = " + fib(9)); +} + +//############################################################################ + +object MH { + def power(x: Double, y: Int): Double = + if (y <= 0) 1 + else if (y % 2 == 0) power(x * x, y / 2) + else x * power(x, y - 1); + + + Console.println("power(0,0) = " + power(0,0)); + Console.println("power(0,1) = " + power(0,1)); + Console.println("power(0,2) = " + power(0,2)); + Console.println("power(0,3) = " + power(0,3)); + Console.println("power(0,4) = " + power(0,4)); + Console.println("power(0,5) = " + power(0,5)); + Console.println("power(0,6) = " + power(0,6)); + Console.println("power(0,7) = " + power(0,7)); + Console.println("power(0,8) = " + power(0,8)); + Console.println; + + Console.println("power(1,0) = " + power(1,0)); + Console.println("power(1,1) = " + power(1,1)); + Console.println("power(1,2) = " + power(1,2)); + Console.println("power(1,3) = " + power(1,3)); + Console.println("power(1,4) = " + power(1,4)); + Console.println("power(1,5) = " + power(1,5)); + Console.println("power(1,6) = " + power(1,6)); + Console.println("power(1,7) = " + power(1,7)); + Console.println("power(1,8) = " + power(1,8)); + Console.println; + + Console.println("power(2,0) = " + power(2,0)); + Console.println("power(2,1) = " + power(2,1)); + Console.println("power(2,2) = " + power(2,2)); + Console.println("power(2,3) = " + power(2,3)); + Console.println("power(2,4) = " + power(2,4)); + Console.println("power(2,5) = " + power(2,5)); + Console.println("power(2,6) = " + power(2,6)); + Console.println("power(2,7) = " + power(2,7)); + Console.println("power(2,8) = " + power(2,8)); + Console.println; + + Console.println("power(3,0) = " + power(3,0)); + Console.println("power(3,1) = " + power(3,1)); + Console.println("power(3,2) = " + power(3,2)); + Console.println("power(3,3) = " + power(3,3)); + Console.println("power(3,4) = " + power(3,4)); + Console.println("power(3,5) = " + power(3,5)); + Console.println("power(3,6) = " + power(3,6)); + Console.println("power(3,7) = " + power(3,7)); + Console.println("power(3,8) = " + power(3,8)); + Console.println; + + Console.println("power(4,0) = " + power(4,0)); + Console.println("power(4,1) = " + power(4,1)); + Console.println("power(4,2) = " + power(4,2)); + Console.println("power(4,3) = " + power(4,3)); + Console.println("power(4,4) = " + power(4,4)); + Console.println("power(4,5) = " + power(4,5)); + Console.println("power(4,6) = " + power(4,6)); + Console.println("power(4,7) = " + power(4,7)); + Console.println("power(4,8) = " + power(4,8)); + Console.println; + + Console.println("power(5,0) = " + power(5,0)); + Console.println("power(5,1) = " + power(5,1)); + Console.println("power(5,2) = " + power(5,2)); + Console.println("power(5,3) = " + power(5,3)); + Console.println("power(5,4) = " + power(5,4)); + Console.println("power(5,5) = " + power(5,5)); + Console.println("power(5,6) = " + power(5,6)); + Console.println("power(5,7) = " + power(5,7)); + Console.println("power(5,8) = " + power(5,8)); + Console.println; +} + +//############################################################################ + +object Test { + def main(args: Array[String]): Unit = { + M0; + M1; + M2; + M3; + M4; + M5; + M6; + M7; + M8; + M9; + MA; + MB; + MC; + MD; + ME; + MF; + MG; + MH; + () + } +} + +//############################################################################ diff --git a/test/files/run/Course-2002-03.check b/test/files/run/Course-2002-03.check new file mode 100644 index 0000000000..01b9977d39 --- /dev/null +++ b/test/files/run/Course-2002-03.check @@ -0,0 +1,67 @@ +1 +2 +1/2 +5/6 + +1/3 +5/7 +3/2 +66/42 + +1/3 +5/7 +3/2 +11/7 + +11/7 +7/11 +11/7 +11/7 + +13/36 + +false +true +true +false + +set0 = [] +set1 = [1] +set2 = [1,2] +set3 = [1,2,3] +set4 = [1,2,3,4] + +set2 contains the following elements: +1 +2 + +set3 contains the following elements: +1 +2 +3 + +set4 contains the following elements: +1 +2 +3 +4 + +2 <- set2: true +3 <- set2: false + +setx = [-10,-1,0,3,5,21] +setx * 2 = [-20,-2,0,6,10,42] + +setx = [-10,-1,0,3,5,21] +sety = [-9,-5,-1,0,3,7,8] +setx & sety = [-1,0,3] +sety & setx = [-1,0,3] +setx > 0 = [3,5,21] +sety > 0 = [3,7,8] +setx & sety = [-1,0,3] +sety & setx = [-1,0,3] + +1/1 +1/1 +1/1 + diff --git a/test/files/run/Course-2002-03.scala b/test/files/run/Course-2002-03.scala new file mode 100644 index 0000000000..7933514f9a --- /dev/null +++ b/test/files/run/Course-2002-03.scala @@ -0,0 +1,392 @@ +//############################################################################ +// Programmation IV - 2002 - Week 03 +//############################################################################ +// $Id$ + +object M0 { + class Rational(x: Int, y: Int) { + def numer = x; + def denom = y; + } + + def addRational(r: Rational, s: Rational): Rational = + new Rational( + r.numer * s.denom + s.numer * r.denom, + r.denom * s.denom); + + def makeString(r: Rational) = + r.numer + "/" + r.denom; + + val x = new Rational(1, 2); + val y = new Rational(1, 3); + Console.println(x.numer); + Console.println(x.denom); + Console.println(makeString(x)); + Console.println(makeString(addRational(x,y))); + Console.println; +} + +//############################################################################ + +object M1 { + class Rational(x: Int, y: Int) { + def numer = x; + def denom = y; + def add(r: Rational) = + new Rational( + numer * r.denom + r.numer * denom, + denom * r.denom); + def mul(r: Rational) = + new Rational( + numer * r.numer, + denom * r.denom); + override def toString() = numer + "/" + denom; + } + + val x = new Rational(1, 3); + val y = new Rational(5, 7); + val z = new Rational(3, 2); + Console.println(x); + Console.println(y); + Console.println(z); + Console.println(x.add(y).mul(z)); + Console.println; +} + +//############################################################################ + +object M2 { + class Rational(x: Int, y: Int) { + private def gcd(a: Int, b: Int): Int = if (b == 0) a else gcd(b, a % b); + private val g = gcd(x, y); + def numer = x / g; + def denom = y / g; + def add(r: Rational) = + new Rational( + numer * r.denom + r.numer * denom, + denom * r.denom); + def sub(r: Rational) = + new Rational( + numer * r.denom - r.numer * denom, + denom * r.denom); + def mul(r: Rational) = + new Rational( + numer * r.numer, + denom * r.denom); + def div(r: Rational) = + new Rational( + numer * r.denom, + denom * r.numer); + override def toString() = numer + "/" + denom; + } + + val x = new Rational(1, 3); + val y = new Rational(5, 7); + val z = new Rational(3, 2); + Console.println(x); + Console.println(y); + Console.println(z); + Console.println(x.add(y).mul(z)); + Console.println; +} + +//############################################################################ + +object M3 { + class Rational(x: Int, y: Int) { + private def gcd(a: Int, b: Int): Int = if (b == 0) a else gcd(b, a % b); + def numer = x / gcd(x, y); + def denom = y / gcd(x, y); + def less(that: Rational) = + this.numer * that.denom < that.numer * this.denom; + def max(that: Rational) = if (this.less(that)) that else this; + override def toString() = numer + "/" + denom; + } + + val x = new Rational(66, 42); + val y = new Rational(42, 66); + Console.println(x); + Console.println(y); + Console.println(x.max(y)); + Console.println(y.max(x)); + Console.println; +} + +//############################################################################ + +object M4 { + class Rational(x: Int, y: Int) { + private def gcd(a: Int, b: Int): Int = if (b == 0) a else gcd(b, a % b); + private val g = gcd(x, y); + def numer = x / g; + def denom = y / g; + def + (r: Rational) = + new Rational( + numer * r.denom + r.numer * denom, + denom * r.denom); + def - (r: Rational) = + new Rational( + numer * r.denom - r.numer * denom, + denom * r.denom); + def * (r: Rational) = + new Rational( + numer * r.numer, + denom * r.denom); + def / (r: Rational) = + new Rational( + numer * r.denom, + denom * r.numer); + override def toString() = numer + "/" + denom; + } + + val x = new Rational(1, 2); + val y = new Rational(1, 3); + Console.println(x * x + y * y); + Console.println; +} + +//############################################################################ + +object M5 { + trait IntSet { + def incl(x: Int): IntSet; + def contains(x: Int): Boolean; + } + + class Empty extends IntSet { + def contains(x: Int): Boolean = false; + def incl(x: Int): IntSet = new NonEmpty(x, new Empty, new Empty); + } + + class NonEmpty(elem: Int, left: IntSet, right: IntSet) extends IntSet { + def contains(x: Int): Boolean = + if (x < elem) left contains x + else if (x > elem) right contains x + else true; + def incl(x: Int): IntSet = + if (x < elem) new NonEmpty(elem, left incl x, right) + else if (x > elem) new NonEmpty(elem, left, right incl x) + else this; + } + + val x = new Empty incl 1 incl 2; + Console.println(x contains 0); + Console.println(x contains 1); + Console.println(x contains 2); + Console.println(x contains 3); + Console.println; +} + +//############################################################################ + +object M6 { + trait Boolean { + def ifThenElse[a](t: => a)(e: => a): a; + + def ! : Boolean = ifThenElse[Boolean](new False())(new True()); + + def && (x: => Boolean): Boolean = ifThenElse[Boolean](x)(new False()); + def || (x: => Boolean): Boolean = ifThenElse[Boolean](new True())(x); + + // !!! def == (x: Boolean): Boolean = ifThenElse[Boolean](x)(x.!); + // !!! def != (x: Boolean): Boolean = ifThenElse[Boolean](x.!)(x); + def < (x: Boolean): Boolean = ifThenElse[Boolean](new False())(x); + def > (x: Boolean): Boolean = ifThenElse[Boolean](x.!)(new False()); + def <= (x: Boolean): Boolean = ifThenElse[Boolean](x)(new True()); + def >= (x: Boolean): Boolean = ifThenElse[Boolean](new True())(x.!); + } + class True() extends Boolean { // !!! class -> object + def ifThenElse[a](t: => a)(e: => a): a = t } + class False() extends Boolean { // !!! class -> object + def ifThenElse[a](t: => a)(e: => a): a = e } +} + +//############################################################################ + +object M7 { + trait Nat { + def isZero(): Boolean; + def predecessor: Nat; + def successor: Nat; + def + (that: Nat): Nat; + def - (that: Nat): Nat; + } +} + +//############################################################################ + +object M8 { + + trait IntSet { + def incl(x: Int): IntSet; + def contains(x: Int): Boolean; + def map(f: Int => Int): IntSet; + + def foreach(f: Int => Unit): Unit; + def intersect0(that: IntSet, accu: IntSet): IntSet; + def filter0(f: Int => Boolean, accu: IntSet): IntSet; + + def intersect(that: IntSet): IntSet = intersect0(that, new Empty); + def intersect2(that: IntSet): IntSet = filter(x => that.contains(x)); + def filter(f: Int => Boolean): IntSet = filter0(f, new Empty); + + def printOn(out: java.io.PrintStream) = foreach(out.println); + + override def toString(): String = { + val buffer: java.lang.StringBuffer = new java.lang.StringBuffer(); + buffer.append('['); + foreach(i => { + if (buffer.length() > 1) {buffer.append(','); ()}; // !!! ; () + buffer.append(i); + ()}); + buffer.append(']'); + buffer.toString(); + } + } + + class Empty extends IntSet { // !!! class Empty() -> object Empty + def contains(x: Int): Boolean = false; + def incl(x: Int): IntSet = new NonEmpty(x, new Empty, new Empty); + def map(f: Int => Int): IntSet = this; + + def foreach(f: Int => Unit): Unit = (); + def intersect0(that: IntSet, accu: IntSet): IntSet = accu; + def filter0(f: Int => Boolean, accu: IntSet): IntSet = accu; + } + + class NonEmpty(elem: Int, left: IntSet, right: IntSet) extends IntSet { + def contains(x: Int): Boolean = + if (x < elem) left contains x + else if (x > elem) right contains x + else true; + + def incl(x: Int): IntSet = + if (x < elem) new NonEmpty(elem, left incl x, right) + else if (x > elem) new NonEmpty(elem, left, right incl x) + else this; + + + def map(f: Int => Int): IntSet = { + val lset = left.map(f); + val rset = right.map(f); + new NonEmpty(f(elem), lset, rset) + } + + def foreach(f: Int => Unit): Unit = { + left.foreach(f); + f(elem); + right.foreach(f); + } + + def intersect0(that: IntSet, accu: IntSet): IntSet = + right.intersect0(that, left.intersect0(that, + if (that.contains(elem)) accu.incl(elem) else accu)); + + def filter0(f: Int => Boolean, accu: IntSet): IntSet = + right.filter0(f, left.filter0(f, + if (f(elem)) accu.incl(elem) else accu)); + } + + def test = { + val set0: IntSet = new Empty; + val set1: IntSet = new Empty incl 1; + val set2: IntSet = new Empty incl 1 incl 2; + val set3: IntSet = new Empty incl 1 incl 2 incl 3; + val set4: IntSet = new Empty incl 1 incl 2 incl 3 incl 4; + val setx: IntSet = set0 incl -10 incl 5 incl 21 incl -1 incl 0 incl 3; + val sety: IntSet = set0 incl 3 incl 7 incl -5 incl 0 incl-9 incl 8 incl-1; + + Console.println("set0 = " + set0); + Console.println("set1 = " + (set1.toString())); + Console.println("set2 = " + set2); + Console.println("set3 = " + (set3.toString())); + Console.println("set4 = " + set4); + Console.println; + + Console.println("set2 contains the following elements:"); + set2.foreach(Console.println); + Console.println; + + Console.println("set3 contains the following elements:"); + set3 foreach Console.println; + Console.println; + + Console.println("set4 contains the following elements:"); + set4.printOn(java.lang.System.out); + Console.println; + + Console.println("2 <- set2: " + (set2 contains 2)); + Console.println("3 <- set2: " + set2.contains(3)); + Console.println; + + Console.println("setx = " + setx); + Console.println("setx * 2 = " + (setx.map(x => 2 * x))); + Console.println; + + Console.println("setx = " + setx); + Console.println("sety = " + sety); + Console.println("setx & sety = " + (setx.intersect(sety))); + Console.println("sety & setx = " + (sety.intersect(setx))); + Console.println("setx > 0 = " + (setx.filter(x => x > 0))); + Console.println("sety > 0 = " + (sety.filter(x => x > 0))); + Console.println("setx & sety = " + (setx.intersect2(sety))); + Console.println("sety & setx = " + (sety.intersect2(setx))); + Console.println; + } +} + +//############################################################################ + +object M9 { + class Rational(x: Int, y: Int) { + private def gcd(a: Int, b: Int): Int = if (b == 0) a else gcd(b, a % b); + private val g = gcd(x, y); + def numer = x / g; + def denom = y / g; + def add(r: Rational) = + new Rational( + numer * r.denom + r.numer * denom, + denom * r.denom); + def sub(r: Rational) = + new Rational( + numer * r.denom - r.numer * denom, + denom * r.denom); + def mul(r: Rational) = + new Rational( + numer * r.numer, + denom * r.denom); + def equal(r: Rational) = + new Rational( + numer * r.denom, + denom * r.numer); + def asString = numer.toString().concat("/").concat(denom.toString()); + override def toString() = asString; + } + + def test = { + Console.println(new Rational(2,2).asString); + Console.println(new Rational(2,2).toString()); + Console.println(new Rational(2,2)); + Console.println; + } +} + +//############################################################################ + +object Test { + def main(args: Array[String]): Unit = { + M0; + M1; + M2; + M3; + M4; + M5; + M6; + M7; + M8.test; + M9.test; + () + } +} + +//############################################################################ diff --git a/test/files/run/Course-2002-04.check b/test/files/run/Course-2002-04.check new file mode 100644 index 0000000000..bf4218fb32 --- /dev/null +++ b/test/files/run/Course-2002-04.check @@ -0,0 +1,64 @@ +list0 = List(6,3,1,8,7,1,2,5,8,4,3,4,8) +list1 = List(1,1,2,3,3,4,4,5,6,7,8,8,8) +list2 = List(1,1,2,3,3,4,4,5,6,7,8,8,8) +list3 = List(1,1,2,3,3,4,4,5,6,7,8,8,8) +list4 = List(1,1,2,3,3,4,4,5,6,7,8,8,8) +list5 = List(8,8,8,7,6,5,4,4,3,3,2,1,1) +list6 = List(8,8,8,7,6,5,4,4,3,3,2,1,1) + +list0: List() -> List() +list1: List(0) -> List(0) +list2: List(0,1) -> List(0,1) +list3: List(1,0) -> List(0,1) +list4: List(0,1,2) -> List(0,1,2) +list5: List(1,0,2) -> List(0,1,2) +list6: List(0,1,2) -> List(0,1,2) +list7: List(1,0,2) -> List(0,1,2) +list8: List(2,0,1) -> List(0,1,2) +list9: List(2,1,0) -> List(0,1,2) +listA: List(6,3,1,8,7,1,2,5,8,4) -> List(1,1,2,3,4,5,6,7,8,8) + +f(x) = 5x^3+7x^2+5x+9 +f(0) = 9.0 +f(1) = 26.0 +f(2) = 87.0 +f(3) = 222.0 + +v1 = List(2.0,3.0,4.0) +v2 = List(6.0,7.0,8.0) + +id = List(List(1.0,0.0,0.0),List(0.0,1.0,0.0),List(0.0,0.0,1.0)) +m1 = List(List(2.0,0.0,0.0),List(0.0,2.0,0.0),List(0.0,0.0,2.0)) +m2 = List(List(1.0,2.0,3.0),List(4.0,5.0,6.0),List(7.0,8.0,9.0)) + +v1 * v1 = 29.0 +v1 * v2 = 65.0 +v2 * v1 = 65.0 +v1 * v2 = 65.0 + +id * v1 = List(2.0,3.0,4.0) +m1 * v1 = List(4.0,6.0,8.0) +m2 * v1 = List(20.0,47.0,74.0) + +trn(id) = List(List(1.0,0.0,0.0),List(0.0,1.0,0.0),List(0.0,0.0,1.0)) +trn(m1) = List(List(2.0,0.0,0.0),List(0.0,2.0,0.0),List(0.0,0.0,2.0)) +trn(m2) = List(List(1.0,4.0,7.0),List(2.0,5.0,8.0),List(3.0,6.0,9.0)) + +List(v1) * id = List(List(2.0,3.0,4.0)) +List(v1) * m1 = List(List(4.0,6.0,8.0)) +List(v1) * m2 = List(List(42.0,51.0,60.0)) + +id * List(v1) = List(List(2.0,3.0,4.0),List(0.0,0.0,0.0),List(0.0,0.0,0.0)) +m1 * List(v1) = List(List(4.0,6.0,8.0),List(0.0,0.0,0.0),List(0.0,0.0,0.0)) +m2 * List(v1) = List(List(2.0,3.0,4.0),List(8.0,12.0,16.0),List(14.0,21.0,28.0)) + +id * id = List(List(1.0,0.0,0.0),List(0.0,1.0,0.0),List(0.0,0.0,1.0)) +id * m1 = List(List(2.0,0.0,0.0),List(0.0,2.0,0.0),List(0.0,0.0,2.0)) +m1 * id = List(List(2.0,0.0,0.0),List(0.0,2.0,0.0),List(0.0,0.0,2.0)) +m1 * m1 = List(List(4.0,0.0,0.0),List(0.0,4.0,0.0),List(0.0,0.0,4.0)) +id * m2 = List(List(1.0,2.0,3.0),List(4.0,5.0,6.0),List(7.0,8.0,9.0)) +m2 * id = List(List(1.0,2.0,3.0),List(4.0,5.0,6.0),List(7.0,8.0,9.0)) +m1 * m2 = List(List(2.0,4.0,6.0),List(8.0,10.0,12.0),List(14.0,16.0,18.0)) +m2 * m1 = List(List(2.0,4.0,6.0),List(8.0,10.0,12.0),List(14.0,16.0,18.0)) +m2 * m2 = List(List(30.0,36.0,42.0),List(66.0,81.0,96.0),List(102.0,126.0,150.0)) + diff --git a/test/files/run/Course-2002-04.scala b/test/files/run/Course-2002-04.scala new file mode 100644 index 0000000000..48d14d9125 --- /dev/null +++ b/test/files/run/Course-2002-04.scala @@ -0,0 +1,245 @@ +//############################################################################ +// Programmation IV - 2002 - Week 04 +//############################################################################ +// $Id$ + +object M0 { + + def quicksort[a] (less : (a,a) => Boolean) (xs : List[a]) : List[a] = { + if (xs.isEmpty) + xs + else { + val pivot : a = xs.head; + val smaller : List[a] = + quicksort(less)(xs.tail.filter(elem => less(elem, pivot))); + val greaterOrEqual : List[a] = + quicksort(less)(xs.tail.filter(elem => !less(elem, pivot))); + smaller ::: List(pivot) ::: greaterOrEqual + } + } + + def test = { + val isort: List[Int] => List[Int] = quicksort[Int]((x,y) => x < y); + val list0 = List(6,3,1,8,7,1,2,5,8,4,3,4,8); + val list1 = quicksort[Int]((x,y) => x < y)(list0); + val list2 = quicksort[Int]((x,y) => x < y)(list1); + val list3 = isort(list0); + val list4 = isort(list1); + val list5 = quicksort[Int]((x,y) => x >= y)(list0); + val list6 = quicksort[Int]((x,y) => x >= y)(list1); + + Console.println("list0 = " + list0); + Console.println("list1 = " + list1); + Console.println("list2 = " + list2); + Console.println("list3 = " + list3); + Console.println("list4 = " + list4); + Console.println("list5 = " + list5); + Console.println("list6 = " + list6); + Console.println; + } +} + +//############################################################################ + +object M1 { + + def mergesort[a] (less : (a,a) => Boolean) (xs: Array[a]): Unit = { + + def While(c: => Boolean)(b: => Unit): Unit = + if (c) { b ; While(c)(b) } else (); + + def swap(i: Int, j: Int): Unit = { + val t = xs(i); + val u = xs(j); + xs(i) = u; + xs(j) = t; + } + + def sort1(l: Int, r: Int): Unit = { + val pivot = xs((l + r) / 2); + var i = l; + var j = r; + While (i <= j) { + While (less(xs(i), pivot)) { i = i + 1 } + While (less(pivot, xs(j))) { j = j - 1 } + if (i <= j) { + swap(i, j); + i = i + 1; + j = j - 1; + } + } + if (l < j) sort1(l, j); + if (j < r) sort1(i, r); + } + + if (xs.length > 0) sort1(0, xs.length - 1); + } + + def list2array(list: List[Int]): Array[Int] = { + val array = new Array[Int](list.length); + list.copyToArray(array, 0); + array; + } + + def array2list(array: Array[Int]): List[Int] = { + var list = List[Int](); + List.range(0, array.length).map(i => list = array(i) :: list); + list.reverse; + } + + def isort(list: List[Int]): List[Int] = { + val array = list2array(list); + mergesort[Int]((x,y) => x < y)(array); + array2list(array); + } + + def test = { + val list0 = List(); + val list1 = List(0); + val list2 = List(0,1); + val list3 = List(1,0); + val list4 = List(0,1,2); + val list5 = List(1,0,2); + val list6 = List(0,1,2); + val list7 = List(1,0,2); + val list8 = List(2,0,1); + val list9 = List(2,1,0); + val listA = List(6,3,1,8,7,1,2,5,8,4); + + Console.println("list0: " + list0 + " -> " + isort(list0)); + Console.println("list1: " + list1 + " -> " + isort(list1)); + Console.println("list2: " + list2 + " -> " + isort(list2)); + Console.println("list3: " + list3 + " -> " + isort(list3)); + Console.println("list4: " + list4 + " -> " + isort(list4)); + Console.println("list5: " + list5 + " -> " + isort(list5)); + Console.println("list6: " + list6 + " -> " + isort(list6)); + Console.println("list7: " + list7 + " -> " + isort(list7)); + Console.println("list8: " + list8 + " -> " + isort(list8)); + Console.println("list9: " + list9 + " -> " + isort(list9)); + Console.println("listA: " + listA + " -> " + isort(listA)); + Console.println; + } + +} + +//############################################################################ + +object M2 { + + def horner (x : Double, coefs : List[Double]) : Double = { + if (coefs.isEmpty) + 0 + else + horner(x, coefs.tail) * x + coefs.head + } + + def test = { + val poly = List(9.0,5.0,7.0,5.0); + Console.println("f(x) = 5x^3+7x^2+5x+9"); + Console.println("f(0) = " + horner(0, poly)); + Console.println("f(1) = " + horner(1, poly)); + Console.println("f(2) = " + horner(2, poly)); + Console.println("f(3) = " + horner(3, poly)); + Console.println; + } +} + +//############################################################################ + +object M3 { + + def dotproduct (v : List[Double], w : List[Double]) : Double = { + if (v.isEmpty) + 0 + else + (v.head * w.head) + dotproduct(v.tail, w.tail) + } + + def matrixTimesVector (m : List[List[Double]], v : List[Double]) + : List[Double] = { + m.map(row => dotproduct(row, v)) + } + + def transpose(m : List[List[Double]]) : List[List[Double]] = { + if (m.isEmpty || m.head.isEmpty) + List() + else + m.map(row => row.head) :: transpose (m.map (row => row.tail)) + } + + def matrixTimesMatrix(m1 : List[List[Double]], m2 : List[List[Double]]) + : List[List[Double]] = { + val columns = transpose(m2); + m1.map(row => matrixTimesVector(columns, row)) + } + + def test = { + val v1 = List(2.0,3.0,4.0); + val v2 = List(6.0,7.0,8.0); + def id = List(List(1.0,0.0,0.0),List(0.0,1.0,0.0),List(0.0,0.0,1.0)); + def m1 = List(List(2.0,0.0,0.0),List(0.0,2.0,0.0),List(0.0,0.0,2.0)); + def m2 = List(List(1.0,2.0,3.0),List(4.0,5.0,6.0),List(7.0,8.0,9.0)); + + def v = List(2.0,3.0,4.0); + + Console.println("v1 = " + v1); + Console.println("v2 = " + v2); + Console.println; + + Console.println("id = " + id); + Console.println("m1 = " + m1); + Console.println("m2 = " + m2); + Console.println; + + Console.println("v1 * v1 = " + dotproduct(v1,v1)); + Console.println("v1 * v2 = " + dotproduct(v1,v2)); + Console.println("v2 * v1 = " + dotproduct(v2,v1)); + Console.println("v1 * v2 = " + dotproduct(v1,v2)); + Console.println; + + Console.println("id * v1 = " + matrixTimesVector(id,v1)); + Console.println("m1 * v1 = " + matrixTimesVector(m1,v1)); + Console.println("m2 * v1 = " + matrixTimesVector(m2,v1)); + Console.println; + + Console.println("trn(id) = " + transpose(id)); + Console.println("trn(m1) = " + transpose(m1)); + Console.println("trn(m2) = " + transpose(m2)); + Console.println; + + Console.println("List(v1) * id = " + matrixTimesMatrix(List(v1),id)); + Console.println("List(v1) * m1 = " + matrixTimesMatrix(List(v1),m1)); + Console.println("List(v1) * m2 = " + matrixTimesMatrix(List(v1),m2)); + Console.println; + + Console.println("id * List(v1) = " + matrixTimesMatrix(id,List(v1))); + Console.println("m1 * List(v1) = " + matrixTimesMatrix(m1,List(v1))); + Console.println("m2 * List(v1) = " + matrixTimesMatrix(m2,List(v1))); + Console.println; + + Console.println("id * id = " + matrixTimesMatrix(id,id)); + Console.println("id * m1 = " + matrixTimesMatrix(id,m1)); + Console.println("m1 * id = " + matrixTimesMatrix(m1,id)); + Console.println("m1 * m1 = " + matrixTimesMatrix(m1,m1)); + Console.println("id * m2 = " + matrixTimesMatrix(id,m2)); + Console.println("m2 * id = " + matrixTimesMatrix(m2,id)); + Console.println("m1 * m2 = " + matrixTimesMatrix(m1,m2)); + Console.println("m2 * m1 = " + matrixTimesMatrix(m2,m1)); + Console.println("m2 * m2 = " + matrixTimesMatrix(m2,m2)); + Console.println; + } +} + +//############################################################################ + +object Test { + def main(args: Array[String]): Unit = { + M0.test; + M1.test; + M2.test; + M3.test; + () + } +} + +//############################################################################ diff --git a/test/files/run/Course-2002-05.check b/test/files/run/Course-2002-05.check new file mode 100644 index 0000000000..aa73638bcb --- /dev/null +++ b/test/files/run/Course-2002-05.check @@ -0,0 +1,44 @@ +(List(),List(1,2,3,4,5,6,7,8)) +(List(1,2,3,4),List(5,6,7,8)) +(List(1,2,3,4,5,6,7,8),List()) + +(List(),List(8,7,6,5,4,3,2,1)) +(List(4,3,2,1),List(8,7,6,5)) +(List(8,7,6,5,4,3,2,1),List()) + +(List(),List(7,2,1,5,4,3,8,6)) +(List(2,1,4,3),List(7,5,8,6)) +(List(7,2,1,5,4,3,8,6),List()) + +List(1,2,3,4,5,6,7,8) + +(List(),List(1,2,3,4,5,6,7,8)) +(List(1,2,3,4),List(5,6,7,8)) +(List(1,2,3,4,5,6,7,8),List()) + +(List(),List(8,7,6,5,4,3,2,1)) +(List(4,3,2,1),List(8,7,6,5)) +(List(8,7,6,5,4,3,2,1),List()) + +(List(),List(7,2,1,5,4,3,8,6)) +(List(2,1,4,3),List(7,5,8,6)) +(List(7,2,1,5,4,3,8,6),List()) + +List(1,2,3,4,5,6,7,8) + +List(List()) +List(List(),List(1)) +List(List(),List(2),List(1),List(1,2)) +List(List(),List(3),List(2),List(2,3),List(1),List(1,3),List(1,2),List(1,2,3)) +List(List(),List(4),List(3),List(3,4),List(2),List(2,4),List(2,3),List(2,3,4),List(1),List(1,4),List(1,3),List(1,3,4),List(1,2),List(1,2,4),List(1,2,3),List(1,2,3,4)) + +queens(1) = List(List((1,1))) +queens(2) = List() +queens(3) = List() +queens(4) = List(List((4,3),(3,1),(2,4),(1,2)),List((4,2),(3,4),(2,1),(1,3))) + +queens(1) = List(List(1)) +queens(2) = List() +queens(3) = List() +queens(4) = List(List(3,1,4,2),List(2,4,1,3)) + diff --git a/test/files/run/Course-2002-05.scala b/test/files/run/Course-2002-05.scala new file mode 100644 index 0000000000..c761f88f5d --- /dev/null +++ b/test/files/run/Course-2002-05.scala @@ -0,0 +1,215 @@ +//############################################################################ +// Programmation IV - 2002 - Week 05 +//############################################################################ +// $Id$ + +object M0 { + def partition[a](xs: List[a], pred: a => boolean): Pair[List[a], List[a]] = { + if (xs.isEmpty) + Pair(List(),List()) + else { + val tailPartition = partition(xs.tail, pred); + if (pred(xs.head)) + Pair(xs.head :: tailPartition._1, tailPartition._2) + else + Pair(tailPartition._1, xs.head :: tailPartition._2) + } + } + + def quicksort[a] (less : (a,a) => boolean) (xs : List[a]) : List[a] = { + if (xs.isEmpty) + xs + else { + val pivot = xs.head; + val sub = partition(xs.tail, (elem : a => less(elem, pivot))); + quicksort(less)(sub._1) ::: List(pivot) ::: quicksort(less)(sub._2) + } + } + + def test = { + Console.println(partition[int](List(1,2,3,4,5,6,7,8), (x => x < 0))); + Console.println(partition[int](List(1,2,3,4,5,6,7,8), (x => x < 5))); + Console.println(partition[int](List(1,2,3,4,5,6,7,8), (x => x < 9))); + Console.println; + + Console.println(partition[int](List(8,7,6,5,4,3,2,1), (x => x < 0))); + Console.println(partition[int](List(8,7,6,5,4,3,2,1), (x => x < 5))); + Console.println(partition[int](List(8,7,6,5,4,3,2,1), (x => x < 9))); + Console.println; + + Console.println(partition[int](List(7,2,1,5,4,3,8,6), (x => x < 0))); + Console.println(partition[int](List(7,2,1,5,4,3,8,6), (x => x < 5))); + Console.println(partition[int](List(7,2,1,5,4,3,8,6), (x => x < 9))); + Console.println; + + Console.println(quicksort[int]((x,y) => x < y)(List(7,2,1,5,4,3,8,6))); + Console.println; + } +} + +//############################################################################ + +object M1 { + def partition[a](xs: List[a], pred: a => boolean): Pair[List[a], List[a]] = { + xs.foldRight[Pair[List[a], List[a]]](Pair(List(), List())) { + (x, p) => if (pred (x)) Pair(x :: p._1, p._2) else Pair(p._1, x :: p._2) + } + } + + def quicksort[a] (less : (a,a) => boolean) (xs : List[a]) : List[a] = { + if (xs.isEmpty) + xs + else { + val pivot = xs.head; + val sub = partition(xs.tail, (elem : a => less(elem, pivot))); + quicksort(less)(sub._1) ::: List(pivot) ::: quicksort(less)(sub._2) + } + } + + def test = { + Console.println(partition[int](List(1,2,3,4,5,6,7,8), (x => x < 0))); + Console.println(partition[int](List(1,2,3,4,5,6,7,8), (x => x < 5))); + Console.println(partition[int](List(1,2,3,4,5,6,7,8), (x => x < 9))); + Console.println; + + Console.println(partition[int](List(8,7,6,5,4,3,2,1), (x => x < 0))); + Console.println(partition[int](List(8,7,6,5,4,3,2,1), (x => x < 5))); + Console.println(partition[int](List(8,7,6,5,4,3,2,1), (x => x < 9))); + Console.println; + + Console.println(partition[int](List(7,2,1,5,4,3,8,6), (x => x < 0))); + Console.println(partition[int](List(7,2,1,5,4,3,8,6), (x => x < 5))); + Console.println(partition[int](List(7,2,1,5,4,3,8,6), (x => x < 9))); + Console.println; + + Console.println(quicksort[int]((x,y) => x < y)(List(7,2,1,5,4,3,8,6))); + Console.println; + } +} + +//############################################################################ + +object M2 { + + def powerset[a] (s : List[a]) : List[List[a]] = { + if (s.isEmpty) + List(List()) + else { + val x = s.head; + val withoutX = powerset(s.tail); + withoutX ::: withoutX.map(s1 : List[a] => x::s1) + } + } + + def test = { + Console.println(powerset(List())); + Console.println(powerset(List(1))); + Console.println(powerset(List(1,2))); + Console.println(powerset(List(1,2,3))); + Console.println(powerset(List(1,2,3,4))); + Console.println; + } +} + +//############################################################################ + +object M3 { + + def abs(x: int) = if (x < 0) 0 - x else x; + + def range(lo: Int, hi: Int): List[Int] = + if (lo > hi) List() + else lo :: range(lo + 1, hi); + + type Placement = List[Pair[int,int]]; + + def queens(n: int): List[Placement] = { + def placeQueens(row: int): List[Placement] = { + if (row == 0) + List(List()) + else { + def isSafe(column: int, placement: Placement): boolean = + placement forall { + pos => (pos._2 != column && + abs(pos._2 - column) != row - pos._1) + } + + def adjoinRow(placement: Placement): List[Placement] = + range(1, n) + .filter (column => isSafe(column, placement)) + .map (column => Pair(row, column) :: placement); + + placeQueens(row - 1) flatMap adjoinRow + } + } + placeQueens(n) + } + + def test = { + Console.println("queens(1) = " + queens(1)); + Console.println("queens(2) = " + queens(2)); + Console.println("queens(3) = " + queens(3)); + Console.println("queens(4) = " + queens(4)); + Console.println; + } +} + +//############################################################################ + +object M4 { + + def abs(x: int) = if (x < 0) 0 - x else x; + + def range(lo: Int, hi: Int): List[Int] = + if (lo > hi) List() + else lo :: range(lo + 1, hi); + + type Placement = List[Int]; + + def queens(n: Int): List[Placement] = { + val columns = range(1, n); + def placeQueens(row: Int): List[Placement] = { + if (row == 0) + List(List()) + else { + def isSafe(col: Int, p: Placement, delta: Int): Boolean = + (p.isEmpty || + (col != p.head && + abs(col - p.head) != delta && + isSafe(col, p.tail, delta + 1))); + + for ( + val placement <- placeQueens(row - 1); + val col <- columns; + isSafe(col, placement, 1) + ) yield { + col :: placement + } + } + } + placeQueens(n); + } + + def test = { + Console.println("queens(1) = " + queens(1)); + Console.println("queens(2) = " + queens(2)); + Console.println("queens(3) = " + queens(3)); + Console.println("queens(4) = " + queens(4)); + Console.println; + } +} + +//############################################################################ + +object Test { + def main(args: Array[String]): unit = { + M0.test; + M1.test; + M2.test; + M3.test; + M4.test; + () + } +} + +//############################################################################ diff --git a/test/files/run/Course-2002-06.check b/test/files/run/Course-2002-06.check new file mode 100644 index 0000000000..bd354594af --- /dev/null +++ b/test/files/run/Course-2002-06.check @@ -0,0 +1,38 @@ +%!PS-Adobe-3.0 EPSF-3.0 +%%Title: ProgrammationIV +%%Creator: LAMP +%%BoundingBox: 0 0 595.28 841.89 +%%EndComments + +/m {moveto} bind def +/l {lineto} bind def + +0.14 setlinewidth +newpath +42.52 165.83 m 297.64 165.83 l +297.64 165.83 m 297.64 505.99 l +297.64 505.99 m 42.52 505.99 l +42.52 505.99 m 170.08 676.07 l +170.08 676.07 m 297.64 505.99 l +297.64 505.99 m 42.52 165.83 l +42.52 165.83 m 42.52 505.99 l +42.52 505.99 m 297.64 165.83 l +297.64 165.83 m 425.2 165.83 l +425.2 165.83 m 425.2 505.99 l +425.2 505.99 m 297.64 505.99 l +297.64 505.99 m 361.42 676.07 l +361.42 676.07 m 425.2 505.99 l +425.2 505.99 m 297.64 165.83 l +297.64 165.83 m 297.64 505.99 l +297.64 505.99 m 425.2 165.83 l +425.2 676.07 m 552.76 676.07 l +552.76 676.07 m 552.76 335.91 l +552.76 335.91 m 425.2 335.91 l +425.2 335.91 m 488.98 165.83 l +488.98 165.83 m 552.76 335.91 l +552.76 335.91 m 425.2 676.07 l +425.2 676.07 m 425.2 335.91 l +425.2 335.91 m 552.76 676.07 l +stroke +showpage +%%EOF diff --git a/test/files/run/Course-2002-06.scala b/test/files/run/Course-2002-06.scala new file mode 100644 index 0000000000..df73daa08f --- /dev/null +++ b/test/files/run/Course-2002-06.scala @@ -0,0 +1,262 @@ +//############################################################################ +// Programmation IV - 2002 - Week 06 +//############################################################################ +// $Id$ + +/** Two-dimensional vector. */ +class Vector (_x: Double, _y: Double) { + def x: Double = _x; + def y: Double = _y; + def +(that: Vector): Vector = new Vector(x + that.x, y + that.y); + def *(scalar: Double): Vector = new Vector(x * scalar, y * scalar); + def -(that: Vector): Vector = new Vector(x - that.x, y - that.y); + def /(scalar: Double): Vector = new Vector(x / scalar, y / scalar); + def norm: Double = scala.runtime.compat.Math.sqrt(x * x + y * y); +} + +//############################################################################ + +/** Frame. */ +class Frame (_origin: Vector, _edgeX: Vector, _edgeY: Vector) { + def origin: Vector = _origin; + def edgeX: Vector = _edgeX; + def edgeY: Vector = _edgeY; + /** The vector v in the absolute (drawing) coordinate system */ + def coordMap(v: Vector): Vector = origin + (edgeX * v.x) + (edgeY * v.y); +} + +//############################################################################ + +/** Space on which we can draw lines. */ +abstract class Graphics(_width: Double, _height: Double) { + /** Width of the picture.*/ + def width: Double = _width; + + /** Height of the picture.*/ + def height: Double = _height; + + /** Frame that represents the drawable area of the output device*/ + val frame: Frame; + + /** Draw a line in device coordinates*/ + def plotLine(x1: Double, y1: Double, x2: Double, y2: Double): Unit; + + /** Draw a line in logical coordinates*/ + def drawLine(v1: Vector, v2: Vector): Unit = { + val _v1 = frame.coordMap(v1); + val _v2 = frame.coordMap(v2); + plotLine(_v1.x, _v1.y, _v2.x, _v2.y); + } + + /** Draw a segment of the picture.*/ + def drawSegment(frm: Frame)(v1: Vector, v2: Vector): Unit = { + val _v1 = frm.coordMap(v1); + val _v2 = frm.coordMap(v2); + drawLine(_v1, _v2); + } + + /** Draw a list of segments on the picture.*/ + def drawSegments(frm: Frame)(segments: List[Pair[Vector, Vector]]): Unit = + if (segments.isEmpty) () + else { + drawSegment(frm)(segments.head._1, segments.head._2); + drawSegments(frm)(segments.tail) + } + + /** Draw a list of continuous segments on the picture.*/ + def drawPolySegment(frm: Frame)(points: List[Vector]) : Unit = + if (!points.tail.isEmpty) { + drawSegment(frm)(points.head, points.tail.head); + drawPolySegment(frm)(points.tail); + } + + /** updates the contents of the output device*/ + def repaint = (); + + /** Add the last touch to the picture.*/ + def close : Unit; +} + +//############################################################################ + +/** Provides PostScript output. The name of the file is the first parameter + * of the constructor. The width and height determine the aspect ratio + */ +class PostScript (filename: String, _width: Double, _height: Double) + extends Graphics(_width, _height) { + /** Convert mm into 72th of inch.*/ + def mm2ps(x: Double) : Double = round(x * 72.0 / 25.4); + + def round(x: Double): Double = + scala.runtime.compat.Math.floor(x * 100.0 + 0.5) / 100.0; + + def scaleAndCenter(frm: Frame, ratio:Double): Frame = { + val currentRatio = frm.edgeX.norm / frm.edgeY.norm; + if (currentRatio < ratio) { + val newEdgeX = frm.edgeX; + val newEdgeY = frm.edgeY * (currentRatio /ratio); + val newOrigin = frm.origin + ((frm.edgeY - newEdgeY) / 2); + new Frame(newOrigin, newEdgeX, newEdgeY) + } + else { + val newEdgeX = frm.edgeX * (ratio / currentRatio); + val newEdgeY = frm.edgeY; + val newOrigin = frm.origin + ((frm.edgeX - newEdgeX) / 2); + new Frame(newOrigin, newEdgeX, newEdgeY) + } + } + + /** Line thickness in millimeters.*/ + val line_thickness : Double = 0.05; + + /** Width, height, left and right margins in mm.*/ + val psWidth: Double = 210.0; + val psHeight: Double = 297.0; + val psWidthMargin: Double = 15.0; + val psHeightMargin: Double = 15.0; + + val frame: Frame = { + val origin = new Vector(mm2ps(psWidthMargin), mm2ps(psHeightMargin)); + val edgeX = new Vector(mm2ps(psWidth) - 2 * mm2ps(psWidthMargin), 0); + val edgeY = new Vector(0, mm2ps(psHeight) - 2 * mm2ps(psHeightMargin)); + scaleAndCenter(new Frame(origin, edgeX, edgeY), width / height) + } + + def plotLine(x1: Double, y1: Double, x2: Double, y2: Double): Unit = { + Console.println(round(x1) + " " + round(y1) + " m " + + round(x2) + " " + round(y2) + " l"); + } + + /** Print the PS header.*/ + Console.println("%!PS-Adobe-3.0 EPSF-3.0\n%%Title: ProgrammationIV"); + Console.println("%%Creator: LAMP"); + Console.println("%%BoundingBox: 0 0 " + mm2ps(psWidth) + " " + mm2ps(psHeight)); + Console.println("%%EndComments\n"); + Console.println("/m {moveto} bind def\n/l {lineto} bind def\n"); + Console.println(mm2ps(line_thickness) + " setlinewidth\nnewpath"); + + /** Terminate the PS document and close the file stream. */ + def close : Unit = { + Console.println("stroke\nshowpage\n%%EOF"); + Console.flush; + } +} + +//############################################################################ + +object M0 { + + /** Define the type of a painter as a function that takes a frame, + * draws itself onto it and returns nothing + */ + type Painter = (Frame) => Unit; + + + /** Transform the frame in which the painter is to be drawn, hence + * changing the appearance of the painter + */ + def transformPainter(origin: Vector, newX: Vector, newY: Vector)(painter: Painter): Painter = { + frame: Frame => { + val newOrigin = frame.coordMap(origin); + val newFrame = new Frame(newOrigin, + frame.coordMap(newX) - newOrigin, + frame.coordMap(newY) - newOrigin); + painter(newFrame) + } + } + + + /** Flip the painter vertically + */ + def flipVert: Painter => Painter = + transformPainter(new Vector(0.0, 1.0), + new Vector(1.0, 1.0), + new Vector(0.0, 0.0)); + + /** Flip the painter horizontally + */ + def flipHoriz: Painter => Painter = + transformPainter(new Vector(1.0, 0.0), + new Vector(0.0, 0.0), + new Vector(1.0, 1.0)); + + /** Compose a painter that draws p1 on the left of p2 + */ + def beside(p1: Painter, p2: Painter) : Painter = { + frame: Frame => { + transformPainter(new Vector(0.0, 0.0), + new Vector(0.5, 0.0), + new Vector(0.0, 1.0))(p1)(frame); + transformPainter(new Vector(0.5, 0.0), + new Vector(1.0, 0.0), + new Vector(0.5, 1.0))(p2)(frame) + } + } + + /** Compose a painter that draws p1 below p2 + */ + def below(p1: Painter, p2: Painter): Painter = { + frame: Frame => { + transformPainter(new Vector(0.0, 0.0), + new Vector(1.0, 0.0), + new Vector(0.0, 0.5))(p1)(frame); + transformPainter(new Vector(0.0, 0.5), + new Vector(1.0, 0.5), + new Vector(0.0, 1.0))(p2)(frame) + } + } + + def rightSplit(painter: Painter, n: Int): Painter = { + if (n == 0) painter + else { + val smaller = rightSplit(painter, n-1); + beside(painter, below(smaller, smaller)) + } + } + + // A small test painter. + def house(canvas: Graphics)(frame: Frame): Unit = { + canvas.drawPolySegment(frame)(List(new Vector(0.0, 0.0), + new Vector(1.0, 0.0), + new Vector(1.0, 2.0/3.0), + new Vector(0.0, 2.0/3.0), + new Vector(0.5, 1.0), + new Vector(1.0, 2.0/3.0), + new Vector(0.0, 0.0), + new Vector(0.0, 2.0/3.0), + new Vector(1.0, 0.0))); + canvas.repaint + } + + def test = { + val psfile = "-"; + val canvas: Graphics = new PostScript(psfile, 2, 2); + + // the identity frame + val identFrame = new Frame(new Vector(0.0,0.0), + new Vector(1.0,0.0), + new Vector(0.0,1.0)); + + // Create a basic painter... + val p: Painter = house(canvas); + // ...then compose it with itself. + val threeHouses = beside(p, beside(p, flipVert(p))); + + // Use the painter to draw the final image. + threeHouses(identFrame); + + // Don't forget to close the canvas! + canvas.close + } +} + +//############################################################################ + +object Test { + def main(args: Array[String]): Unit = { + M0.test; + () + } +} + +//############################################################################ diff --git a/test/files/run/Course-2002-07.check b/test/files/run/Course-2002-07.check new file mode 100644 index 0000000000..0a378e6d20 --- /dev/null +++ b/test/files/run/Course-2002-07.check @@ -0,0 +1,137 @@ + 0 = 0 + 1 = 1 + 0 + 1 = 1 + 1 + 2 = 3 +2 + 3 + 4 = 9 + + 0 = 0 + 1 = 1 + 0 + 1 = 1 + 1 + 2 = 3 +2 + 3 + 4 = 9 + + 0 = 0 + 1 = 1 + 0 + 1 = 1 + 1 + 2 = 3 +2 + 3 + 4 = 9 + + 0 = 0 + 1 = 1 + 0 + 1 = 1 + 1 + 2 = 3 +2 + 3 + 4 = 9 + +List() = concat(List()) +List() = concat(List(List())) +List() = concat(List(List(),List())) +List() = concat(List(List(),List(),List())) +List(1,2,3,4,5,6) = concat(List(List(1,2,3,4,5,6))) +List(1,2,3,4,5,6) = concat(List(List(1,2,3,4,5,6),List())) +List(1,2,3,4,5,6) = concat(List(List(1,2,3),List(4,5,6))) +List(1,2,3,4,5,6) = concat(List(List(),List(1,2,3,4,5,6))) +List(1,2,3,4,5,6) = concat(List(List(1,2,3,4,5,6),List(),List())) +List(1,2,3,4,5,6) = concat(List(List(1,2,3,4,5),List(6),List())) +List(1,2,3,4,5,6) = concat(List(List(1,2,3),List(4,5,6),List())) +List(1,2,3,4,5,6) = concat(List(List(1),List(2,3,4,5,6),List())) +List(1,2,3,4,5,6) = concat(List(List(),List(1,2,3,4,5,6),List())) +List(1,2,3,4,5,6) = concat(List(List(),List(1,2,3,4,5),List(6))) +List(1,2,3,4,5,6) = concat(List(List(),List(1,2,3),List(4,5,6))) +List(1,2,3,4,5,6) = concat(List(List(),List(1),List(2,3,4,5,6))) +List(1,2,3,4,5,6) = concat(List(List(),List(),List(1,2,3,4,5,6))) +List(1,2,3,4,5,6) = concat(List(List(1,2),List(3,4),List(5,6))) + +List() = zipFun(List(),List()) +List() = zipFun(List(),List(a,b,c)) +List() = zipFun(List(1,2,3),List()) +List((1,a)) = zipFun(List(1),List(a)) +List((1,a)) = zipFun(List(1),List(a,b,c)) +List((1,a)) = zipFun(List(1,2,3),List(a)) +List((1,a),(2,b)) = zipFun(List(1,2),List(a,b)) +List((1,a),(2,b)) = zipFun(List(1,2),List(a,b,c)) +List((1,a),(2,b)) = zipFun(List(1,2,3),List(a,b)) +List((1,a),(2,b),(3,c)) = zipFun(List(1,2,3),List(a,b,c)) + +List() = heads(List()) +List() = heads(List(List())) +List() = heads(List(List(),List())) +List() = heads(List(List(),List(),List())) +List(1) = heads(List(List(1,2,3,4,5,6))) +List(1) = heads(List(List(1,2,3,4,5,6),List())) +List(1) = heads(List(List(),List(1,2,3,4,5,6))) +List(1) = heads(List(List(1,2,3,4,5,6),List(),List())) +List(1) = heads(List(List(),List(1,2,3,4,5,6),List())) +List(1) = heads(List(List(),List(),List(1,2,3,4,5,6))) +List(1,2) = heads(List(List(1),List(2,3,4,5,6),List())) +List(1,2) = heads(List(List(),List(1),List(2,3,4,5,6))) +List(1,4) = heads(List(List(1,2,3),List(4,5,6))) +List(1,4) = heads(List(List(1,2,3),List(4,5,6),List())) +List(1,4) = heads(List(List(),List(1,2,3),List(4,5,6))) +List(1,6) = heads(List(List(1,2,3,4,5),List(6),List())) +List(1,6) = heads(List(List(),List(1,2,3,4,5),List(6))) +List(1,3,5) = heads(List(List(1,2),List(3,4),List(5,6))) + +List() = heads(List()) +List() = heads(List(List())) +List() = heads(List(List(),List())) +List() = heads(List(List(),List(),List())) +List(1) = heads(List(List(1,2,3,4,5,6))) +List(1) = heads(List(List(1,2,3,4,5,6),List())) +List(1) = heads(List(List(),List(1,2,3,4,5,6))) +List(1) = heads(List(List(1,2,3,4,5,6),List(),List())) +List(1) = heads(List(List(),List(1,2,3,4,5,6),List())) +List(1) = heads(List(List(),List(),List(1,2,3,4,5,6))) +List(1,2) = heads(List(List(1),List(2,3,4,5,6),List())) +List(1,2) = heads(List(List(),List(1),List(2,3,4,5,6))) +List(1,4) = heads(List(List(1,2,3),List(4,5,6))) +List(1,4) = heads(List(List(1,2,3),List(4,5,6),List())) +List(1,4) = heads(List(List(),List(1,2,3),List(4,5,6))) +List(1,6) = heads(List(List(1,2,3,4,5),List(6),List())) +List(1,6) = heads(List(List(),List(1,2,3,4,5),List(6))) +List(1,3,5) = heads(List(List(1,2),List(3,4),List(5,6))) + +f (x) = Prod(Var(x), Var(x)) +f'(x) = Sum(Prod(Var(x), Number(1)), Prod(Var(x), Number(1))) + +f (x) = x * x +f'(x) = x * 1 + x * 1 +g (x) = 2 * x * x + 3 * x +g'(x) = 2 * x * 1 + x * (2 * 1 + x * 0) + 3 * 1 + x * 0 +g (3) = 27 +g'(3) = 15 + +ta(x) = x + 3 +tb(x) = x + 3 +tc(x) = x + 3 +td(x) = x + 3 +te(x) = 2 * x + 3 +tf(x) = 2 * x + 3 +tg(x) = 6 * x +th(x) = x^6 + +f4(x) = x^4 + 7 * x^3 + 20 * x^2 + 23 * x + 5 +f3(x) = 4 * x^3 + 21 * x^2 + 40 * x + 23 +f2(x) = 12 * x^2 + 42 * x + 40 +f1(x) = 24 * x + 42 +f0(x) = 24 + +f4(0) = 5 ok +f4(1) = 56 ok +f4(2) = 203 ok +f4(3) = 524 ok +f4(4) = 1121 ok + +f3(0) = 23 ok +f3(1) = 88 ok +f3(2) = 219 ok +f3(3) = 440 ok + +f2(0) = 40 ok +f2(1) = 94 ok +f2(2) = 172 ok + +f1(0) = 42 ok +f1(1) = 66 ok + +f0(0) = 24 ok + diff --git a/test/files/run/Course-2002-07.scala b/test/files/run/Course-2002-07.scala new file mode 100644 index 0000000000..98f09aafb7 --- /dev/null +++ b/test/files/run/Course-2002-07.scala @@ -0,0 +1,726 @@ +//############################################################################ +// Programmation IV - 2002 - Week 07 +//############################################################################ +// $Id$ + +import java.lang.System; // to avoid name clash with .NET's library + +object M0 { + + trait Expr { + def isNumber: boolean; + def isSum: boolean; + def numValue: int; + def leftOp: Expr; + def rightOp: Expr; + } + + class Number(n: int) extends Expr { + def isNumber: boolean = true; + def isSum: boolean = false; + def numValue: int = n; + def leftOp: Expr = error("Number.leftOp"); + def rightOp: Expr = error("Number.rightOp"); + } + class Sum(e1: Expr, e2: Expr) extends Expr { + def isNumber: boolean = false; + def isSum: boolean = true; + def numValue: int = error("Sum.numValue"); + def leftOp: Expr = e1; + def rightOp: Expr = e2; + } + + class Prod(e1: Expr, e2: Expr) extends Expr { + def isNumber: boolean = false; + def isSum: boolean = false; + def numValue: int = error("Prod.numValue"); + def leftOp: Expr = e1; + def rightOp: Expr = e2; + } + + class Var(x: String) extends Expr { + def isNumber: boolean = false; + def isSum: boolean = false; + def numValue: int = error("Var.numValue"); + def leftOp: Expr = error("Var.leftOp"); + def rightOp: Expr = error("Var.rightOp"); + } + + def eval(e: Expr): int = { + if (e.isNumber) e.numValue + else if (e.isSum) eval(e.leftOp) + eval(e.rightOp) + else error("unknown expression") + } + + def test = { + System.out.println(" 0 = " + eval(new Number(0))); + System.out.println(" 1 = " + eval(new Number(1))); + System.out.println(" 0 + 1 = " + + eval(new Sum(new Number(0),new Number(1)))); + System.out.println(" 1 + 2 = " + + eval(new Sum(new Number(1),new Number(2)))); + System.out.println("2 + 3 + 4 = " + + eval(new Sum(new Sum(new Number(2),new Number(3)),new Number(4)))); + System.out.println(); + } + +} + +//############################################################################ + +object M1 { + + trait Expr { + def eval: int; + } + class Number(n: int) extends Expr { + def eval: int = n; + } + class Sum(e1: Expr, e2: Expr) extends Expr { + def eval: int = e1.eval + e2.eval; + } + + def test = { + System.out.println(" 0 = " + new Number(0).eval); + System.out.println(" 1 = " + new Number(1).eval); + System.out.println(" 0 + 1 = " + + new Sum(new Number(0),new Number(1)).eval); + System.out.println(" 1 + 2 = " + + new Sum(new Number(1),new Number(2)).eval); + System.out.println("2 + 3 + 4 = " + + new Sum(new Sum(new Number(2),new Number(3)),new Number(4)).eval); + System.out.println(); + } +} + +//############################################################################ + +object M2 { + + trait Expr; + case class Number(n: int) extends Expr; + case class Sum(e1: Expr, e2: Expr) extends Expr; + + def eval(e: Expr): int = e match { + case Number(n) => n + case Sum(e1, e2) => eval(e1) + eval(e2) + } + + def test = { + System.out.println(" 0 = " + eval(Number(0))); + System.out.println(" 1 = " + eval(Number(1))); + System.out.println(" 0 + 1 = " + eval(Sum(Number(0),Number(1)))); + System.out.println(" 1 + 2 = " + eval(Sum(Number(1),Number(2)))); + System.out.println("2 + 3 + 4 = " + eval(Sum(Sum(Number(2),Number(3)), + Number(4)))); + System.out.println(); + } +} + +//############################################################################ + +object M3 { + + trait Expr { + def eval: int = this match { + case Number(n) => n + case Sum(e1, e2) => e1.eval + e2.eval + } + } + case class Number(n: int) extends Expr; + case class Sum(e1: Expr, e2: Expr) extends Expr; + + def test = { + System.out.println(" 0 = " + Number(0).eval); + System.out.println(" 1 = " + Number(1).eval); + System.out.println(" 0 + 1 = " + Sum(Number(0),Number(1)).eval); + System.out.println(" 1 + 2 = " + Sum(Number(1),Number(2)).eval); + System.out.println("2 + 3 + 4 = " + Sum(Sum(Number(2),Number(3)), + Number(4)).eval); + System.out.println(); + } + +} + +//############################################################################ + +object M4 { + + def concat[a](xss: List[List[a]]): List[a] = xss match { + case List() => List() + case xs :: xss1 => xs ::: concat(xss1) + } + + def test_concat[a](xss: List[List[a]]) = { + System.out.println(concat(xss).toString() + " = concat(" + xss + ")"); // !!! .toString() + } + + def test = { + test_concat(List()); + test_concat(List(List())); + test_concat(List(List(),List())); + test_concat(List(List(),List(),List())); + + test_concat(List(List(1,2,3,4,5,6))); + test_concat(List(List(1,2,3,4,5,6),List[int]())); // !!! [int] + test_concat(List(List(1,2,3),List(4,5,6))); + test_concat(List(List[int](),List(1,2,3,4,5,6))); // !!! [int] + test_concat(List(List(1,2,3,4,5,6),List[int](),List[int]())); // !!! [int] + test_concat(List(List(1,2,3,4,5),List(6),List[int]())); // !!! [int] + test_concat(List(List(1,2,3),List(4,5,6),List[int]())); // !!! [int] + test_concat(List(List(1),List(2,3,4,5,6),List[int]())); // !!! [int] + test_concat(List(List[int](),List(1,2,3,4,5,6),List[int]())); // !!! [int] + test_concat(List(List[int](),List(1,2,3,4,5),List(6))); // !!! [int] + test_concat(List(List[int](),List(1,2,3),List(4,5,6))); // !!! [int] + test_concat(List(List[int](),List(1),List(2,3,4,5,6))); // !!! [int] + test_concat(List(List[int](),List[int](),List(1,2,3,4,5,6))); // !!! [int] + test_concat(List(List(1,2),List(3,4),List(5,6))); + System.out.println(); + } + +} + +//############################################################################ + +object M5 { + + def zipFun[a,b](xs:List[a], ys:List[b]):List[Pair[a,b]] = Pair(xs,ys) match { + case Pair(List(), _) => List() + case Pair(_, List()) => List() + case Pair(x :: xs1, y :: ys1) => Pair(x, y) :: zipFun(xs1, ys1) + } + + def test_zipFun[a,b](xs: List[a], ys: List[b]) = { + System.out.println(zipFun(xs,ys).toString() + " = zipFun(" + xs + "," + ys + ")"); // !!! .toString() + } + + def test = { + test_zipFun(List(),List()); + test_zipFun(List(),List('a','b','c')); + test_zipFun(List(1,2,3),List()); + + test_zipFun(List(1),List('a')); + test_zipFun(List(1),List('a','b','c')); + test_zipFun(List(1,2,3),List('a')); + + test_zipFun(List(1,2),List('a','b')); + test_zipFun(List(1,2),List('a','b','c')); + test_zipFun(List(1,2,3),List('a','b')); + + test_zipFun(List(1,2,3),List('a','b','c')); + + System.out.println(); + } + +} + + +//############################################################################ + +object M6 { + + def zipFun[a,b](xs:List[a], ys:List[b]):List[Pair[a,b]] = Pair(xs,ys) match { + // !!! case Pair(List(), _), Pair(_, List()) => List() + case Pair(x :: xs1, y :: ys1) => Pair(x, y) :: zipFun(xs1, ys1) + } + + def test_zipFun[a,b](xs: List[a], ys: List[b]) = { + System.out.println(zipFun(xs,ys).toString() + " = zipFun(" + xs + "," + ys + ")"); // !!! .toString() + } + + def test = { + test_zipFun(List(),List()); + test_zipFun(List(),List('a','b','c')); + test_zipFun(List(1,2,3),List()); + + test_zipFun(List(1),List('a')); + test_zipFun(List(1),List('a','b','c')); + test_zipFun(List(1,2,3),List('a')); + + test_zipFun(List(1,2),List('a','b')); + test_zipFun(List(1,2),List('a','b','c')); + test_zipFun(List(1,2,3),List('a','b')); + + test_zipFun(List(1,2,3),List('a','b','c')); + + System.out.println(); + } + +} + +//############################################################################ + +object M7 { + + def heads[a](xss: List[List[a]]): List[a] = xss flatMap { + case x :: xs => List(x) + case List() => List() + } + + def test_heads[a](xss: List[List[a]]) = { + System.out.println(heads(xss).toString() + " = heads(" + xss + ")"); // !!! .toString() + } + + + def test = { + test_heads(List()); + test_heads(List(List())); + test_heads(List(List(),List())); + test_heads(List(List(),List(),List())); + + test_heads(List(List(1,2,3,4,5,6))); + test_heads(List(List(1,2,3,4,5,6),List[int]())); // !!! [int] + test_heads(List(List[int](),List(1,2,3,4,5,6))); // !!! [int] + test_heads(List(List(1,2,3,4,5,6),List[int](),List[int]())); // !!! [int] + test_heads(List(List[int](),List(1,2,3,4,5,6),List[int]())); // !!! [int] + test_heads(List(List[int](),List[int](),List(1,2,3,4,5,6))); // !!! [int] + + test_heads(List(List(1),List(2,3,4,5,6),List[int]())); // !!! [int] + test_heads(List(List[int](),List(1),List(2,3,4,5,6))); // !!! [int] + + test_heads(List(List(1,2,3),List(4,5,6))); + test_heads(List(List(1,2,3),List(4,5,6),List[int]())); // !!! [int] + test_heads(List(List[int](),List(1,2,3),List(4,5,6))); // !!! [int] + + test_heads(List(List(1,2,3,4,5),List(6),List[int]())); // !!! [int] + test_heads(List(List[int](),List(1,2,3,4,5),List(6))); // !!! [int] + + test_heads(List(List(1,2),List(3,4),List(5,6))); + + System.out.println(); + } + +} + +//############################################################################ + +object M8 { + + def heads[a](xss: List[List[a]]): List[a] = xss.flatMap { + y => y match { + case x :: xs => List(x) + case List() => List() + } + } + + def test_heads[a](xss: List[List[a]]) = { + System.out.println(heads(xss).toString() + " = heads(" + xss + ")"); // !!! .toString() + } + + + def test = { + test_heads(List()); + test_heads(List(List())); + test_heads(List(List(),List())); + test_heads(List(List(),List(),List())); + + test_heads(List(List(1,2,3,4,5,6))); + test_heads(List(List(1,2,3,4,5,6),List[int]())); // !!! [int] + test_heads(List(List[int](),List(1,2,3,4,5,6))); // !!! [int] + test_heads(List(List(1,2,3,4,5,6),List[int](),List[int]())); // !!! [int] + test_heads(List(List[int](),List(1,2,3,4,5,6),List[int]())); // !!! [int] + test_heads(List(List[int](),List[int](),List(1,2,3,4,5,6))); // !!! [int] + + test_heads(List(List(1),List(2,3,4,5,6),List[int]())); // !!! [int] + test_heads(List(List[int](),List(1),List(2,3,4,5,6))); // !!! [int] + + test_heads(List(List(1,2,3),List(4,5,6))); + test_heads(List(List(1,2,3),List(4,5,6),List[int]())); // !!! [int] + test_heads(List(List[int](),List(1,2,3),List(4,5,6))); // !!! + + test_heads(List(List(1,2,3,4,5),List(6),List[int]())); // !!! [int] + test_heads(List(List[int](),List(1,2,3,4,5),List(6))); // !!! [int] + + test_heads(List(List(1,2),List(3,4),List(5,6))); + + System.out.println(); + } + +} + +//############################################################################ + +object M9 { + + trait Expr { + def derive(v: Var): Expr = this match { + case Number(_) => Number(0) + case Var(name) => if (name == v.name) Number(1) else Number(0) + case Sum(e1, e2) => Sum(e1 derive v, e2 derive v) + case Prod(e1, e2) => Sum(Prod(e1, e2 derive v), Prod(e2, e1 derive v)) + } + } + case class Number(x: int) extends Expr { + override def toString() = "Number(" + x + ")"; // !!! remove ! + } + case class Var(name: String) extends Expr { + override def toString() = "Var(" + name + ")"; // !!! remove ! + } + case class Sum(e1: Expr, e2: Expr) extends Expr { + override def toString() = "Sum(" + e1 + ", " + e2 + ")"; // !!! remove ! + } + case class Prod(e1: Expr, e2: Expr) extends Expr { + override def toString() = "Prod(" + e1 + ", " + e2 + ")"; // !!! remove ! + } + + def test = { + val x = Var("x"); + val f0 = Prod(x, x); + val f1 = f0 derive x; + System.out.println("f (x) = " + f0); + System.out.println("f'(x) = " + f1); + System.out.println(); + } + +} + +//############################################################################ + +object MA { + + def lookup[k,v](xs: List[Pair[k,v]], k: k): v = xs match { + case List() => error("no value for " + k) + case Pair(k1,v1) :: xs1 => if (k1 == k) v1 else lookup(xs1, k) + } + + trait Expr { + def + (that: Expr) = Sum(this, that); + def * (that: Expr) = Prod(this, that); + def derive(v: Var): Expr = this match { + case Number(_) => Number(0) + case Var(name) => if (name == v.name) Number(1) else Number(0) + case Sum(e1, e2) => (e1 derive v) + (e2 derive v) + case Prod(e1, e2) => e1 * (e2 derive v) + e2 * (e1 derive v) + } + } + case class Number(x: int) extends Expr { + override def toString() = x.toString() + } + case class Var(name: String) extends Expr { + override def toString() = name; + } + case class Sum(e1: Expr, e2: Expr) extends Expr { + override def toString() = e1.toString() + " + " + e2.toString(); + } + case class Prod(e1: Expr, e2: Expr) extends Expr { + override def toString() = { + def factorToString(e: Expr) = e match { + case Sum(_, _) => "(" + e.toString() + ")" + case _ => e.toString() + } + factorToString(e1) + " * " + factorToString(e2); + } + } + + def eval(e: Expr): int = e match { + case Number(n) => n + case Var(_) => error("cannot evaluate variable") + case Sum(e1, e2) => eval(e1) + eval(e2) + case Prod(e1, e2) => eval(e1) * eval(e2) + } + + def evalvars(xs: List[Pair[String,int]]): Expr => Int = { + def loop(e: Expr): int = e match { + case Number(n) => n + case Var(name) => lookup(xs,name) + case Sum(e1, e2) => loop(e1) + loop(e2) + case Prod(e1, e2) => loop(e1) * loop(e2) + } + loop + } + + def test = { + val x = Var("x"); + + val f0 = x * x; + val f1 = f0 derive x; + System.out.println("f (x) = " + f0); + System.out.println("f'(x) = " + f1); + + val g0 = Number(2) * x * x + Number(3) * x; + val g1 = g0 derive x; + System.out.println("g (x) = " + g0); + System.out.println("g'(x) = " + g1); + System.out.println("g (3) = " + evalvars(List(Pair("x",3)))(g0)); + System.out.println("g'(3) = " + evalvars(List(Pair("x",3)))(g1)); + + System.out.println(); + } + +} + +//############################################################################ + +object Utils { + + private def power0(x: int, y: int): int = + if (y == 1) x else if (y % 2 == 0) power0(x*x,y/2) else x*power0(x, y-1); + + def power(x: int, y: int): int = Pair(x,y) match { + case Pair(0,0) => error("power(0,0)") + case Pair(0,_) => 0 + case Pair(1,_) => 1 + case Pair(_,0) => 1 + case Pair(_,1) => x + case Pair(_,2) => x*x + case Pair(_,_) => if (y < 0) 1/power0(x,y) else power0(x,y) + } + + def lookup(entries: List[Pair[String,int]], key: String):int = entries match{ + case List() => error("no value for " + key) + case Pair(k,v) :: _ if (k == key) => v + case _ :: rest => lookup(rest, key) + } + + def compare(xs: List[String], ys: List[String]): int = Pair(xs,ys) match{ + case Pair(List(), List()) => 0 + case Pair(List(), _ ) => -1 + case Pair(_ , List()) => +1 + case Pair(x::xs , y::ys ) => { + val diff = x.compareTo(y); + if (diff != 0) diff else compare(xs,ys) + } + } + +} + +object MB { + + import Utils._; + + + trait Expr { + + private def count: int = this match { + case Lit(n) => n + case Mul(Lit(n),_) => n + case _ => 1 + } + + private def term: Expr = this match { + case Lit(_) => Lit(1) + case Mul(Lit(_),r) => r + case _ => this + } + + private def vars: List[String] = this match { + case Var(n) => List(n) + case Mul(l,r) => l.vars ::: r.vars + case Pow(l,n) => { val vs = l.vars; List.range(0,n).flatMap(i => vs) } + case _ => List() + } + + private def +< (that: Expr): boolean = (this +<? that) < 0; + private def +<= (that: Expr): boolean = (this +<? that) <= 0; + private def +<? (that: Expr): int = Pair(this,that) match { + case Pair(Add(_,_), _ ) => 0 + case Pair(_ , Add(_,_)) => 0 + case Pair(_ , _ ) => compare(this.vars,that.vars) + } + + def + (that: Expr): Expr = if (that +<= this) Pair(this,that) match { + case Pair(_ , Lit(0) ) => this + case Pair(Lit(l) , Lit(r) ) => Lit(l + r) + case Pair(_ , Add(rl,rr)) => (this + rl) + rr + case Pair(Add(ll,lr), _ ) if (lr +<= that) => ll + (that + lr) + case Pair(_ , _ ) => { + val l = this.term; + val r = that.term; + if (l equ r) Lit(this.count + that.count) * r else Add(this, that) + } + } else that + this; + + private def *< (that: Expr): boolean = (this *<? that) < 0; + private def *<= (that: Expr): boolean = (this *<? that) <= 0; + private def *<? (that: Expr): int = Pair(this,that) match { + case Pair(Mul(_,_), _ ) => 0 + case Pair(_ , Mul(_,_)) => 0 + case Pair(Add(_,_), Add(_,_)) => 0 + case Pair(Add(_,_), _ ) => -1 + case Pair(_ , Add(_,_)) => +1 + case Pair(Lit(_) , Lit(_) ) => 0 + case Pair(Lit(_) , _ ) => -1 + case Pair(_ , Lit(_) ) => +1 + case Pair(Var(l) , Var(r) ) => l.compareTo(r) + case Pair(Var(_) , Pow(r,_)) => if (this *<= r) -1 else +1 + case Pair(Pow(l,_), Var(_) ) => if (l *< that) -1 else +1 + case Pair(Pow(l,_), Pow(r,_)) => l *<? r + } + + def * (that: Expr): Expr = if (this *<= that) Pair(this,that) match { + case Pair(Lit(0) , _ ) => this + case Pair(Lit(1) , _ ) => that + case Pair(Mul(ll,lr), r ) => ll * (lr * r) + case Pair(Add(ll,lr), r ) => ll * r + lr * r + case Pair(Lit(l) , Lit(r) ) => Lit(l * r) + case Pair(Var(_) , Var(_) ) if (this equ that) => Pow(this,2) + case Pair(Var(_) , Pow(r,n) ) if (this equ r) => Pow(this,n + 1) + case Pair(Pow(ll,lr), Pow(rl,rr)) if (ll equ rl) => Pow(ll,lr + rr) + case Pair(l , Mul(rl,rr)) if (rl *<= l) => (rl * l) * rr + case Pair(_ , _ ) => Mul(this,that) + } else that * this; + + def ^ (that: int): Expr = Pair(this,that) match { + case Pair(_ ,1) => this + case Pair(Lit(i) ,n) => Lit(power(i,n)) + case Pair(Var(_) ,n) => Pow(this,n) + case Pair(Add(_,_),n) => this * (this ^ (n - 1)) + case Pair(Mul(l,r),n) => (l ^ n) * (r ^ n) + case Pair(Pow(e,m),n) => Pow(e,m + n) + } + + def derive(v: Var): Expr = this match { + case Lit(_) => Lit(0) + case Var(name) => if (name == v.name) Lit(1) else Lit(0) + case Add(e1, e2) => (e1 derive v) + (e2 derive v) + case Mul(e1, e2) => e1 * (e2 derive v) + e2 * (e1 derive v) + case Pow(e1, i2) => Lit(i2) * (e1 derive v) * (e1 ^ (i2 - 1)) + } + + def evaluate(vars: List[Pair[String,int]]): int = this match { + case Lit(cst) => cst + case Var (name) => lookup(vars, name) + case Add (l, r) => l.evaluate(vars) + r.evaluate(vars) + case Mul (l, r) => l.evaluate(vars) * r.evaluate(vars) + case Pow(l, r) => power(l.evaluate(vars), r) + } + + def equ(that: Expr): boolean = Pair(this,that) match { + case Pair(Lit(l) ,Lit(r)) => l == r + case Pair(Var(l) ,Var(r)) => l == r + case Pair(Add(ll,lr),Add(rl,rr)) => (ll equ rl) && (lr equ rr) + case Pair(Mul(ll,lr),Mul(rl,rr)) => (ll equ rl) && (lr equ rr) + case Pair(Pow(ll,lr),Pow(rl,rr)) => (ll equ rl) && (lr == rr) + case _ => false + } + + } + + case class Lit(x: int) extends Expr { + override def toString() = x.toString() + } + + case class Var(name: String) extends Expr { + override def toString() = name; + } + + case class Add(e1: Expr, e2: Expr) extends Expr { + override def toString() = e1.toString() + " + " + e2.toString(); // !!! .toString + } + + case class Mul(e1: Expr, e2: Expr) extends Expr { + override def toString() = { + def factorToString(e: Expr) = e match { + case Add(_, _) => "(" + e.toString() + ")" + case _ => e.toString() + } + factorToString(e1) + " * " + factorToString(e2); + } + } + + case class Pow(e1: Expr, i2: int) extends Expr { + override def toString() = { + def factorToString(e: Expr) = e match { + case Add(_, _) => "(" + e.toString() + ")" + case Mul(_, _) => "(" + e.toString() + ")" + case _ => e.toString() + } + factorToString(e1) + "^" + i2; + } + } + + def test = { + val _1 = Lit(1); + val _2 = Lit(2); + val _3 = Lit(3); + val _4 = Lit(4); + val _5 = Lit(5); + + val x = Var("x"); + + val ta = (_1 + (_2 + x)); + val tb = (_1 + (x + _2)); + val tc = ((_1 + x) + _2); + val td = ((x + _1) + _2); + val te = ((x + _1) + (x + _2)); + val tf = ((_1 + x) + (_2 + x)); + val tg = x + x + (x * _2) + x + x; + val th = x * x * (x ^ 2) * x * x; + + System.out.println("ta(x) = " + ta); + System.out.println("tb(x) = " + tb); + System.out.println("tc(x) = " + tc); + System.out.println("td(x) = " + td); + System.out.println("te(x) = " + te); + System.out.println("tf(x) = " + tf); + System.out.println("tg(x) = " + tg); + System.out.println("th(x) = " + th); + System.out.println(); + + val f4 = (x+ _3)*(_2+x)*x*(x+ _1) + (x+ _5)*(x*(x+ _2)+x+ _1) + (x^2) + x; + val f3 = f4.derive(x); + val f2 = f3.derive(x); + val f1 = f2.derive(x); + val f0 = f1.derive(x); + + System.out.println("f4(x) = " + f4); + System.out.println("f3(x) = " + f3); + System.out.println("f2(x) = " + f2); + System.out.println("f1(x) = " + f1); + System.out.println("f0(x) = " + f0); + System.out.println(); + + def check(n: String, f: Expr, x: int, e: int) = { + val a: int = f.evaluate(List(Pair("x",x))); + val s: String = if (a == e) "ok" else "KO(" + e + ")"; + System.out.println(n + "(" + x + ") = " + a + " " + s); + } + + check("f4", f4, 0, 5); + check("f4", f4, 1, 56); + check("f4", f4, 2, 203); + check("f4", f4, 3, 524); + check("f4", f4, 4, 1121); + System.out.println(); + + check("f3", f3, 0, 23); + check("f3", f3, 1, 88); + check("f3", f3, 2, 219); + check("f3", f3, 3, 440); + System.out.println(); + + check("f2", f2, 0, 40); + check("f2", f2, 1, 94); + check("f2", f2, 2, 172); + System.out.println(); + + check("f1", f1, 0, 42); + check("f1", f1, 1, 66); + System.out.println(); + + check("f0", f0, 0, 24); + System.out.println(); + } +} + +//############################################################################ + +object Test { + def main(args: Array[String]): unit = { + M0.test; + M1.test; + M2.test; + M3.test; + M4.test; + M5.test; + // !!! M6.test; + M7.test; + M8.test; + M9.test; + MA.test; + MB.test; + () + } +} + +//############################################################################ diff --git a/test/files/run/Course-2002-08.check b/test/files/run/Course-2002-08.check new file mode 100644 index 0000000000..ec25c77524 --- /dev/null +++ b/test/files/run/Course-2002-08.check @@ -0,0 +1,171 @@ +x = abc +count = 111 +x = hello +count = 112 + +account deposit 50 -> () +account withdraw 20 -> 30 +account withdraw 20 -> 10 +account withdraw 15 -> + +x deposit 30 -> () +y withdraw 20 -> + +x deposit 30 -> () +x withdraw 20 -> 10 + +x deposit 30 -> () +y withdraw 20 -> 10 + +2^0 = 1.0 +2^1 = 2.0 +2^2 = 4.0 +2^3 = 8.0 + +2^0 = 1.0 +2^1 = 2.0 +2^2 = 4.0 +2^3 = 8.0 + +1 2 3 +List(1,2,3) + +out 0 new-value = false +*** simulation started *** +out 1 new-value = true +!0 = 1 + +*** simulation started *** +out 2 new-value = false +!1 = 0 + +out 2 new-value = false + +*** simulation started *** +0 & 0 = 0 + +*** simulation started *** +0 & 1 = 0 + +*** simulation started *** +out 11 new-value = true +out 11 new-value = false +1 & 0 = 0 + +*** simulation started *** +out 14 new-value = true +1 & 1 = 1 + +out 14 new-value = false + +*** simulation started *** +0 | 0 = 0 + +*** simulation started *** +out 24 new-value = true +0 | 1 = 1 + +*** simulation started *** +1 | 0 = 1 + +*** simulation started *** +1 | 1 = 1 + +sum 34 new-value = false +carry 34 new-value = false + +*** simulation started *** +0 + 0 = 0 + +*** simulation started *** +sum 47 new-value = true +0 + 1 = 1 + +*** simulation started *** +carry 50 new-value = true +carry 50 new-value = false +sum 54 new-value = false +sum 54 new-value = true +1 + 0 = 1 + +*** simulation started *** +carry 57 new-value = true +sum 61 new-value = false +1 + 1 = 2 + +sum 61 new-value = false +carry 61 new-value = false + +*** simulation started *** +0 + 0 + 0 = 0 + +*** simulation started *** +sum 82 new-value = true +0 + 0 + 1 = 1 + +*** simulation started *** +sum 89 new-value = false +carry 90 new-value = true +sum 97 new-value = true +carry 98 new-value = false +0 + 1 + 0 = 1 + +*** simulation started *** +sum 113 new-value = false +carry 114 new-value = true +0 + 1 + 1 = 2 + +*** simulation started *** +sum 121 new-value = true +carry 122 new-value = false +sum 129 new-value = false +sum 129 new-value = true +1 + 0 + 0 = 1 + +*** simulation started *** +carry 137 new-value = true +sum 144 new-value = false +1 + 0 + 1 = 2 + +*** simulation started *** +carry 152 new-value = false +sum 152 new-value = true +sum 158 new-value = false +carry 159 new-value = true +1 + 1 + 0 = 2 + +*** simulation started *** +sum 173 new-value = true +1 + 1 + 1 = 3 + +in 0 new-value = false +ctrl0 0 new-value = false +ctrl1 0 new-value = false +ctrl2 0 new-value = false +out0 0 new-value = false +out1 0 new-value = false +out2 0 new-value = false +out3 0 new-value = false +out4 0 new-value = false +out5 0 new-value = false +out6 0 new-value = false +out7 0 new-value = false +in 0 new-value = true +*** simulation started *** +out0 10 new-value = true +ctrl0 10 new-value = true +*** simulation started *** +out1 13 new-value = true +out0 14 new-value = false +ctrl1 14 new-value = true +*** simulation started *** +out3 20 new-value = true +out1 21 new-value = false +ctrl2 21 new-value = true +*** simulation started *** +out7 30 new-value = true +out3 31 new-value = false +ctrl0 31 new-value = false +*** simulation started *** +out7 34 new-value = false +out6 35 new-value = true diff --git a/test/files/run/Course-2002-08.scala b/test/files/run/Course-2002-08.scala new file mode 100644 index 0000000000..a0d679d3d1 --- /dev/null +++ b/test/files/run/Course-2002-08.scala @@ -0,0 +1,602 @@ +//############################################################################ +// Programmation IV - 2002 - Week 08 +//############################################################################ +// $Id$ + +import List._; + +object M0 { + + var x: String = "abc"; + var count = 111; + + def test = { + Console.println("x = " + x); + Console.println("count = " + count); + x = "hello"; + count = count + 1; + Console.println("x = " + x); + Console.println("count = " + count); + Console.println; + } +} + +//############################################################################ + +object M1 { + + class BankAccount() { + private var balance = 0; + def deposit(amount: Int): Unit = + if (amount > 0) balance = balance + amount; + + def withdraw(amount: Int): Int = + if (0 < amount && amount <= balance) { + balance = balance - amount; + balance + } else error("insufficient funds"); + } + + def test0 = { + val account = new BankAccount(); + Console.print("account deposit 50 -> "); + Console.println((account deposit 50).toString()); // !!! .toString + Console.print("account withdraw 20 -> "); + Console.println(account withdraw 20); + Console.print("account withdraw 20 -> "); + Console.println(account withdraw 20); + Console.print("account withdraw 15 -> "); + Console.println; + } + + def test1 = { + val x = new BankAccount(); + val y = new BankAccount(); + Console.print("x deposit 30 -> "); + Console.println((x deposit 30).toString()); // !!! .toString + Console.print("y withdraw 20 -> "); + Console.println; + } + + def test2 = { + val x = new BankAccount(); + val y = new BankAccount(); + Console.print("x deposit 30 -> "); + Console.println((x deposit 30).toString()); // !!! .toString + Console.print("x withdraw 20 -> "); + Console.println(x withdraw 20); + } + + def test3 = { + val x = new BankAccount(); + val y = x; + Console.print("x deposit 30 -> "); + Console.println((x deposit 30).toString()); // !!! .toString + Console.print("y withdraw 20 -> "); + Console.println(y withdraw 20); + } + + def test = { + test0; Console.println; + test1; Console.println; + test2; Console.println; + test3; Console.println; + } +} + + +//############################################################################ + +object M2 { + + def While(condition: => Boolean)(command: => Unit): Unit = + if (condition) { + command; While(condition)(command) + } else { + } + + def power (x: Double, exp: Int): Double = { + var r = 1.0; + var i = exp; + While (i > 0) { r = r * x; i = i - 1 } + r + } + + def test = { + Console.println("2^0 = " + power(2,0)); + Console.println("2^1 = " + power(2,1)); + Console.println("2^2 = " + power(2,2)); + Console.println("2^3 = " + power(2,3)); + Console.println; + } +} + +//############################################################################ + +object M3 { + + def power (x: Double, exp: Int): Double = { + var r = 1.0; + var i = exp; + while (i > 0) { r = r * x; i = i - 1 } + r + } + + def test = { + Console.println("2^0 = " + power(2,0)); + Console.println("2^1 = " + power(2,1)); + Console.println("2^2 = " + power(2,2)); + Console.println("2^3 = " + power(2,3)); + Console.println; + } +} + +//############################################################################ + +object M4 { + + def test = { + for (val i <- range(1, 4)) { Console.print(i + " ") }; + Console.println; + Console.println(for (val i <- range(1, 4)) yield i); + Console.println; + } +} + +//############################################################################ + +object M5 { + + type Action = () => Unit; + + class Wire() { + private var sigVal = false; + private var actions: List[Action] = List(); + def getSignal = sigVal; + def setSignal(s: Boolean) = + if (s != sigVal) { + sigVal = s; + actions.foreach(action => action()); + } + def addAction(a: Action) = { + actions = a :: actions; a() + } + } + + abstract class Simulation() { + private type Agenda = List[Pair[Int, Action]]; + private var agenda: Agenda = List(); + private var curtime = 0; + def currentTime: Int = curtime; + + def afterDelay(delay: Int)(action: Action): Unit = { + def insert(ag: Agenda, time: Int): Agenda = ag match { + case List() => + List(Pair(time, action)) + case Pair(t, act) :: ag1 => + if (time < t) Pair(time, action) :: ag + else Pair(t, act) :: insert(ag1, time) + } + agenda = insert(agenda, curtime + delay) + } + + private def next: Unit = agenda match { + case List() => () + case Pair(time, action) :: ag1 => { + agenda = ag1; + curtime = time; + action(); + } + } + + def run: Unit = { + afterDelay(0){() => Console.println("*** simulation started ***"); } + while (!agenda.isEmpty) { next } + } + } + + abstract class BasicCircuitSimulation() extends Simulation() { + + val InverterDelay: Int; + val AndGateDelay: Int; + val OrGateDelay: Int; + + def inverter(input: Wire, output: Wire): Unit = { + def invertAction() = { + val inputSig = input.getSignal; + afterDelay(InverterDelay) {() => output.setSignal(!inputSig) }; + } + input addAction invertAction + } + + def andGate(a1: Wire, a2: Wire, output: Wire): Unit = { + def andAction() = { + val a1Sig = a1.getSignal; + val a2Sig = a2.getSignal; + afterDelay(AndGateDelay) {() => output.setSignal(a1Sig & a2Sig) }; + } + a1 addAction andAction; + a2 addAction andAction; + } + + def orGate(o1: Wire, o2: Wire, output: Wire): Unit = { + def orAction() = { + val o1Sig = o1.getSignal; + val o2Sig = o2.getSignal; + afterDelay(OrGateDelay) {() => output.setSignal(o1Sig | o2Sig) }; + } + o1 addAction orAction; + o2 addAction orAction; + } + + def probe(name: String, wire: Wire): Unit = { + wire addAction {() => + Console.println( + name + " " + currentTime + " new-value = " + wire.getSignal); + } + } + } + + abstract class CircuitSimulation() extends BasicCircuitSimulation() { + + def halfAdder(a: Wire, b: Wire, s: Wire, c: Wire): Unit = { + val d = new Wire(); + val e = new Wire(); + orGate(a, b, d); + andGate(a, b, c); + inverter(c, e); + andGate(d, e, s); + } + + def fullAdder(a: Wire, b: Wire, cin: Wire, sum: Wire, cout: Wire): Unit = { + val s = new Wire(); + val c1 = new Wire(); + val c2 = new Wire(); + halfAdder(a, cin, s, c1); + halfAdder(b, s, sum, c2); + orGate(c1, c2, cout); + } + } + + class Test() extends CircuitSimulation() { + + val InverterDelay = 1; + val AndGateDelay = 3; + val OrGateDelay = 5; + + def invert = { + val ain = new Wire(); + val cout = new Wire(); + inverter(ain, cout); + + def result = if (cout.getSignal) 1 else 0; + + def test(a: Int) = { + ain setSignal (if (a == 0) false else true); + run; + Console.println("!" + a + " = " + result); + Console.println; + } + + probe("out ", cout); + + test(0); + test(1); + } + + def and = { + val ain = new Wire(); + val bin = new Wire(); + val cout = new Wire(); + andGate(ain, bin, cout); + + def result = if (cout.getSignal) 1 else 0; + + def test(a: Int, b: Int) = { + ain setSignal (if (a == 0) false else true); + bin setSignal (if (b == 0) false else true); + run; + Console.println(a + " & " + b + " = " + result); + Console.println; + } + + probe("out ", cout); + Console.println; + + test(0,0); + test(0,1); + test(1,0); + test(1,1); + } + + def or = { + val ain = new Wire(); + val bin = new Wire(); + val cout = new Wire(); + orGate(ain, bin, cout); + + def result = if (cout.getSignal) 1 else 0; + + def test(a: Int, b: Int) = { + ain setSignal (if (a == 0) false else true); + bin setSignal (if (b == 0) false else true); + run; + Console.println(a + " | " + b + " = " + result); + Console.println; + } + + probe("out ", cout); + Console.println; + + test(0,0); + test(0,1); + test(1,0); + test(1,1); + } + + def half = { + val ain = new Wire(); + val bin = new Wire(); + val sout = new Wire(); + val cout = new Wire(); + halfAdder(ain, bin, sout, cout); + + def result = + ((if (sout.getSignal) 1 else 0) + + (if (cout.getSignal) 2 else 0)); + + def test(a: Int, b: Int) = { + ain setSignal (if (a == 0) false else true); + bin setSignal (if (b == 0) false else true); + run; + Console.println(a + " + " + b + " = " + result); + Console.println; + } + + probe("sum ", sout); + probe("carry", cout); + Console.println; + + test(0,0); + test(0,1); + test(1,0); + test(1,1); + } + + def full = { + val ain = new Wire(); + val bin = new Wire(); + val cin = new Wire(); + val sout = new Wire(); + val cout = new Wire(); + fullAdder(ain, bin, cin, sout, cout); + + def result = + ((if (sout.getSignal) 1 else 0) + + (if (cout.getSignal) 2 else 0)); + + def test(a: Int, b: Int, c: Int) = { + ain setSignal (if (a == 0) false else true); + bin setSignal (if (b == 0) false else true); + cin setSignal (if (c == 0) false else true); + run; + Console.println(a + " + " + b + " + " + c + " = " + result); + Console.println; + } + + probe("sum ", sout); + probe("carry", cout); + Console.println; + + test(0,0,0); + test(0,0,1); + test(0,1,0); + test(0,1,1); + test(1,0,0); + test(1,0,1); + test(1,1,0); + test(1,1,1); + } + } + + def test = { + val sim = new Test(); + sim.invert; + sim.and; + sim.or; + sim.half; + sim.full; + } +} + +//############################################################################ + +class Simulator() { + + type Action = () => Unit; + type Agenda = List[Pair[Int, Action]]; + + private var agenda: Agenda = List(); + private var curtime = 0; + + def afterDelay(delay: Int)(action: Action) = { + def insert(ag: Agenda, time: Int): Agenda = ag match { + case List() => + List(Pair(time, action)) + case Pair(t, act) :: ag1 => + if (time < t) Pair(time, action) :: ag + else Pair(t, act) :: insert(ag1, time) + } + agenda = insert(agenda, curtime + delay) + } + + def next: Unit = agenda match { + case List() => () + case Pair(time, action) :: rest => { + agenda = rest; + curtime = time; + action(); + } + } + + protected def currentTime: Int = curtime; + + def run = { + afterDelay(0){() => Console.println("*** simulation started ***"); } + while (!agenda.isEmpty) { next } + } +} + +class Wire() { + private var sigVal = false; + private var actions: List[() => Unit] = List(); + def getSignal = sigVal; + def setSignal(s: Boolean) = + if (s != sigVal) { + sigVal = s; + actions.foreach(action => action()); + } + def addAction(a: () => Unit) = { + actions = a :: actions; + a() + } +} + +abstract class BasicCircuitSimulator() extends Simulator() { + + def probe(name: String, wire: Wire): Unit = { + wire addAction {() => + Console.println( + name + " " + currentTime + " new-value = " + wire.getSignal); + } + } + + val InverterDelay: Int; + val AndGateDelay: Int; + val OrGateDelay: Int; + + def inverter(input: Wire, output: Wire) = { + def invertAction() = { + val inputSig = input.getSignal; + afterDelay(InverterDelay) {() => output.setSignal(!inputSig) }; + } + input addAction invertAction + } + + def andGate(a1: Wire, a2: Wire, output: Wire) = { + def andAction() = { + val a1Sig = a1.getSignal; + val a2Sig = a2.getSignal; + afterDelay(AndGateDelay) {() => output.setSignal(a1Sig & a2Sig) }; + } + a1 addAction andAction; + a2 addAction andAction + } + + def orGate(a1: Wire, a2: Wire, output: Wire) = { + def orAction() = { + val a1Sig = a1.getSignal; + val a2Sig = a2.getSignal; + afterDelay(OrGateDelay) {() => output.setSignal(a1Sig | a2Sig) }; + } + a1 addAction orAction; + a2 addAction orAction + } + + def orGate2(a1: Wire, a2: Wire, output: Wire) = { + val w1 = new Wire(); + val w2 = new Wire(); + val w3 = new Wire(); + inverter(a1, w1); + inverter(a2, w2); + andGate(w1, w2, w3); + inverter(w3, output); + } +} + +abstract class CircuitSimulator() extends BasicCircuitSimulator() { + def demux2(in: Wire, ctrl: List[Wire], out: List[Wire]) : Unit = { + val ctrlN = ctrl.map(w => { val iw = new Wire(); inverter(w,iw); iw}); + val w0 = new Wire(); + val w1 = new Wire(); + val w2 = new Wire(); + val w3 = new Wire(); + + andGate(in, ctrl(1), w3); + andGate(in, ctrl(1), w2); + andGate(in, ctrlN(1), w1); + andGate(in, ctrlN(1), w0); + + andGate(w3, ctrl(0), out(3)); + andGate(w2, ctrlN(0), out(2)); + andGate(w1, ctrl(0), out(1)); + andGate(w0, ctrlN(0), out(0)); + } + + def connect(in: Wire, out: Wire) = { + in addAction {() => out.setSignal(in.getSignal); } + } + + def demux(in: Wire, ctrl: List[Wire], out: List[Wire]): Unit = ctrl match { + case List() => connect(in, out.head); + case c :: rest => + val c_ = new Wire(); + val w1 = new Wire(); + val w2 = new Wire(); + inverter(c, c_); + andGate(in, c_, w1); + andGate(in, c, w2); + demux(w1, rest, out.drop(out.length / 2)); + demux(w2, rest, out.take(out.length / 2)); + } +} + +class Main() extends CircuitSimulator() { + + val InverterDelay = 1; + val AndGateDelay = 3; + val OrGateDelay = 5; + + def main = { + val n = 3; + val outNum = 1 << n; + + val in = new Wire(); + val ctrl = for (val x <- range(0,n)) yield { new Wire() }; + val out = for (val x <- range(0,outNum)) yield { new Wire() }; + + demux(in, ctrl.reverse, out.reverse); + + probe("in", in); + for (val Pair(x,c) <- range(0,n) zip ctrl) { probe("ctrl" + x, c) } + for (val Pair(x,o) <- range(0,outNum) zip out) { probe("out" + x, o) } + + in.setSignal(true); + run; + ctrl(0).setSignal(true); + run; + ctrl(1).setSignal(true); + run; + ctrl(2).setSignal(true); + run; + ctrl(0).setSignal(false); + run; + } +} + +//############################################################################ + +object Test { + def main(args: Array[String]): Unit = { + M0.test; + M1.test; + M2.test; + M3.test; + M4.test; + M5.test; + new Main().main; + () + } +} + +//############################################################################ diff --git a/test/files/run/Course-2002-09.check b/test/files/run/Course-2002-09.check new file mode 100644 index 0000000000..765962aad8 --- /dev/null +++ b/test/files/run/Course-2002-09.check @@ -0,0 +1,50 @@ +Probe: f = 32.0 +Probe: c = 0.0 +Probe: f = ? +Probe: c = ? + +Probe: f = 212.0 +Probe: c = 100.0 +Probe: f = ? +Probe: c = ? + +Probe: c = 0.0 +Probe: f = 32.0 +Probe: c = ? +Probe: f = ? + +Probe: c = 100.0 +Probe: f = 212.0 +Probe: c = ? +Probe: f = ? + +0.0 Celsius -> 32.0 Fahrenheits +100.0 Celsius -> 212.0 Fahrenheits +32.0 Fahrenheits -> 0.0 Celsius +212.0 Fahrenheits -> 100.0 Celsius + +a = ?, b = ?, c = ? => ? * ? = ? +a = 2, b = ?, c = ? => 2.0 * ? = ? +a = ?, b = 3, c = ? => ? * 3.0 = ? +a = ?, b = ?, c = 6 => ? * ? = 6.0 +a = 2, b = 3, c = ? => 2.0 * 3.0 = 6.0 +a = 2, b = ?, c = 6 => 2.0 * 3.0 = 6.0 +a = ?, b = 3, c = 6 => 2.0 * 3.0 = 6.0 +a = 2, b = 3, c = 6 => 2.0 * 3.0 = 6.0 + +a = 0, b = ?, c = ? => 0.0 * ? = 0.0 +a = ?, b = 0, c = ? => ? * 0.0 = 0.0 +a = ?, b = ?, c = 0 => ? * ? = 0.0 +a = 0, b = 7, c = ? => 0.0 * 7.0 = 0.0 +a = 7, b = 0, c = ? => 7.0 * 0.0 = 0.0 +a = 0, b = 0, c = ? => 0.0 * 0.0 = 0.0 +a = 0, b = ?, c = 0 => 0.0 * ? = 0.0 +a = ?, b = 0, c = 0 => ? * 0.0 = 0.0 +a = 0, b = 7, c = 0 => 0.0 * 7.0 = 0.0 +a = 7, b = 0, c = 0 => 7.0 * 0.0 = 0.0 +a = 0, b = 0, c = 0 => 0.0 * 0.0 = 0.0 + +a = 3, b = 4 => c = 5.0 +a = 3, c = 5 => b = 4.0 +b = 4, c = 5 => a = 3.0 + diff --git a/test/files/run/Course-2002-09.scala b/test/files/run/Course-2002-09.scala new file mode 100644 index 0000000000..65f9adad2b --- /dev/null +++ b/test/files/run/Course-2002-09.scala @@ -0,0 +1,334 @@ +//############################################################################ +// Programmation IV - 2002 - Week 09 +//############################################################################ +// $Id$ + +trait Constraint { + def newValue: Unit; + def dropValue: Unit +} + +object NoConstraint extends Constraint { + def newValue: Unit = error("NoConstraint.newValue"); + def dropValue: Unit = error("NoConstraint.dropValue"); +} + +class Adder(a1: Quantity,a2: Quantity,sum: Quantity) extends Constraint { + def newValue = Triple(a1.getValue, a2.getValue, sum.getValue) match { + case Triple(Some(x1), Some(x2), _ ) => sum.setValue(x1 + x2, this) + case Triple(Some(x1), _ , Some(r)) => a2.setValue(r - x1, this) + case Triple(_ , Some(x2), Some(r)) => a1.setValue(r - x2, this) + case _ => + } + def dropValue: Unit = { + a1.forgetValue(this); a2.forgetValue(this); sum.forgetValue(this); + } + a1 connect this; + a2 connect this; + sum connect this; +} + +class Multiplier(m1: Quantity, m2: Quantity, prod: Quantity) + extends Constraint { + def newValue = Triple(m1.getValue, m2.getValue, prod.getValue) match { + case Triple(Some(0d), _ , _ ) => prod.setValue(0, this); + case Triple(_ , Some(0d), _ ) => prod.setValue(0, this); + case Triple(Some(x1), Some(x2), _ ) => prod.setValue(x1 * x2, this) + case Triple(Some(x1), _ , Some(r)) => m2.setValue(r / x1, this) + case Triple(_, Some(x2), Some(r)) => m1.setValue(r / x2, this) + case _ => + } + def dropValue: Unit = { + m1.forgetValue(this); m2.forgetValue(this); prod.forgetValue(this); + } + m1 connect this; + m2 connect this; + prod connect this; +} + +class Squarer(square: Quantity, root: Quantity) extends Constraint { + def newValue: Unit = Pair(square.getValue, root.getValue) match { + case Pair(Some(x), _ )if (x < 0) => error("Square of negative number") + case Pair(Some(x), _ ) => + root.setValue(scala.runtime.compat.Math.sqrt(x), this) + case Pair(_ , Some(x)) => square.setValue(x*x, this) + case _ => + } + def dropValue: Unit = { + square.forgetValue(this); root.forgetValue(this); + } + square connect this; + root connect this; +} + +class Eq(a: Quantity, b: Quantity) extends Constraint { + def newValue = Pair(a.getValue, b.getValue) match { + case Pair(Some(x), _ ) => b.setValue(x, this); + case Pair(_ , Some(y)) => a.setValue(y, this); + } + def dropValue: Unit = { + a.forgetValue(this); b.forgetValue(this); + } + a connect this; + b connect this; +} + +class Constant(q: Quantity, v: double) extends Constraint { + def newValue: Unit = error("Constant.newValue"); + def dropValue: Unit = error("Constant.dropValue"); + q connect this; + q.setValue(v, this); +} + +class Probe(name: String, q: Quantity) extends Constraint { + def newValue: Unit = printProbe(q.getValue); + def dropValue: Unit = printProbe(None); + private def printProbe(v: Option[double]): Unit = { + val vstr = v match { + case Some(x) => x.toString() + case None => "?" + } + Console.println("Probe: " + name + " = " + vstr); + } + q connect this +} + +class Quantity() { + private var value: Option[double] = None; + private var constraints: List[Constraint] = List(); + private var informant: Constraint = null; + + def getValue: Option[double] = value; + + def setValue(v: double, setter: Constraint) = value match { + case Some(v1) => + if (v != v1) error("Error! contradiction: " + v + " and " + v1); + case None => + informant = setter; value = Some(v); + for (val c <- constraints; !(c == informant)) { + c.newValue; + } + } + def setValue(v: double): Unit = setValue(v, NoConstraint); + + def forgetValue(retractor: Constraint): Unit = { + if (retractor == informant) { + value = None; + for (val c <- constraints; !(c == informant)) c.dropValue; + } + } + def forgetValue: Unit = forgetValue(NoConstraint); + + def connect(c: Constraint) = { + constraints = c :: constraints; + value match { + case Some(_) => c.newValue + case None => + } + } + + def +(that: Quantity): Quantity = { + val sum = new Quantity(); + new Adder(this, that, sum); + sum; + } + + def *(that: Quantity): Quantity = { + val prod = new Quantity(); + new Multiplier(this, that, prod); + prod; + } + + def square: Quantity = { + val square = new Quantity(); + new Squarer(square, this); + square; + } + + def sqrt: Quantity = { + val root = new Quantity(); + new Squarer(this, root); + root; + } + + def ===(that: Quantity): Constraint = { + new Eq(this, that); + } + + override def toString(): String = value match { + case None => " ?" + case Some(v) => v.toString() + } + + def str: String = toString(); +} + +//############################################################################ + +object M0 { + + def CFconverter(c: Quantity, f: Quantity) = { + val u = new Quantity(); + val v = new Quantity(); + val w = new Quantity(); + val x = new Quantity(); + val y = new Quantity(); + new Multiplier(c, w, u); + new Multiplier(v, x, u); + new Adder(v, y, f); + new Constant(w, 9); + new Constant(x, 5); + new Constant(y, 32); + } + + def test = { + val c = new Quantity(); new Probe("c", c); + val f = new Quantity(); new Probe("f", f); + CFconverter(c, f); + + c.setValue(0); + c.forgetValue; + Console.println; + + c.setValue(100); + c.forgetValue; + Console.println; + + f.setValue(32); + f.forgetValue; + Console.println; + + f.setValue(212); + f.forgetValue; + Console.println; + } +} + +//############################################################################ + +object M1 { + + def constant(x: double): Quantity = { + val q = new Quantity(); + new Constant(q, x); + q + } + + def CFconverter(c: Quantity, f: Quantity) = { + val v = new Quantity(); + constant(9) * c === constant(5) * v; + v + constant(32) === f; + } + + def show_c2f(c: Quantity, f: Quantity, v: int) = { + c.setValue(v); + Console.println(c.str + " Celsius -> " + f.str + " Fahrenheits"); + c.forgetValue; + } + + def show_f2c(c: Quantity, f: Quantity, v: int) = { + f.setValue(v); + Console.println(f.str + " Fahrenheits -> " + c.str + " Celsius"); + f.forgetValue; + } + + def test = { + val c = new Quantity(); + val f = new Quantity(); + CFconverter(c, f); + + show_c2f(c, f, 0); + show_c2f(c, f, 100); + show_f2c(c, f, 32); + show_f2c(c, f, 212); + Console.println; + } +} + +//############################################################################ + +object M2 { + + val a = new Quantity(); + val b = new Quantity(); + val c = a * b; + + def set(q: Quantity, o: Option[int]): String = { + o match { + case None => "?" + case Some(v) => q.setValue(v); v.toString() + }; + } + + def show(x: Option[int], y: Option[int], z: Option[int]) = { + Console.print("a = " +set(a,x)+ ", b = " +set(b,y)+ ", c = " +set(c,z)); + Console.println(" => " + a.str + " * " + b.str + " = " + c.str); + a.forgetValue; b.forgetValue; c.forgetValue; + } + + def test = { + show(None , None , None ); + show(Some(2), None , None ); + show(None , Some(3), None ); + show(None , None , Some(6)); + show(Some(2), Some(3), None ); + show(Some(2), None , Some(6)); + show(None , Some(3), Some(6)); + show(Some(2), Some(3), Some(6)); + Console.println; + + show(Some(0), None , None ); + show(None , Some(0), None ); + show(None , None , Some(0)); + show(Some(0), Some(7), None ); + show(Some(7), Some(0), None ); + show(Some(0), Some(0), None ); + show(Some(0), None , Some(0)); + show(None , Some(0), Some(0)); + show(Some(0), Some(7), Some(0)); + show(Some(7), Some(0), Some(0)); + show(Some(0), Some(0), Some(0)); + Console.println; + } +} + + +//############################################################################ + +object M3 { + + def test = { + val a = new Quantity(); + val b = new Quantity(); + val c = new Quantity(); + c === (a.square + b.square).sqrt; + + a.setValue(3); b.setValue(4); + Console.println("a = 3, b = 4 => c = " + c.str); + a.forgetValue; b.forgetValue; + + a.setValue(3); c.setValue(5); + Console.println("a = 3, c = 5 => b = " + b.str); + a.forgetValue; c.forgetValue; + + b.setValue(4); c.setValue(5); + Console.println("b = 4, c = 5 => a = " + a.str); + b.forgetValue; c.forgetValue; + + Console.println; + } +} + +//############################################################################ + +object Test { + def main(args: Array[String]): Unit = { + M0.test; + M1.test; + M2.test; + M3.test; + () + } +} + +//############################################################################ diff --git a/test/files/run/Course-2002-10.check b/test/files/run/Course-2002-10.check new file mode 100644 index 0000000000..207b671f05 --- /dev/null +++ b/test/files/run/Course-2002-10.check @@ -0,0 +1,46 @@ +fib(0) = 0 +fib(1) = 1 +fib(2) = 1 +fib(3) = 2 +fib(4) = 3 +fib(5) = 5 +fib(6) = 8 +fib(7) = 13 +fib(8) = 21 +fib(9) = 34 +fib(10) = 55 +fib(11) = 89 +fib(12) = 144 +fib(13) = 233 +fib(14) = 377 +fib(15) = 610 +fib(16) = 987 +fib(17) = 1597 +fib(18) = 2584 +fib(19) = 4181 + +pi(0) = 4.0 , 3.166666666666667 , 4.0 +pi(1) = 2.666666666666667 , 3.1333333333333337, 3.166666666666667 +pi(2) = 3.466666666666667 , 3.1452380952380956, 3.142105263157895 +pi(3) = 2.8952380952380956, 3.1396825396825396, 3.1415993573190044 +pi(4) = 3.33968253968254 , 3.142712842712843 , 3.141592714033778 +pi(5) = 2.976046176046176 , 3.140881340881341 , 3.1415926539752923 +pi(6) = 3.283738483738484 , 3.142071817071817 , 3.141592653591176 +pi(7) = 3.017071817071817 , 3.1412548236077646, 3.141592653589777 +pi(8) = 3.252365934718876 , 3.1418396189294024, 3.141592653589794 +pi(9) = 3.0418396189294024, 3.141406718496502 , 3.1415926535897936 +pi = 3.141592653589793 , 3.141592653589793 , 3.141592653589793 + +ln(0) = 1.0 , 0.7 , 1.0 +ln(1) = 0.5 , 0.6904761904761905, 0.7 +ln(2) = 0.8333333333333333, 0.6944444444444444, 0.6932773109243697 +ln(3) = 0.5833333333333333, 0.6924242424242424, 0.6931488693329254 +ln(4) = 0.7833333333333333, 0.6935897435897436, 0.6931471960735491 +ln(5) = 0.6166666666666667, 0.6928571428571428, 0.6931471806635636 +ln(6) = 0.7595238095238095, 0.6933473389355742, 0.6931471805604038 +ln(7) = 0.6345238095238095, 0.6930033416875522, 0.6931471805599444 +ln(8) = 0.7456349206349207, 0.6932539682539682, 0.6931471805599426 +ln(9) = 0.6456349206349206, 0.6930657506744463, 0.6931471805599453 +ln = 0.6931471805599453, 0.6931471805599453, 0.6931471805599453 + +prime numbers: 2 3 5 7 11 13 17 19 23 29 31 37 41 43 47 53 59 61 67 71 73 79 83 89 97 101 103 107 109 113 diff --git a/test/files/run/Course-2002-10.scala b/test/files/run/Course-2002-10.scala new file mode 100644 index 0000000000..e634309018 --- /dev/null +++ b/test/files/run/Course-2002-10.scala @@ -0,0 +1,136 @@ +//############################################################################ +// Programmation IV - 2002 - Week 10 +//############################################################################ +// $Id$ + +import java.lang.System; // to avoid name clash with .NET's library + +object M0 { + + def addStream (s1: Stream[int], s2: Stream[int]): Stream[int] = + Stream.cons(s1.head + s2.head, addStream(s1.tail, s2.tail)); + + val fib: Stream[int] = + Stream.cons(0, Stream.cons(1, addStream(this.fib, this.fib.tail))); + + def test = { + var i = 0; + fib.take(20).foreach(n => {System.out.println("fib("+i+") = "+n); i=i+1}); + System.out.println(); + } +} + +//############################################################################ + +object M1 { + + def scale(x: double, s: Stream[double]): Stream[double] = + s map (e: double => e*x); + + def partialSums(s: Stream[double]): Stream[double] = + Stream.cons(s.head, partialSums(s.tail) map (x => x + s.head)); + + def euler(s: Stream[double]): Stream[double] = { + val nm1 = s at 0; + val n = s at 1; + val np1 = s at 2; + Stream.cons(np1 - ((np1 - n)*(np1 - n) / (nm1 - 2*n + np1)),euler(s.tail)) + }; + + def better(s: Stream[double], transform: Stream[double] => Stream[double]) + : Stream[Stream[double]] = + Stream.cons(s, better(transform(s), transform)); + + def veryGood(s: Stream[double], transform: Stream[double] => Stream[double]) + : Stream[double] = + better(s, transform) map (x => x.head); + + def lnSummands(n: double): Stream[double] = + Stream.cons(1.0 / n, lnSummands(n + 1.0) map (x: double => -x)); + + var ln0 = partialSums(lnSummands(1.0)); + var ln1 = euler(ln0); + var ln2 = veryGood(ln0, euler); + + def piSummands(n: double): Stream[double] = + Stream.cons(1.0 / n, piSummands(n + 2.0) map (x: double => -x)); + + var pi0 = scale(4.0, partialSums(piSummands(1.0))); + var pi1 = euler(pi0); + var pi2 = veryGood(pi0, euler); + + def pad(s: String, n: int): String = + if (n <= 0) s.substring(0, s.length() + n) + else pad(s + " ", n - 1); + def str(d: double) = { val s = d.toString(); pad(s, 18 - s.length()) }; + + def test = { + var i = 0; + while (i < 10) { + System.out.print("pi("+i+") = "); + System.out.print(str(pi0.at(i)) + ", "); + System.out.print(str(pi1.at(i)) + ", "); + System.out.print(str(pi2.at(i)) + "\n"); + i = i + 1; + } + System.out.print("pi = "); + System.out.print(str(Math.PI) + ", "); + System.out.print(str(Math.PI) + ", "); + System.out.print(str(Math.PI) + "\n"); + System.out.println(); + i = 0; + while (i < 10) { + System.out.print("ln("+i+") = "); + System.out.print(str(ln0.at(i)) + ", "); + System.out.print(str(ln1.at(i)) + ", "); + System.out.print(str(ln2.at(i)) + "\n"); + i = i + 1; + } + System.out.print("ln = "); + System.out.print(str(Math.log(2)) + ", "); + System.out.print(str(Math.log(2)) + ", "); + System.out.print(str(Math.log(2)) + "\n"); + System.out.println(); + } +} + +//############################################################################ + +object M2 { + + class IntIterator(start: int) extends Iterator[int] { + var current: int = start; + def hasNext = true; + def next = { current = current + 1; current - 1 }; + } + + class PrimeIterator() extends Iterator[int] { + var current: Iterator[int] = new IntIterator(2); + def hasNext = true; + def next = { + val p = current.next; + current = current filter { x => !((x % p) == 0) }; + p + } + } + + def test = { + val i = (new PrimeIterator()).take(30); + System.out.print("prime numbers:"); + while (i.hasNext) { System.out.print(" " + i.next); } + System.out.println(); + } +} + +//############################################################################ + +object Test { + def main(args: Array[String]): Unit = { + M0.test; + M1.test; + M2.test; + () + } +} + +//############################################################################ diff --git a/test/files/run/Course-2002-13.check b/test/files/run/Course-2002-13.check new file mode 100644 index 0000000000..913c4e4edd --- /dev/null +++ b/test/files/run/Course-2002-13.check @@ -0,0 +1,14 @@ +List(S = jean,V = mange,A = le,D = grand,N = table) +List(S = jean,V = mange,A = le,D = grand,N = cheval) + +List(S = jean,V = mange,A = le,D = grand,N = cheval) +List(S = jean,V = mange,A = la,D = belle,N = table) + +List(S = jean,V = mange,A = le,D = nil,N = cheval) +List(S = jean,V = mange,A = le,D = cons(grand,nil),N = cheval) +List(S = jean,V = mange,A = le,D = cons(grand,cons(grand,nil)),N = cheval) +List(S = jean,V = mange,A = la,D = nil,N = table) +yes +yes +no + diff --git a/test/files/run/Course-2002-13.scala b/test/files/run/Course-2002-13.scala new file mode 100644 index 0000000000..e98d8944a8 --- /dev/null +++ b/test/files/run/Course-2002-13.scala @@ -0,0 +1,324 @@ +//############################################################################ +// Programmation IV - 2002 - Week 13 +//############################################################################ +// $Id$ + +class Tokenizer(s: String, delimiters: String) extends Iterator[String] { + + private var i = 0; + + def isDelimiter(ch: Char) = { + var i = 0; + while (i < delimiters.length() && delimiters.charAt(i) != ch) { i = i + 1 } + i < delimiters.length() + } + + def hasNext: boolean = { + while (i < s.length() && s.charAt(i) <= ' ') { i = i + 1 } + i < s.length() + } + + def next: String = + if (hasNext) { + val start = i; + var ch = s.charAt(i); i = i + 1; + if (isDelimiter(ch)) ch.toString() + else { + while (i < s.length() && + s.charAt(i) > ' ' && + !isDelimiter(s.charAt(i))){ i = i + 1 } + s.substring(start, i) + } + } else ""; + +} + +object Terms { + + val debug = false; + + trait Term { + def map(s: Subst): Term; + def tyvars: List[String]; + } + + case class Binding(name: String, term: Term) { + term match { case Var(n) if (name == n) => error("bad binding") case _ => () } + override def toString() = name + " = " + term; + } + + type Subst = List[Binding]; + + def lookup(s: Subst, name: String): Option[Term] = s match { + case List() => None + case b :: s1 => if (name == b.name) Some(b.term) else lookup(s1, name) + } + + case class Var(a: String) extends Term { + override def toString() = a; + def map(s: Subst): Term = lookup(s, a) match { + case Some(b) => b map s + case None => this; + } + def tyvars = List(a); + } + + case class Con(a: String, ts: List[Term]) extends Term { + override def toString() = + a + (if (ts.isEmpty) "" else ts.mkString("(", ",", ")")); + def map(s: Subst): Term = Con(a, ts map (t => t map s)); + def tyvars = (ts flatMap (t => t.tyvars)).removeDuplicates; + } + + private var count = 0; + def newVar(prefix: String) = { count = count + 1; Var(prefix + count) } + + val NoTerm = Con("<none>", List()); + + def unify1(x: Term, y: Term, s: Subst): Option[Subst] = Pair(x, y) match { + case Pair(Var(a), Var(b)) if (a == b) => + Some(s) + case Pair(Var(a), _) => lookup(s, a) match { + case Some(x1) => unify(x1, y, s) + case None => if (y.tyvars contains a) None else Some(Binding(a, y) :: s) + } + case Pair(_, Var(b)) => lookup(s, b) match { + case Some(y1) => unify(x, y1, s) + case None => if (x.tyvars contains b) None else Some(Binding(b, x) :: s) + } + case Pair(Con(a, xs), Con(b, ys)) if (a == b) => + unify(xs, ys, s) + case _ => None + } + + def unify(x: Term, y: Term, s: Subst): Option[Subst] = { + val ss = unify1(x, y, s); + if (debug) Console.println("unify " + x + " with " + y + " = " + ss); + ss + } + + def unify(xs: List[Term], ys: List[Term], s: Subst): Option[Subst] = Pair(xs, ys) match { + case Pair(List(), List()) => Some(s) + case Pair(x :: xs1, y :: ys1) => + unify(x, y, s) match { + case Some(s1) => unify(xs1, ys1, s1) + case None => None + } + case _ => None + } +} + +import Terms._; + +object Programs { + + case class Clause(lhs: Term, rhs: List[Term]) { + def tyvars = + (lhs.tyvars ::: (rhs flatMap (t => t.tyvars))).removeDuplicates; + def newInstance = { + var s: Subst = List(); + for (val a <- tyvars) { s = Binding(a, newVar(a)) :: s } + Clause(lhs map s, rhs map (t => t map s)) + } + override def toString() = + lhs.toString() + " :- " + rhs.mkString("", ",", "") + "."; + } + + def list2stream[a](xs: List[a]): Stream[a] = xs match { + case List() => Stream.empty + case x :: xs1 => Stream.cons(x, list2stream(xs1)) + } + def option2stream[a](xo: Option[a]): Stream[a] = xo match { + case None => Stream.empty + case Some(x) => Stream.cons(x, Stream.empty) + } + + def solve(query: List[Term], clauses: List[Clause]): Stream[Subst] = { + + def solve2(query: List[Term], s: Subst): Stream[Subst] = query match { + case List() => + Stream.cons(s, Stream.empty) + case Con("not", qs) :: query1 => + if (solve1(qs, s).isEmpty) Stream.cons(s, Stream.empty) + else Stream.empty + case q :: query1 => + for (val clause <- list2stream(clauses); + val s1 <- tryClause(clause.newInstance, q, s); + val s2 <- solve1(query1, s1)) yield s2 + } + + def solve1(query: List[Term], s: Subst): Stream[Subst] = { + val ss = solve2(query, s); + if (debug) Console.println("solved " + query + " = " + ss); + ss + } + + def tryClause(c: Clause, q: Term, s: Subst): Stream[Subst] = { + if (debug) Console.println("trying " + c); + for (val s1 <- option2stream(unify(q, c.lhs, s)); + val s2 <- solve1(c.rhs, s1)) yield s2; + } + + solve1(query, List()) + } +} + +import Programs._; + +class Parser(s: String) { + val it = new Tokenizer(s, "(),.?"); + + var token: String = it.next; + + def syntaxError(msg: String): Unit = error(msg + ", but " + token + " found"); + + def rep[a](p: => a): List[a] = { + val t = p; + if (token == ",") { token = it.next; t :: rep(p) } else List(t) + } + + def constructor: Term = { + val a = token; + token = it.next; + Con(a, + if (token equals "(") { + token = it.next; + val ts: List[Term] = if (token equals ")") List() else rep(term); + if (token equals ")") token = it.next else syntaxError("`)' expected"); + ts + } else List()) + } + + def term: Term = { + val ch = token.charAt(0); + if ('A' <= ch && ch <= 'Z') { val a = token; token = it.next; Var(a) } + else if (it.isDelimiter(ch)) { syntaxError("term expected"); null } + else constructor + } + + def line: Clause = { + val result = + if (token equals "?") { + token = it.next; + Clause(NoTerm, rep(constructor)); + } else { + Clause( + constructor, + if (token equals ":-") { token = it.next; rep(constructor) } else List()) + } + if (token equals ".") token = it.next else syntaxError("`.' expected"); + result + } + + def all: List[Clause] = if (token equals "") List() else line :: all; +} + +object Prolog { + + def processor: String => Unit = { + var program: List[Clause] = List(); + var solutions: Stream[Subst] = Stream.empty; + var tvs: List[String] = List(); + { input => + new Parser(input).all foreach { c => + if (c.lhs == NoTerm) { + c.rhs match { + case List(Con("more", List())) => + solutions = solutions.tail; + case _ => + solutions = solve(c.rhs, program); + tvs = c.tyvars; + } + if (solutions.isEmpty) { + Console.println("no") + } else { + val s: Subst = solutions.head + .filter(b => tvs contains b.name) + .map(b => Binding(b.name, b.term map solutions.head)) + .reverse; + if (s.isEmpty) Console.println("yes") + else Console.println(s); + } + } else { + program = program ::: List(c); + } + } + } + } + + def process(code: String) = processor(code); +} + +//############################################################################ + +object Test { + def main(args: Array[String]): Unit = { + Prolog.process( + "sujet(jean).\n" + + "sujet(marie).\n" + + "verbe(mange).\n" + + "verbe(dort).\n" + + "article(le).\n" + + "article(la).\n" + + "adjectif(grand).\n" + + "adjectif(belle).\n" + + "nom(table).\n" + + "nom(cheval).\n" + + + "complement(A,D,N) :- article(A), adjectif(D), nom(N).\n" + + "phrase(S,V,A,D,N) :- sujet(S), verbe(V), complement(A,D,N).\n" + + + "?phrase(S,V,A,D,N).\n" + "?more.\n" + ); + Console.println; + + Prolog.process( + "sujet(jean).\n" + + "sujet(marie).\n" + + "verbe(mange).\n" + + "verbe(dort).\n" + + "article(le,m).\n" + + "article(la,f).\n" + + "adjectif(grand,m).\n" + + "adjectif(belle,f).\n" + + "nom(table,f).\n" + + "nom(cheval,m).\n" + + + "complement(A,D,N) :- article(A,G), adjectif(D,G), nom(N,G).\n" + + "phrase(S,V,A,D,N) :- sujet(S), verbe(V), complement(A,D,N).\n" + + + "?phrase(S,V,A,D,N).\n" + "?more.\n" + ); + Console.println; + + Prolog.process( + "sujet(jean).\n" + + "sujet(marie).\n" + + "verbe(mange).\n" + + "verbe(dort).\n" + + "article(le,m).\n" + + "article(la,f).\n" + + "adjectif(grand,m).\n" + + "adjectif(belle,f).\n" + + "nom(table,f).\n" + + "nom(cheval,m).\n" + + + "adjectifs(nil,G).\n" + + "adjectifs(cons(A1,nil),G) :- adjectif(A1,G).\n" + + "adjectifs(cons(A1,cons(A2,nil)),G) :- adjectif(A1,G),adjectif(A2,G).\n"+ + "complement(A,D,N) :- article(A,G), adjectifs(D,G), nom(N,G).\n" + + "phrase(S,V,A,D,N) :- sujet(S), verbe(V), complement(A,D,N).\n" + + + "?phrase(S,V,A,D,N).\n" + "?more.\n" + "?more.\n" + "?more.\n" + + + "?phrase(jean,mange,le,nil,cheval).\n" + + "?phrase(jean,mange,le,cons(grand,nil),cheval).\n" + + "?phrase(jean,mange,le,cons(grand,nil),table).\n" + ); + Console.println; + + () + } +} + +//############################################################################ diff --git a/test/files/run/NestedClasses.check b/test/files/run/NestedClasses.check new file mode 100644 index 0000000000..a7ebc386e0 --- /dev/null +++ b/test/files/run/NestedClasses.check @@ -0,0 +1,9 @@ +e.e1 = 119 +cc.m = 3 +cc.am = 1 +cc.bm = 2 +aaa.f = 111 +bbb1.f = 42 +bbb2.f = 24 +bbb3.f = 24 +bbb4.f = 24 diff --git a/test/files/run/NestedClasses.scala b/test/files/run/NestedClasses.scala new file mode 100644 index 0000000000..5a427144fc --- /dev/null +++ b/test/files/run/NestedClasses.scala @@ -0,0 +1,98 @@ +//############################################################################ +// Test nested classes +//############################################################################ +// $Id$ + +// The following set of classes tests nasty references to "outer" +// values. + +class A(pa : Int) { + def a1 = pa; + class B(pb : Int) { + def b1 = pa+pb+a1; + class C(pc : Int) extends A(b1) { + def c1 = pc+pb+pa + } + val c1 = new C(13) + } +} + +trait M { + def m1 = 1 +} + +class A1(x : Int) extends A(x) with M { + class D extends B(14) { + val c2 = new C(15); + class E extends C(16) { + def e1 = c1+b1+a1+m1; + def e2 = new D(); + } + } +} + +// The following set of classes test qualified "this" and "super" +// references. + +class AA { + def m = 1; + class BB { + def m = 2; + class CC { + def m = 3; + def am = AA.this.m; + def bm = BB.this.m; + } + } +} + +class AAA { + def f = 42; +} + +class BBB extends AAA { + override def f = 24; +} + +class AAA1 extends AAA { + override def f = 111; + class BBB1 extends BBB { + override def f = AAA1.super.f; + } + class BBB2 extends BBB { + override def f = BBB2.super.f; + } + class BBB3 extends BBB { + override def f = super.f; + } + class BBB4 extends BBB { } +} + +object Test { + def main(args: Array[String]): Unit = { + val a = new A1(12); + val d = new a.D; + val e = new d.E; + Console.println("e.e1 = " + e.e1); + + val aa = new AA; + val bb = new aa.BB; + val cc = new bb.CC; + Console.println("cc.m = " + cc.m); + Console.println("cc.am = " + cc.am); + Console.println("cc.bm = " + cc.bm); + + val aaa = new AAA1; + val bbb1 = new aaa.BBB1; + val bbb2 = new aaa.BBB2; + val bbb3 = new aaa.BBB3; + val bbb4 = new aaa.BBB4; + Console.println("aaa.f = " + aaa.f); + Console.println("bbb1.f = " + bbb1.f); + Console.println("bbb2.f = " + bbb2.f); + Console.println("bbb3.f = " + bbb3.f); + Console.println("bbb4.f = " + bbb4.f); + } +} + +//############################################################################ diff --git a/test/files/run/all.lst b/test/files/run/all.lst new file mode 100644 index 0000000000..5742905aa8 --- /dev/null +++ b/test/files/run/all.lst @@ -0,0 +1,32 @@ +arrays.scala +boolexprs.scala +bridges.scala +bugs.scala +constructors.scala +Course-2002-01.scala +Course-2002-02.scala +Course-2002-03.scala +Course-2002-04.scala +Course-2002-05.scala +Course-2002-06.scala +Course-2002-07.scala +Course-2002-08.scala +Course-2002-09.scala +Course-2002-10.scala +Course-2002-13.scala +enums.scala +exceptions.scala +imports.scala +iq.scala +iterators.scala +lisp.scala +lists.scala +literals.scala +map_test.scala +misc.scala +mixins.scala +NestedClasses.scala +overloads.scala +regularpatmat.scala +runtime.scala +tailcalls.scala diff --git a/test/files/run/arrays.check b/test/files/run/arrays.check new file mode 100644 index 0000000000..8a0c57deae --- /dev/null +++ b/test/files/run/arrays.check @@ -0,0 +1 @@ +checks: 2300 diff --git a/test/files/run/arrays.scala b/test/files/run/arrays.scala new file mode 100644 index 0000000000..eee62afcb3 --- /dev/null +++ b/test/files/run/arrays.scala @@ -0,0 +1,912 @@ +//############################################################################ +// Arrays +//############################################################################ +// $Id$ + +//############################################################################ + +object Test { + + //########################################################################## + // Types + + type Strings = List[String]; + type Map = scala.collection.Map[Int, Any]; + type HashMap = scala.collection.mutable.HashMap[Int, Any]; + type TreeMap = scala.collection.immutable.TreeMap[Int, Any]; + + //########################################################################## + // Identity Functions + + def id_Ta_T[T <: Any ](x: T): T = x; + def id_Tr_T[T <: AnyRef ](x: T): T = x; + def id_To_T[T <: Object ](x: T): T = x; + + def id_Ta_a[T <: Any ](x: T): Any = x; + def id_Tr_a[T <: AnyRef ](x: T): Any = x; + def id_To_a[T <: Object ](x: T): Any = x; + + def id_Tr_r[T <: AnyRef ](x: T): AnyRef = x; + def id_To_r[T <: Object ](x: T): AnyRef = x; + + def id_To_o[T <: Object ](x: T): Object = x; + + def id_TSa_T [S <: Any , T <: Array[S]](x: T): T = x; + def id_TSv_T [S <: AnyVal , T <: Array[S]](x: T): T = x; + def id_TSr_T [S <: AnyRef , T <: Array[S]](x: T): T = x; + def id_TSo_T [S <: Object , T <: Array[S]](x: T): T = x; + def id_TSm_T [S <: Map , T <: Array[S]](x: T): T = x; + def id_TSn_T [S <: Strings, T <: Array[S]](x: T): T = x; + + def id_TSa_Ss[S <: Any , T <: Array[S]](x: T): Array[S] = x; + def id_TSv_Ss[S <: AnyVal , T <: Array[S]](x: T): Array[S] = x; + def id_TSr_Ss[S <: AnyRef , T <: Array[S]](x: T): Array[S] = x; + def id_TSo_Ss[S <: Object , T <: Array[S]](x: T): Array[S] = x; + def id_TSm_Ss[S <: Map , T <: Array[S]](x: T): Array[S] = x; + def id_TSn_Ss[S <: Strings, T <: Array[S]](x: T): Array[S] = x; + + def id_TSa_a [S <: Any , T <: Array[S]](x: T): Any = x; + def id_TSv_a [S <: AnyVal , T <: Array[S]](x: T): Any = x; + def id_TSr_a [S <: AnyRef , T <: Array[S]](x: T): Any = x; + def id_TSo_a [S <: Object , T <: Array[S]](x: T): Any = x; + def id_TSm_a [S <: Map , T <: Array[S]](x: T): Any = x; + def id_TSn_a [S <: Strings, T <: Array[S]](x: T): Any = x; + + def id_TSa_r [S <: Any , T <: Array[S]](x: T): AnyRef = x; + def id_TSv_r [S <: AnyVal , T <: Array[S]](x: T): AnyRef = x; + def id_TSr_r [S <: AnyRef , T <: Array[S]](x: T): AnyRef = x; + def id_TSo_r [S <: Object , T <: Array[S]](x: T): AnyRef = x; + def id_TSm_r [S <: Map , T <: Array[S]](x: T): AnyRef = x; + def id_TSn_r [S <: Strings, T <: Array[S]](x: T): AnyRef = x; + + def id_TSa_o [S <: Any , T <: Array[S]](x: T): Object = x; + def id_TSv_o [S <: AnyVal , T <: Array[S]](x: T): Object = x; + def id_TSr_o [S <: AnyRef , T <: Array[S]](x: T): Object = x; + def id_TSo_o [S <: Object , T <: Array[S]](x: T): Object = x; + def id_TSm_o [S <: Map , T <: Array[S]](x: T): Object = x; + def id_TSn_o [S <: Strings, T <: Array[S]](x: T): Object = x; + + def id_Sas_Ss[S <: Any ](xs: Array[S]): Array[S] = xs; + def id_Svs_Ss[S <: AnyVal ](xs: Array[S]): Array[S] = xs; + def id_Srs_Ss[S <: AnyRef ](xs: Array[S]): Array[S] = xs; + def id_Sos_Ss[S <: Object ](xs: Array[S]): Array[S] = xs; + def id_Sms_Ss[S <: Map ](xs: Array[S]): Array[S] = xs; + def id_Sns_Ss[S <: Strings](xs: Array[S]): Array[S] = xs; + + def id_Sas_a [S <: Any ](xs: Array[S]): Any = xs; + def id_Svs_a [S <: AnyVal ](xs: Array[S]): Any = xs; + def id_Srs_a [S <: AnyRef ](xs: Array[S]): Any = xs; + def id_Sos_a [S <: Object ](xs: Array[S]): Any = xs; + def id_Sms_a [S <: Map ](xs: Array[S]): Any = xs; + def id_Sns_a [S <: Strings](xs: Array[S]): Any = xs; + + def id_Sas_r [S <: Any ](xs: Array[S]): AnyRef = xs; + def id_Svs_r [S <: AnyVal ](xs: Array[S]): AnyRef = xs; + def id_Srs_r [S <: AnyRef ](xs: Array[S]): AnyRef = xs; + def id_Sos_r [S <: Object ](xs: Array[S]): AnyRef = xs; + def id_Sms_r [S <: Map ](xs: Array[S]): AnyRef = xs; + def id_Sns_r [S <: Strings](xs: Array[S]): AnyRef = xs; + + def id_Sas_o [S <: Any ](xs: Array[S]): Object = xs; + def id_Svs_o [S <: AnyVal ](xs: Array[S]): Object = xs; + def id_Srs_o [S <: AnyRef ](xs: Array[S]): Object = xs; + def id_Sos_o [S <: Object ](xs: Array[S]): Object = xs; + def id_Sms_o [S <: Map ](xs: Array[S]): Object = xs; + def id_Sns_o [S <: Strings](xs: Array[S]): Object = xs; + + //########################################################################## + // Generic Checks + + type Check[T] = Array[T] => Unit; + + var checks: Int = 0; + + def check(test0: Boolean, actual: Any, expected: Any): Unit = { + val test1: Boolean = actual == expected; + if (!test0 || !test1) { + val s0 = if (test0) "ok" else "KO"; + val s1 = if (test1) "ok" else "KO"; + val s2 = actual.toString(); + val s3 = expected.toString(); + error(s0 + " - " + s1 + ": " + s2 + " != " + s3); + } + checks = checks + 1; + } + + def check_Ta[T <: Any ](xs: Array[T], l: Int, x0: T, c: Check[T]): Unit ={ + check(xs.length == l, xs.length, l); + check(xs(0) == x0, xs(0), x0); + c(xs); + } + + def check_Tv[T <: AnyVal ](xs: Array[T], l: Int, x0: T, c: Check[T]): Unit ={ + check(xs.length == l, xs.length, l); + check(xs(0) == x0, xs(0), x0); + check_Ta(xs, l, x0, c); + c(xs); + } + + def check_Tr[T <: AnyRef ](xs: Array[T], l: Int, x0: T, c: Check[T]): Unit ={ + check(xs.length == l, xs.length, l); + check(xs(0) == x0, xs(0), x0); + check_Ta(xs, l, x0, c); + c(xs); + } + + def check_To[T <: Object ](xs: Array[T], l: Int, x0: T, c: Check[T]): Unit ={ + check(xs.length == l, xs.length, l); + check(xs(0) == x0, xs(0), x0); + check_Ta(xs, l, x0, c); + check_Tr(xs, l, x0, c); + c(xs); + } + + def check_Tm[T <: Map ](xs: Array[T], l: Int, x0: T, c: Check[T]): Unit ={ + check(xs.length == l, xs.length, l); + check(xs(0) == x0, xs(0), x0); + check_Ta(xs, l, x0, c); + check_Tr(xs, l, x0, c); + check_To(xs, l, x0, c); + c(xs); + } + + def check_Tn[T <: Strings](xs: Array[T], l: Int, x0: T, c: Check[T]): Unit ={ + check(xs.length == l, xs.length, l); + check(xs(0) == x0, xs(0), x0); + check_Ta(xs, l, x0, c); + check_Tr(xs, l, x0, c); + check_To(xs, l, x0, c); + c(xs); + } + + //########################################################################## + // Values + + import scala.runtime.compat.Math._; + + val u0: Unit = (); + val u1: Unit = (); + + val z0: Boolean = false; + val z1: Boolean = true; + + val b0: Byte = MIN_BYTE; + val b1: Byte = 1; + val b2: Byte = MAX_BYTE; + + val s0: Short = MIN_SHORT; + val s1: Short = 2; + val s2: Short = MAX_SHORT; + + val c0: Char = MIN_CHAR; + val c1: Char = '3'; + val c2: Char = MAX_CHAR; + + val i0: Int = MIN_INT; + val i1: Int = 4; + val i2: Int = MAX_INT; + + val l0: Long = MIN_LONG; + val l1: Int = 5; + val l2: Long = MAX_LONG; + + val f0: Float = MIN_FLOAT; + val f1: Int = 6; + val f2: Float = MAX_FLOAT; + + val d0: Double = MIN_DOUBLE; + val d1: Int = 7; + val d2: Double = MAX_DOUBLE; + + val a0: Unit = (); + val a1: Boolean = false; + val a2: Int = 0; + val a3: AllRef = null; + val a4: String = "a-z"; + val a5: Symbol = 'token; + val a6: HashMap = new HashMap(); + val a7: TreeMap = scala.collection.immutable.TreeMap.Empty[Int, Any]; + val a8: Strings = List("a", "z"); + + val v0: Unit = (); + val v1: Boolean = false; + val v2: Int = 0; + val v3: Long = l2; + val v4: Float = f2; + val v5: Double = d2; + + val r0: AllRef = a3; + val r1: String = a4; + val r2: Symbol = a5; + val r3: HashMap = a6; + val r4: TreeMap = a7; + val r5: Strings = a8; + + val o0: AllRef = r0; + val o1: String = r1; + val o2: Symbol = r2; + val o3: HashMap = r3; + val o4: TreeMap = r4; + val o5: Strings = r5; + + val m0: AllRef = r0; + val m1: HashMap = r3; + val m2: TreeMap = r4; + + val n0: AllRef = r0; + val n1: Strings = r5; + val n2: Nil.type= Nil; + + //########################################################################## + // Specific Checks + + def ucheck(xs: Array[Unit ]): Unit = { + check(xs.length == 2, xs.length, 2); + check(xs(0) == u0, xs(0), u0); + check(xs(1) == u1, xs(1), u1); + } + + def zcheck(xs: Array[Boolean]): Unit = { + check(xs.length == 2, xs.length, 2); + check(xs(0) == z0, xs(0), z0); + check(xs(1) == z1, xs(1), z1); + } + + def bcheck(xs: Array[Byte ]): Unit = { + check(xs.length == 3, xs.length, 3); + check(xs(0) == b0, xs(0), b0); + check(xs(1) == b1, xs(1), b1); + check(xs(2) == b2, xs(2), b2); + } + + def scheck(xs: Array[Short ]): Unit = { + check(xs.length == 3, xs.length, 3); + check(xs(0) == s0, xs(0), s0); + check(xs(1) == s1, xs(1), s1); + check(xs(2) == s2, xs(2), s2); + } + + def ccheck(xs: Array[Char ]): Unit = { + check(xs.length == 3, xs.length, 3); + check(xs(0) == c0, xs(0), c0); + check(xs(1) == c1, xs(1), c1); + check(xs(2) == c2, xs(2), c2); + } + + def icheck(xs: Array[Int ]): Unit = { + check(xs.length == 3, xs.length, 3); + check(xs(0) == i0, xs(0), i0); + check(xs(1) == i1, xs(1), i1); + check(xs(2) == i2, xs(2), i2); + } + + def lcheck(xs: Array[Long ]): Unit = { + check(xs.length == 3, xs.length, 3); + check(xs(0) == l0, xs(0), l0); + check(xs(1) == l1, xs(1), l1: Long); // !!! : Long + check(xs(2) == l2, xs(2), l2); + } + + def fcheck(xs: Array[Float ]): Unit = { + check(xs.length == 3, xs.length, 3); + check(xs(0) == f0, xs(0), f0); + check(xs(1) == f1, xs(1), f1: Float); // !!! : Float + check(xs(2) == f2, xs(2), f2); + } + + def dcheck(xs: Array[Double ]): Unit = { + check(xs.length == 3, xs.length, 3); + check(xs(0) == d0, xs(0), d0); + check(xs(1) == d1, xs(1), d1: Double); // !!! : Double + check(xs(2) == d2, xs(2), d2); + } + + def rcheck(xs: Array[AnyRef ]): Unit = { + check(xs.length == 6, xs.length, 6); + check(xs(0) == r0, xs(0), r0); + check(xs(1) == r1, xs(1), r1); + check(xs(2) == r2, xs(2), r2); + check(xs(3) == r3, xs(3), r3); + check(xs(4) == r4, xs(4), r4); + check(xs(5) == r5, xs(5), r5); + } + + def ocheck(xs: Array[Object ]): Unit = { + check(xs.length == 6, xs.length, 6); + check(xs(0) == o0, xs(0), o0); + check(xs(1) == o1, xs(1), o1); + check(xs(2) == o2, xs(2), o2); + check(xs(3) == o3, xs(3), o3); + check(xs(4) == o4, xs(4), o4); + check(xs(5) == o5, xs(5), o5); + } + + def mcheck(xs: Array[Map ]): Unit = { + check(xs.length == 3, xs.length, 3); + check(xs(0) == m0, xs(0), m0); + check(xs(1) == m1, xs(1), m1); + check(xs(2) == m2, xs(2), m2); + } + + def ncheck(xs: Array[Strings]): Unit = { + check(xs.length == 3, xs.length, 3); + check(xs(0) == n0, xs(0), n0); + check(xs(1) == n1, xs(1), n1); + check(xs(2) == n2, xs(2), n2); + } + + //########################################################################## + // Arrays + + val uarray: Array[Unit ] = Array(u0, u1); + val zarray: Array[Boolean] = Array(z0, z1); + val barray: Array[Byte ] = Array(b0, b1, b2); + val sarray: Array[Short ] = Array(s0, s1, s2); + val carray: Array[Char ] = Array(c0, c1, c2); + val iarray: Array[Int ] = Array(i0, i1, i2); + val larray: Array[Long ] = Array(l0, l1, l2); + val farray: Array[Float ] = Array(f0, f1, f2); + val darray: Array[Double ] = Array(d0, d1, d2); + val rarray: Array[AnyRef ] = Array(r0, r1, r2, r4, r4, r5); + val oarray: Array[Object ] = Array(o0, o1, o2, o4, o4, o5); + val marray: Array[Map ] = Array(m0, m1, m2); + val narray: Array[Strings] = Array(n0, n1, n2); + + //########################################################################## + // Main + + def main(args: Array[String]): Unit = { + + //###################################################################### + + ucheck(uarray); + zcheck(zarray); + bcheck(barray); + scheck(sarray); + ccheck(carray); + icheck(iarray); + lcheck(larray); + fcheck(farray); + dcheck(darray); + rcheck(rarray); + ocheck(oarray); + mcheck(marray); + ncheck(narray); + + //###################################################################### + + ucheck(id_Ta_T(uarray)); + zcheck(id_Ta_T(zarray)); + bcheck(id_Ta_T(barray)); + scheck(id_Ta_T(sarray)); + ccheck(id_Ta_T(carray)); + icheck(id_Ta_T(iarray)); + lcheck(id_Ta_T(larray)); + fcheck(id_Ta_T(farray)); + dcheck(id_Ta_T(darray)); + rcheck(id_Ta_T(rarray)); + ocheck(id_Ta_T(oarray)); + mcheck(id_Ta_T(marray)); + ncheck(id_Ta_T(narray)); + + ucheck(id_Tr_T(uarray)); + zcheck(id_Tr_T(zarray)); + bcheck(id_Tr_T(barray)); + scheck(id_Tr_T(sarray)); + ccheck(id_Tr_T(carray)); + icheck(id_Tr_T(iarray)); + lcheck(id_Tr_T(larray)); + fcheck(id_Tr_T(farray)); + dcheck(id_Tr_T(darray)); + rcheck(id_Tr_T(rarray)); + ocheck(id_Tr_T(oarray)); + mcheck(id_Tr_T(marray)); + ncheck(id_Tr_T(narray)); + + ucheck(id_To_T(uarray)); + zcheck(id_To_T(zarray)); + bcheck(id_To_T(barray)); + scheck(id_To_T(sarray)); + ccheck(id_To_T(carray)); + icheck(id_To_T(iarray)); + lcheck(id_To_T(larray)); + fcheck(id_To_T(farray)); + dcheck(id_To_T(darray)); + rcheck(id_To_T(rarray)); + ocheck(id_To_T(oarray)); + mcheck(id_To_T(marray)); + ncheck(id_To_T(narray)); + + ucheck(id_Ta_a(uarray).asInstanceOf[Array[Unit ]]); + zcheck(id_Ta_a(zarray).asInstanceOf[Array[Boolean]]); + bcheck(id_Ta_a(barray).asInstanceOf[Array[Byte ]]); + scheck(id_Ta_a(sarray).asInstanceOf[Array[Short ]]); + ccheck(id_Ta_a(carray).asInstanceOf[Array[Char ]]); + icheck(id_Ta_a(iarray).asInstanceOf[Array[Int ]]); + lcheck(id_Ta_a(larray).asInstanceOf[Array[Long ]]); + fcheck(id_Ta_a(farray).asInstanceOf[Array[Float ]]); + dcheck(id_Ta_a(darray).asInstanceOf[Array[Double ]]); + rcheck(id_Ta_a(rarray).asInstanceOf[Array[AnyRef ]]); + ocheck(id_Ta_a(oarray).asInstanceOf[Array[Object ]]); + mcheck(id_Ta_a(marray).asInstanceOf[Array[Map ]]); + ncheck(id_Ta_a(narray).asInstanceOf[Array[Strings]]); + + ucheck(id_Tr_a(uarray).asInstanceOf[Array[Unit ]]); + zcheck(id_Tr_a(zarray).asInstanceOf[Array[Boolean]]); + bcheck(id_Tr_a(barray).asInstanceOf[Array[Byte ]]); + scheck(id_Tr_a(sarray).asInstanceOf[Array[Short ]]); + ccheck(id_Tr_a(carray).asInstanceOf[Array[Char ]]); + icheck(id_Tr_a(iarray).asInstanceOf[Array[Int ]]); + lcheck(id_Tr_a(larray).asInstanceOf[Array[Long ]]); + fcheck(id_Tr_a(farray).asInstanceOf[Array[Float ]]); + dcheck(id_Tr_a(darray).asInstanceOf[Array[Double ]]); + rcheck(id_Tr_a(rarray).asInstanceOf[Array[AnyRef ]]); + ocheck(id_Tr_a(oarray).asInstanceOf[Array[Object ]]); + mcheck(id_Tr_a(marray).asInstanceOf[Array[Map ]]); + ncheck(id_Tr_a(narray).asInstanceOf[Array[Strings]]); + + ucheck(id_To_a(uarray).asInstanceOf[Array[Unit ]]); + zcheck(id_To_a(zarray).asInstanceOf[Array[Boolean]]); + bcheck(id_To_a(barray).asInstanceOf[Array[Byte ]]); + scheck(id_To_a(sarray).asInstanceOf[Array[Short ]]); + ccheck(id_To_a(carray).asInstanceOf[Array[Char ]]); + icheck(id_To_a(iarray).asInstanceOf[Array[Int ]]); + lcheck(id_To_a(larray).asInstanceOf[Array[Long ]]); + fcheck(id_To_a(farray).asInstanceOf[Array[Float ]]); + dcheck(id_To_a(darray).asInstanceOf[Array[Double ]]); + rcheck(id_To_a(rarray).asInstanceOf[Array[AnyRef ]]); + ocheck(id_To_a(oarray).asInstanceOf[Array[Object ]]); + mcheck(id_To_a(marray).asInstanceOf[Array[Map ]]); + ncheck(id_To_a(narray).asInstanceOf[Array[Strings]]); + + ucheck(id_Tr_r(uarray).asInstanceOf[Array[Unit ]]); + zcheck(id_Tr_r(zarray).asInstanceOf[Array[Boolean]]); + bcheck(id_Tr_r(barray).asInstanceOf[Array[Byte ]]); + scheck(id_Tr_r(sarray).asInstanceOf[Array[Short ]]); + ccheck(id_Tr_r(carray).asInstanceOf[Array[Char ]]); + icheck(id_Tr_r(iarray).asInstanceOf[Array[Int ]]); + lcheck(id_Tr_r(larray).asInstanceOf[Array[Long ]]); + fcheck(id_Tr_r(farray).asInstanceOf[Array[Float ]]); + dcheck(id_Tr_r(darray).asInstanceOf[Array[Double ]]); + rcheck(id_Tr_r(rarray).asInstanceOf[Array[AnyRef ]]); + ocheck(id_Tr_r(oarray).asInstanceOf[Array[Object ]]); + mcheck(id_Tr_r(marray).asInstanceOf[Array[Map ]]); + ncheck(id_Tr_r(narray).asInstanceOf[Array[Strings]]); + + ucheck(id_To_r(uarray).asInstanceOf[Array[Unit ]]); + zcheck(id_To_r(zarray).asInstanceOf[Array[Boolean]]); + bcheck(id_To_r(barray).asInstanceOf[Array[Byte ]]); + scheck(id_To_r(sarray).asInstanceOf[Array[Short ]]); + ccheck(id_To_r(carray).asInstanceOf[Array[Char ]]); + icheck(id_To_r(iarray).asInstanceOf[Array[Int ]]); + lcheck(id_To_r(larray).asInstanceOf[Array[Long ]]); + fcheck(id_To_r(farray).asInstanceOf[Array[Float ]]); + dcheck(id_To_r(darray).asInstanceOf[Array[Double ]]); + rcheck(id_To_r(rarray).asInstanceOf[Array[AnyRef ]]); + ocheck(id_To_r(oarray).asInstanceOf[Array[Object ]]); + mcheck(id_To_r(marray).asInstanceOf[Array[Map ]]); + ncheck(id_To_r(narray).asInstanceOf[Array[Strings]]); + + ucheck(id_To_o(uarray).asInstanceOf[Array[Unit ]]); + zcheck(id_To_o(zarray).asInstanceOf[Array[Boolean]]); + bcheck(id_To_o(barray).asInstanceOf[Array[Byte ]]); + scheck(id_To_o(sarray).asInstanceOf[Array[Short ]]); + ccheck(id_To_o(carray).asInstanceOf[Array[Char ]]); + icheck(id_To_o(iarray).asInstanceOf[Array[Int ]]); + lcheck(id_To_o(larray).asInstanceOf[Array[Long ]]); + fcheck(id_To_o(farray).asInstanceOf[Array[Float ]]); + dcheck(id_To_o(darray).asInstanceOf[Array[Double ]]); + rcheck(id_To_o(rarray).asInstanceOf[Array[AnyRef ]]); + ocheck(id_To_o(oarray).asInstanceOf[Array[Object ]]); + mcheck(id_To_o(marray).asInstanceOf[Array[Map ]]); + ncheck(id_To_o(narray).asInstanceOf[Array[Strings]]); + + //###################################################################### + + ucheck(id_TSa_T [Unit , Array[Unit ]](uarray)); + zcheck(id_TSa_T [Boolean, Array[Boolean]](zarray)); + bcheck(id_TSa_T [Byte , Array[Byte ]](barray)); + scheck(id_TSa_T [Short , Array[Short ]](sarray)); + ccheck(id_TSa_T [Char , Array[Char ]](carray)); + icheck(id_TSa_T [Int , Array[Int ]](iarray)); + lcheck(id_TSa_T [Long , Array[Long ]](larray)); + fcheck(id_TSa_T [Float , Array[Float ]](farray)); + dcheck(id_TSa_T [Double , Array[Double ]](darray)); + rcheck(id_TSa_T [AnyRef , Array[AnyRef ]](rarray)); + ocheck(id_TSa_T [Object , Array[Object ]](oarray)); + mcheck(id_TSa_T [Map , Array[Map ]](marray)); + ncheck(id_TSa_T [Strings, Array[Strings]](narray)); + + ucheck(id_TSv_T [Unit , Array[Unit ]](uarray)); + zcheck(id_TSv_T [Boolean, Array[Boolean]](zarray)); + bcheck(id_TSv_T [Byte , Array[Byte ]](barray)); + scheck(id_TSv_T [Short , Array[Short ]](sarray)); + ccheck(id_TSv_T [Char , Array[Char ]](carray)); + icheck(id_TSv_T [Int , Array[Int ]](iarray)); + lcheck(id_TSv_T [Long , Array[Long ]](larray)); + fcheck(id_TSv_T [Float , Array[Float ]](farray)); + dcheck(id_TSv_T [Double , Array[Double ]](darray)); + + rcheck(id_TSr_T [AnyRef , Array[AnyRef ]](rarray)); + ocheck(id_TSr_T [Object , Array[Object ]](oarray)); + mcheck(id_TSr_T [Map , Array[Map ]](marray)); + ncheck(id_TSr_T [Strings, Array[Strings]](narray)); + + rcheck(id_TSo_T [AnyRef , Array[AnyRef ]](rarray)); + ocheck(id_TSo_T [Object , Array[Object ]](oarray)); + mcheck(id_TSo_T [Map , Array[Map ]](marray)); + ncheck(id_TSo_T [Strings, Array[Strings]](narray)); + + mcheck(id_TSm_T [Map , Array[Map ]](marray)); + + ncheck(id_TSn_T [Strings, Array[Strings]](narray)); + + //###################################################################### + + ucheck(id_TSa_Ss[Unit , Array[Unit ]](uarray)); + zcheck(id_TSa_Ss[Boolean, Array[Boolean]](zarray)); + bcheck(id_TSa_Ss[Byte , Array[Byte ]](barray)); + scheck(id_TSa_Ss[Short , Array[Short ]](sarray)); + ccheck(id_TSa_Ss[Char , Array[Char ]](carray)); + icheck(id_TSa_Ss[Int , Array[Int ]](iarray)); + lcheck(id_TSa_Ss[Long , Array[Long ]](larray)); + fcheck(id_TSa_Ss[Float , Array[Float ]](farray)); + dcheck(id_TSa_Ss[Double , Array[Double ]](darray)); + rcheck(id_TSa_Ss[AnyRef , Array[AnyRef ]](rarray)); + ocheck(id_TSa_Ss[Object , Array[Object ]](oarray)); + mcheck(id_TSa_Ss[Map , Array[Map ]](marray)); + ncheck(id_TSa_Ss[Strings, Array[Strings]](narray)); + + ucheck(id_TSv_Ss[Unit , Array[Unit ]](uarray)); + zcheck(id_TSv_Ss[Boolean, Array[Boolean]](zarray)); + bcheck(id_TSv_Ss[Byte , Array[Byte ]](barray)); + scheck(id_TSv_Ss[Short , Array[Short ]](sarray)); + ccheck(id_TSv_Ss[Char , Array[Char ]](carray)); + icheck(id_TSv_Ss[Int , Array[Int ]](iarray)); + lcheck(id_TSv_Ss[Long , Array[Long ]](larray)); + fcheck(id_TSv_Ss[Float , Array[Float ]](farray)); + dcheck(id_TSv_Ss[Double , Array[Double ]](darray)); + + rcheck(id_TSr_Ss[AnyRef , Array[AnyRef ]](rarray)); + ocheck(id_TSr_Ss[Object , Array[Object ]](oarray)); + mcheck(id_TSr_Ss[Map , Array[Map ]](marray)); + ncheck(id_TSr_Ss[Strings, Array[Strings]](narray)); + + rcheck(id_TSo_Ss[AnyRef , Array[AnyRef ]](rarray)); + ocheck(id_TSo_Ss[Object , Array[Object ]](oarray)); + mcheck(id_TSo_Ss[Map , Array[Map ]](marray)); + ncheck(id_TSo_Ss[Strings, Array[Strings]](narray)); + + mcheck(id_TSm_Ss[Map , Array[Map ]](marray)); + + ncheck(id_TSn_Ss[Strings, Array[Strings]](narray)); + + //###################################################################### + + ucheck(id_TSa_a [Unit , Array[Unit ]](uarray).asInstanceOf[Array[Unit ]]); + zcheck(id_TSa_a [Boolean, Array[Boolean]](zarray).asInstanceOf[Array[Boolean]]); + bcheck(id_TSa_a [Byte , Array[Byte ]](barray).asInstanceOf[Array[Byte ]]); + scheck(id_TSa_a [Short , Array[Short ]](sarray).asInstanceOf[Array[Short ]]); + ccheck(id_TSa_a [Char , Array[Char ]](carray).asInstanceOf[Array[Char ]]); + icheck(id_TSa_a [Int , Array[Int ]](iarray).asInstanceOf[Array[Int ]]); + lcheck(id_TSa_a [Long , Array[Long ]](larray).asInstanceOf[Array[Long ]]); + fcheck(id_TSa_a [Float , Array[Float ]](farray).asInstanceOf[Array[Float ]]); + dcheck(id_TSa_a [Double , Array[Double ]](darray).asInstanceOf[Array[Double ]]); + rcheck(id_TSa_a [AnyRef , Array[AnyRef ]](rarray).asInstanceOf[Array[AnyRef ]]); + ocheck(id_TSa_a [Object , Array[Object ]](oarray).asInstanceOf[Array[Object ]]); + mcheck(id_TSa_a [Map , Array[Map ]](marray).asInstanceOf[Array[Map ]]); + ncheck(id_TSa_a [Strings, Array[Strings]](narray).asInstanceOf[Array[Strings]]); + + ucheck(id_TSv_a [Unit , Array[Unit ]](uarray).asInstanceOf[Array[Unit ]]); + zcheck(id_TSv_a [Boolean, Array[Boolean]](zarray).asInstanceOf[Array[Boolean]]); + bcheck(id_TSv_a [Byte , Array[Byte ]](barray).asInstanceOf[Array[Byte ]]); + scheck(id_TSv_a [Short , Array[Short ]](sarray).asInstanceOf[Array[Short ]]); + ccheck(id_TSv_a [Char , Array[Char ]](carray).asInstanceOf[Array[Char ]]); + icheck(id_TSv_a [Int , Array[Int ]](iarray).asInstanceOf[Array[Int ]]); + lcheck(id_TSv_a [Long , Array[Long ]](larray).asInstanceOf[Array[Long ]]); + fcheck(id_TSv_a [Float , Array[Float ]](farray).asInstanceOf[Array[Float ]]); + dcheck(id_TSv_a [Double , Array[Double ]](darray).asInstanceOf[Array[Double ]]); + + rcheck(id_TSr_a [AnyRef , Array[AnyRef ]](rarray).asInstanceOf[Array[AnyRef ]]); + ocheck(id_TSr_a [Object , Array[Object ]](oarray).asInstanceOf[Array[Object ]]); + mcheck(id_TSr_a [Map , Array[Map ]](marray).asInstanceOf[Array[Map ]]); + ncheck(id_TSr_a [Strings, Array[Strings]](narray).asInstanceOf[Array[Strings]]); + + rcheck(id_TSo_a [AnyRef , Array[AnyRef ]](rarray).asInstanceOf[Array[AnyRef ]]); + ocheck(id_TSo_a [Object , Array[Object ]](oarray).asInstanceOf[Array[Object ]]); + mcheck(id_TSo_a [Map , Array[Map ]](marray).asInstanceOf[Array[Map ]]); + ncheck(id_TSo_a [Strings, Array[Strings]](narray).asInstanceOf[Array[Strings]]); + + mcheck(id_TSm_a [Map , Array[Map ]](marray).asInstanceOf[Array[Map ]]); + + ncheck(id_TSn_a [Strings, Array[Strings]](narray).asInstanceOf[Array[Strings]]); + + //###################################################################### + + ucheck(id_TSa_r [Unit , Array[Unit ]](uarray).asInstanceOf[Array[Unit ]]); + zcheck(id_TSa_r [Boolean, Array[Boolean]](zarray).asInstanceOf[Array[Boolean]]); + bcheck(id_TSa_r [Byte , Array[Byte ]](barray).asInstanceOf[Array[Byte ]]); + scheck(id_TSa_r [Short , Array[Short ]](sarray).asInstanceOf[Array[Short ]]); + ccheck(id_TSa_r [Char , Array[Char ]](carray).asInstanceOf[Array[Char ]]); + icheck(id_TSa_r [Int , Array[Int ]](iarray).asInstanceOf[Array[Int ]]); + lcheck(id_TSa_r [Long , Array[Long ]](larray).asInstanceOf[Array[Long ]]); + fcheck(id_TSa_r [Float , Array[Float ]](farray).asInstanceOf[Array[Float ]]); + dcheck(id_TSa_r [Double , Array[Double ]](darray).asInstanceOf[Array[Double ]]); + rcheck(id_TSa_r [AnyRef , Array[AnyRef ]](rarray).asInstanceOf[Array[AnyRef ]]); + ocheck(id_TSa_r [Object , Array[Object ]](oarray).asInstanceOf[Array[Object ]]); + mcheck(id_TSa_r [Map , Array[Map ]](marray).asInstanceOf[Array[Map ]]); + ncheck(id_TSa_r [Strings, Array[Strings]](narray).asInstanceOf[Array[Strings]]); + + ucheck(id_TSv_r [Unit , Array[Unit ]](uarray).asInstanceOf[Array[Unit ]]); + zcheck(id_TSv_r [Boolean, Array[Boolean]](zarray).asInstanceOf[Array[Boolean]]); + bcheck(id_TSv_r [Byte , Array[Byte ]](barray).asInstanceOf[Array[Byte ]]); + scheck(id_TSv_r [Short , Array[Short ]](sarray).asInstanceOf[Array[Short ]]); + ccheck(id_TSv_r [Char , Array[Char ]](carray).asInstanceOf[Array[Char ]]); + icheck(id_TSv_r [Int , Array[Int ]](iarray).asInstanceOf[Array[Int ]]); + lcheck(id_TSv_r [Long , Array[Long ]](larray).asInstanceOf[Array[Long ]]); + fcheck(id_TSv_r [Float , Array[Float ]](farray).asInstanceOf[Array[Float ]]); + dcheck(id_TSv_r [Double , Array[Double ]](darray).asInstanceOf[Array[Double ]]); + + rcheck(id_TSr_r [AnyRef , Array[AnyRef ]](rarray).asInstanceOf[Array[AnyRef ]]); + ocheck(id_TSr_r [Object , Array[Object ]](oarray).asInstanceOf[Array[Object ]]); + mcheck(id_TSr_r [Map , Array[Map ]](marray).asInstanceOf[Array[Map ]]); + ncheck(id_TSr_r [Strings, Array[Strings]](narray).asInstanceOf[Array[Strings]]); + + rcheck(id_TSo_r [AnyRef , Array[AnyRef ]](rarray).asInstanceOf[Array[AnyRef ]]); + ocheck(id_TSo_r [Object , Array[Object ]](oarray).asInstanceOf[Array[Object ]]); + mcheck(id_TSo_r [Map , Array[Map ]](marray).asInstanceOf[Array[Map ]]); + ncheck(id_TSo_r [Strings, Array[Strings]](narray).asInstanceOf[Array[Strings]]); + + mcheck(id_TSm_r [Map , Array[Map ]](marray).asInstanceOf[Array[Map ]]); + + ncheck(id_TSn_r [Strings, Array[Strings]](narray).asInstanceOf[Array[Strings]]); + + //###################################################################### + + ucheck(id_TSa_o [Unit , Array[Unit ]](uarray).asInstanceOf[Array[Unit ]]); + zcheck(id_TSa_o [Boolean, Array[Boolean]](zarray).asInstanceOf[Array[Boolean]]); + bcheck(id_TSa_o [Byte , Array[Byte ]](barray).asInstanceOf[Array[Byte ]]); + scheck(id_TSa_o [Short , Array[Short ]](sarray).asInstanceOf[Array[Short ]]); + ccheck(id_TSa_o [Char , Array[Char ]](carray).asInstanceOf[Array[Char ]]); + icheck(id_TSa_o [Int , Array[Int ]](iarray).asInstanceOf[Array[Int ]]); + lcheck(id_TSa_o [Long , Array[Long ]](larray).asInstanceOf[Array[Long ]]); + fcheck(id_TSa_o [Float , Array[Float ]](farray).asInstanceOf[Array[Float ]]); + dcheck(id_TSa_o [Double , Array[Double ]](darray).asInstanceOf[Array[Double ]]); + rcheck(id_TSa_o [AnyRef , Array[AnyRef ]](rarray).asInstanceOf[Array[AnyRef ]]); + ocheck(id_TSa_o [Object , Array[Object ]](oarray).asInstanceOf[Array[Object ]]); + mcheck(id_TSa_o [Map , Array[Map ]](marray).asInstanceOf[Array[Map ]]); + ncheck(id_TSa_o [Strings, Array[Strings]](narray).asInstanceOf[Array[Strings]]); + + ucheck(id_TSv_o [Unit , Array[Unit ]](uarray).asInstanceOf[Array[Unit ]]); + zcheck(id_TSv_o [Boolean, Array[Boolean]](zarray).asInstanceOf[Array[Boolean]]); + bcheck(id_TSv_o [Byte , Array[Byte ]](barray).asInstanceOf[Array[Byte ]]); + scheck(id_TSv_o [Short , Array[Short ]](sarray).asInstanceOf[Array[Short ]]); + ccheck(id_TSv_o [Char , Array[Char ]](carray).asInstanceOf[Array[Char ]]); + icheck(id_TSv_o [Int , Array[Int ]](iarray).asInstanceOf[Array[Int ]]); + lcheck(id_TSv_o [Long , Array[Long ]](larray).asInstanceOf[Array[Long ]]); + fcheck(id_TSv_o [Float , Array[Float ]](farray).asInstanceOf[Array[Float ]]); + dcheck(id_TSv_o [Double , Array[Double ]](darray).asInstanceOf[Array[Double ]]); + + rcheck(id_TSr_o [AnyRef , Array[AnyRef ]](rarray).asInstanceOf[Array[AnyRef ]]); + ocheck(id_TSr_o [Object , Array[Object ]](oarray).asInstanceOf[Array[Object ]]); + mcheck(id_TSr_o [Map , Array[Map ]](marray).asInstanceOf[Array[Map ]]); + ncheck(id_TSr_o [Strings, Array[Strings]](narray).asInstanceOf[Array[Strings]]); + + rcheck(id_TSo_o [AnyRef , Array[AnyRef ]](rarray).asInstanceOf[Array[AnyRef ]]); + ocheck(id_TSo_o [Object , Array[Object ]](oarray).asInstanceOf[Array[Object ]]); + mcheck(id_TSo_o [Map , Array[Map ]](marray).asInstanceOf[Array[Map ]]); + ncheck(id_TSo_o [Strings, Array[Strings]](narray).asInstanceOf[Array[Strings]]); + + mcheck(id_TSm_o [Map , Array[Map ]](marray).asInstanceOf[Array[Map ]]); + + ncheck(id_TSn_o [Strings, Array[Strings]](narray).asInstanceOf[Array[Strings]]); + + //###################################################################### + + ucheck(id_Sas_Ss[Unit ](uarray)); + zcheck(id_Sas_Ss[Boolean](zarray)); + bcheck(id_Sas_Ss[Byte ](barray)); + scheck(id_Sas_Ss[Short ](sarray)); + ccheck(id_Sas_Ss[Char ](carray)); + icheck(id_Sas_Ss[Int ](iarray)); + lcheck(id_Sas_Ss[Long ](larray)); + fcheck(id_Sas_Ss[Float ](farray)); + dcheck(id_Sas_Ss[Double ](darray)); + rcheck(id_Sas_Ss[AnyRef ](rarray)); + ocheck(id_Sas_Ss[Object ](oarray)); + mcheck(id_Sas_Ss[Map ](marray)); + ncheck(id_Sas_Ss[Strings](narray)); + + ucheck(id_Svs_Ss[Unit ](uarray)); + zcheck(id_Svs_Ss[Boolean](zarray)); + bcheck(id_Svs_Ss[Byte ](barray)); + scheck(id_Svs_Ss[Short ](sarray)); + ccheck(id_Svs_Ss[Char ](carray)); + icheck(id_Svs_Ss[Int ](iarray)); + lcheck(id_Svs_Ss[Long ](larray)); + fcheck(id_Svs_Ss[Float ](farray)); + dcheck(id_Svs_Ss[Double ](darray)); + + rcheck(id_Srs_Ss[AnyRef ](rarray)); + ocheck(id_Srs_Ss[Object ](oarray)); + mcheck(id_Srs_Ss[Map ](marray)); + ncheck(id_Srs_Ss[Strings](narray)); + + rcheck(id_Sos_Ss[AnyRef ](rarray)); + ocheck(id_Sos_Ss[Object ](oarray)); + mcheck(id_Sos_Ss[Map ](marray)); + ncheck(id_Sos_Ss[Strings](narray)); + + mcheck(id_Sms_Ss[Map ](marray)); + + ncheck(id_Sns_Ss[Strings](narray)); + + //###################################################################### + + ucheck(id_TSa_a [Unit , Array[Unit ]](uarray).asInstanceOf[Array[Unit ]]); + zcheck(id_TSa_a [Boolean, Array[Boolean]](zarray).asInstanceOf[Array[Boolean]]); + bcheck(id_TSa_a [Byte , Array[Byte ]](barray).asInstanceOf[Array[Byte ]]); + scheck(id_TSa_a [Short , Array[Short ]](sarray).asInstanceOf[Array[Short ]]); + ccheck(id_TSa_a [Char , Array[Char ]](carray).asInstanceOf[Array[Char ]]); + icheck(id_TSa_a [Int , Array[Int ]](iarray).asInstanceOf[Array[Int ]]); + lcheck(id_TSa_a [Long , Array[Long ]](larray).asInstanceOf[Array[Long ]]); + fcheck(id_TSa_a [Float , Array[Float ]](farray).asInstanceOf[Array[Float ]]); + dcheck(id_TSa_a [Double , Array[Double ]](darray).asInstanceOf[Array[Double ]]); + rcheck(id_TSa_a [AnyRef , Array[AnyRef ]](rarray).asInstanceOf[Array[AnyRef ]]); + ocheck(id_TSa_a [Object , Array[Object ]](oarray).asInstanceOf[Array[Object ]]); + mcheck(id_TSa_a [Map , Array[Map ]](marray).asInstanceOf[Array[Map ]]); + ncheck(id_TSa_a [Strings, Array[Strings]](narray).asInstanceOf[Array[Strings]]); + + ucheck(id_TSv_a [Unit , Array[Unit ]](uarray).asInstanceOf[Array[Unit ]]); + zcheck(id_TSv_a [Boolean, Array[Boolean]](zarray).asInstanceOf[Array[Boolean]]); + bcheck(id_TSv_a [Byte , Array[Byte ]](barray).asInstanceOf[Array[Byte ]]); + scheck(id_TSv_a [Short , Array[Short ]](sarray).asInstanceOf[Array[Short ]]); + ccheck(id_TSv_a [Char , Array[Char ]](carray).asInstanceOf[Array[Char ]]); + icheck(id_TSv_a [Int , Array[Int ]](iarray).asInstanceOf[Array[Int ]]); + lcheck(id_TSv_a [Long , Array[Long ]](larray).asInstanceOf[Array[Long ]]); + fcheck(id_TSv_a [Float , Array[Float ]](farray).asInstanceOf[Array[Float ]]); + dcheck(id_TSv_a [Double , Array[Double ]](darray).asInstanceOf[Array[Double ]]); + + rcheck(id_TSr_a [AnyRef , Array[AnyRef ]](rarray).asInstanceOf[Array[AnyRef ]]); + ocheck(id_TSr_a [Object , Array[Object ]](oarray).asInstanceOf[Array[Object ]]); + mcheck(id_TSr_a [Map , Array[Map ]](marray).asInstanceOf[Array[Map ]]); + ncheck(id_TSr_a [Strings, Array[Strings]](narray).asInstanceOf[Array[Strings]]); + + rcheck(id_TSo_a [AnyRef , Array[AnyRef ]](rarray).asInstanceOf[Array[AnyRef ]]); + ocheck(id_TSo_a [Object , Array[Object ]](oarray).asInstanceOf[Array[Object ]]); + mcheck(id_TSo_a [Map , Array[Map ]](marray).asInstanceOf[Array[Map ]]); + ncheck(id_TSo_a [Strings, Array[Strings]](narray).asInstanceOf[Array[Strings]]); + + mcheck(id_TSm_a [Map , Array[Map ]](marray).asInstanceOf[Array[Map ]]); + + ncheck(id_TSn_a [Strings, Array[Strings]](narray).asInstanceOf[Array[Strings]]); + + //###################################################################### + + ucheck(id_TSa_r [Unit , Array[Unit ]](uarray).asInstanceOf[Array[Unit ]]); + zcheck(id_TSa_r [Boolean, Array[Boolean]](zarray).asInstanceOf[Array[Boolean]]); + bcheck(id_TSa_r [Byte , Array[Byte ]](barray).asInstanceOf[Array[Byte ]]); + scheck(id_TSa_r [Short , Array[Short ]](sarray).asInstanceOf[Array[Short ]]); + ccheck(id_TSa_r [Char , Array[Char ]](carray).asInstanceOf[Array[Char ]]); + icheck(id_TSa_r [Int , Array[Int ]](iarray).asInstanceOf[Array[Int ]]); + lcheck(id_TSa_r [Long , Array[Long ]](larray).asInstanceOf[Array[Long ]]); + fcheck(id_TSa_r [Float , Array[Float ]](farray).asInstanceOf[Array[Float ]]); + dcheck(id_TSa_r [Double , Array[Double ]](darray).asInstanceOf[Array[Double ]]); + rcheck(id_TSa_r [AnyRef , Array[AnyRef ]](rarray).asInstanceOf[Array[AnyRef ]]); + ocheck(id_TSa_r [Object , Array[Object ]](oarray).asInstanceOf[Array[Object ]]); + mcheck(id_TSa_r [Map , Array[Map ]](marray).asInstanceOf[Array[Map ]]); + ncheck(id_TSa_r [Strings, Array[Strings]](narray).asInstanceOf[Array[Strings]]); + + ucheck(id_TSv_r [Unit , Array[Unit ]](uarray).asInstanceOf[Array[Unit ]]); + zcheck(id_TSv_r [Boolean, Array[Boolean]](zarray).asInstanceOf[Array[Boolean]]); + bcheck(id_TSv_r [Byte , Array[Byte ]](barray).asInstanceOf[Array[Byte ]]); + scheck(id_TSv_r [Short , Array[Short ]](sarray).asInstanceOf[Array[Short ]]); + ccheck(id_TSv_r [Char , Array[Char ]](carray).asInstanceOf[Array[Char ]]); + icheck(id_TSv_r [Int , Array[Int ]](iarray).asInstanceOf[Array[Int ]]); + lcheck(id_TSv_r [Long , Array[Long ]](larray).asInstanceOf[Array[Long ]]); + fcheck(id_TSv_r [Float , Array[Float ]](farray).asInstanceOf[Array[Float ]]); + dcheck(id_TSv_r [Double , Array[Double ]](darray).asInstanceOf[Array[Double ]]); + + rcheck(id_TSr_r [AnyRef , Array[AnyRef ]](rarray).asInstanceOf[Array[AnyRef ]]); + ocheck(id_TSr_r [Object , Array[Object ]](oarray).asInstanceOf[Array[Object ]]); + mcheck(id_TSr_r [Map , Array[Map ]](marray).asInstanceOf[Array[Map ]]); + ncheck(id_TSr_r [Strings, Array[Strings]](narray).asInstanceOf[Array[Strings]]); + + rcheck(id_TSo_r [AnyRef , Array[AnyRef ]](rarray).asInstanceOf[Array[AnyRef ]]); + ocheck(id_TSo_r [Object , Array[Object ]](oarray).asInstanceOf[Array[Object ]]); + mcheck(id_TSo_r [Map , Array[Map ]](marray).asInstanceOf[Array[Map ]]); + ncheck(id_TSo_r [Strings, Array[Strings]](narray).asInstanceOf[Array[Strings]]); + + mcheck(id_TSm_r [Map , Array[Map ]](marray).asInstanceOf[Array[Map ]]); + + ncheck(id_TSn_r [Strings, Array[Strings]](narray).asInstanceOf[Array[Strings]]); + + //###################################################################### + + ucheck(id_TSa_o [Unit , Array[Unit ]](uarray).asInstanceOf[Array[Unit ]]); + zcheck(id_TSa_o [Boolean, Array[Boolean]](zarray).asInstanceOf[Array[Boolean]]); + bcheck(id_TSa_o [Byte , Array[Byte ]](barray).asInstanceOf[Array[Byte ]]); + scheck(id_TSa_o [Short , Array[Short ]](sarray).asInstanceOf[Array[Short ]]); + ccheck(id_TSa_o [Char , Array[Char ]](carray).asInstanceOf[Array[Char ]]); + icheck(id_TSa_o [Int , Array[Int ]](iarray).asInstanceOf[Array[Int ]]); + lcheck(id_TSa_o [Long , Array[Long ]](larray).asInstanceOf[Array[Long ]]); + fcheck(id_TSa_o [Float , Array[Float ]](farray).asInstanceOf[Array[Float ]]); + dcheck(id_TSa_o [Double , Array[Double ]](darray).asInstanceOf[Array[Double ]]); + rcheck(id_TSa_o [AnyRef , Array[AnyRef ]](rarray).asInstanceOf[Array[AnyRef ]]); + ocheck(id_TSa_o [Object , Array[Object ]](oarray).asInstanceOf[Array[Object ]]); + mcheck(id_TSa_o [Map , Array[Map ]](marray).asInstanceOf[Array[Map ]]); + ncheck(id_TSa_o [Strings, Array[Strings]](narray).asInstanceOf[Array[Strings]]); + + ucheck(id_TSv_o [Unit , Array[Unit ]](uarray).asInstanceOf[Array[Unit ]]); + zcheck(id_TSv_o [Boolean, Array[Boolean]](zarray).asInstanceOf[Array[Boolean]]); + bcheck(id_TSv_o [Byte , Array[Byte ]](barray).asInstanceOf[Array[Byte ]]); + scheck(id_TSv_o [Short , Array[Short ]](sarray).asInstanceOf[Array[Short ]]); + ccheck(id_TSv_o [Char , Array[Char ]](carray).asInstanceOf[Array[Char ]]); + icheck(id_TSv_o [Int , Array[Int ]](iarray).asInstanceOf[Array[Int ]]); + lcheck(id_TSv_o [Long , Array[Long ]](larray).asInstanceOf[Array[Long ]]); + fcheck(id_TSv_o [Float , Array[Float ]](farray).asInstanceOf[Array[Float ]]); + dcheck(id_TSv_o [Double , Array[Double ]](darray).asInstanceOf[Array[Double ]]); + + rcheck(id_TSr_o [AnyRef , Array[AnyRef ]](rarray).asInstanceOf[Array[AnyRef ]]); + ocheck(id_TSr_o [Object , Array[Object ]](oarray).asInstanceOf[Array[Object ]]); + mcheck(id_TSr_o [Map , Array[Map ]](marray).asInstanceOf[Array[Map ]]); + ncheck(id_TSr_o [Strings, Array[Strings]](narray).asInstanceOf[Array[Strings]]); + + rcheck(id_TSo_o [AnyRef , Array[AnyRef ]](rarray).asInstanceOf[Array[AnyRef ]]); + ocheck(id_TSo_o [Object , Array[Object ]](oarray).asInstanceOf[Array[Object ]]); + mcheck(id_TSo_o [Map , Array[Map ]](marray).asInstanceOf[Array[Map ]]); + ncheck(id_TSo_o [Strings, Array[Strings]](narray).asInstanceOf[Array[Strings]]); + + mcheck(id_TSm_o [Map , Array[Map ]](marray).asInstanceOf[Array[Map ]]); + + ncheck(id_TSn_o [Strings, Array[Strings]](narray).asInstanceOf[Array[Strings]]); + + //###################################################################### + + check_Ta(uarray, 2, u0, ucheck); + check_Ta(zarray, 2, z0, zcheck); + check_Ta(barray, 3, b0, bcheck); + check_Ta(sarray, 3, s0, scheck); + check_Ta(carray, 3, c0, ccheck); + check_Ta(iarray, 3, i0, icheck); + check_Ta(larray, 3, l0, lcheck); + check_Ta(farray, 3, f0, fcheck); + check_Ta(darray, 3, d0, dcheck); + check_Ta(rarray, 6, r0, rcheck); + check_Ta(oarray, 6, o0, ocheck); + check_Ta(marray, 3, m0, mcheck); + check_Ta(narray, 3, n0, ncheck); + + check_Tv(uarray, 2, u0, ucheck); + check_Tv(zarray, 2, z0, zcheck); + check_Tv(barray, 3, b0, bcheck); + check_Tv(sarray, 3, s0, scheck); + check_Tv(carray, 3, c0, ccheck); + check_Tv(iarray, 3, i0, icheck); + check_Tv(larray, 3, l0, lcheck); + check_Tv(farray, 3, f0, fcheck); + check_Tv(darray, 3, d0, dcheck); + + check_Tr(rarray, 6, r0, rcheck); + check_Tr(oarray, 6, o0, ocheck); + check_Tr(marray, 3, m0, mcheck); + check_Tr(narray, 3, n0, ncheck); + + check_To(rarray, 6, r0, rcheck); + check_To(oarray, 6, o0, ocheck); + check_To(marray, 3, m0, mcheck); + check_To(narray, 3, n0, ncheck); + + check_Tm(marray, 3, m0, mcheck); + + check_Tn(narray, 3, n0, ncheck); + + //###################################################################### + + Console.println("checks: " + checks); + + //###################################################################### + } + + //########################################################################## +} diff --git a/test/files/run/boolexprs.check b/test/files/run/boolexprs.check new file mode 100644 index 0000000000..cd2c735894 --- /dev/null +++ b/test/files/run/boolexprs.check @@ -0,0 +1,3 @@ +test Test1 was successful +test Test2 was successful + diff --git a/test/files/run/boolexprs.scala b/test/files/run/boolexprs.scala new file mode 100644 index 0000000000..7080f84b56 --- /dev/null +++ b/test/files/run/boolexprs.scala @@ -0,0 +1,61 @@ +//############################################################################ +// Boolean Expressions +//############################################################################ +// $Id$ + +class Counter { + private var n: Int = 0; + def incrThen(b: Boolean) = if (b) n = n + 1; + def value = n; +} + +object Test1 { + var flag = false; + def flip: boolean = { val tmp = flag; flag = !flag; tmp } + def run: Int = { + val c = new Counter; + c.incrThen(flip || flip); + c.value + } +} + +object Test2 { + val a = Array(false); + + def run: Int = { + val c = new Counter; + c.incrThen(true && a(0)); + c.incrThen(false || Nil.length > 0); + c.value + } +} + +//############################################################################ +// Test code + +object Test { + def check_success(name: String, closure: => Int, expected: Int): Unit = { + Console.print("test " + name); + try { + val actual: Int = closure; + if (actual == expected) { + Console.print(" was successful"); + } else { + Console.print(" failed: expected "+ expected +", found "+ actual); + } + } catch { + case exception: Throwable => { + Console.print(" raised exception " + exception); + } + } + Console.println; + } + + def main(args: Array[String]): Unit = { + check_success("Test1", Test1.run, 1); + check_success("Test2", Test2.run, 0); + Console.println; + } +} + +//############################################################################ diff --git a/test/files/run/bridges.scala b/test/files/run/bridges.scala new file mode 100644 index 0000000000..bf3781fde0 --- /dev/null +++ b/test/files/run/bridges.scala @@ -0,0 +1,7123 @@ +//############################################################################ +// Test bridge methods +//############################################################################ +// $Id$ + +class A; +class B; +class C; +class D; + +object Help { + val max: Int = 4; + var next: Int = 0; + var vars: Array[String] = new Array[String](max); + def init: Unit = { + var i = 0; + while (i < max) { vars(i) = null; i = i + 1; } + next = 0; + } + def check(count: Int, value: String): Boolean = { + var b: Boolean = true; + var i: Int = 0; + while (i < count) { if (vars(i) != value) b = false; i = i + 1; } + while (i < max) { if (vars(i) != null) b = false; i = i + 1; } + b; + } + def print: Unit = { + var i = 0; + while (i < max) { if (i > 0) Console.print(", "); Console.print(vars(i)); i = i + 1; } + } + def foo = { vars(next) = "foo"; next = next + 1; } + def bar = { vars(next) = "bar"; next = next + 1; } + def mix = { vars(next) = "mix"; next = next + 1; } + def sub = { vars(next) = "sub"; next = next + 1; } +} + +import Help.foo; +import Help.bar; +import Help.mix; +import Help.sub; + +abstract class Foo___ { type I<:AnyRef; def f: I ; f; } +abstract class Foo__f { type I<:AnyRef; def f: I = {foo; null}; f; } +abstract class Foo_I_ { class I ; def f: I ; f; } +abstract class Foo_If { class I ; def f: I = {foo; null}; f; } +abstract class FooX__[X] { type I<:AnyRef; def f: I ; f; } +abstract class FooX_f[X] { type I<:AnyRef; def f: I = {foo; null}; f; } +abstract class FooXI_[X] { class I ; def f: I ; f; } +abstract class FooXIf[X] { class I ; def f: I = {foo; null}; f; } + +trait Bar___ { type I<:AnyRef; def f: I ; f; } +trait Bar__f { type I<:AnyRef; def f: I = {bar; null}; f; } +trait Bar_I_ { class I ; def f: I ; f; } +trait Bar_If { class I ; def f: I = {bar; null}; f; } +trait BarY__[Y] { type I<:AnyRef; def f: I ; f; } +trait BarY_f[Y] { type I<:AnyRef; def f: I = {bar; null}; f; } +trait BarYI_[Y] { class I ; def f: I ; f; } +trait BarYIf[Y] { class I ; def f: I = {bar; null}; f; } + + +/* */abstract class Mix___eFoo___ extends Foo___ { ; ; f; } +/* */abstract class Mix___eFoo___wBar___ extends Foo___ with Bar___ { ; ; f; } +/* */abstract class Mix___eFoo___wBar__f extends Foo___ with Bar__f { ; ; f; } +/* */abstract class Mix___eFoo___wBar_I_ extends Foo___ with Bar_I_ { ; ; f; } +/* *//* */ class Mix___eFoo___wBar_If extends Foo___ with Bar_If { ; ; f; } +/* */abstract class Mix___eFoo___wBarY__ extends Foo___ with BarY__[B] { ; ; f; } +/* */abstract class Mix___eFoo___wBarY_f extends Foo___ with BarY_f[B] { ; ; f; } +/* */abstract class Mix___eFoo___wBarYI_ extends Foo___ with BarYI_[B] { ; ; f; } +/* *//* */ class Mix___eFoo___wBarYIf extends Foo___ with BarYIf[B] { ; ; f; } +/* */abstract class Mix___eFoo__f extends Foo__f { ; ; f; } +/* */abstract class Mix___eFoo__fwBar___ extends Foo__f with Bar___ { ; ; f; } +// */abstract class Mix___eFoo__fwBar__f extends Foo__f with Bar__f { ; ; f; } +/* *//* */ class Mix___eFoo__fwBar_I_ extends Foo__f with Bar_I_ { ; ; f; } +// *//* */ class Mix___eFoo__fwBar_If extends Foo__f with Bar_If { ; ; f; } +/* */abstract class Mix___eFoo__fwBarY__ extends Foo__f with BarY__[B] { ; ; f; } +// */abstract class Mix___eFoo__fwBarY_f extends Foo__f with BarY_f[B] { ; ; f; } +/* *//* */ class Mix___eFoo__fwBarYI_ extends Foo__f with BarYI_[B] { ; ; f; } +// *//* */ class Mix___eFoo__fwBarYIf extends Foo__f with BarYIf[B] { ; ; f; } +/* */abstract class Mix___eFoo_I_ extends Foo_I_ { ; ; f; } +/* */abstract class Mix___eFoo_I_wBar___ extends Foo_I_ with Bar___ { ; ; f; } +/* *//* */ class Mix___eFoo_I_wBar__f extends Foo_I_ with Bar__f { ; ; f; } +// */abstract class Mix___eFoo_I_wBar_I_ extends Foo_I_ with Bar_I_ { ; ; f; } +// *//* */ class Mix___eFoo_I_wBar_If extends Foo_I_ with Bar_If { ; ; f; } +/* */abstract class Mix___eFoo_I_wBarY__ extends Foo_I_ with BarY__[B] { ; ; f; } +/* *//* */ class Mix___eFoo_I_wBarY_f extends Foo_I_ with BarY_f[B] { ; ; f; } +// */abstract class Mix___eFoo_I_wBarYI_ extends Foo_I_ with BarYI_[B] { ; ; f; } +// *//* */ class Mix___eFoo_I_wBarYIf extends Foo_I_ with BarYIf[B] { ; ; f; } +/* *//* */ class Mix___eFoo_If extends Foo_If { ; ; f; } +/* *//* */ class Mix___eFoo_IfwBar___ extends Foo_If with Bar___ { ; ; f; } +// *//* */ class Mix___eFoo_IfwBar__f extends Foo_If with Bar__f { ; ; f; } +// *//* */ class Mix___eFoo_IfwBar_I_ extends Foo_If with Bar_I_ { ; ; f; } +// *//* */ class Mix___eFoo_IfwBar_If extends Foo_If with Bar_If { ; ; f; } +/* *//* */ class Mix___eFoo_IfwBarY__ extends Foo_If with BarY__[B] { ; ; f; } +// *//* */ class Mix___eFoo_IfwBarY_f extends Foo_If with BarY_f[B] { ; ; f; } +// *//* */ class Mix___eFoo_IfwBarYI_ extends Foo_If with BarYI_[B] { ; ; f; } +// *//* */ class Mix___eFoo_IfwBarYIf extends Foo_If with BarYIf[B] { ; ; f; } +/* */abstract class Mix___eFooX__ extends FooX__[A] { ; ; f; } +/* */abstract class Mix___eFooX__wBar___ extends FooX__[A] with Bar___ { ; ; f; } +/* */abstract class Mix___eFooX__wBar__f extends FooX__[A] with Bar__f { ; ; f; } +/* */abstract class Mix___eFooX__wBar_I_ extends FooX__[A] with Bar_I_ { ; ; f; } +/* *//* */ class Mix___eFooX__wBar_If extends FooX__[A] with Bar_If { ; ; f; } +/* */abstract class Mix___eFooX__wBarY__ extends FooX__[A] with BarY__[B] { ; ; f; } +/* */abstract class Mix___eFooX__wBarY_f extends FooX__[A] with BarY_f[B] { ; ; f; } +/* */abstract class Mix___eFooX__wBarYI_ extends FooX__[A] with BarYI_[B] { ; ; f; } +/* *//* */ class Mix___eFooX__wBarYIf extends FooX__[A] with BarYIf[B] { ; ; f; } +/* */abstract class Mix___eFooX_f extends FooX_f[A] { ; ; f; } +/* */abstract class Mix___eFooX_fwBar___ extends FooX_f[A] with Bar___ { ; ; f; } +// */abstract class Mix___eFooX_fwBar__f extends FooX_f[A] with Bar__f { ; ; f; } +/* *//* */ class Mix___eFooX_fwBar_I_ extends FooX_f[A] with Bar_I_ { ; ; f; } +// *//* */ class Mix___eFooX_fwBar_If extends FooX_f[A] with Bar_If { ; ; f; } +/* */abstract class Mix___eFooX_fwBarY__ extends FooX_f[A] with BarY__[B] { ; ; f; } +// */abstract class Mix___eFooX_fwBarY_f extends FooX_f[A] with BarY_f[B] { ; ; f; } +/* *//* */ class Mix___eFooX_fwBarYI_ extends FooX_f[A] with BarYI_[B] { ; ; f; } +// *//* */ class Mix___eFooX_fwBarYIf extends FooX_f[A] with BarYIf[B] { ; ; f; } +/* */abstract class Mix___eFooXI_ extends FooXI_[A] { ; ; f; } +/* */abstract class Mix___eFooXI_wBar___ extends FooXI_[A] with Bar___ { ; ; f; } +/* *//* */ class Mix___eFooXI_wBar__f extends FooXI_[A] with Bar__f { ; ; f; } +// */abstract class Mix___eFooXI_wBar_I_ extends FooXI_[A] with Bar_I_ { ; ; f; } +// *//* */ class Mix___eFooXI_wBar_If extends FooXI_[A] with Bar_If { ; ; f; } +/* */abstract class Mix___eFooXI_wBarY__ extends FooXI_[A] with BarY__[B] { ; ; f; } +/* *//* */ class Mix___eFooXI_wBarY_f extends FooXI_[A] with BarY_f[B] { ; ; f; } +// */abstract class Mix___eFooXI_wBarYI_ extends FooXI_[A] with BarYI_[B] { ; ; f; } +// *//* */ class Mix___eFooXI_wBarYIf extends FooXI_[A] with BarYIf[B] { ; ; f; } +/* *//* */ class Mix___eFooXIf extends FooXIf[A] { ; ; f; } +/* *//* */ class Mix___eFooXIfwBar___ extends FooXIf[A] with Bar___ { ; ; f; } +// *//* */ class Mix___eFooXIfwBar__f extends FooXIf[A] with Bar__f { ; ; f; } +// *//* */ class Mix___eFooXIfwBar_I_ extends FooXIf[A] with Bar_I_ { ; ; f; } +// *//* */ class Mix___eFooXIfwBar_If extends FooXIf[A] with Bar_If { ; ; f; } +/* *//* */ class Mix___eFooXIfwBarY__ extends FooXIf[A] with BarY__[B] { ; ; f; } +// *//* */ class Mix___eFooXIfwBarY_f extends FooXIf[A] with BarY_f[B] { ; ; f; } +// *//* */ class Mix___eFooXIfwBarYI_ extends FooXIf[A] with BarYI_[B] { ; ; f; } +// *//* */ class Mix___eFooXIfwBarYIf extends FooXIf[A] with BarYIf[B] { ; ; f; } + +/* */abstract class Mix__feFoo___ extends Foo___ { ; def f: I = {mix; null}; f; } +/* */abstract class Mix__feFoo___wBar___ extends Foo___ with Bar___ { ; def f: I = {mix; null}; f; } +/* */abstract class Mix__feFoo___wBar__f extends Foo___ with Bar__f { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFoo___wBar_I_ extends Foo___ with Bar_I_ { ; def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFoo___wBar_If extends Foo___ with Bar_If { ; override def f: I = {mix; null}; f; } +/* */abstract class Mix__feFoo___wBarY__ extends Foo___ with BarY__[B] { ; def f: I = {mix; null}; f; } +/* */abstract class Mix__feFoo___wBarY_f extends Foo___ with BarY_f[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFoo___wBarYI_ extends Foo___ with BarYI_[B] { ; def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFoo___wBarYIf extends Foo___ with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* */abstract class Mix__feFoo__f extends Foo__f { ; override def f: I = {mix; null}; f; } +/* */abstract class Mix__feFoo__fwBar___ extends Foo__f with Bar___ { ; override def f: I = {mix; null}; f; } +/* */abstract class Mix__feFoo__fwBar__f extends Foo__f with Bar__f { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFoo__fwBar_I_ extends Foo__f with Bar_I_ { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFoo__fwBar_If extends Foo__f with Bar_If { ; override def f: I = {mix; null}; f; } +/* */abstract class Mix__feFoo__fwBarY__ extends Foo__f with BarY__[B] { ; override def f: I = {mix; null}; f; } +/* */abstract class Mix__feFoo__fwBarY_f extends Foo__f with BarY_f[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFoo__fwBarYI_ extends Foo__f with BarYI_[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFoo__fwBarYIf extends Foo__f with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFoo_I_ extends Foo_I_ { ; def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFoo_I_wBar___ extends Foo_I_ with Bar___ { ; def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFoo_I_wBar__f extends Foo_I_ with Bar__f { ; override def f: I = {mix; null}; f; } +// *//* */ class Mix__feFoo_I_wBar_I_ extends Foo_I_ with Bar_I_ { ; def f: I = {mix; null}; f; } +// *//* */ class Mix__feFoo_I_wBar_If extends Foo_I_ with Bar_If { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFoo_I_wBarY__ extends Foo_I_ with BarY__[B] { ; def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFoo_I_wBarY_f extends Foo_I_ with BarY_f[B] { ; override def f: I = {mix; null}; f; } +// *//* */ class Mix__feFoo_I_wBarYI_ extends Foo_I_ with BarYI_[B] { ; def f: I = {mix; null}; f; } +// *//* */ class Mix__feFoo_I_wBarYIf extends Foo_I_ with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFoo_If extends Foo_If { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFoo_IfwBar___ extends Foo_If with Bar___ { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFoo_IfwBar__f extends Foo_If with Bar__f { ; override def f: I = {mix; null}; f; } +// *//* */ class Mix__feFoo_IfwBar_I_ extends Foo_If with Bar_I_ { ; override def f: I = {mix; null}; f; } +// *//* */ class Mix__feFoo_IfwBar_If extends Foo_If with Bar_If { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFoo_IfwBarY__ extends Foo_If with BarY__[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFoo_IfwBarY_f extends Foo_If with BarY_f[B] { ; override def f: I = {mix; null}; f; } +// *//* */ class Mix__feFoo_IfwBarYI_ extends Foo_If with BarYI_[B] { ; override def f: I = {mix; null}; f; } +// *//* */ class Mix__feFoo_IfwBarYIf extends Foo_If with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* */abstract class Mix__feFooX__ extends FooX__[A] { ; def f: I = {mix; null}; f; } +/* */abstract class Mix__feFooX__wBar___ extends FooX__[A] with Bar___ { ; def f: I = {mix; null}; f; } +/* */abstract class Mix__feFooX__wBar__f extends FooX__[A] with Bar__f { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFooX__wBar_I_ extends FooX__[A] with Bar_I_ { ; def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFooX__wBar_If extends FooX__[A] with Bar_If { ; override def f: I = {mix; null}; f; } +/* */abstract class Mix__feFooX__wBarY__ extends FooX__[A] with BarY__[B] { ; def f: I = {mix; null}; f; } +/* */abstract class Mix__feFooX__wBarY_f extends FooX__[A] with BarY_f[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFooX__wBarYI_ extends FooX__[A] with BarYI_[B] { ; def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFooX__wBarYIf extends FooX__[A] with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* */abstract class Mix__feFooX_f extends FooX_f[A] { ; override def f: I = {mix; null}; f; } +/* */abstract class Mix__feFooX_fwBar___ extends FooX_f[A] with Bar___ { ; override def f: I = {mix; null}; f; } +/* */abstract class Mix__feFooX_fwBar__f extends FooX_f[A] with Bar__f { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFooX_fwBar_I_ extends FooX_f[A] with Bar_I_ { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFooX_fwBar_If extends FooX_f[A] with Bar_If { ; override def f: I = {mix; null}; f; } +/* */abstract class Mix__feFooX_fwBarY__ extends FooX_f[A] with BarY__[B] { ; override def f: I = {mix; null}; f; } +/* */abstract class Mix__feFooX_fwBarY_f extends FooX_f[A] with BarY_f[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFooX_fwBarYI_ extends FooX_f[A] with BarYI_[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFooX_fwBarYIf extends FooX_f[A] with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFooXI_ extends FooXI_[A] { ; def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFooXI_wBar___ extends FooXI_[A] with Bar___ { ; def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFooXI_wBar__f extends FooXI_[A] with Bar__f { ; override def f: I = {mix; null}; f; } +// *//* */ class Mix__feFooXI_wBar_I_ extends FooXI_[A] with Bar_I_ { ; def f: I = {mix; null}; f; } +// *//* */ class Mix__feFooXI_wBar_If extends FooXI_[A] with Bar_If { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFooXI_wBarY__ extends FooXI_[A] with BarY__[B] { ; def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFooXI_wBarY_f extends FooXI_[A] with BarY_f[B] { ; override def f: I = {mix; null}; f; } +// *//* */ class Mix__feFooXI_wBarYI_ extends FooXI_[A] with BarYI_[B] { ; def f: I = {mix; null}; f; } +// *//* */ class Mix__feFooXI_wBarYIf extends FooXI_[A] with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFooXIf extends FooXIf[A] { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFooXIfwBar___ extends FooXIf[A] with Bar___ { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFooXIfwBar__f extends FooXIf[A] with Bar__f { ; override def f: I = {mix; null}; f; } +// *//* */ class Mix__feFooXIfwBar_I_ extends FooXIf[A] with Bar_I_ { ; override def f: I = {mix; null}; f; } +// *//* */ class Mix__feFooXIfwBar_If extends FooXIf[A] with Bar_If { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFooXIfwBarY__ extends FooXIf[A] with BarY__[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__feFooXIfwBarY_f extends FooXIf[A] with BarY_f[B] { ; override def f: I = {mix; null}; f; } +// *//* */ class Mix__feFooXIfwBarYI_ extends FooXIf[A] with BarYI_[B] { ; override def f: I = {mix; null}; f; } +// *//* */ class Mix__feFooXIfwBarYIf extends FooXIf[A] with BarYIf[B] { ; override def f: I = {mix; null}; f; } + +/* */abstract class Mix_I_eFoo___ extends Foo___ { class I; ; f; } +/* */abstract class Mix_I_eFoo___wBar___ extends Foo___ with Bar___ { class I; ; f; } +/* *//* */ class Mix_I_eFoo___wBar__f extends Foo___ with Bar__f { class I; ; f; } +// */abstract class Mix_I_eFoo___wBar_I_ extends Foo___ with Bar_I_ { class I; ; f; } +// *//* */ class Mix_I_eFoo___wBar_If extends Foo___ with Bar_If { class I; ; f; } +/* */abstract class Mix_I_eFoo___wBarY__ extends Foo___ with BarY__[B] { class I; ; f; } +/* *//* */ class Mix_I_eFoo___wBarY_f extends Foo___ with BarY_f[B] { class I; ; f; } +// */abstract class Mix_I_eFoo___wBarYI_ extends Foo___ with BarYI_[B] { class I; ; f; } +// *//* */ class Mix_I_eFoo___wBarYIf extends Foo___ with BarYIf[B] { class I; ; f; } +/* *//* */ class Mix_I_eFoo__f extends Foo__f { class I; ; f; } +/* *//* */ class Mix_I_eFoo__fwBar___ extends Foo__f with Bar___ { class I; ; f; } +// *//* */ class Mix_I_eFoo__fwBar__f extends Foo__f with Bar__f { class I; ; f; } +// *//* */ class Mix_I_eFoo__fwBar_I_ extends Foo__f with Bar_I_ { class I; ; f; } +// *//* */ class Mix_I_eFoo__fwBar_If extends Foo__f with Bar_If { class I; ; f; } +/* *//* */ class Mix_I_eFoo__fwBarY__ extends Foo__f with BarY__[B] { class I; ; f; } +// *//* */ class Mix_I_eFoo__fwBarY_f extends Foo__f with BarY_f[B] { class I; ; f; } +// *//* */ class Mix_I_eFoo__fwBarYI_ extends Foo__f with BarYI_[B] { class I; ; f; } +// *//* */ class Mix_I_eFoo__fwBarYIf extends Foo__f with BarYIf[B] { class I; ; f; } +// */abstract class Mix_I_eFoo_I_ extends Foo_I_ { class I; ; f; } +// */abstract class Mix_I_eFoo_I_wBar___ extends Foo_I_ with Bar___ { class I; ; f; } +// *//* */ class Mix_I_eFoo_I_wBar__f extends Foo_I_ with Bar__f { class I; ; f; } +// */abstract class Mix_I_eFoo_I_wBar_I_ extends Foo_I_ with Bar_I_ { class I; ; f; } +// *//* */ class Mix_I_eFoo_I_wBar_If extends Foo_I_ with Bar_If { class I; ; f; } +// */abstract class Mix_I_eFoo_I_wBarY__ extends Foo_I_ with BarY__[B] { class I; ; f; } +// *//* */ class Mix_I_eFoo_I_wBarY_f extends Foo_I_ with BarY_f[B] { class I; ; f; } +// */abstract class Mix_I_eFoo_I_wBarYI_ extends Foo_I_ with BarYI_[B] { class I; ; f; } +// *//* */ class Mix_I_eFoo_I_wBarYIf extends Foo_I_ with BarYIf[B] { class I; ; f; } +// *//* */ class Mix_I_eFoo_If extends Foo_If { class I; ; f; } +// *//* */ class Mix_I_eFoo_IfwBar___ extends Foo_If with Bar___ { class I; ; f; } +// *//* */ class Mix_I_eFoo_IfwBar__f extends Foo_If with Bar__f { class I; ; f; } +// *//* */ class Mix_I_eFoo_IfwBar_I_ extends Foo_If with Bar_I_ { class I; ; f; } +// *//* */ class Mix_I_eFoo_IfwBar_If extends Foo_If with Bar_If { class I; ; f; } +// *//* */ class Mix_I_eFoo_IfwBarY__ extends Foo_If with BarY__[B] { class I; ; f; } +// *//* */ class Mix_I_eFoo_IfwBarY_f extends Foo_If with BarY_f[B] { class I; ; f; } +// *//* */ class Mix_I_eFoo_IfwBarYI_ extends Foo_If with BarYI_[B] { class I; ; f; } +// *//* */ class Mix_I_eFoo_IfwBarYIf extends Foo_If with BarYIf[B] { class I; ; f; } +/* */abstract class Mix_I_eFooX__ extends FooX__[A] { class I; ; f; } +/* */abstract class Mix_I_eFooX__wBar___ extends FooX__[A] with Bar___ { class I; ; f; } +/* *//* */ class Mix_I_eFooX__wBar__f extends FooX__[A] with Bar__f { class I; ; f; } +// */abstract class Mix_I_eFooX__wBar_I_ extends FooX__[A] with Bar_I_ { class I; ; f; } +// *//* */ class Mix_I_eFooX__wBar_If extends FooX__[A] with Bar_If { class I; ; f; } +/* */abstract class Mix_I_eFooX__wBarY__ extends FooX__[A] with BarY__[B] { class I; ; f; } +/* *//* */ class Mix_I_eFooX__wBarY_f extends FooX__[A] with BarY_f[B] { class I; ; f; } +// */abstract class Mix_I_eFooX__wBarYI_ extends FooX__[A] with BarYI_[B] { class I; ; f; } +// *//* */ class Mix_I_eFooX__wBarYIf extends FooX__[A] with BarYIf[B] { class I; ; f; } +/* *//* */ class Mix_I_eFooX_f extends FooX_f[A] { class I; ; f; } +/* *//* */ class Mix_I_eFooX_fwBar___ extends FooX_f[A] with Bar___ { class I; ; f; } +// *//* */ class Mix_I_eFooX_fwBar__f extends FooX_f[A] with Bar__f { class I; ; f; } +// *//* */ class Mix_I_eFooX_fwBar_I_ extends FooX_f[A] with Bar_I_ { class I; ; f; } +// *//* */ class Mix_I_eFooX_fwBar_If extends FooX_f[A] with Bar_If { class I; ; f; } +/* *//* */ class Mix_I_eFooX_fwBarY__ extends FooX_f[A] with BarY__[B] { class I; ; f; } +// *//* */ class Mix_I_eFooX_fwBarY_f extends FooX_f[A] with BarY_f[B] { class I; ; f; } +// *//* */ class Mix_I_eFooX_fwBarYI_ extends FooX_f[A] with BarYI_[B] { class I; ; f; } +// *//* */ class Mix_I_eFooX_fwBarYIf extends FooX_f[A] with BarYIf[B] { class I; ; f; } +// */abstract class Mix_I_eFooXI_ extends FooXI_[A] { class I; ; f; } +// */abstract class Mix_I_eFooXI_wBar___ extends FooXI_[A] with Bar___ { class I; ; f; } +// *//* */ class Mix_I_eFooXI_wBar__f extends FooXI_[A] with Bar__f { class I; ; f; } +// */abstract class Mix_I_eFooXI_wBar_I_ extends FooXI_[A] with Bar_I_ { class I; ; f; } +// *//* */ class Mix_I_eFooXI_wBar_If extends FooXI_[A] with Bar_If { class I; ; f; } +// */abstract class Mix_I_eFooXI_wBarY__ extends FooXI_[A] with BarY__[B] { class I; ; f; } +// *//* */ class Mix_I_eFooXI_wBarY_f extends FooXI_[A] with BarY_f[B] { class I; ; f; } +// */abstract class Mix_I_eFooXI_wBarYI_ extends FooXI_[A] with BarYI_[B] { class I; ; f; } +// *//* */ class Mix_I_eFooXI_wBarYIf extends FooXI_[A] with BarYIf[B] { class I; ; f; } +// *//* */ class Mix_I_eFooXIf extends FooXIf[A] { class I; ; f; } +// *//* */ class Mix_I_eFooXIfwBar___ extends FooXIf[A] with Bar___ { class I; ; f; } +// *//* */ class Mix_I_eFooXIfwBar__f extends FooXIf[A] with Bar__f { class I; ; f; } +// *//* */ class Mix_I_eFooXIfwBar_I_ extends FooXIf[A] with Bar_I_ { class I; ; f; } +// *//* */ class Mix_I_eFooXIfwBar_If extends FooXIf[A] with Bar_If { class I; ; f; } +// *//* */ class Mix_I_eFooXIfwBarY__ extends FooXIf[A] with BarY__[B] { class I; ; f; } +// *//* */ class Mix_I_eFooXIfwBarY_f extends FooXIf[A] with BarY_f[B] { class I; ; f; } +// *//* */ class Mix_I_eFooXIfwBarYI_ extends FooXIf[A] with BarYI_[B] { class I; ; f; } +// *//* */ class Mix_I_eFooXIfwBarYIf extends FooXIf[A] with BarYIf[B] { class I; ; f; } + +/* *//* */ class Mix_IfeFoo___ extends Foo___ { class I; def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfeFoo___wBar___ extends Foo___ with Bar___ { class I; def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfeFoo___wBar__f extends Foo___ with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFoo___wBar_I_ extends Foo___ with Bar_I_ { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFoo___wBar_If extends Foo___ with Bar_If { class I; override def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfeFoo___wBarY__ extends Foo___ with BarY__[B] { class I; def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfeFoo___wBarY_f extends Foo___ with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFoo___wBarYI_ extends Foo___ with BarYI_[B] { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFoo___wBarYIf extends Foo___ with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfeFoo__f extends Foo__f { class I; override def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfeFoo__fwBar___ extends Foo__f with Bar___ { class I; override def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfeFoo__fwBar__f extends Foo__f with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFoo__fwBar_I_ extends Foo__f with Bar_I_ { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFoo__fwBar_If extends Foo__f with Bar_If { class I; override def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfeFoo__fwBarY__ extends Foo__f with BarY__[B] { class I; override def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfeFoo__fwBarY_f extends Foo__f with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFoo__fwBarYI_ extends Foo__f with BarYI_[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFoo__fwBarYIf extends Foo__f with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFoo_I_ extends Foo_I_ { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFoo_I_wBar___ extends Foo_I_ with Bar___ { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFoo_I_wBar__f extends Foo_I_ with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFoo_I_wBar_I_ extends Foo_I_ with Bar_I_ { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFoo_I_wBar_If extends Foo_I_ with Bar_If { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFoo_I_wBarY__ extends Foo_I_ with BarY__[B] { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFoo_I_wBarY_f extends Foo_I_ with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFoo_I_wBarYI_ extends Foo_I_ with BarYI_[B] { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFoo_I_wBarYIf extends Foo_I_ with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFoo_If extends Foo_If { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFoo_IfwBar___ extends Foo_If with Bar___ { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFoo_IfwBar__f extends Foo_If with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFoo_IfwBar_I_ extends Foo_If with Bar_I_ { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFoo_IfwBar_If extends Foo_If with Bar_If { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFoo_IfwBarY__ extends Foo_If with BarY__[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFoo_IfwBarY_f extends Foo_If with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFoo_IfwBarYI_ extends Foo_If with BarYI_[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFoo_IfwBarYIf extends Foo_If with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfeFooX__ extends FooX__[A] { class I; def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfeFooX__wBar___ extends FooX__[A] with Bar___ { class I; def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfeFooX__wBar__f extends FooX__[A] with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFooX__wBar_I_ extends FooX__[A] with Bar_I_ { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFooX__wBar_If extends FooX__[A] with Bar_If { class I; override def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfeFooX__wBarY__ extends FooX__[A] with BarY__[B] { class I; def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfeFooX__wBarY_f extends FooX__[A] with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFooX__wBarYI_ extends FooX__[A] with BarYI_[B] { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFooX__wBarYIf extends FooX__[A] with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfeFooX_f extends FooX_f[A] { class I; override def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfeFooX_fwBar___ extends FooX_f[A] with Bar___ { class I; override def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfeFooX_fwBar__f extends FooX_f[A] with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFooX_fwBar_I_ extends FooX_f[A] with Bar_I_ { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFooX_fwBar_If extends FooX_f[A] with Bar_If { class I; override def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfeFooX_fwBarY__ extends FooX_f[A] with BarY__[B] { class I; override def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfeFooX_fwBarY_f extends FooX_f[A] with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFooX_fwBarYI_ extends FooX_f[A] with BarYI_[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFooX_fwBarYIf extends FooX_f[A] with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFooXI_ extends FooXI_[A] { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFooXI_wBar___ extends FooXI_[A] with Bar___ { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFooXI_wBar__f extends FooXI_[A] with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFooXI_wBar_I_ extends FooXI_[A] with Bar_I_ { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFooXI_wBar_If extends FooXI_[A] with Bar_If { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFooXI_wBarY__ extends FooXI_[A] with BarY__[B] { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFooXI_wBarY_f extends FooXI_[A] with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFooXI_wBarYI_ extends FooXI_[A] with BarYI_[B] { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFooXI_wBarYIf extends FooXI_[A] with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFooXIf extends FooXIf[A] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFooXIfwBar___ extends FooXIf[A] with Bar___ { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFooXIfwBar__f extends FooXIf[A] with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFooXIfwBar_I_ extends FooXIf[A] with Bar_I_ { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFooXIfwBar_If extends FooXIf[A] with Bar_If { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFooXIfwBarY__ extends FooXIf[A] with BarY__[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFooXIfwBarY_f extends FooXIf[A] with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFooXIfwBarYI_ extends FooXIf[A] with BarYI_[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfeFooXIfwBarYIf extends FooXIf[A] with BarYIf[B] { class I; override def f: I = {mix; null}; f; } + +/* */abstract class MixZ__eFoo___ [Z] extends Foo___ { ; ; f; } +/* */abstract class MixZ__eFoo___wBar___[Z] extends Foo___ with Bar___ { ; ; f; } +/* */abstract class MixZ__eFoo___wBar__f[Z] extends Foo___ with Bar__f { ; ; f; } +/* */abstract class MixZ__eFoo___wBar_I_[Z] extends Foo___ with Bar_I_ { ; ; f; } +/* *//* */ class MixZ__eFoo___wBar_If[Z] extends Foo___ with Bar_If { ; ; f; } +/* */abstract class MixZ__eFoo___wBarY__[Z] extends Foo___ with BarY__[B] { ; ; f; } +/* */abstract class MixZ__eFoo___wBarY_f[Z] extends Foo___ with BarY_f[B] { ; ; f; } +/* */abstract class MixZ__eFoo___wBarYI_[Z] extends Foo___ with BarYI_[B] { ; ; f; } +/* *//* */ class MixZ__eFoo___wBarYIf[Z] extends Foo___ with BarYIf[B] { ; ; f; } +/* */abstract class MixZ__eFoo__f [Z] extends Foo__f { ; ; f; } +/* */abstract class MixZ__eFoo__fwBar___[Z] extends Foo__f with Bar___ { ; ; f; } +// */abstract class MixZ__eFoo__fwBar__f[Z] extends Foo__f with Bar__f { ; ; f; } +/* *//* */ class MixZ__eFoo__fwBar_I_[Z] extends Foo__f with Bar_I_ { ; ; f; } +// *//* */ class MixZ__eFoo__fwBar_If[Z] extends Foo__f with Bar_If { ; ; f; } +/* */abstract class MixZ__eFoo__fwBarY__[Z] extends Foo__f with BarY__[B] { ; ; f; } +// */abstract class MixZ__eFoo__fwBarY_f[Z] extends Foo__f with BarY_f[B] { ; ; f; } +/* *//* */ class MixZ__eFoo__fwBarYI_[Z] extends Foo__f with BarYI_[B] { ; ; f; } +// *//* */ class MixZ__eFoo__fwBarYIf[Z] extends Foo__f with BarYIf[B] { ; ; f; } +/* */abstract class MixZ__eFoo_I_ [Z] extends Foo_I_ { ; ; f; } +/* */abstract class MixZ__eFoo_I_wBar___[Z] extends Foo_I_ with Bar___ { ; ; f; } +/* *//* */ class MixZ__eFoo_I_wBar__f[Z] extends Foo_I_ with Bar__f { ; ; f; } +// */abstract class MixZ__eFoo_I_wBar_I_[Z] extends Foo_I_ with Bar_I_ { ; ; f; } +// *//* */ class MixZ__eFoo_I_wBar_If[Z] extends Foo_I_ with Bar_If { ; ; f; } +/* */abstract class MixZ__eFoo_I_wBarY__[Z] extends Foo_I_ with BarY__[B] { ; ; f; } +/* *//* */ class MixZ__eFoo_I_wBarY_f[Z] extends Foo_I_ with BarY_f[B] { ; ; f; } +// */abstract class MixZ__eFoo_I_wBarYI_[Z] extends Foo_I_ with BarYI_[B] { ; ; f; } +// *//* */ class MixZ__eFoo_I_wBarYIf[Z] extends Foo_I_ with BarYIf[B] { ; ; f; } +/* *//* */ class MixZ__eFoo_If [Z] extends Foo_If { ; ; f; } +/* *//* */ class MixZ__eFoo_IfwBar___[Z] extends Foo_If with Bar___ { ; ; f; } +// *//* */ class MixZ__eFoo_IfwBar__f[Z] extends Foo_If with Bar__f { ; ; f; } +// *//* */ class MixZ__eFoo_IfwBar_I_[Z] extends Foo_If with Bar_I_ { ; ; f; } +// *//* */ class MixZ__eFoo_IfwBar_If[Z] extends Foo_If with Bar_If { ; ; f; } +/* *//* */ class MixZ__eFoo_IfwBarY__[Z] extends Foo_If with BarY__[B] { ; ; f; } +// *//* */ class MixZ__eFoo_IfwBarY_f[Z] extends Foo_If with BarY_f[B] { ; ; f; } +// *//* */ class MixZ__eFoo_IfwBarYI_[Z] extends Foo_If with BarYI_[B] { ; ; f; } +// *//* */ class MixZ__eFoo_IfwBarYIf[Z] extends Foo_If with BarYIf[B] { ; ; f; } +/* */abstract class MixZ__eFooX__ [Z] extends FooX__[A] { ; ; f; } +/* */abstract class MixZ__eFooX__wBar___[Z] extends FooX__[A] with Bar___ { ; ; f; } +/* */abstract class MixZ__eFooX__wBar__f[Z] extends FooX__[A] with Bar__f { ; ; f; } +/* */abstract class MixZ__eFooX__wBar_I_[Z] extends FooX__[A] with Bar_I_ { ; ; f; } +/* *//* */ class MixZ__eFooX__wBar_If[Z] extends FooX__[A] with Bar_If { ; ; f; } +/* */abstract class MixZ__eFooX__wBarY__[Z] extends FooX__[A] with BarY__[B] { ; ; f; } +/* */abstract class MixZ__eFooX__wBarY_f[Z] extends FooX__[A] with BarY_f[B] { ; ; f; } +/* */abstract class MixZ__eFooX__wBarYI_[Z] extends FooX__[A] with BarYI_[B] { ; ; f; } +/* *//* */ class MixZ__eFooX__wBarYIf[Z] extends FooX__[A] with BarYIf[B] { ; ; f; } +/* */abstract class MixZ__eFooX_f [Z] extends FooX_f[A] { ; ; f; } +/* */abstract class MixZ__eFooX_fwBar___[Z] extends FooX_f[A] with Bar___ { ; ; f; } +// */abstract class MixZ__eFooX_fwBar__f[Z] extends FooX_f[A] with Bar__f { ; ; f; } +/* *//* */ class MixZ__eFooX_fwBar_I_[Z] extends FooX_f[A] with Bar_I_ { ; ; f; } +// *//* */ class MixZ__eFooX_fwBar_If[Z] extends FooX_f[A] with Bar_If { ; ; f; } +/* */abstract class MixZ__eFooX_fwBarY__[Z] extends FooX_f[A] with BarY__[B] { ; ; f; } +// */abstract class MixZ__eFooX_fwBarY_f[Z] extends FooX_f[A] with BarY_f[B] { ; ; f; } +/* *//* */ class MixZ__eFooX_fwBarYI_[Z] extends FooX_f[A] with BarYI_[B] { ; ; f; } +// *//* */ class MixZ__eFooX_fwBarYIf[Z] extends FooX_f[A] with BarYIf[B] { ; ; f; } +/* */abstract class MixZ__eFooXI_ [Z] extends FooXI_[A] { ; ; f; } +/* */abstract class MixZ__eFooXI_wBar___[Z] extends FooXI_[A] with Bar___ { ; ; f; } +/* *//* */ class MixZ__eFooXI_wBar__f[Z] extends FooXI_[A] with Bar__f { ; ; f; } +// */abstract class MixZ__eFooXI_wBar_I_[Z] extends FooXI_[A] with Bar_I_ { ; ; f; } +// *//* */ class MixZ__eFooXI_wBar_If[Z] extends FooXI_[A] with Bar_If { ; ; f; } +/* */abstract class MixZ__eFooXI_wBarY__[Z] extends FooXI_[A] with BarY__[B] { ; ; f; } +/* *//* */ class MixZ__eFooXI_wBarY_f[Z] extends FooXI_[A] with BarY_f[B] { ; ; f; } +// */abstract class MixZ__eFooXI_wBarYI_[Z] extends FooXI_[A] with BarYI_[B] { ; ; f; } +// *//* */ class MixZ__eFooXI_wBarYIf[Z] extends FooXI_[A] with BarYIf[B] { ; ; f; } +/* *//* */ class MixZ__eFooXIf [Z] extends FooXIf[A] { ; ; f; } +/* *//* */ class MixZ__eFooXIfwBar___[Z] extends FooXIf[A] with Bar___ { ; ; f; } +// *//* */ class MixZ__eFooXIfwBar__f[Z] extends FooXIf[A] with Bar__f { ; ; f; } +// *//* */ class MixZ__eFooXIfwBar_I_[Z] extends FooXIf[A] with Bar_I_ { ; ; f; } +// *//* */ class MixZ__eFooXIfwBar_If[Z] extends FooXIf[A] with Bar_If { ; ; f; } +/* *//* */ class MixZ__eFooXIfwBarY__[Z] extends FooXIf[A] with BarY__[B] { ; ; f; } +// *//* */ class MixZ__eFooXIfwBarY_f[Z] extends FooXIf[A] with BarY_f[B] { ; ; f; } +// *//* */ class MixZ__eFooXIfwBarYI_[Z] extends FooXIf[A] with BarYI_[B] { ; ; f; } +// *//* */ class MixZ__eFooXIfwBarYIf[Z] extends FooXIf[A] with BarYIf[B] { ; ; f; } + +/* */abstract class MixZ_feFoo___ [Z] extends Foo___ { ; def f: I = {mix; null}; f; } +/* */abstract class MixZ_feFoo___wBar___[Z] extends Foo___ with Bar___ { ; def f: I = {mix; null}; f; } +/* */abstract class MixZ_feFoo___wBar__f[Z] extends Foo___ with Bar__f { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFoo___wBar_I_[Z] extends Foo___ with Bar_I_ { ; def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFoo___wBar_If[Z] extends Foo___ with Bar_If { ; override def f: I = {mix; null}; f; } +/* */abstract class MixZ_feFoo___wBarY__[Z] extends Foo___ with BarY__[B] { ; def f: I = {mix; null}; f; } +/* */abstract class MixZ_feFoo___wBarY_f[Z] extends Foo___ with BarY_f[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFoo___wBarYI_[Z] extends Foo___ with BarYI_[B] { ; def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFoo___wBarYIf[Z] extends Foo___ with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* */abstract class MixZ_feFoo__f [Z] extends Foo__f { ; override def f: I = {mix; null}; f; } +/* */abstract class MixZ_feFoo__fwBar___[Z] extends Foo__f with Bar___ { ; override def f: I = {mix; null}; f; } +/* */abstract class MixZ_feFoo__fwBar__f[Z] extends Foo__f with Bar__f { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFoo__fwBar_I_[Z] extends Foo__f with Bar_I_ { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFoo__fwBar_If[Z] extends Foo__f with Bar_If { ; override def f: I = {mix; null}; f; } +/* */abstract class MixZ_feFoo__fwBarY__[Z] extends Foo__f with BarY__[B] { ; override def f: I = {mix; null}; f; } +/* */abstract class MixZ_feFoo__fwBarY_f[Z] extends Foo__f with BarY_f[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFoo__fwBarYI_[Z] extends Foo__f with BarYI_[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFoo__fwBarYIf[Z] extends Foo__f with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFoo_I_ [Z] extends Foo_I_ { ; def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFoo_I_wBar___[Z] extends Foo_I_ with Bar___ { ; def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFoo_I_wBar__f[Z] extends Foo_I_ with Bar__f { ; override def f: I = {mix; null}; f; } +// *//* */ class MixZ_feFoo_I_wBar_I_[Z] extends Foo_I_ with Bar_I_ { ; def f: I = {mix; null}; f; } +// *//* */ class MixZ_feFoo_I_wBar_If[Z] extends Foo_I_ with Bar_If { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFoo_I_wBarY__[Z] extends Foo_I_ with BarY__[B] { ; def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFoo_I_wBarY_f[Z] extends Foo_I_ with BarY_f[B] { ; override def f: I = {mix; null}; f; } +// *//* */ class MixZ_feFoo_I_wBarYI_[Z] extends Foo_I_ with BarYI_[B] { ; def f: I = {mix; null}; f; } +// *//* */ class MixZ_feFoo_I_wBarYIf[Z] extends Foo_I_ with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFoo_If [Z] extends Foo_If { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFoo_IfwBar___[Z] extends Foo_If with Bar___ { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFoo_IfwBar__f[Z] extends Foo_If with Bar__f { ; override def f: I = {mix; null}; f; } +// *//* */ class MixZ_feFoo_IfwBar_I_[Z] extends Foo_If with Bar_I_ { ; override def f: I = {mix; null}; f; } +// *//* */ class MixZ_feFoo_IfwBar_If[Z] extends Foo_If with Bar_If { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFoo_IfwBarY__[Z] extends Foo_If with BarY__[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFoo_IfwBarY_f[Z] extends Foo_If with BarY_f[B] { ; override def f: I = {mix; null}; f; } +// *//* */ class MixZ_feFoo_IfwBarYI_[Z] extends Foo_If with BarYI_[B] { ; override def f: I = {mix; null}; f; } +// *//* */ class MixZ_feFoo_IfwBarYIf[Z] extends Foo_If with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* */abstract class MixZ_feFooX__ [Z] extends FooX__[A] { ; def f: I = {mix; null}; f; } +/* */abstract class MixZ_feFooX__wBar___[Z] extends FooX__[A] with Bar___ { ; def f: I = {mix; null}; f; } +/* */abstract class MixZ_feFooX__wBar__f[Z] extends FooX__[A] with Bar__f { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFooX__wBar_I_[Z] extends FooX__[A] with Bar_I_ { ; def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFooX__wBar_If[Z] extends FooX__[A] with Bar_If { ; override def f: I = {mix; null}; f; } +/* */abstract class MixZ_feFooX__wBarY__[Z] extends FooX__[A] with BarY__[B] { ; def f: I = {mix; null}; f; } +/* */abstract class MixZ_feFooX__wBarY_f[Z] extends FooX__[A] with BarY_f[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFooX__wBarYI_[Z] extends FooX__[A] with BarYI_[B] { ; def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFooX__wBarYIf[Z] extends FooX__[A] with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* */abstract class MixZ_feFooX_f [Z] extends FooX_f[A] { ; override def f: I = {mix; null}; f; } +/* */abstract class MixZ_feFooX_fwBar___[Z] extends FooX_f[A] with Bar___ { ; override def f: I = {mix; null}; f; } +/* */abstract class MixZ_feFooX_fwBar__f[Z] extends FooX_f[A] with Bar__f { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFooX_fwBar_I_[Z] extends FooX_f[A] with Bar_I_ { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFooX_fwBar_If[Z] extends FooX_f[A] with Bar_If { ; override def f: I = {mix; null}; f; } +/* */abstract class MixZ_feFooX_fwBarY__[Z] extends FooX_f[A] with BarY__[B] { ; override def f: I = {mix; null}; f; } +/* */abstract class MixZ_feFooX_fwBarY_f[Z] extends FooX_f[A] with BarY_f[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFooX_fwBarYI_[Z] extends FooX_f[A] with BarYI_[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFooX_fwBarYIf[Z] extends FooX_f[A] with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFooXI_ [Z] extends FooXI_[A] { ; def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFooXI_wBar___[Z] extends FooXI_[A] with Bar___ { ; def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFooXI_wBar__f[Z] extends FooXI_[A] with Bar__f { ; override def f: I = {mix; null}; f; } +// *//* */ class MixZ_feFooXI_wBar_I_[Z] extends FooXI_[A] with Bar_I_ { ; def f: I = {mix; null}; f; } +// *//* */ class MixZ_feFooXI_wBar_If[Z] extends FooXI_[A] with Bar_If { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFooXI_wBarY__[Z] extends FooXI_[A] with BarY__[B] { ; def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFooXI_wBarY_f[Z] extends FooXI_[A] with BarY_f[B] { ; override def f: I = {mix; null}; f; } +// *//* */ class MixZ_feFooXI_wBarYI_[Z] extends FooXI_[A] with BarYI_[B] { ; def f: I = {mix; null}; f; } +// *//* */ class MixZ_feFooXI_wBarYIf[Z] extends FooXI_[A] with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFooXIf [Z] extends FooXIf[A] { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFooXIfwBar___[Z] extends FooXIf[A] with Bar___ { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFooXIfwBar__f[Z] extends FooXIf[A] with Bar__f { ; override def f: I = {mix; null}; f; } +// *//* */ class MixZ_feFooXIfwBar_I_[Z] extends FooXIf[A] with Bar_I_ { ; override def f: I = {mix; null}; f; } +// *//* */ class MixZ_feFooXIfwBar_If[Z] extends FooXIf[A] with Bar_If { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFooXIfwBarY__[Z] extends FooXIf[A] with BarY__[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_feFooXIfwBarY_f[Z] extends FooXIf[A] with BarY_f[B] { ; override def f: I = {mix; null}; f; } +// *//* */ class MixZ_feFooXIfwBarYI_[Z] extends FooXIf[A] with BarYI_[B] { ; override def f: I = {mix; null}; f; } +// *//* */ class MixZ_feFooXIfwBarYIf[Z] extends FooXIf[A] with BarYIf[B] { ; override def f: I = {mix; null}; f; } + +/* */abstract class MixZI_eFoo___ [Z] extends Foo___ { class I; ; f; } +/* */abstract class MixZI_eFoo___wBar___[Z] extends Foo___ with Bar___ { class I; ; f; } +/* *//* */ class MixZI_eFoo___wBar__f[Z] extends Foo___ with Bar__f { class I; ; f; } +// */abstract class MixZI_eFoo___wBar_I_[Z] extends Foo___ with Bar_I_ { class I; ; f; } +// *//* */ class MixZI_eFoo___wBar_If[Z] extends Foo___ with Bar_If { class I; ; f; } +/* */abstract class MixZI_eFoo___wBarY__[Z] extends Foo___ with BarY__[B] { class I; ; f; } +/* *//* */ class MixZI_eFoo___wBarY_f[Z] extends Foo___ with BarY_f[B] { class I; ; f; } +// */abstract class MixZI_eFoo___wBarYI_[Z] extends Foo___ with BarYI_[B] { class I; ; f; } +// *//* */ class MixZI_eFoo___wBarYIf[Z] extends Foo___ with BarYIf[B] { class I; ; f; } +/* *//* */ class MixZI_eFoo__f [Z] extends Foo__f { class I; ; f; } +/* *//* */ class MixZI_eFoo__fwBar___[Z] extends Foo__f with Bar___ { class I; ; f; } +// *//* */ class MixZI_eFoo__fwBar__f[Z] extends Foo__f with Bar__f { class I; ; f; } +// *//* */ class MixZI_eFoo__fwBar_I_[Z] extends Foo__f with Bar_I_ { class I; ; f; } +// *//* */ class MixZI_eFoo__fwBar_If[Z] extends Foo__f with Bar_If { class I; ; f; } +/* *//* */ class MixZI_eFoo__fwBarY__[Z] extends Foo__f with BarY__[B] { class I; ; f; } +// *//* */ class MixZI_eFoo__fwBarY_f[Z] extends Foo__f with BarY_f[B] { class I; ; f; } +// *//* */ class MixZI_eFoo__fwBarYI_[Z] extends Foo__f with BarYI_[B] { class I; ; f; } +// *//* */ class MixZI_eFoo__fwBarYIf[Z] extends Foo__f with BarYIf[B] { class I; ; f; } +// */abstract class MixZI_eFoo_I_ [Z] extends Foo_I_ { class I; ; f; } +// */abstract class MixZI_eFoo_I_wBar___[Z] extends Foo_I_ with Bar___ { class I; ; f; } +// *//* */ class MixZI_eFoo_I_wBar__f[Z] extends Foo_I_ with Bar__f { class I; ; f; } +// */abstract class MixZI_eFoo_I_wBar_I_[Z] extends Foo_I_ with Bar_I_ { class I; ; f; } +// *//* */ class MixZI_eFoo_I_wBar_If[Z] extends Foo_I_ with Bar_If { class I; ; f; } +// */abstract class MixZI_eFoo_I_wBarY__[Z] extends Foo_I_ with BarY__[B] { class I; ; f; } +// *//* */ class MixZI_eFoo_I_wBarY_f[Z] extends Foo_I_ with BarY_f[B] { class I; ; f; } +// */abstract class MixZI_eFoo_I_wBarYI_[Z] extends Foo_I_ with BarYI_[B] { class I; ; f; } +// *//* */ class MixZI_eFoo_I_wBarYIf[Z] extends Foo_I_ with BarYIf[B] { class I; ; f; } +// *//* */ class MixZI_eFoo_If [Z] extends Foo_If { class I; ; f; } +// *//* */ class MixZI_eFoo_IfwBar___[Z] extends Foo_If with Bar___ { class I; ; f; } +// *//* */ class MixZI_eFoo_IfwBar__f[Z] extends Foo_If with Bar__f { class I; ; f; } +// *//* */ class MixZI_eFoo_IfwBar_I_[Z] extends Foo_If with Bar_I_ { class I; ; f; } +// *//* */ class MixZI_eFoo_IfwBar_If[Z] extends Foo_If with Bar_If { class I; ; f; } +// *//* */ class MixZI_eFoo_IfwBarY__[Z] extends Foo_If with BarY__[B] { class I; ; f; } +// *//* */ class MixZI_eFoo_IfwBarY_f[Z] extends Foo_If with BarY_f[B] { class I; ; f; } +// *//* */ class MixZI_eFoo_IfwBarYI_[Z] extends Foo_If with BarYI_[B] { class I; ; f; } +// *//* */ class MixZI_eFoo_IfwBarYIf[Z] extends Foo_If with BarYIf[B] { class I; ; f; } +/* */abstract class MixZI_eFooX__ [Z] extends FooX__[A] { class I; ; f; } +/* */abstract class MixZI_eFooX__wBar___[Z] extends FooX__[A] with Bar___ { class I; ; f; } +/* *//* */ class MixZI_eFooX__wBar__f[Z] extends FooX__[A] with Bar__f { class I; ; f; } +// */abstract class MixZI_eFooX__wBar_I_[Z] extends FooX__[A] with Bar_I_ { class I; ; f; } +// *//* */ class MixZI_eFooX__wBar_If[Z] extends FooX__[A] with Bar_If { class I; ; f; } +/* */abstract class MixZI_eFooX__wBarY__[Z] extends FooX__[A] with BarY__[B] { class I; ; f; } +/* *//* */ class MixZI_eFooX__wBarY_f[Z] extends FooX__[A] with BarY_f[B] { class I; ; f; } +// */abstract class MixZI_eFooX__wBarYI_[Z] extends FooX__[A] with BarYI_[B] { class I; ; f; } +// *//* */ class MixZI_eFooX__wBarYIf[Z] extends FooX__[A] with BarYIf[B] { class I; ; f; } +/* *//* */ class MixZI_eFooX_f [Z] extends FooX_f[A] { class I; ; f; } +/* *//* */ class MixZI_eFooX_fwBar___[Z] extends FooX_f[A] with Bar___ { class I; ; f; } +// *//* */ class MixZI_eFooX_fwBar__f[Z] extends FooX_f[A] with Bar__f { class I; ; f; } +// *//* */ class MixZI_eFooX_fwBar_I_[Z] extends FooX_f[A] with Bar_I_ { class I; ; f; } +// *//* */ class MixZI_eFooX_fwBar_If[Z] extends FooX_f[A] with Bar_If { class I; ; f; } +/* *//* */ class MixZI_eFooX_fwBarY__[Z] extends FooX_f[A] with BarY__[B] { class I; ; f; } +// *//* */ class MixZI_eFooX_fwBarY_f[Z] extends FooX_f[A] with BarY_f[B] { class I; ; f; } +// *//* */ class MixZI_eFooX_fwBarYI_[Z] extends FooX_f[A] with BarYI_[B] { class I; ; f; } +// *//* */ class MixZI_eFooX_fwBarYIf[Z] extends FooX_f[A] with BarYIf[B] { class I; ; f; } +// */abstract class MixZI_eFooXI_ [Z] extends FooXI_[A] { class I; ; f; } +// */abstract class MixZI_eFooXI_wBar___[Z] extends FooXI_[A] with Bar___ { class I; ; f; } +// *//* */ class MixZI_eFooXI_wBar__f[Z] extends FooXI_[A] with Bar__f { class I; ; f; } +// */abstract class MixZI_eFooXI_wBar_I_[Z] extends FooXI_[A] with Bar_I_ { class I; ; f; } +// *//* */ class MixZI_eFooXI_wBar_If[Z] extends FooXI_[A] with Bar_If { class I; ; f; } +// */abstract class MixZI_eFooXI_wBarY__[Z] extends FooXI_[A] with BarY__[B] { class I; ; f; } +// *//* */ class MixZI_eFooXI_wBarY_f[Z] extends FooXI_[A] with BarY_f[B] { class I; ; f; } +// */abstract class MixZI_eFooXI_wBarYI_[Z] extends FooXI_[A] with BarYI_[B] { class I; ; f; } +// *//* */ class MixZI_eFooXI_wBarYIf[Z] extends FooXI_[A] with BarYIf[B] { class I; ; f; } +// *//* */ class MixZI_eFooXIf [Z] extends FooXIf[A] { class I; ; f; } +// *//* */ class MixZI_eFooXIfwBar___[Z] extends FooXIf[A] with Bar___ { class I; ; f; } +// *//* */ class MixZI_eFooXIfwBar__f[Z] extends FooXIf[A] with Bar__f { class I; ; f; } +// *//* */ class MixZI_eFooXIfwBar_I_[Z] extends FooXIf[A] with Bar_I_ { class I; ; f; } +// *//* */ class MixZI_eFooXIfwBar_If[Z] extends FooXIf[A] with Bar_If { class I; ; f; } +// *//* */ class MixZI_eFooXIfwBarY__[Z] extends FooXIf[A] with BarY__[B] { class I; ; f; } +// *//* */ class MixZI_eFooXIfwBarY_f[Z] extends FooXIf[A] with BarY_f[B] { class I; ; f; } +// *//* */ class MixZI_eFooXIfwBarYI_[Z] extends FooXIf[A] with BarYI_[B] { class I; ; f; } +// *//* */ class MixZI_eFooXIfwBarYIf[Z] extends FooXIf[A] with BarYIf[B] { class I; ; f; } + +/* *//* */ class MixZIfeFoo___ [Z] extends Foo___ { class I; def f: I = {mix; null}; f; } +/* *//* */ class MixZIfeFoo___wBar___[Z] extends Foo___ with Bar___ { class I; def f: I = {mix; null}; f; } +/* *//* */ class MixZIfeFoo___wBar__f[Z] extends Foo___ with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFoo___wBar_I_[Z] extends Foo___ with Bar_I_ { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFoo___wBar_If[Z] extends Foo___ with Bar_If { class I; override def f: I = {mix; null}; f; } +/* *//* */ class MixZIfeFoo___wBarY__[Z] extends Foo___ with BarY__[B] { class I; def f: I = {mix; null}; f; } +/* *//* */ class MixZIfeFoo___wBarY_f[Z] extends Foo___ with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFoo___wBarYI_[Z] extends Foo___ with BarYI_[B] { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFoo___wBarYIf[Z] extends Foo___ with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +/* *//* */ class MixZIfeFoo__f [Z] extends Foo__f { class I; override def f: I = {mix; null}; f; } +/* *//* */ class MixZIfeFoo__fwBar___[Z] extends Foo__f with Bar___ { class I; override def f: I = {mix; null}; f; } +/* *//* */ class MixZIfeFoo__fwBar__f[Z] extends Foo__f with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFoo__fwBar_I_[Z] extends Foo__f with Bar_I_ { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFoo__fwBar_If[Z] extends Foo__f with Bar_If { class I; override def f: I = {mix; null}; f; } +/* *//* */ class MixZIfeFoo__fwBarY__[Z] extends Foo__f with BarY__[B] { class I; override def f: I = {mix; null}; f; } +/* *//* */ class MixZIfeFoo__fwBarY_f[Z] extends Foo__f with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFoo__fwBarYI_[Z] extends Foo__f with BarYI_[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFoo__fwBarYIf[Z] extends Foo__f with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFoo_I_ [Z] extends Foo_I_ { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFoo_I_wBar___[Z] extends Foo_I_ with Bar___ { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFoo_I_wBar__f[Z] extends Foo_I_ with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFoo_I_wBar_I_[Z] extends Foo_I_ with Bar_I_ { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFoo_I_wBar_If[Z] extends Foo_I_ with Bar_If { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFoo_I_wBarY__[Z] extends Foo_I_ with BarY__[B] { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFoo_I_wBarY_f[Z] extends Foo_I_ with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFoo_I_wBarYI_[Z] extends Foo_I_ with BarYI_[B] { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFoo_I_wBarYIf[Z] extends Foo_I_ with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFoo_If [Z] extends Foo_If { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFoo_IfwBar___[Z] extends Foo_If with Bar___ { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFoo_IfwBar__f[Z] extends Foo_If with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFoo_IfwBar_I_[Z] extends Foo_If with Bar_I_ { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFoo_IfwBar_If[Z] extends Foo_If with Bar_If { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFoo_IfwBarY__[Z] extends Foo_If with BarY__[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFoo_IfwBarY_f[Z] extends Foo_If with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFoo_IfwBarYI_[Z] extends Foo_If with BarYI_[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFoo_IfwBarYIf[Z] extends Foo_If with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +/* *//* */ class MixZIfeFooX__ [Z] extends FooX__[A] { class I; def f: I = {mix; null}; f; } +/* *//* */ class MixZIfeFooX__wBar___[Z] extends FooX__[A] with Bar___ { class I; def f: I = {mix; null}; f; } +/* *//* */ class MixZIfeFooX__wBar__f[Z] extends FooX__[A] with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFooX__wBar_I_[Z] extends FooX__[A] with Bar_I_ { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFooX__wBar_If[Z] extends FooX__[A] with Bar_If { class I; override def f: I = {mix; null}; f; } +/* *//* */ class MixZIfeFooX__wBarY__[Z] extends FooX__[A] with BarY__[B] { class I; def f: I = {mix; null}; f; } +/* *//* */ class MixZIfeFooX__wBarY_f[Z] extends FooX__[A] with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFooX__wBarYI_[Z] extends FooX__[A] with BarYI_[B] { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFooX__wBarYIf[Z] extends FooX__[A] with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +/* *//* */ class MixZIfeFooX_f [Z] extends FooX_f[A] { class I; override def f: I = {mix; null}; f; } +/* *//* */ class MixZIfeFooX_fwBar___[Z] extends FooX_f[A] with Bar___ { class I; override def f: I = {mix; null}; f; } +/* *//* */ class MixZIfeFooX_fwBar__f[Z] extends FooX_f[A] with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFooX_fwBar_I_[Z] extends FooX_f[A] with Bar_I_ { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFooX_fwBar_If[Z] extends FooX_f[A] with Bar_If { class I; override def f: I = {mix; null}; f; } +/* *//* */ class MixZIfeFooX_fwBarY__[Z] extends FooX_f[A] with BarY__[B] { class I; override def f: I = {mix; null}; f; } +/* *//* */ class MixZIfeFooX_fwBarY_f[Z] extends FooX_f[A] with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFooX_fwBarYI_[Z] extends FooX_f[A] with BarYI_[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFooX_fwBarYIf[Z] extends FooX_f[A] with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFooXI_ [Z] extends FooXI_[A] { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFooXI_wBar___[Z] extends FooXI_[A] with Bar___ { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFooXI_wBar__f[Z] extends FooXI_[A] with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFooXI_wBar_I_[Z] extends FooXI_[A] with Bar_I_ { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFooXI_wBar_If[Z] extends FooXI_[A] with Bar_If { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFooXI_wBarY__[Z] extends FooXI_[A] with BarY__[B] { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFooXI_wBarY_f[Z] extends FooXI_[A] with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFooXI_wBarYI_[Z] extends FooXI_[A] with BarYI_[B] { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFooXI_wBarYIf[Z] extends FooXI_[A] with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFooXIf [Z] extends FooXIf[A] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFooXIfwBar___[Z] extends FooXIf[A] with Bar___ { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFooXIfwBar__f[Z] extends FooXIf[A] with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFooXIfwBar_I_[Z] extends FooXIf[A] with Bar_I_ { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFooXIfwBar_If[Z] extends FooXIf[A] with Bar_If { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFooXIfwBarY__[Z] extends FooXIf[A] with BarY__[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFooXIfwBarY_f[Z] extends FooXIf[A] with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFooXIfwBarYI_[Z] extends FooXIf[A] with BarYI_[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfeFooXIfwBarYIf[Z] extends FooXIf[A] with BarYIf[B] { class I; override def f: I = {mix; null}; f; } + + + +/* */abstract class Mix___wFoo___ extends Foo___ { ; ; f; } +/* */abstract class Mix___wFoo___wBar___ extends Foo___ with Bar___ { ; ; f; } +/* */abstract class Mix___wFoo___wBar__f extends Foo___ with Bar__f { ; ; f; } +/* */abstract class Mix___wFoo___wBar_I_ extends Foo___ with Bar_I_ { ; ; f; } +/* *//* */ class Mix___wFoo___wBar_If extends Foo___ with Bar_If { ; ; f; } +/* */abstract class Mix___wFoo___wBarY__ extends Foo___ with BarY__[B] { ; ; f; } +/* */abstract class Mix___wFoo___wBarY_f extends Foo___ with BarY_f[B] { ; ; f; } +/* */abstract class Mix___wFoo___wBarYI_ extends Foo___ with BarYI_[B] { ; ; f; } +/* *//* */ class Mix___wFoo___wBarYIf extends Foo___ with BarYIf[B] { ; ; f; } +/* */abstract class Mix___wFoo__f extends Foo__f { ; ; f; } +/* */abstract class Mix___wFoo__fwBar___ extends Foo__f with Bar___ { ; ; f; } +// */abstract class Mix___wFoo__fwBar__f extends Foo__f with Bar__f { ; ; f; } +/* *//* */ class Mix___wFoo__fwBar_I_ extends Foo__f with Bar_I_ { ; ; f; } +// *//* */ class Mix___wFoo__fwBar_If extends Foo__f with Bar_If { ; ; f; } +/* */abstract class Mix___wFoo__fwBarY__ extends Foo__f with BarY__[B] { ; ; f; } +// */abstract class Mix___wFoo__fwBarY_f extends Foo__f with BarY_f[B] { ; ; f; } +/* *//* */ class Mix___wFoo__fwBarYI_ extends Foo__f with BarYI_[B] { ; ; f; } +// *//* */ class Mix___wFoo__fwBarYIf extends Foo__f with BarYIf[B] { ; ; f; } +/* */abstract class Mix___wFoo_I_ extends Foo_I_ { ; ; f; } +/* */abstract class Mix___wFoo_I_wBar___ extends Foo_I_ with Bar___ { ; ; f; } +/* *//* */ class Mix___wFoo_I_wBar__f extends Foo_I_ with Bar__f { ; ; f; } +// */abstract class Mix___wFoo_I_wBar_I_ extends Foo_I_ with Bar_I_ { ; ; f; } +// *//* */ class Mix___wFoo_I_wBar_If extends Foo_I_ with Bar_If { ; ; f; } +/* */abstract class Mix___wFoo_I_wBarY__ extends Foo_I_ with BarY__[B] { ; ; f; } +/* *//* */ class Mix___wFoo_I_wBarY_f extends Foo_I_ with BarY_f[B] { ; ; f; } +// */abstract class Mix___wFoo_I_wBarYI_ extends Foo_I_ with BarYI_[B] { ; ; f; } +// *//* */ class Mix___wFoo_I_wBarYIf extends Foo_I_ with BarYIf[B] { ; ; f; } +/* *//* */ class Mix___wFoo_If extends Foo_If { ; ; f; } +/* *//* */ class Mix___wFoo_IfwBar___ extends Foo_If with Bar___ { ; ; f; } +// *//* */ class Mix___wFoo_IfwBar__f extends Foo_If with Bar__f { ; ; f; } +// *//* */ class Mix___wFoo_IfwBar_I_ extends Foo_If with Bar_I_ { ; ; f; } +// *//* */ class Mix___wFoo_IfwBar_If extends Foo_If with Bar_If { ; ; f; } +/* *//* */ class Mix___wFoo_IfwBarY__ extends Foo_If with BarY__[B] { ; ; f; } +// *//* */ class Mix___wFoo_IfwBarY_f extends Foo_If with BarY_f[B] { ; ; f; } +// *//* */ class Mix___wFoo_IfwBarYI_ extends Foo_If with BarYI_[B] { ; ; f; } +// *//* */ class Mix___wFoo_IfwBarYIf extends Foo_If with BarYIf[B] { ; ; f; } +/* */abstract class Mix___wFooX__ extends FooX__[A] { ; ; f; } +/* */abstract class Mix___wFooX__wBar___ extends FooX__[A] with Bar___ { ; ; f; } +/* */abstract class Mix___wFooX__wBar__f extends FooX__[A] with Bar__f { ; ; f; } +/* */abstract class Mix___wFooX__wBar_I_ extends FooX__[A] with Bar_I_ { ; ; f; } +/* *//* */ class Mix___wFooX__wBar_If extends FooX__[A] with Bar_If { ; ; f; } +/* */abstract class Mix___wFooX__wBarY__ extends FooX__[A] with BarY__[B] { ; ; f; } +/* */abstract class Mix___wFooX__wBarY_f extends FooX__[A] with BarY_f[B] { ; ; f; } +/* */abstract class Mix___wFooX__wBarYI_ extends FooX__[A] with BarYI_[B] { ; ; f; } +/* *//* */ class Mix___wFooX__wBarYIf extends FooX__[A] with BarYIf[B] { ; ; f; } +/* */abstract class Mix___wFooX_f extends FooX_f[A] { ; ; f; } +/* */abstract class Mix___wFooX_fwBar___ extends FooX_f[A] with Bar___ { ; ; f; } +// */abstract class Mix___wFooX_fwBar__f extends FooX_f[A] with Bar__f { ; ; f; } +/* *//* */ class Mix___wFooX_fwBar_I_ extends FooX_f[A] with Bar_I_ { ; ; f; } +// *//* */ class Mix___wFooX_fwBar_If extends FooX_f[A] with Bar_If { ; ; f; } +/* */abstract class Mix___wFooX_fwBarY__ extends FooX_f[A] with BarY__[B] { ; ; f; } +// */abstract class Mix___wFooX_fwBarY_f extends FooX_f[A] with BarY_f[B] { ; ; f; } +/* *//* */ class Mix___wFooX_fwBarYI_ extends FooX_f[A] with BarYI_[B] { ; ; f; } +// *//* */ class Mix___wFooX_fwBarYIf extends FooX_f[A] with BarYIf[B] { ; ; f; } +/* */abstract class Mix___wFooXI_ extends FooXI_[A] { ; ; f; } +/* */abstract class Mix___wFooXI_wBar___ extends FooXI_[A] with Bar___ { ; ; f; } +/* *//* */ class Mix___wFooXI_wBar__f extends FooXI_[A] with Bar__f { ; ; f; } +// */abstract class Mix___wFooXI_wBar_I_ extends FooXI_[A] with Bar_I_ { ; ; f; } +// *//* */ class Mix___wFooXI_wBar_If extends FooXI_[A] with Bar_If { ; ; f; } +/* */abstract class Mix___wFooXI_wBarY__ extends FooXI_[A] with BarY__[B] { ; ; f; } +/* *//* */ class Mix___wFooXI_wBarY_f extends FooXI_[A] with BarY_f[B] { ; ; f; } +// */abstract class Mix___wFooXI_wBarYI_ extends FooXI_[A] with BarYI_[B] { ; ; f; } +// *//* */ class Mix___wFooXI_wBarYIf extends FooXI_[A] with BarYIf[B] { ; ; f; } +/* *//* */ class Mix___wFooXIf extends FooXIf[A] { ; ; f; } +/* *//* */ class Mix___wFooXIfwBar___ extends FooXIf[A] with Bar___ { ; ; f; } +// *//* */ class Mix___wFooXIfwBar__f extends FooXIf[A] with Bar__f { ; ; f; } +// *//* */ class Mix___wFooXIfwBar_I_ extends FooXIf[A] with Bar_I_ { ; ; f; } +// *//* */ class Mix___wFooXIfwBar_If extends FooXIf[A] with Bar_If { ; ; f; } +/* *//* */ class Mix___wFooXIfwBarY__ extends FooXIf[A] with BarY__[B] { ; ; f; } +// *//* */ class Mix___wFooXIfwBarY_f extends FooXIf[A] with BarY_f[B] { ; ; f; } +// *//* */ class Mix___wFooXIfwBarYI_ extends FooXIf[A] with BarYI_[B] { ; ; f; } +// *//* */ class Mix___wFooXIfwBarYIf extends FooXIf[A] with BarYIf[B] { ; ; f; } + +/* */abstract class Mix__fwFoo___ extends Foo___ { ; def f: I = {mix; null}; f; } +/* */abstract class Mix__fwFoo___wBar___ extends Foo___ with Bar___ { ; def f: I = {mix; null}; f; } +/* */abstract class Mix__fwFoo___wBar__f extends Foo___ with Bar__f { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFoo___wBar_I_ extends Foo___ with Bar_I_ { ; def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFoo___wBar_If extends Foo___ with Bar_If { ; override def f: I = {mix; null}; f; } +/* */abstract class Mix__fwFoo___wBarY__ extends Foo___ with BarY__[B] { ; def f: I = {mix; null}; f; } +/* */abstract class Mix__fwFoo___wBarY_f extends Foo___ with BarY_f[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFoo___wBarYI_ extends Foo___ with BarYI_[B] { ; def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFoo___wBarYIf extends Foo___ with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* */abstract class Mix__fwFoo__f extends Foo__f { ; override def f: I = {mix; null}; f; } +/* */abstract class Mix__fwFoo__fwBar___ extends Foo__f with Bar___ { ; override def f: I = {mix; null}; f; } +/* */abstract class Mix__fwFoo__fwBar__f extends Foo__f with Bar__f { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFoo__fwBar_I_ extends Foo__f with Bar_I_ { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFoo__fwBar_If extends Foo__f with Bar_If { ; override def f: I = {mix; null}; f; } +/* */abstract class Mix__fwFoo__fwBarY__ extends Foo__f with BarY__[B] { ; override def f: I = {mix; null}; f; } +/* */abstract class Mix__fwFoo__fwBarY_f extends Foo__f with BarY_f[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFoo__fwBarYI_ extends Foo__f with BarYI_[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFoo__fwBarYIf extends Foo__f with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFoo_I_ extends Foo_I_ { ; def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFoo_I_wBar___ extends Foo_I_ with Bar___ { ; def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFoo_I_wBar__f extends Foo_I_ with Bar__f { ; override def f: I = {mix; null}; f; } +// *//* */ class Mix__fwFoo_I_wBar_I_ extends Foo_I_ with Bar_I_ { ; def f: I = {mix; null}; f; } +// *//* */ class Mix__fwFoo_I_wBar_If extends Foo_I_ with Bar_If { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFoo_I_wBarY__ extends Foo_I_ with BarY__[B] { ; def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFoo_I_wBarY_f extends Foo_I_ with BarY_f[B] { ; override def f: I = {mix; null}; f; } +// *//* */ class Mix__fwFoo_I_wBarYI_ extends Foo_I_ with BarYI_[B] { ; def f: I = {mix; null}; f; } +// *//* */ class Mix__fwFoo_I_wBarYIf extends Foo_I_ with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFoo_If extends Foo_If { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFoo_IfwBar___ extends Foo_If with Bar___ { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFoo_IfwBar__f extends Foo_If with Bar__f { ; override def f: I = {mix; null}; f; } +// *//* */ class Mix__fwFoo_IfwBar_I_ extends Foo_If with Bar_I_ { ; override def f: I = {mix; null}; f; } +// *//* */ class Mix__fwFoo_IfwBar_If extends Foo_If with Bar_If { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFoo_IfwBarY__ extends Foo_If with BarY__[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFoo_IfwBarY_f extends Foo_If with BarY_f[B] { ; override def f: I = {mix; null}; f; } +// *//* */ class Mix__fwFoo_IfwBarYI_ extends Foo_If with BarYI_[B] { ; override def f: I = {mix; null}; f; } +// *//* */ class Mix__fwFoo_IfwBarYIf extends Foo_If with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* */abstract class Mix__fwFooX__ extends FooX__[A] { ; def f: I = {mix; null}; f; } +/* */abstract class Mix__fwFooX__wBar___ extends FooX__[A] with Bar___ { ; def f: I = {mix; null}; f; } +/* */abstract class Mix__fwFooX__wBar__f extends FooX__[A] with Bar__f { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFooX__wBar_I_ extends FooX__[A] with Bar_I_ { ; def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFooX__wBar_If extends FooX__[A] with Bar_If { ; override def f: I = {mix; null}; f; } +/* */abstract class Mix__fwFooX__wBarY__ extends FooX__[A] with BarY__[B] { ; def f: I = {mix; null}; f; } +/* */abstract class Mix__fwFooX__wBarY_f extends FooX__[A] with BarY_f[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFooX__wBarYI_ extends FooX__[A] with BarYI_[B] { ; def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFooX__wBarYIf extends FooX__[A] with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* */abstract class Mix__fwFooX_f extends FooX_f[A] { ; override def f: I = {mix; null}; f; } +/* */abstract class Mix__fwFooX_fwBar___ extends FooX_f[A] with Bar___ { ; override def f: I = {mix; null}; f; } +/* */abstract class Mix__fwFooX_fwBar__f extends FooX_f[A] with Bar__f { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFooX_fwBar_I_ extends FooX_f[A] with Bar_I_ { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFooX_fwBar_If extends FooX_f[A] with Bar_If { ; override def f: I = {mix; null}; f; } +/* */abstract class Mix__fwFooX_fwBarY__ extends FooX_f[A] with BarY__[B] { ; override def f: I = {mix; null}; f; } +/* */abstract class Mix__fwFooX_fwBarY_f extends FooX_f[A] with BarY_f[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFooX_fwBarYI_ extends FooX_f[A] with BarYI_[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFooX_fwBarYIf extends FooX_f[A] with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFooXI_ extends FooXI_[A] { ; def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFooXI_wBar___ extends FooXI_[A] with Bar___ { ; def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFooXI_wBar__f extends FooXI_[A] with Bar__f { ; override def f: I = {mix; null}; f; } +// *//* */ class Mix__fwFooXI_wBar_I_ extends FooXI_[A] with Bar_I_ { ; def f: I = {mix; null}; f; } +// *//* */ class Mix__fwFooXI_wBar_If extends FooXI_[A] with Bar_If { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFooXI_wBarY__ extends FooXI_[A] with BarY__[B] { ; def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFooXI_wBarY_f extends FooXI_[A] with BarY_f[B] { ; override def f: I = {mix; null}; f; } +// *//* */ class Mix__fwFooXI_wBarYI_ extends FooXI_[A] with BarYI_[B] { ; def f: I = {mix; null}; f; } +// *//* */ class Mix__fwFooXI_wBarYIf extends FooXI_[A] with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFooXIf extends FooXIf[A] { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFooXIfwBar___ extends FooXIf[A] with Bar___ { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFooXIfwBar__f extends FooXIf[A] with Bar__f { ; override def f: I = {mix; null}; f; } +// *//* */ class Mix__fwFooXIfwBar_I_ extends FooXIf[A] with Bar_I_ { ; override def f: I = {mix; null}; f; } +// *//* */ class Mix__fwFooXIfwBar_If extends FooXIf[A] with Bar_If { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFooXIfwBarY__ extends FooXIf[A] with BarY__[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class Mix__fwFooXIfwBarY_f extends FooXIf[A] with BarY_f[B] { ; override def f: I = {mix; null}; f; } +// *//* */ class Mix__fwFooXIfwBarYI_ extends FooXIf[A] with BarYI_[B] { ; override def f: I = {mix; null}; f; } +// *//* */ class Mix__fwFooXIfwBarYIf extends FooXIf[A] with BarYIf[B] { ; override def f: I = {mix; null}; f; } + +/* */abstract class Mix_I_wFoo___ extends Foo___ { class I; ; f; } +/* */abstract class Mix_I_wFoo___wBar___ extends Foo___ with Bar___ { class I; ; f; } +/* *//* */ class Mix_I_wFoo___wBar__f extends Foo___ with Bar__f { class I; ; f; } +// */abstract class Mix_I_wFoo___wBar_I_ extends Foo___ with Bar_I_ { class I; ; f; } +// *//* */ class Mix_I_wFoo___wBar_If extends Foo___ with Bar_If { class I; ; f; } +/* */abstract class Mix_I_wFoo___wBarY__ extends Foo___ with BarY__[B] { class I; ; f; } +/* *//* */ class Mix_I_wFoo___wBarY_f extends Foo___ with BarY_f[B] { class I; ; f; } +// */abstract class Mix_I_wFoo___wBarYI_ extends Foo___ with BarYI_[B] { class I; ; f; } +// *//* */ class Mix_I_wFoo___wBarYIf extends Foo___ with BarYIf[B] { class I; ; f; } +/* *//* */ class Mix_I_wFoo__f extends Foo__f { class I; ; f; } +/* *//* */ class Mix_I_wFoo__fwBar___ extends Foo__f with Bar___ { class I; ; f; } +// *//* */ class Mix_I_wFoo__fwBar__f extends Foo__f with Bar__f { class I; ; f; } +// *//* */ class Mix_I_wFoo__fwBar_I_ extends Foo__f with Bar_I_ { class I; ; f; } +// *//* */ class Mix_I_wFoo__fwBar_If extends Foo__f with Bar_If { class I; ; f; } +/* *//* */ class Mix_I_wFoo__fwBarY__ extends Foo__f with BarY__[B] { class I; ; f; } +// *//* */ class Mix_I_wFoo__fwBarY_f extends Foo__f with BarY_f[B] { class I; ; f; } +// *//* */ class Mix_I_wFoo__fwBarYI_ extends Foo__f with BarYI_[B] { class I; ; f; } +// *//* */ class Mix_I_wFoo__fwBarYIf extends Foo__f with BarYIf[B] { class I; ; f; } +// */abstract class Mix_I_wFoo_I_ extends Foo_I_ { class I; ; f; } +// */abstract class Mix_I_wFoo_I_wBar___ extends Foo_I_ with Bar___ { class I; ; f; } +// *//* */ class Mix_I_wFoo_I_wBar__f extends Foo_I_ with Bar__f { class I; ; f; } +// */abstract class Mix_I_wFoo_I_wBar_I_ extends Foo_I_ with Bar_I_ { class I; ; f; } +// *//* */ class Mix_I_wFoo_I_wBar_If extends Foo_I_ with Bar_If { class I; ; f; } +// */abstract class Mix_I_wFoo_I_wBarY__ extends Foo_I_ with BarY__[B] { class I; ; f; } +// *//* */ class Mix_I_wFoo_I_wBarY_f extends Foo_I_ with BarY_f[B] { class I; ; f; } +// */abstract class Mix_I_wFoo_I_wBarYI_ extends Foo_I_ with BarYI_[B] { class I; ; f; } +// *//* */ class Mix_I_wFoo_I_wBarYIf extends Foo_I_ with BarYIf[B] { class I; ; f; } +// *//* */ class Mix_I_wFoo_If extends Foo_If { class I; ; f; } +// *//* */ class Mix_I_wFoo_IfwBar___ extends Foo_If with Bar___ { class I; ; f; } +// *//* */ class Mix_I_wFoo_IfwBar__f extends Foo_If with Bar__f { class I; ; f; } +// *//* */ class Mix_I_wFoo_IfwBar_I_ extends Foo_If with Bar_I_ { class I; ; f; } +// *//* */ class Mix_I_wFoo_IfwBar_If extends Foo_If with Bar_If { class I; ; f; } +// *//* */ class Mix_I_wFoo_IfwBarY__ extends Foo_If with BarY__[B] { class I; ; f; } +// *//* */ class Mix_I_wFoo_IfwBarY_f extends Foo_If with BarY_f[B] { class I; ; f; } +// *//* */ class Mix_I_wFoo_IfwBarYI_ extends Foo_If with BarYI_[B] { class I; ; f; } +// *//* */ class Mix_I_wFoo_IfwBarYIf extends Foo_If with BarYIf[B] { class I; ; f; } +/* */abstract class Mix_I_wFooX__ extends FooX__[A] { class I; ; f; } +/* */abstract class Mix_I_wFooX__wBar___ extends FooX__[A] with Bar___ { class I; ; f; } +/* *//* */ class Mix_I_wFooX__wBar__f extends FooX__[A] with Bar__f { class I; ; f; } +// */abstract class Mix_I_wFooX__wBar_I_ extends FooX__[A] with Bar_I_ { class I; ; f; } +// *//* */ class Mix_I_wFooX__wBar_If extends FooX__[A] with Bar_If { class I; ; f; } +/* */abstract class Mix_I_wFooX__wBarY__ extends FooX__[A] with BarY__[B] { class I; ; f; } +/* *//* */ class Mix_I_wFooX__wBarY_f extends FooX__[A] with BarY_f[B] { class I; ; f; } +// */abstract class Mix_I_wFooX__wBarYI_ extends FooX__[A] with BarYI_[B] { class I; ; f; } +// *//* */ class Mix_I_wFooX__wBarYIf extends FooX__[A] with BarYIf[B] { class I; ; f; } +/* *//* */ class Mix_I_wFooX_f extends FooX_f[A] { class I; ; f; } +/* *//* */ class Mix_I_wFooX_fwBar___ extends FooX_f[A] with Bar___ { class I; ; f; } +// *//* */ class Mix_I_wFooX_fwBar__f extends FooX_f[A] with Bar__f { class I; ; f; } +// *//* */ class Mix_I_wFooX_fwBar_I_ extends FooX_f[A] with Bar_I_ { class I; ; f; } +// *//* */ class Mix_I_wFooX_fwBar_If extends FooX_f[A] with Bar_If { class I; ; f; } +/* *//* */ class Mix_I_wFooX_fwBarY__ extends FooX_f[A] with BarY__[B] { class I; ; f; } +// *//* */ class Mix_I_wFooX_fwBarY_f extends FooX_f[A] with BarY_f[B] { class I; ; f; } +// *//* */ class Mix_I_wFooX_fwBarYI_ extends FooX_f[A] with BarYI_[B] { class I; ; f; } +// *//* */ class Mix_I_wFooX_fwBarYIf extends FooX_f[A] with BarYIf[B] { class I; ; f; } +// */abstract class Mix_I_wFooXI_ extends FooXI_[A] { class I; ; f; } +// */abstract class Mix_I_wFooXI_wBar___ extends FooXI_[A] with Bar___ { class I; ; f; } +// *//* */ class Mix_I_wFooXI_wBar__f extends FooXI_[A] with Bar__f { class I; ; f; } +// */abstract class Mix_I_wFooXI_wBar_I_ extends FooXI_[A] with Bar_I_ { class I; ; f; } +// *//* */ class Mix_I_wFooXI_wBar_If extends FooXI_[A] with Bar_If { class I; ; f; } +// */abstract class Mix_I_wFooXI_wBarY__ extends FooXI_[A] with BarY__[B] { class I; ; f; } +// *//* */ class Mix_I_wFooXI_wBarY_f extends FooXI_[A] with BarY_f[B] { class I; ; f; } +// */abstract class Mix_I_wFooXI_wBarYI_ extends FooXI_[A] with BarYI_[B] { class I; ; f; } +// *//* */ class Mix_I_wFooXI_wBarYIf extends FooXI_[A] with BarYIf[B] { class I; ; f; } +// *//* */ class Mix_I_wFooXIf extends FooXIf[A] { class I; ; f; } +// *//* */ class Mix_I_wFooXIfwBar___ extends FooXIf[A] with Bar___ { class I; ; f; } +// *//* */ class Mix_I_wFooXIfwBar__f extends FooXIf[A] with Bar__f { class I; ; f; } +// *//* */ class Mix_I_wFooXIfwBar_I_ extends FooXIf[A] with Bar_I_ { class I; ; f; } +// *//* */ class Mix_I_wFooXIfwBar_If extends FooXIf[A] with Bar_If { class I; ; f; } +// *//* */ class Mix_I_wFooXIfwBarY__ extends FooXIf[A] with BarY__[B] { class I; ; f; } +// *//* */ class Mix_I_wFooXIfwBarY_f extends FooXIf[A] with BarY_f[B] { class I; ; f; } +// *//* */ class Mix_I_wFooXIfwBarYI_ extends FooXIf[A] with BarYI_[B] { class I; ; f; } +// *//* */ class Mix_I_wFooXIfwBarYIf extends FooXIf[A] with BarYIf[B] { class I; ; f; } + +/* *//* */ class Mix_IfwFoo___ extends Foo___ { class I; def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfwFoo___wBar___ extends Foo___ with Bar___ { class I; def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfwFoo___wBar__f extends Foo___ with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFoo___wBar_I_ extends Foo___ with Bar_I_ { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFoo___wBar_If extends Foo___ with Bar_If { class I; override def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfwFoo___wBarY__ extends Foo___ with BarY__[B] { class I; def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfwFoo___wBarY_f extends Foo___ with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFoo___wBarYI_ extends Foo___ with BarYI_[B] { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFoo___wBarYIf extends Foo___ with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfwFoo__f extends Foo__f { class I; override def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfwFoo__fwBar___ extends Foo__f with Bar___ { class I; override def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfwFoo__fwBar__f extends Foo__f with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFoo__fwBar_I_ extends Foo__f with Bar_I_ { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFoo__fwBar_If extends Foo__f with Bar_If { class I; override def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfwFoo__fwBarY__ extends Foo__f with BarY__[B] { class I; override def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfwFoo__fwBarY_f extends Foo__f with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFoo__fwBarYI_ extends Foo__f with BarYI_[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFoo__fwBarYIf extends Foo__f with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFoo_I_ extends Foo_I_ { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFoo_I_wBar___ extends Foo_I_ with Bar___ { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFoo_I_wBar__f extends Foo_I_ with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFoo_I_wBar_I_ extends Foo_I_ with Bar_I_ { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFoo_I_wBar_If extends Foo_I_ with Bar_If { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFoo_I_wBarY__ extends Foo_I_ with BarY__[B] { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFoo_I_wBarY_f extends Foo_I_ with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFoo_I_wBarYI_ extends Foo_I_ with BarYI_[B] { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFoo_I_wBarYIf extends Foo_I_ with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFoo_If extends Foo_If { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFoo_IfwBar___ extends Foo_If with Bar___ { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFoo_IfwBar__f extends Foo_If with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFoo_IfwBar_I_ extends Foo_If with Bar_I_ { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFoo_IfwBar_If extends Foo_If with Bar_If { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFoo_IfwBarY__ extends Foo_If with BarY__[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFoo_IfwBarY_f extends Foo_If with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFoo_IfwBarYI_ extends Foo_If with BarYI_[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFoo_IfwBarYIf extends Foo_If with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfwFooX__ extends FooX__[A] { class I; def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfwFooX__wBar___ extends FooX__[A] with Bar___ { class I; def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfwFooX__wBar__f extends FooX__[A] with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFooX__wBar_I_ extends FooX__[A] with Bar_I_ { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFooX__wBar_If extends FooX__[A] with Bar_If { class I; override def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfwFooX__wBarY__ extends FooX__[A] with BarY__[B] { class I; def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfwFooX__wBarY_f extends FooX__[A] with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFooX__wBarYI_ extends FooX__[A] with BarYI_[B] { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFooX__wBarYIf extends FooX__[A] with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfwFooX_f extends FooX_f[A] { class I; override def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfwFooX_fwBar___ extends FooX_f[A] with Bar___ { class I; override def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfwFooX_fwBar__f extends FooX_f[A] with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFooX_fwBar_I_ extends FooX_f[A] with Bar_I_ { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFooX_fwBar_If extends FooX_f[A] with Bar_If { class I; override def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfwFooX_fwBarY__ extends FooX_f[A] with BarY__[B] { class I; override def f: I = {mix; null}; f; } +/* *//* */ class Mix_IfwFooX_fwBarY_f extends FooX_f[A] with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFooX_fwBarYI_ extends FooX_f[A] with BarYI_[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFooX_fwBarYIf extends FooX_f[A] with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFooXI_ extends FooXI_[A] { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFooXI_wBar___ extends FooXI_[A] with Bar___ { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFooXI_wBar__f extends FooXI_[A] with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFooXI_wBar_I_ extends FooXI_[A] with Bar_I_ { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFooXI_wBar_If extends FooXI_[A] with Bar_If { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFooXI_wBarY__ extends FooXI_[A] with BarY__[B] { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFooXI_wBarY_f extends FooXI_[A] with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFooXI_wBarYI_ extends FooXI_[A] with BarYI_[B] { class I; def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFooXI_wBarYIf extends FooXI_[A] with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFooXIf extends FooXIf[A] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFooXIfwBar___ extends FooXIf[A] with Bar___ { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFooXIfwBar__f extends FooXIf[A] with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFooXIfwBar_I_ extends FooXIf[A] with Bar_I_ { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFooXIfwBar_If extends FooXIf[A] with Bar_If { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFooXIfwBarY__ extends FooXIf[A] with BarY__[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFooXIfwBarY_f extends FooXIf[A] with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFooXIfwBarYI_ extends FooXIf[A] with BarYI_[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class Mix_IfwFooXIfwBarYIf extends FooXIf[A] with BarYIf[B] { class I; override def f: I = {mix; null}; f; } + +/* */abstract class MixZ__wFoo___ [Z] extends Foo___ { ; ; f; } +/* */abstract class MixZ__wFoo___wBar___[Z] extends Foo___ with Bar___ { ; ; f; } +/* */abstract class MixZ__wFoo___wBar__f[Z] extends Foo___ with Bar__f { ; ; f; } +/* */abstract class MixZ__wFoo___wBar_I_[Z] extends Foo___ with Bar_I_ { ; ; f; } +/* *//* */ class MixZ__wFoo___wBar_If[Z] extends Foo___ with Bar_If { ; ; f; } +/* */abstract class MixZ__wFoo___wBarY__[Z] extends Foo___ with BarY__[B] { ; ; f; } +/* */abstract class MixZ__wFoo___wBarY_f[Z] extends Foo___ with BarY_f[B] { ; ; f; } +/* */abstract class MixZ__wFoo___wBarYI_[Z] extends Foo___ with BarYI_[B] { ; ; f; } +/* *//* */ class MixZ__wFoo___wBarYIf[Z] extends Foo___ with BarYIf[B] { ; ; f; } +/* */abstract class MixZ__wFoo__f [Z] extends Foo__f { ; ; f; } +/* */abstract class MixZ__wFoo__fwBar___[Z] extends Foo__f with Bar___ { ; ; f; } +// */abstract class MixZ__wFoo__fwBar__f[Z] extends Foo__f with Bar__f { ; ; f; } +/* *//* */ class MixZ__wFoo__fwBar_I_[Z] extends Foo__f with Bar_I_ { ; ; f; } +// *//* */ class MixZ__wFoo__fwBar_If[Z] extends Foo__f with Bar_If { ; ; f; } +/* */abstract class MixZ__wFoo__fwBarY__[Z] extends Foo__f with BarY__[B] { ; ; f; } +// */abstract class MixZ__wFoo__fwBarY_f[Z] extends Foo__f with BarY_f[B] { ; ; f; } +/* *//* */ class MixZ__wFoo__fwBarYI_[Z] extends Foo__f with BarYI_[B] { ; ; f; } +// *//* */ class MixZ__wFoo__fwBarYIf[Z] extends Foo__f with BarYIf[B] { ; ; f; } +/* */abstract class MixZ__wFoo_I_ [Z] extends Foo_I_ { ; ; f; } +/* */abstract class MixZ__wFoo_I_wBar___[Z] extends Foo_I_ with Bar___ { ; ; f; } +/* *//* */ class MixZ__wFoo_I_wBar__f[Z] extends Foo_I_ with Bar__f { ; ; f; } +// */abstract class MixZ__wFoo_I_wBar_I_[Z] extends Foo_I_ with Bar_I_ { ; ; f; } +// *//* */ class MixZ__wFoo_I_wBar_If[Z] extends Foo_I_ with Bar_If { ; ; f; } +/* */abstract class MixZ__wFoo_I_wBarY__[Z] extends Foo_I_ with BarY__[B] { ; ; f; } +/* *//* */ class MixZ__wFoo_I_wBarY_f[Z] extends Foo_I_ with BarY_f[B] { ; ; f; } +// */abstract class MixZ__wFoo_I_wBarYI_[Z] extends Foo_I_ with BarYI_[B] { ; ; f; } +// *//* */ class MixZ__wFoo_I_wBarYIf[Z] extends Foo_I_ with BarYIf[B] { ; ; f; } +/* *//* */ class MixZ__wFoo_If [Z] extends Foo_If { ; ; f; } +/* *//* */ class MixZ__wFoo_IfwBar___[Z] extends Foo_If with Bar___ { ; ; f; } +// *//* */ class MixZ__wFoo_IfwBar__f[Z] extends Foo_If with Bar__f { ; ; f; } +// *//* */ class MixZ__wFoo_IfwBar_I_[Z] extends Foo_If with Bar_I_ { ; ; f; } +// *//* */ class MixZ__wFoo_IfwBar_If[Z] extends Foo_If with Bar_If { ; ; f; } +/* *//* */ class MixZ__wFoo_IfwBarY__[Z] extends Foo_If with BarY__[B] { ; ; f; } +// *//* */ class MixZ__wFoo_IfwBarY_f[Z] extends Foo_If with BarY_f[B] { ; ; f; } +// *//* */ class MixZ__wFoo_IfwBarYI_[Z] extends Foo_If with BarYI_[B] { ; ; f; } +// *//* */ class MixZ__wFoo_IfwBarYIf[Z] extends Foo_If with BarYIf[B] { ; ; f; } +/* */abstract class MixZ__wFooX__ [Z] extends FooX__[A] { ; ; f; } +/* */abstract class MixZ__wFooX__wBar___[Z] extends FooX__[A] with Bar___ { ; ; f; } +/* */abstract class MixZ__wFooX__wBar__f[Z] extends FooX__[A] with Bar__f { ; ; f; } +/* */abstract class MixZ__wFooX__wBar_I_[Z] extends FooX__[A] with Bar_I_ { ; ; f; } +/* *//* */ class MixZ__wFooX__wBar_If[Z] extends FooX__[A] with Bar_If { ; ; f; } +/* */abstract class MixZ__wFooX__wBarY__[Z] extends FooX__[A] with BarY__[B] { ; ; f; } +/* */abstract class MixZ__wFooX__wBarY_f[Z] extends FooX__[A] with BarY_f[B] { ; ; f; } +/* */abstract class MixZ__wFooX__wBarYI_[Z] extends FooX__[A] with BarYI_[B] { ; ; f; } +/* *//* */ class MixZ__wFooX__wBarYIf[Z] extends FooX__[A] with BarYIf[B] { ; ; f; } +/* */abstract class MixZ__wFooX_f [Z] extends FooX_f[A] { ; ; f; } +/* */abstract class MixZ__wFooX_fwBar___[Z] extends FooX_f[A] with Bar___ { ; ; f; } +// */abstract class MixZ__wFooX_fwBar__f[Z] extends FooX_f[A] with Bar__f { ; ; f; } +/* *//* */ class MixZ__wFooX_fwBar_I_[Z] extends FooX_f[A] with Bar_I_ { ; ; f; } +// *//* */ class MixZ__wFooX_fwBar_If[Z] extends FooX_f[A] with Bar_If { ; ; f; } +/* */abstract class MixZ__wFooX_fwBarY__[Z] extends FooX_f[A] with BarY__[B] { ; ; f; } +// */abstract class MixZ__wFooX_fwBarY_f[Z] extends FooX_f[A] with BarY_f[B] { ; ; f; } +/* *//* */ class MixZ__wFooX_fwBarYI_[Z] extends FooX_f[A] with BarYI_[B] { ; ; f; } +// *//* */ class MixZ__wFooX_fwBarYIf[Z] extends FooX_f[A] with BarYIf[B] { ; ; f; } +/* */abstract class MixZ__wFooXI_ [Z] extends FooXI_[A] { ; ; f; } +/* */abstract class MixZ__wFooXI_wBar___[Z] extends FooXI_[A] with Bar___ { ; ; f; } +/* *//* */ class MixZ__wFooXI_wBar__f[Z] extends FooXI_[A] with Bar__f { ; ; f; } +// */abstract class MixZ__wFooXI_wBar_I_[Z] extends FooXI_[A] with Bar_I_ { ; ; f; } +// *//* */ class MixZ__wFooXI_wBar_If[Z] extends FooXI_[A] with Bar_If { ; ; f; } +/* */abstract class MixZ__wFooXI_wBarY__[Z] extends FooXI_[A] with BarY__[B] { ; ; f; } +/* *//* */ class MixZ__wFooXI_wBarY_f[Z] extends FooXI_[A] with BarY_f[B] { ; ; f; } +// */abstract class MixZ__wFooXI_wBarYI_[Z] extends FooXI_[A] with BarYI_[B] { ; ; f; } +// *//* */ class MixZ__wFooXI_wBarYIf[Z] extends FooXI_[A] with BarYIf[B] { ; ; f; } +/* *//* */ class MixZ__wFooXIf [Z] extends FooXIf[A] { ; ; f; } +/* *//* */ class MixZ__wFooXIfwBar___[Z] extends FooXIf[A] with Bar___ { ; ; f; } +// *//* */ class MixZ__wFooXIfwBar__f[Z] extends FooXIf[A] with Bar__f { ; ; f; } +// *//* */ class MixZ__wFooXIfwBar_I_[Z] extends FooXIf[A] with Bar_I_ { ; ; f; } +// *//* */ class MixZ__wFooXIfwBar_If[Z] extends FooXIf[A] with Bar_If { ; ; f; } +/* *//* */ class MixZ__wFooXIfwBarY__[Z] extends FooXIf[A] with BarY__[B] { ; ; f; } +// *//* */ class MixZ__wFooXIfwBarY_f[Z] extends FooXIf[A] with BarY_f[B] { ; ; f; } +// *//* */ class MixZ__wFooXIfwBarYI_[Z] extends FooXIf[A] with BarYI_[B] { ; ; f; } +// *//* */ class MixZ__wFooXIfwBarYIf[Z] extends FooXIf[A] with BarYIf[B] { ; ; f; } + +/* */abstract class MixZ_fwFoo___ [Z] extends Foo___ { ; def f: I = {mix; null}; f; } +/* */abstract class MixZ_fwFoo___wBar___[Z] extends Foo___ with Bar___ { ; def f: I = {mix; null}; f; } +/* */abstract class MixZ_fwFoo___wBar__f[Z] extends Foo___ with Bar__f { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFoo___wBar_I_[Z] extends Foo___ with Bar_I_ { ; def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFoo___wBar_If[Z] extends Foo___ with Bar_If { ; override def f: I = {mix; null}; f; } +/* */abstract class MixZ_fwFoo___wBarY__[Z] extends Foo___ with BarY__[B] { ; def f: I = {mix; null}; f; } +/* */abstract class MixZ_fwFoo___wBarY_f[Z] extends Foo___ with BarY_f[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFoo___wBarYI_[Z] extends Foo___ with BarYI_[B] { ; def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFoo___wBarYIf[Z] extends Foo___ with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* */abstract class MixZ_fwFoo__f [Z] extends Foo__f { ; override def f: I = {mix; null}; f; } +/* */abstract class MixZ_fwFoo__fwBar___[Z] extends Foo__f with Bar___ { ; override def f: I = {mix; null}; f; } +/* */abstract class MixZ_fwFoo__fwBar__f[Z] extends Foo__f with Bar__f { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFoo__fwBar_I_[Z] extends Foo__f with Bar_I_ { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFoo__fwBar_If[Z] extends Foo__f with Bar_If { ; override def f: I = {mix; null}; f; } +/* */abstract class MixZ_fwFoo__fwBarY__[Z] extends Foo__f with BarY__[B] { ; override def f: I = {mix; null}; f; } +/* */abstract class MixZ_fwFoo__fwBarY_f[Z] extends Foo__f with BarY_f[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFoo__fwBarYI_[Z] extends Foo__f with BarYI_[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFoo__fwBarYIf[Z] extends Foo__f with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFoo_I_ [Z] extends Foo_I_ { ; def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFoo_I_wBar___[Z] extends Foo_I_ with Bar___ { ; def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFoo_I_wBar__f[Z] extends Foo_I_ with Bar__f { ; override def f: I = {mix; null}; f; } +// *//* */ class MixZ_fwFoo_I_wBar_I_[Z] extends Foo_I_ with Bar_I_ { ; def f: I = {mix; null}; f; } +// *//* */ class MixZ_fwFoo_I_wBar_If[Z] extends Foo_I_ with Bar_If { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFoo_I_wBarY__[Z] extends Foo_I_ with BarY__[B] { ; def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFoo_I_wBarY_f[Z] extends Foo_I_ with BarY_f[B] { ; override def f: I = {mix; null}; f; } +// *//* */ class MixZ_fwFoo_I_wBarYI_[Z] extends Foo_I_ with BarYI_[B] { ; def f: I = {mix; null}; f; } +// *//* */ class MixZ_fwFoo_I_wBarYIf[Z] extends Foo_I_ with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFoo_If [Z] extends Foo_If { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFoo_IfwBar___[Z] extends Foo_If with Bar___ { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFoo_IfwBar__f[Z] extends Foo_If with Bar__f { ; override def f: I = {mix; null}; f; } +// *//* */ class MixZ_fwFoo_IfwBar_I_[Z] extends Foo_If with Bar_I_ { ; override def f: I = {mix; null}; f; } +// *//* */ class MixZ_fwFoo_IfwBar_If[Z] extends Foo_If with Bar_If { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFoo_IfwBarY__[Z] extends Foo_If with BarY__[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFoo_IfwBarY_f[Z] extends Foo_If with BarY_f[B] { ; override def f: I = {mix; null}; f; } +// *//* */ class MixZ_fwFoo_IfwBarYI_[Z] extends Foo_If with BarYI_[B] { ; override def f: I = {mix; null}; f; } +// *//* */ class MixZ_fwFoo_IfwBarYIf[Z] extends Foo_If with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* */abstract class MixZ_fwFooX__ [Z] extends FooX__[A] { ; def f: I = {mix; null}; f; } +/* */abstract class MixZ_fwFooX__wBar___[Z] extends FooX__[A] with Bar___ { ; def f: I = {mix; null}; f; } +/* */abstract class MixZ_fwFooX__wBar__f[Z] extends FooX__[A] with Bar__f { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFooX__wBar_I_[Z] extends FooX__[A] with Bar_I_ { ; def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFooX__wBar_If[Z] extends FooX__[A] with Bar_If { ; override def f: I = {mix; null}; f; } +/* */abstract class MixZ_fwFooX__wBarY__[Z] extends FooX__[A] with BarY__[B] { ; def f: I = {mix; null}; f; } +/* */abstract class MixZ_fwFooX__wBarY_f[Z] extends FooX__[A] with BarY_f[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFooX__wBarYI_[Z] extends FooX__[A] with BarYI_[B] { ; def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFooX__wBarYIf[Z] extends FooX__[A] with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* */abstract class MixZ_fwFooX_f [Z] extends FooX_f[A] { ; override def f: I = {mix; null}; f; } +/* */abstract class MixZ_fwFooX_fwBar___[Z] extends FooX_f[A] with Bar___ { ; override def f: I = {mix; null}; f; } +/* */abstract class MixZ_fwFooX_fwBar__f[Z] extends FooX_f[A] with Bar__f { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFooX_fwBar_I_[Z] extends FooX_f[A] with Bar_I_ { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFooX_fwBar_If[Z] extends FooX_f[A] with Bar_If { ; override def f: I = {mix; null}; f; } +/* */abstract class MixZ_fwFooX_fwBarY__[Z] extends FooX_f[A] with BarY__[B] { ; override def f: I = {mix; null}; f; } +/* */abstract class MixZ_fwFooX_fwBarY_f[Z] extends FooX_f[A] with BarY_f[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFooX_fwBarYI_[Z] extends FooX_f[A] with BarYI_[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFooX_fwBarYIf[Z] extends FooX_f[A] with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFooXI_ [Z] extends FooXI_[A] { ; def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFooXI_wBar___[Z] extends FooXI_[A] with Bar___ { ; def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFooXI_wBar__f[Z] extends FooXI_[A] with Bar__f { ; override def f: I = {mix; null}; f; } +// *//* */ class MixZ_fwFooXI_wBar_I_[Z] extends FooXI_[A] with Bar_I_ { ; def f: I = {mix; null}; f; } +// *//* */ class MixZ_fwFooXI_wBar_If[Z] extends FooXI_[A] with Bar_If { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFooXI_wBarY__[Z] extends FooXI_[A] with BarY__[B] { ; def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFooXI_wBarY_f[Z] extends FooXI_[A] with BarY_f[B] { ; override def f: I = {mix; null}; f; } +// *//* */ class MixZ_fwFooXI_wBarYI_[Z] extends FooXI_[A] with BarYI_[B] { ; def f: I = {mix; null}; f; } +// *//* */ class MixZ_fwFooXI_wBarYIf[Z] extends FooXI_[A] with BarYIf[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFooXIf [Z] extends FooXIf[A] { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFooXIfwBar___[Z] extends FooXIf[A] with Bar___ { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFooXIfwBar__f[Z] extends FooXIf[A] with Bar__f { ; override def f: I = {mix; null}; f; } +// *//* */ class MixZ_fwFooXIfwBar_I_[Z] extends FooXIf[A] with Bar_I_ { ; override def f: I = {mix; null}; f; } +// *//* */ class MixZ_fwFooXIfwBar_If[Z] extends FooXIf[A] with Bar_If { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFooXIfwBarY__[Z] extends FooXIf[A] with BarY__[B] { ; override def f: I = {mix; null}; f; } +/* *//* */ class MixZ_fwFooXIfwBarY_f[Z] extends FooXIf[A] with BarY_f[B] { ; override def f: I = {mix; null}; f; } +// *//* */ class MixZ_fwFooXIfwBarYI_[Z] extends FooXIf[A] with BarYI_[B] { ; override def f: I = {mix; null}; f; } +// *//* */ class MixZ_fwFooXIfwBarYIf[Z] extends FooXIf[A] with BarYIf[B] { ; override def f: I = {mix; null}; f; } + +/* */abstract class MixZI_wFoo___ [Z] extends Foo___ { class I; ; f; } +/* */abstract class MixZI_wFoo___wBar___[Z] extends Foo___ with Bar___ { class I; ; f; } +/* *//* */ class MixZI_wFoo___wBar__f[Z] extends Foo___ with Bar__f { class I; ; f; } +// */abstract class MixZI_wFoo___wBar_I_[Z] extends Foo___ with Bar_I_ { class I; ; f; } +// *//* */ class MixZI_wFoo___wBar_If[Z] extends Foo___ with Bar_If { class I; ; f; } +/* */abstract class MixZI_wFoo___wBarY__[Z] extends Foo___ with BarY__[B] { class I; ; f; } +/* *//* */ class MixZI_wFoo___wBarY_f[Z] extends Foo___ with BarY_f[B] { class I; ; f; } +// */abstract class MixZI_wFoo___wBarYI_[Z] extends Foo___ with BarYI_[B] { class I; ; f; } +// *//* */ class MixZI_wFoo___wBarYIf[Z] extends Foo___ with BarYIf[B] { class I; ; f; } +/* *//* */ class MixZI_wFoo__f [Z] extends Foo__f { class I; ; f; } +/* *//* */ class MixZI_wFoo__fwBar___[Z] extends Foo__f with Bar___ { class I; ; f; } +// *//* */ class MixZI_wFoo__fwBar__f[Z] extends Foo__f with Bar__f { class I; ; f; } +// *//* */ class MixZI_wFoo__fwBar_I_[Z] extends Foo__f with Bar_I_ { class I; ; f; } +// *//* */ class MixZI_wFoo__fwBar_If[Z] extends Foo__f with Bar_If { class I; ; f; } +/* *//* */ class MixZI_wFoo__fwBarY__[Z] extends Foo__f with BarY__[B] { class I; ; f; } +// *//* */ class MixZI_wFoo__fwBarY_f[Z] extends Foo__f with BarY_f[B] { class I; ; f; } +// *//* */ class MixZI_wFoo__fwBarYI_[Z] extends Foo__f with BarYI_[B] { class I; ; f; } +// *//* */ class MixZI_wFoo__fwBarYIf[Z] extends Foo__f with BarYIf[B] { class I; ; f; } +// */abstract class MixZI_wFoo_I_ [Z] extends Foo_I_ { class I; ; f; } +// */abstract class MixZI_wFoo_I_wBar___[Z] extends Foo_I_ with Bar___ { class I; ; f; } +// *//* */ class MixZI_wFoo_I_wBar__f[Z] extends Foo_I_ with Bar__f { class I; ; f; } +// */abstract class MixZI_wFoo_I_wBar_I_[Z] extends Foo_I_ with Bar_I_ { class I; ; f; } +// *//* */ class MixZI_wFoo_I_wBar_If[Z] extends Foo_I_ with Bar_If { class I; ; f; } +// */abstract class MixZI_wFoo_I_wBarY__[Z] extends Foo_I_ with BarY__[B] { class I; ; f; } +// *//* */ class MixZI_wFoo_I_wBarY_f[Z] extends Foo_I_ with BarY_f[B] { class I; ; f; } +// */abstract class MixZI_wFoo_I_wBarYI_[Z] extends Foo_I_ with BarYI_[B] { class I; ; f; } +// *//* */ class MixZI_wFoo_I_wBarYIf[Z] extends Foo_I_ with BarYIf[B] { class I; ; f; } +// *//* */ class MixZI_wFoo_If [Z] extends Foo_If { class I; ; f; } +// *//* */ class MixZI_wFoo_IfwBar___[Z] extends Foo_If with Bar___ { class I; ; f; } +// *//* */ class MixZI_wFoo_IfwBar__f[Z] extends Foo_If with Bar__f { class I; ; f; } +// *//* */ class MixZI_wFoo_IfwBar_I_[Z] extends Foo_If with Bar_I_ { class I; ; f; } +// *//* */ class MixZI_wFoo_IfwBar_If[Z] extends Foo_If with Bar_If { class I; ; f; } +// *//* */ class MixZI_wFoo_IfwBarY__[Z] extends Foo_If with BarY__[B] { class I; ; f; } +// *//* */ class MixZI_wFoo_IfwBarY_f[Z] extends Foo_If with BarY_f[B] { class I; ; f; } +// *//* */ class MixZI_wFoo_IfwBarYI_[Z] extends Foo_If with BarYI_[B] { class I; ; f; } +// *//* */ class MixZI_wFoo_IfwBarYIf[Z] extends Foo_If with BarYIf[B] { class I; ; f; } +/* */abstract class MixZI_wFooX__ [Z] extends FooX__[A] { class I; ; f; } +/* */abstract class MixZI_wFooX__wBar___[Z] extends FooX__[A] with Bar___ { class I; ; f; } +/* *//* */ class MixZI_wFooX__wBar__f[Z] extends FooX__[A] with Bar__f { class I; ; f; } +// */abstract class MixZI_wFooX__wBar_I_[Z] extends FooX__[A] with Bar_I_ { class I; ; f; } +// *//* */ class MixZI_wFooX__wBar_If[Z] extends FooX__[A] with Bar_If { class I; ; f; } +/* */abstract class MixZI_wFooX__wBarY__[Z] extends FooX__[A] with BarY__[B] { class I; ; f; } +/* *//* */ class MixZI_wFooX__wBarY_f[Z] extends FooX__[A] with BarY_f[B] { class I; ; f; } +// */abstract class MixZI_wFooX__wBarYI_[Z] extends FooX__[A] with BarYI_[B] { class I; ; f; } +// *//* */ class MixZI_wFooX__wBarYIf[Z] extends FooX__[A] with BarYIf[B] { class I; ; f; } +/* *//* */ class MixZI_wFooX_f [Z] extends FooX_f[A] { class I; ; f; } +/* *//* */ class MixZI_wFooX_fwBar___[Z] extends FooX_f[A] with Bar___ { class I; ; f; } +// *//* */ class MixZI_wFooX_fwBar__f[Z] extends FooX_f[A] with Bar__f { class I; ; f; } +// *//* */ class MixZI_wFooX_fwBar_I_[Z] extends FooX_f[A] with Bar_I_ { class I; ; f; } +// *//* */ class MixZI_wFooX_fwBar_If[Z] extends FooX_f[A] with Bar_If { class I; ; f; } +/* *//* */ class MixZI_wFooX_fwBarY__[Z] extends FooX_f[A] with BarY__[B] { class I; ; f; } +// *//* */ class MixZI_wFooX_fwBarY_f[Z] extends FooX_f[A] with BarY_f[B] { class I; ; f; } +// *//* */ class MixZI_wFooX_fwBarYI_[Z] extends FooX_f[A] with BarYI_[B] { class I; ; f; } +// *//* */ class MixZI_wFooX_fwBarYIf[Z] extends FooX_f[A] with BarYIf[B] { class I; ; f; } +// */abstract class MixZI_wFooXI_ [Z] extends FooXI_[A] { class I; ; f; } +// */abstract class MixZI_wFooXI_wBar___[Z] extends FooXI_[A] with Bar___ { class I; ; f; } +// *//* */ class MixZI_wFooXI_wBar__f[Z] extends FooXI_[A] with Bar__f { class I; ; f; } +// */abstract class MixZI_wFooXI_wBar_I_[Z] extends FooXI_[A] with Bar_I_ { class I; ; f; } +// *//* */ class MixZI_wFooXI_wBar_If[Z] extends FooXI_[A] with Bar_If { class I; ; f; } +// */abstract class MixZI_wFooXI_wBarY__[Z] extends FooXI_[A] with BarY__[B] { class I; ; f; } +// *//* */ class MixZI_wFooXI_wBarY_f[Z] extends FooXI_[A] with BarY_f[B] { class I; ; f; } +// */abstract class MixZI_wFooXI_wBarYI_[Z] extends FooXI_[A] with BarYI_[B] { class I; ; f; } +// *//* */ class MixZI_wFooXI_wBarYIf[Z] extends FooXI_[A] with BarYIf[B] { class I; ; f; } +// *//* */ class MixZI_wFooXIf [Z] extends FooXIf[A] { class I; ; f; } +// *//* */ class MixZI_wFooXIfwBar___[Z] extends FooXIf[A] with Bar___ { class I; ; f; } +// *//* */ class MixZI_wFooXIfwBar__f[Z] extends FooXIf[A] with Bar__f { class I; ; f; } +// *//* */ class MixZI_wFooXIfwBar_I_[Z] extends FooXIf[A] with Bar_I_ { class I; ; f; } +// *//* */ class MixZI_wFooXIfwBar_If[Z] extends FooXIf[A] with Bar_If { class I; ; f; } +// *//* */ class MixZI_wFooXIfwBarY__[Z] extends FooXIf[A] with BarY__[B] { class I; ; f; } +// *//* */ class MixZI_wFooXIfwBarY_f[Z] extends FooXIf[A] with BarY_f[B] { class I; ; f; } +// *//* */ class MixZI_wFooXIfwBarYI_[Z] extends FooXIf[A] with BarYI_[B] { class I; ; f; } +// *//* */ class MixZI_wFooXIfwBarYIf[Z] extends FooXIf[A] with BarYIf[B] { class I; ; f; } + +/* *//* */ class MixZIfwFoo___ [Z] extends Foo___ { class I; def f: I = {mix; null}; f; } +/* *//* */ class MixZIfwFoo___wBar___[Z] extends Foo___ with Bar___ { class I; def f: I = {mix; null}; f; } +/* *//* */ class MixZIfwFoo___wBar__f[Z] extends Foo___ with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFoo___wBar_I_[Z] extends Foo___ with Bar_I_ { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFoo___wBar_If[Z] extends Foo___ with Bar_If { class I; override def f: I = {mix; null}; f; } +/* *//* */ class MixZIfwFoo___wBarY__[Z] extends Foo___ with BarY__[B] { class I; def f: I = {mix; null}; f; } +/* *//* */ class MixZIfwFoo___wBarY_f[Z] extends Foo___ with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFoo___wBarYI_[Z] extends Foo___ with BarYI_[B] { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFoo___wBarYIf[Z] extends Foo___ with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +/* *//* */ class MixZIfwFoo__f [Z] extends Foo__f { class I; override def f: I = {mix; null}; f; } +/* *//* */ class MixZIfwFoo__fwBar___[Z] extends Foo__f with Bar___ { class I; override def f: I = {mix; null}; f; } +/* *//* */ class MixZIfwFoo__fwBar__f[Z] extends Foo__f with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFoo__fwBar_I_[Z] extends Foo__f with Bar_I_ { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFoo__fwBar_If[Z] extends Foo__f with Bar_If { class I; override def f: I = {mix; null}; f; } +/* *//* */ class MixZIfwFoo__fwBarY__[Z] extends Foo__f with BarY__[B] { class I; override def f: I = {mix; null}; f; } +/* *//* */ class MixZIfwFoo__fwBarY_f[Z] extends Foo__f with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFoo__fwBarYI_[Z] extends Foo__f with BarYI_[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFoo__fwBarYIf[Z] extends Foo__f with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFoo_I_ [Z] extends Foo_I_ { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFoo_I_wBar___[Z] extends Foo_I_ with Bar___ { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFoo_I_wBar__f[Z] extends Foo_I_ with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFoo_I_wBar_I_[Z] extends Foo_I_ with Bar_I_ { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFoo_I_wBar_If[Z] extends Foo_I_ with Bar_If { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFoo_I_wBarY__[Z] extends Foo_I_ with BarY__[B] { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFoo_I_wBarY_f[Z] extends Foo_I_ with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFoo_I_wBarYI_[Z] extends Foo_I_ with BarYI_[B] { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFoo_I_wBarYIf[Z] extends Foo_I_ with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFoo_If [Z] extends Foo_If { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFoo_IfwBar___[Z] extends Foo_If with Bar___ { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFoo_IfwBar__f[Z] extends Foo_If with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFoo_IfwBar_I_[Z] extends Foo_If with Bar_I_ { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFoo_IfwBar_If[Z] extends Foo_If with Bar_If { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFoo_IfwBarY__[Z] extends Foo_If with BarY__[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFoo_IfwBarY_f[Z] extends Foo_If with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFoo_IfwBarYI_[Z] extends Foo_If with BarYI_[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFoo_IfwBarYIf[Z] extends Foo_If with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +/* *//* */ class MixZIfwFooX__ [Z] extends FooX__[A] { class I; def f: I = {mix; null}; f; } +/* *//* */ class MixZIfwFooX__wBar___[Z] extends FooX__[A] with Bar___ { class I; def f: I = {mix; null}; f; } +/* *//* */ class MixZIfwFooX__wBar__f[Z] extends FooX__[A] with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFooX__wBar_I_[Z] extends FooX__[A] with Bar_I_ { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFooX__wBar_If[Z] extends FooX__[A] with Bar_If { class I; override def f: I = {mix; null}; f; } +/* *//* */ class MixZIfwFooX__wBarY__[Z] extends FooX__[A] with BarY__[B] { class I; def f: I = {mix; null}; f; } +/* *//* */ class MixZIfwFooX__wBarY_f[Z] extends FooX__[A] with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFooX__wBarYI_[Z] extends FooX__[A] with BarYI_[B] { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFooX__wBarYIf[Z] extends FooX__[A] with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +/* *//* */ class MixZIfwFooX_f [Z] extends FooX_f[A] { class I; override def f: I = {mix; null}; f; } +/* *//* */ class MixZIfwFooX_fwBar___[Z] extends FooX_f[A] with Bar___ { class I; override def f: I = {mix; null}; f; } +/* *//* */ class MixZIfwFooX_fwBar__f[Z] extends FooX_f[A] with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFooX_fwBar_I_[Z] extends FooX_f[A] with Bar_I_ { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFooX_fwBar_If[Z] extends FooX_f[A] with Bar_If { class I; override def f: I = {mix; null}; f; } +/* *//* */ class MixZIfwFooX_fwBarY__[Z] extends FooX_f[A] with BarY__[B] { class I; override def f: I = {mix; null}; f; } +/* *//* */ class MixZIfwFooX_fwBarY_f[Z] extends FooX_f[A] with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFooX_fwBarYI_[Z] extends FooX_f[A] with BarYI_[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFooX_fwBarYIf[Z] extends FooX_f[A] with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFooXI_ [Z] extends FooXI_[A] { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFooXI_wBar___[Z] extends FooXI_[A] with Bar___ { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFooXI_wBar__f[Z] extends FooXI_[A] with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFooXI_wBar_I_[Z] extends FooXI_[A] with Bar_I_ { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFooXI_wBar_If[Z] extends FooXI_[A] with Bar_If { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFooXI_wBarY__[Z] extends FooXI_[A] with BarY__[B] { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFooXI_wBarY_f[Z] extends FooXI_[A] with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFooXI_wBarYI_[Z] extends FooXI_[A] with BarYI_[B] { class I; def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFooXI_wBarYIf[Z] extends FooXI_[A] with BarYIf[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFooXIf [Z] extends FooXIf[A] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFooXIfwBar___[Z] extends FooXIf[A] with Bar___ { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFooXIfwBar__f[Z] extends FooXIf[A] with Bar__f { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFooXIfwBar_I_[Z] extends FooXIf[A] with Bar_I_ { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFooXIfwBar_If[Z] extends FooXIf[A] with Bar_If { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFooXIfwBarY__[Z] extends FooXIf[A] with BarY__[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFooXIfwBarY_f[Z] extends FooXIf[A] with BarY_f[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFooXIfwBarYI_[Z] extends FooXIf[A] with BarYI_[B] { class I; override def f: I = {mix; null}; f; } +// *//* */ class MixZIfwFooXIfwBarYIf[Z] extends FooXIf[A] with BarYIf[B] { class I; override def f: I = {mix; null}; f; } + + + + + +/* */class S_____eFoo___ extends Mix___eFoo___ { class I; def f: I = {sub; null}; f; } +/* */class S_____eFoo___wBar___ extends Mix___eFoo___wBar___ { class I; def f: I = {sub; null}; f; } +/* */class S_____eFoo___wBar__f extends Mix___eFoo___wBar__f { class I; ; f; } +/* */class S_____eFoo___wBar_I_ extends Mix___eFoo___wBar_I_ { ; def f: I = {sub; null}; f; } +/* */class S_____eFoo___wBar_If extends Mix___eFoo___wBar_If { ; ; f; } +/* */class S_____eFoo___wBarY__ extends Mix___eFoo___wBarY__ { class I; def f: I = {sub; null}; f; } +/* */class S_____eFoo___wBarY_f extends Mix___eFoo___wBarY_f { class I; ; f; } +/* */class S_____eFoo___wBarYI_ extends Mix___eFoo___wBarYI_ { ; def f: I = {sub; null}; f; } +/* */class S_____eFoo___wBarYIf extends Mix___eFoo___wBarYIf { ; ; f; } +/* */class S_____eFoo__f extends Mix___eFoo__f { class I; ; f; } +/* */class S_____eFoo__fwBar___ extends Mix___eFoo__fwBar___ { class I; ; f; } +// */class S_____eFoo__fwBar__f extends Mix___eFoo__fwBar__f { class I; ; f; } +/* */class S_____eFoo__fwBar_I_ extends Mix___eFoo__fwBar_I_ { ; ; f; } +// */class S_____eFoo__fwBar_If extends Mix___eFoo__fwBar_If { ; ; f; } +/* */class S_____eFoo__fwBarY__ extends Mix___eFoo__fwBarY__ { class I; ; f; } +// */class S_____eFoo__fwBarY_f extends Mix___eFoo__fwBarY_f { class I; ; f; } +/* */class S_____eFoo__fwBarYI_ extends Mix___eFoo__fwBarYI_ { ; ; f; } +// */class S_____eFoo__fwBarYIf extends Mix___eFoo__fwBarYIf { ; ; f; } +/* */class S_____eFoo_I_ extends Mix___eFoo_I_ { ; def f: I = {sub; null}; f; } +/* */class S_____eFoo_I_wBar___ extends Mix___eFoo_I_wBar___ { ; def f: I = {sub; null}; f; } +/* */class S_____eFoo_I_wBar__f extends Mix___eFoo_I_wBar__f { ; ; f; } +// */class S_____eFoo_I_wBar_I_ extends Mix___eFoo_I_wBar_I_ { ; def f: I = {sub; null}; f; } +// */class S_____eFoo_I_wBar_If extends Mix___eFoo_I_wBar_If { ; ; f; } +/* */class S_____eFoo_I_wBarY__ extends Mix___eFoo_I_wBarY__ { ; def f: I = {sub; null}; f; } +/* */class S_____eFoo_I_wBarY_f extends Mix___eFoo_I_wBarY_f { ; ; f; } +// */class S_____eFoo_I_wBarYI_ extends Mix___eFoo_I_wBarYI_ { ; def f: I = {sub; null}; f; } +// */class S_____eFoo_I_wBarYIf extends Mix___eFoo_I_wBarYIf { ; ; f; } +/* */class S_____eFoo_If extends Mix___eFoo_If { ; ; f; } +/* */class S_____eFoo_IfwBar___ extends Mix___eFoo_IfwBar___ { ; ; f; } +// */class S_____eFoo_IfwBar__f extends Mix___eFoo_IfwBar__f { ; ; f; } +// */class S_____eFoo_IfwBar_I_ extends Mix___eFoo_IfwBar_I_ { ; ; f; } +// */class S_____eFoo_IfwBar_If extends Mix___eFoo_IfwBar_If { ; ; f; } +/* */class S_____eFoo_IfwBarY__ extends Mix___eFoo_IfwBarY__ { ; ; f; } +// */class S_____eFoo_IfwBarY_f extends Mix___eFoo_IfwBarY_f { ; ; f; } +// */class S_____eFoo_IfwBarYI_ extends Mix___eFoo_IfwBarYI_ { ; ; f; } +// */class S_____eFoo_IfwBarYIf extends Mix___eFoo_IfwBarYIf { ; ; f; } +/* */class S_____eFooX__ extends Mix___eFooX__ { class I; def f: I = {sub; null}; f; } +/* */class S_____eFooX__wBar___ extends Mix___eFooX__wBar___ { class I; def f: I = {sub; null}; f; } +/* */class S_____eFooX__wBar__f extends Mix___eFooX__wBar__f { class I; ; f; } +/* */class S_____eFooX__wBar_I_ extends Mix___eFooX__wBar_I_ { ; def f: I = {sub; null}; f; } +/* */class S_____eFooX__wBar_If extends Mix___eFooX__wBar_If { ; ; f; } +/* */class S_____eFooX__wBarY__ extends Mix___eFooX__wBarY__ { class I; def f: I = {sub; null}; f; } +/* */class S_____eFooX__wBarY_f extends Mix___eFooX__wBarY_f { class I; ; f; } +/* */class S_____eFooX__wBarYI_ extends Mix___eFooX__wBarYI_ { ; def f: I = {sub; null}; f; } +/* */class S_____eFooX__wBarYIf extends Mix___eFooX__wBarYIf { ; ; f; } +/* */class S_____eFooX_f extends Mix___eFooX_f { class I; ; f; } +/* */class S_____eFooX_fwBar___ extends Mix___eFooX_fwBar___ { class I; ; f; } +// */class S_____eFooX_fwBar__f extends Mix___eFooX_fwBar__f { class I; ; f; } +/* */class S_____eFooX_fwBar_I_ extends Mix___eFooX_fwBar_I_ { ; ; f; } +// */class S_____eFooX_fwBar_If extends Mix___eFooX_fwBar_If { ; ; f; } +/* */class S_____eFooX_fwBarY__ extends Mix___eFooX_fwBarY__ { class I; ; f; } +// */class S_____eFooX_fwBarY_f extends Mix___eFooX_fwBarY_f { class I; ; f; } +/* */class S_____eFooX_fwBarYI_ extends Mix___eFooX_fwBarYI_ { ; ; f; } +// */class S_____eFooX_fwBarYIf extends Mix___eFooX_fwBarYIf { ; ; f; } +/* */class S_____eFooXI_ extends Mix___eFooXI_ { ; def f: I = {sub; null}; f; } +/* */class S_____eFooXI_wBar___ extends Mix___eFooXI_wBar___ { ; def f: I = {sub; null}; f; } +/* */class S_____eFooXI_wBar__f extends Mix___eFooXI_wBar__f { ; ; f; } +// */class S_____eFooXI_wBar_I_ extends Mix___eFooXI_wBar_I_ { ; def f: I = {sub; null}; f; } +// */class S_____eFooXI_wBar_If extends Mix___eFooXI_wBar_If { ; ; f; } +/* */class S_____eFooXI_wBarY__ extends Mix___eFooXI_wBarY__ { ; def f: I = {sub; null}; f; } +/* */class S_____eFooXI_wBarY_f extends Mix___eFooXI_wBarY_f { ; ; f; } +// */class S_____eFooXI_wBarYI_ extends Mix___eFooXI_wBarYI_ { ; def f: I = {sub; null}; f; } +// */class S_____eFooXI_wBarYIf extends Mix___eFooXI_wBarYIf { ; ; f; } +/* */class S_____eFooXIf extends Mix___eFooXIf { ; ; f; } +/* */class S_____eFooXIfwBar___ extends Mix___eFooXIfwBar___ { ; ; f; } +// */class S_____eFooXIfwBar__f extends Mix___eFooXIfwBar__f { ; ; f; } +// */class S_____eFooXIfwBar_I_ extends Mix___eFooXIfwBar_I_ { ; ; f; } +// */class S_____eFooXIfwBar_If extends Mix___eFooXIfwBar_If { ; ; f; } +/* */class S_____eFooXIfwBarY__ extends Mix___eFooXIfwBarY__ { ; ; f; } +// */class S_____eFooXIfwBarY_f extends Mix___eFooXIfwBarY_f { ; ; f; } +// */class S_____eFooXIfwBarYI_ extends Mix___eFooXIfwBarYI_ { ; ; f; } +// */class S_____eFooXIfwBarYIf extends Mix___eFooXIfwBarYIf { ; ; f; } + +/* */class S____feFoo___ extends Mix__feFoo___ { class I; ; f; } +/* */class S____feFoo___wBar___ extends Mix__feFoo___wBar___ { class I; ; f; } +/* */class S____feFoo___wBar__f extends Mix__feFoo___wBar__f { class I; ; f; } +/* */class S____feFoo___wBar_I_ extends Mix__feFoo___wBar_I_ { ; ; f; } +/* */class S____feFoo___wBar_If extends Mix__feFoo___wBar_If { ; ; f; } +/* */class S____feFoo___wBarY__ extends Mix__feFoo___wBarY__ { class I; ; f; } +/* */class S____feFoo___wBarY_f extends Mix__feFoo___wBarY_f { class I; ; f; } +/* */class S____feFoo___wBarYI_ extends Mix__feFoo___wBarYI_ { ; ; f; } +/* */class S____feFoo___wBarYIf extends Mix__feFoo___wBarYIf { ; ; f; } +/* */class S____feFoo__f extends Mix__feFoo__f { class I; ; f; } +/* */class S____feFoo__fwBar___ extends Mix__feFoo__fwBar___ { class I; ; f; } +/* */class S____feFoo__fwBar__f extends Mix__feFoo__fwBar__f { class I; ; f; } +/* */class S____feFoo__fwBar_I_ extends Mix__feFoo__fwBar_I_ { ; ; f; } +/* */class S____feFoo__fwBar_If extends Mix__feFoo__fwBar_If { ; ; f; } +/* */class S____feFoo__fwBarY__ extends Mix__feFoo__fwBarY__ { class I; ; f; } +/* */class S____feFoo__fwBarY_f extends Mix__feFoo__fwBarY_f { class I; ; f; } +/* */class S____feFoo__fwBarYI_ extends Mix__feFoo__fwBarYI_ { ; ; f; } +/* */class S____feFoo__fwBarYIf extends Mix__feFoo__fwBarYIf { ; ; f; } +/* */class S____feFoo_I_ extends Mix__feFoo_I_ { ; ; f; } +/* */class S____feFoo_I_wBar___ extends Mix__feFoo_I_wBar___ { ; ; f; } +/* */class S____feFoo_I_wBar__f extends Mix__feFoo_I_wBar__f { ; ; f; } +// */class S____feFoo_I_wBar_I_ extends Mix__feFoo_I_wBar_I_ { ; ; f; } +// */class S____feFoo_I_wBar_If extends Mix__feFoo_I_wBar_If { ; ; f; } +/* */class S____feFoo_I_wBarY__ extends Mix__feFoo_I_wBarY__ { ; ; f; } +/* */class S____feFoo_I_wBarY_f extends Mix__feFoo_I_wBarY_f { ; ; f; } +// */class S____feFoo_I_wBarYI_ extends Mix__feFoo_I_wBarYI_ { ; ; f; } +// */class S____feFoo_I_wBarYIf extends Mix__feFoo_I_wBarYIf { ; ; f; } +/* */class S____feFoo_If extends Mix__feFoo_If { ; ; f; } +/* */class S____feFoo_IfwBar___ extends Mix__feFoo_IfwBar___ { ; ; f; } +/* */class S____feFoo_IfwBar__f extends Mix__feFoo_IfwBar__f { ; ; f; } +// */class S____feFoo_IfwBar_I_ extends Mix__feFoo_IfwBar_I_ { ; ; f; } +// */class S____feFoo_IfwBar_If extends Mix__feFoo_IfwBar_If { ; ; f; } +/* */class S____feFoo_IfwBarY__ extends Mix__feFoo_IfwBarY__ { ; ; f; } +/* */class S____feFoo_IfwBarY_f extends Mix__feFoo_IfwBarY_f { ; ; f; } +// */class S____feFoo_IfwBarYI_ extends Mix__feFoo_IfwBarYI_ { ; ; f; } +// */class S____feFoo_IfwBarYIf extends Mix__feFoo_IfwBarYIf { ; ; f; } +/* */class S____feFooX__ extends Mix__feFooX__ { class I; ; f; } +/* */class S____feFooX__wBar___ extends Mix__feFooX__wBar___ { class I; ; f; } +/* */class S____feFooX__wBar__f extends Mix__feFooX__wBar__f { class I; ; f; } +/* */class S____feFooX__wBar_I_ extends Mix__feFooX__wBar_I_ { ; ; f; } +/* */class S____feFooX__wBar_If extends Mix__feFooX__wBar_If { ; ; f; } +/* */class S____feFooX__wBarY__ extends Mix__feFooX__wBarY__ { class I; ; f; } +/* */class S____feFooX__wBarY_f extends Mix__feFooX__wBarY_f { class I; ; f; } +/* */class S____feFooX__wBarYI_ extends Mix__feFooX__wBarYI_ { ; ; f; } +/* */class S____feFooX__wBarYIf extends Mix__feFooX__wBarYIf { ; ; f; } +/* */class S____feFooX_f extends Mix__feFooX_f { class I; ; f; } +/* */class S____feFooX_fwBar___ extends Mix__feFooX_fwBar___ { class I; ; f; } +/* */class S____feFooX_fwBar__f extends Mix__feFooX_fwBar__f { class I; ; f; } +/* */class S____feFooX_fwBar_I_ extends Mix__feFooX_fwBar_I_ { ; ; f; } +/* */class S____feFooX_fwBar_If extends Mix__feFooX_fwBar_If { ; ; f; } +/* */class S____feFooX_fwBarY__ extends Mix__feFooX_fwBarY__ { class I; ; f; } +/* */class S____feFooX_fwBarY_f extends Mix__feFooX_fwBarY_f { class I; ; f; } +/* */class S____feFooX_fwBarYI_ extends Mix__feFooX_fwBarYI_ { ; ; f; } +/* */class S____feFooX_fwBarYIf extends Mix__feFooX_fwBarYIf { ; ; f; } +/* */class S____feFooXI_ extends Mix__feFooXI_ { ; ; f; } +/* */class S____feFooXI_wBar___ extends Mix__feFooXI_wBar___ { ; ; f; } +/* */class S____feFooXI_wBar__f extends Mix__feFooXI_wBar__f { ; ; f; } +// */class S____feFooXI_wBar_I_ extends Mix__feFooXI_wBar_I_ { ; ; f; } +// */class S____feFooXI_wBar_If extends Mix__feFooXI_wBar_If { ; ; f; } +/* */class S____feFooXI_wBarY__ extends Mix__feFooXI_wBarY__ { ; ; f; } +/* */class S____feFooXI_wBarY_f extends Mix__feFooXI_wBarY_f { ; ; f; } +// */class S____feFooXI_wBarYI_ extends Mix__feFooXI_wBarYI_ { ; ; f; } +// */class S____feFooXI_wBarYIf extends Mix__feFooXI_wBarYIf { ; ; f; } +/* */class S____feFooXIf extends Mix__feFooXIf { ; ; f; } +/* */class S____feFooXIfwBar___ extends Mix__feFooXIfwBar___ { ; ; f; } +/* */class S____feFooXIfwBar__f extends Mix__feFooXIfwBar__f { ; ; f; } +// */class S____feFooXIfwBar_I_ extends Mix__feFooXIfwBar_I_ { ; ; f; } +// */class S____feFooXIfwBar_If extends Mix__feFooXIfwBar_If { ; ; f; } +/* */class S____feFooXIfwBarY__ extends Mix__feFooXIfwBarY__ { ; ; f; } +/* */class S____feFooXIfwBarY_f extends Mix__feFooXIfwBarY_f { ; ; f; } +// */class S____feFooXIfwBarYI_ extends Mix__feFooXIfwBarYI_ { ; ; f; } +// */class S____feFooXIfwBarYIf extends Mix__feFooXIfwBarYIf { ; ; f; } + +/* */class S___I_eFoo___ extends Mix_I_eFoo___ { ; def f: I = {sub; null}; f; } +/* */class S___I_eFoo___wBar___ extends Mix_I_eFoo___wBar___ { ; def f: I = {sub; null}; f; } +/* */class S___I_eFoo___wBar__f extends Mix_I_eFoo___wBar__f { ; ; f; } +// */class S___I_eFoo___wBar_I_ extends Mix_I_eFoo___wBar_I_ { ; def f: I = {sub; null}; f; } +// */class S___I_eFoo___wBar_If extends Mix_I_eFoo___wBar_If { ; ; f; } +/* */class S___I_eFoo___wBarY__ extends Mix_I_eFoo___wBarY__ { ; def f: I = {sub; null}; f; } +/* */class S___I_eFoo___wBarY_f extends Mix_I_eFoo___wBarY_f { ; ; f; } +// */class S___I_eFoo___wBarYI_ extends Mix_I_eFoo___wBarYI_ { ; def f: I = {sub; null}; f; } +// */class S___I_eFoo___wBarYIf extends Mix_I_eFoo___wBarYIf { ; ; f; } +/* */class S___I_eFoo__f extends Mix_I_eFoo__f { ; ; f; } +/* */class S___I_eFoo__fwBar___ extends Mix_I_eFoo__fwBar___ { ; ; f; } +// */class S___I_eFoo__fwBar__f extends Mix_I_eFoo__fwBar__f { ; ; f; } +// */class S___I_eFoo__fwBar_I_ extends Mix_I_eFoo__fwBar_I_ { ; ; f; } +// */class S___I_eFoo__fwBar_If extends Mix_I_eFoo__fwBar_If { ; ; f; } +/* */class S___I_eFoo__fwBarY__ extends Mix_I_eFoo__fwBarY__ { ; ; f; } +// */class S___I_eFoo__fwBarY_f extends Mix_I_eFoo__fwBarY_f { ; ; f; } +// */class S___I_eFoo__fwBarYI_ extends Mix_I_eFoo__fwBarYI_ { ; ; f; } +// */class S___I_eFoo__fwBarYIf extends Mix_I_eFoo__fwBarYIf { ; ; f; } +// */class S___I_eFoo_I_ extends Mix_I_eFoo_I_ { ; def f: I = {sub; null}; f; } +// */class S___I_eFoo_I_wBar___ extends Mix_I_eFoo_I_wBar___ { ; def f: I = {sub; null}; f; } +// */class S___I_eFoo_I_wBar__f extends Mix_I_eFoo_I_wBar__f { ; ; f; } +// */class S___I_eFoo_I_wBar_I_ extends Mix_I_eFoo_I_wBar_I_ { ; def f: I = {sub; null}; f; } +// */class S___I_eFoo_I_wBar_If extends Mix_I_eFoo_I_wBar_If { ; ; f; } +// */class S___I_eFoo_I_wBarY__ extends Mix_I_eFoo_I_wBarY__ { ; def f: I = {sub; null}; f; } +// */class S___I_eFoo_I_wBarY_f extends Mix_I_eFoo_I_wBarY_f { ; ; f; } +// */class S___I_eFoo_I_wBarYI_ extends Mix_I_eFoo_I_wBarYI_ { ; def f: I = {sub; null}; f; } +// */class S___I_eFoo_I_wBarYIf extends Mix_I_eFoo_I_wBarYIf { ; ; f; } +// */class S___I_eFoo_If extends Mix_I_eFoo_If { ; ; f; } +// */class S___I_eFoo_IfwBar___ extends Mix_I_eFoo_IfwBar___ { ; ; f; } +// */class S___I_eFoo_IfwBar__f extends Mix_I_eFoo_IfwBar__f { ; ; f; } +// */class S___I_eFoo_IfwBar_I_ extends Mix_I_eFoo_IfwBar_I_ { ; ; f; } +// */class S___I_eFoo_IfwBar_If extends Mix_I_eFoo_IfwBar_If { ; ; f; } +// */class S___I_eFoo_IfwBarY__ extends Mix_I_eFoo_IfwBarY__ { ; ; f; } +// */class S___I_eFoo_IfwBarY_f extends Mix_I_eFoo_IfwBarY_f { ; ; f; } +// */class S___I_eFoo_IfwBarYI_ extends Mix_I_eFoo_IfwBarYI_ { ; ; f; } +// */class S___I_eFoo_IfwBarYIf extends Mix_I_eFoo_IfwBarYIf { ; ; f; } +/* */class S___I_eFooX__ extends Mix_I_eFooX__ { ; def f: I = {sub; null}; f; } +/* */class S___I_eFooX__wBar___ extends Mix_I_eFooX__wBar___ { ; def f: I = {sub; null}; f; } +/* */class S___I_eFooX__wBar__f extends Mix_I_eFooX__wBar__f { ; ; f; } +// */class S___I_eFooX__wBar_I_ extends Mix_I_eFooX__wBar_I_ { ; def f: I = {sub; null}; f; } +// */class S___I_eFooX__wBar_If extends Mix_I_eFooX__wBar_If { ; ; f; } +/* */class S___I_eFooX__wBarY__ extends Mix_I_eFooX__wBarY__ { ; def f: I = {sub; null}; f; } +/* */class S___I_eFooX__wBarY_f extends Mix_I_eFooX__wBarY_f { ; ; f; } +// */class S___I_eFooX__wBarYI_ extends Mix_I_eFooX__wBarYI_ { ; def f: I = {sub; null}; f; } +// */class S___I_eFooX__wBarYIf extends Mix_I_eFooX__wBarYIf { ; ; f; } +/* */class S___I_eFooX_f extends Mix_I_eFooX_f { ; ; f; } +/* */class S___I_eFooX_fwBar___ extends Mix_I_eFooX_fwBar___ { ; ; f; } +// */class S___I_eFooX_fwBar__f extends Mix_I_eFooX_fwBar__f { ; ; f; } +// */class S___I_eFooX_fwBar_I_ extends Mix_I_eFooX_fwBar_I_ { ; ; f; } +// */class S___I_eFooX_fwBar_If extends Mix_I_eFooX_fwBar_If { ; ; f; } +/* */class S___I_eFooX_fwBarY__ extends Mix_I_eFooX_fwBarY__ { ; ; f; } +// */class S___I_eFooX_fwBarY_f extends Mix_I_eFooX_fwBarY_f { ; ; f; } +// */class S___I_eFooX_fwBarYI_ extends Mix_I_eFooX_fwBarYI_ { ; ; f; } +// */class S___I_eFooX_fwBarYIf extends Mix_I_eFooX_fwBarYIf { ; ; f; } +// */class S___I_eFooXI_ extends Mix_I_eFooXI_ { ; def f: I = {sub; null}; f; } +// */class S___I_eFooXI_wBar___ extends Mix_I_eFooXI_wBar___ { ; def f: I = {sub; null}; f; } +// */class S___I_eFooXI_wBar__f extends Mix_I_eFooXI_wBar__f { ; ; f; } +// */class S___I_eFooXI_wBar_I_ extends Mix_I_eFooXI_wBar_I_ { ; def f: I = {sub; null}; f; } +// */class S___I_eFooXI_wBar_If extends Mix_I_eFooXI_wBar_If { ; ; f; } +// */class S___I_eFooXI_wBarY__ extends Mix_I_eFooXI_wBarY__ { ; def f: I = {sub; null}; f; } +// */class S___I_eFooXI_wBarY_f extends Mix_I_eFooXI_wBarY_f { ; ; f; } +// */class S___I_eFooXI_wBarYI_ extends Mix_I_eFooXI_wBarYI_ { ; def f: I = {sub; null}; f; } +// */class S___I_eFooXI_wBarYIf extends Mix_I_eFooXI_wBarYIf { ; ; f; } +// */class S___I_eFooXIf extends Mix_I_eFooXIf { ; ; f; } +// */class S___I_eFooXIfwBar___ extends Mix_I_eFooXIfwBar___ { ; ; f; } +// */class S___I_eFooXIfwBar__f extends Mix_I_eFooXIfwBar__f { ; ; f; } +// */class S___I_eFooXIfwBar_I_ extends Mix_I_eFooXIfwBar_I_ { ; ; f; } +// */class S___I_eFooXIfwBar_If extends Mix_I_eFooXIfwBar_If { ; ; f; } +// */class S___I_eFooXIfwBarY__ extends Mix_I_eFooXIfwBarY__ { ; ; f; } +// */class S___I_eFooXIfwBarY_f extends Mix_I_eFooXIfwBarY_f { ; ; f; } +// */class S___I_eFooXIfwBarYI_ extends Mix_I_eFooXIfwBarYI_ { ; ; f; } +// */class S___I_eFooXIfwBarYIf extends Mix_I_eFooXIfwBarYIf { ; ; f; } + +/* */class S___IfeFoo___ extends Mix_IfeFoo___ { ; ; f; } +/* */class S___IfeFoo___wBar___ extends Mix_IfeFoo___wBar___ { ; ; f; } +/* */class S___IfeFoo___wBar__f extends Mix_IfeFoo___wBar__f { ; ; f; } +// */class S___IfeFoo___wBar_I_ extends Mix_IfeFoo___wBar_I_ { ; ; f; } +// */class S___IfeFoo___wBar_If extends Mix_IfeFoo___wBar_If { ; ; f; } +/* */class S___IfeFoo___wBarY__ extends Mix_IfeFoo___wBarY__ { ; ; f; } +/* */class S___IfeFoo___wBarY_f extends Mix_IfeFoo___wBarY_f { ; ; f; } +// */class S___IfeFoo___wBarYI_ extends Mix_IfeFoo___wBarYI_ { ; ; f; } +// */class S___IfeFoo___wBarYIf extends Mix_IfeFoo___wBarYIf { ; ; f; } +/* */class S___IfeFoo__f extends Mix_IfeFoo__f { ; ; f; } +/* */class S___IfeFoo__fwBar___ extends Mix_IfeFoo__fwBar___ { ; ; f; } +/* */class S___IfeFoo__fwBar__f extends Mix_IfeFoo__fwBar__f { ; ; f; } +// */class S___IfeFoo__fwBar_I_ extends Mix_IfeFoo__fwBar_I_ { ; ; f; } +// */class S___IfeFoo__fwBar_If extends Mix_IfeFoo__fwBar_If { ; ; f; } +/* */class S___IfeFoo__fwBarY__ extends Mix_IfeFoo__fwBarY__ { ; ; f; } +/* */class S___IfeFoo__fwBarY_f extends Mix_IfeFoo__fwBarY_f { ; ; f; } +// */class S___IfeFoo__fwBarYI_ extends Mix_IfeFoo__fwBarYI_ { ; ; f; } +// */class S___IfeFoo__fwBarYIf extends Mix_IfeFoo__fwBarYIf { ; ; f; } +// */class S___IfeFoo_I_ extends Mix_IfeFoo_I_ { ; ; f; } +// */class S___IfeFoo_I_wBar___ extends Mix_IfeFoo_I_wBar___ { ; ; f; } +// */class S___IfeFoo_I_wBar__f extends Mix_IfeFoo_I_wBar__f { ; ; f; } +// */class S___IfeFoo_I_wBar_I_ extends Mix_IfeFoo_I_wBar_I_ { ; ; f; } +// */class S___IfeFoo_I_wBar_If extends Mix_IfeFoo_I_wBar_If { ; ; f; } +// */class S___IfeFoo_I_wBarY__ extends Mix_IfeFoo_I_wBarY__ { ; ; f; } +// */class S___IfeFoo_I_wBarY_f extends Mix_IfeFoo_I_wBarY_f { ; ; f; } +// */class S___IfeFoo_I_wBarYI_ extends Mix_IfeFoo_I_wBarYI_ { ; ; f; } +// */class S___IfeFoo_I_wBarYIf extends Mix_IfeFoo_I_wBarYIf { ; ; f; } +// */class S___IfeFoo_If extends Mix_IfeFoo_If { ; ; f; } +// */class S___IfeFoo_IfwBar___ extends Mix_IfeFoo_IfwBar___ { ; ; f; } +// */class S___IfeFoo_IfwBar__f extends Mix_IfeFoo_IfwBar__f { ; ; f; } +// */class S___IfeFoo_IfwBar_I_ extends Mix_IfeFoo_IfwBar_I_ { ; ; f; } +// */class S___IfeFoo_IfwBar_If extends Mix_IfeFoo_IfwBar_If { ; ; f; } +// */class S___IfeFoo_IfwBarY__ extends Mix_IfeFoo_IfwBarY__ { ; ; f; } +// */class S___IfeFoo_IfwBarY_f extends Mix_IfeFoo_IfwBarY_f { ; ; f; } +// */class S___IfeFoo_IfwBarYI_ extends Mix_IfeFoo_IfwBarYI_ { ; ; f; } +// */class S___IfeFoo_IfwBarYIf extends Mix_IfeFoo_IfwBarYIf { ; ; f; } +/* */class S___IfeFooX__ extends Mix_IfeFooX__ { ; ; f; } +/* */class S___IfeFooX__wBar___ extends Mix_IfeFooX__wBar___ { ; ; f; } +/* */class S___IfeFooX__wBar__f extends Mix_IfeFooX__wBar__f { ; ; f; } +// */class S___IfeFooX__wBar_I_ extends Mix_IfeFooX__wBar_I_ { ; ; f; } +// */class S___IfeFooX__wBar_If extends Mix_IfeFooX__wBar_If { ; ; f; } +/* */class S___IfeFooX__wBarY__ extends Mix_IfeFooX__wBarY__ { ; ; f; } +/* */class S___IfeFooX__wBarY_f extends Mix_IfeFooX__wBarY_f { ; ; f; } +// */class S___IfeFooX__wBarYI_ extends Mix_IfeFooX__wBarYI_ { ; ; f; } +// */class S___IfeFooX__wBarYIf extends Mix_IfeFooX__wBarYIf { ; ; f; } +/* */class S___IfeFooX_f extends Mix_IfeFooX_f { ; ; f; } +/* */class S___IfeFooX_fwBar___ extends Mix_IfeFooX_fwBar___ { ; ; f; } +/* */class S___IfeFooX_fwBar__f extends Mix_IfeFooX_fwBar__f { ; ; f; } +// */class S___IfeFooX_fwBar_I_ extends Mix_IfeFooX_fwBar_I_ { ; ; f; } +// */class S___IfeFooX_fwBar_If extends Mix_IfeFooX_fwBar_If { ; ; f; } +/* */class S___IfeFooX_fwBarY__ extends Mix_IfeFooX_fwBarY__ { ; ; f; } +/* */class S___IfeFooX_fwBarY_f extends Mix_IfeFooX_fwBarY_f { ; ; f; } +// */class S___IfeFooX_fwBarYI_ extends Mix_IfeFooX_fwBarYI_ { ; ; f; } +// */class S___IfeFooX_fwBarYIf extends Mix_IfeFooX_fwBarYIf { ; ; f; } +// */class S___IfeFooXI_ extends Mix_IfeFooXI_ { ; ; f; } +// */class S___IfeFooXI_wBar___ extends Mix_IfeFooXI_wBar___ { ; ; f; } +// */class S___IfeFooXI_wBar__f extends Mix_IfeFooXI_wBar__f { ; ; f; } +// */class S___IfeFooXI_wBar_I_ extends Mix_IfeFooXI_wBar_I_ { ; ; f; } +// */class S___IfeFooXI_wBar_If extends Mix_IfeFooXI_wBar_If { ; ; f; } +// */class S___IfeFooXI_wBarY__ extends Mix_IfeFooXI_wBarY__ { ; ; f; } +// */class S___IfeFooXI_wBarY_f extends Mix_IfeFooXI_wBarY_f { ; ; f; } +// */class S___IfeFooXI_wBarYI_ extends Mix_IfeFooXI_wBarYI_ { ; ; f; } +// */class S___IfeFooXI_wBarYIf extends Mix_IfeFooXI_wBarYIf { ; ; f; } +// */class S___IfeFooXIf extends Mix_IfeFooXIf { ; ; f; } +// */class S___IfeFooXIfwBar___ extends Mix_IfeFooXIfwBar___ { ; ; f; } +// */class S___IfeFooXIfwBar__f extends Mix_IfeFooXIfwBar__f { ; ; f; } +// */class S___IfeFooXIfwBar_I_ extends Mix_IfeFooXIfwBar_I_ { ; ; f; } +// */class S___IfeFooXIfwBar_If extends Mix_IfeFooXIfwBar_If { ; ; f; } +// */class S___IfeFooXIfwBarY__ extends Mix_IfeFooXIfwBarY__ { ; ; f; } +// */class S___IfeFooXIfwBarY_f extends Mix_IfeFooXIfwBarY_f { ; ; f; } +// */class S___IfeFooXIfwBarYI_ extends Mix_IfeFooXIfwBarYI_ { ; ; f; } +// */class S___IfeFooXIfwBarYIf extends Mix_IfeFooXIfwBarYIf { ; ; f; } + +/* */class S__Z__eFoo___ extends MixZ__eFoo___ [C] { class I; def f: I = {sub; null}; f; } +/* */class S__Z__eFoo___wBar___ extends MixZ__eFoo___wBar___[C] { class I; def f: I = {sub; null}; f; } +/* */class S__Z__eFoo___wBar__f extends MixZ__eFoo___wBar__f[C] { class I; ; f; } +/* */class S__Z__eFoo___wBar_I_ extends MixZ__eFoo___wBar_I_[C] { ; def f: I = {sub; null}; f; } +/* */class S__Z__eFoo___wBar_If extends MixZ__eFoo___wBar_If[C] { ; ; f; } +/* */class S__Z__eFoo___wBarY__ extends MixZ__eFoo___wBarY__[C] { class I; def f: I = {sub; null}; f; } +/* */class S__Z__eFoo___wBarY_f extends MixZ__eFoo___wBarY_f[C] { class I; ; f; } +/* */class S__Z__eFoo___wBarYI_ extends MixZ__eFoo___wBarYI_[C] { ; def f: I = {sub; null}; f; } +/* */class S__Z__eFoo___wBarYIf extends MixZ__eFoo___wBarYIf[C] { ; ; f; } +/* */class S__Z__eFoo__f extends MixZ__eFoo__f [C] { class I; ; f; } +/* */class S__Z__eFoo__fwBar___ extends MixZ__eFoo__fwBar___[C] { class I; ; f; } +// */class S__Z__eFoo__fwBar__f extends MixZ__eFoo__fwBar__f[C] { class I; ; f; } +/* */class S__Z__eFoo__fwBar_I_ extends MixZ__eFoo__fwBar_I_[C] { ; ; f; } +// */class S__Z__eFoo__fwBar_If extends MixZ__eFoo__fwBar_If[C] { ; ; f; } +/* */class S__Z__eFoo__fwBarY__ extends MixZ__eFoo__fwBarY__[C] { class I; ; f; } +// */class S__Z__eFoo__fwBarY_f extends MixZ__eFoo__fwBarY_f[C] { class I; ; f; } +/* */class S__Z__eFoo__fwBarYI_ extends MixZ__eFoo__fwBarYI_[C] { ; ; f; } +// */class S__Z__eFoo__fwBarYIf extends MixZ__eFoo__fwBarYIf[C] { ; ; f; } +/* */class S__Z__eFoo_I_ extends MixZ__eFoo_I_ [C] { ; def f: I = {sub; null}; f; } +/* */class S__Z__eFoo_I_wBar___ extends MixZ__eFoo_I_wBar___[C] { ; def f: I = {sub; null}; f; } +/* */class S__Z__eFoo_I_wBar__f extends MixZ__eFoo_I_wBar__f[C] { ; ; f; } +// */class S__Z__eFoo_I_wBar_I_ extends MixZ__eFoo_I_wBar_I_[C] { ; def f: I = {sub; null}; f; } +// */class S__Z__eFoo_I_wBar_If extends MixZ__eFoo_I_wBar_If[C] { ; ; f; } +/* */class S__Z__eFoo_I_wBarY__ extends MixZ__eFoo_I_wBarY__[C] { ; def f: I = {sub; null}; f; } +/* */class S__Z__eFoo_I_wBarY_f extends MixZ__eFoo_I_wBarY_f[C] { ; ; f; } +// */class S__Z__eFoo_I_wBarYI_ extends MixZ__eFoo_I_wBarYI_[C] { ; def f: I = {sub; null}; f; } +// */class S__Z__eFoo_I_wBarYIf extends MixZ__eFoo_I_wBarYIf[C] { ; ; f; } +/* */class S__Z__eFoo_If extends MixZ__eFoo_If [C] { ; ; f; } +/* */class S__Z__eFoo_IfwBar___ extends MixZ__eFoo_IfwBar___[C] { ; ; f; } +// */class S__Z__eFoo_IfwBar__f extends MixZ__eFoo_IfwBar__f[C] { ; ; f; } +// */class S__Z__eFoo_IfwBar_I_ extends MixZ__eFoo_IfwBar_I_[C] { ; ; f; } +// */class S__Z__eFoo_IfwBar_If extends MixZ__eFoo_IfwBar_If[C] { ; ; f; } +/* */class S__Z__eFoo_IfwBarY__ extends MixZ__eFoo_IfwBarY__[C] { ; ; f; } +// */class S__Z__eFoo_IfwBarY_f extends MixZ__eFoo_IfwBarY_f[C] { ; ; f; } +// */class S__Z__eFoo_IfwBarYI_ extends MixZ__eFoo_IfwBarYI_[C] { ; ; f; } +// */class S__Z__eFoo_IfwBarYIf extends MixZ__eFoo_IfwBarYIf[C] { ; ; f; } +/* */class S__Z__eFooX__ extends MixZ__eFooX__ [C] { class I; def f: I = {sub; null}; f; } +/* */class S__Z__eFooX__wBar___ extends MixZ__eFooX__wBar___[C] { class I; def f: I = {sub; null}; f; } +/* */class S__Z__eFooX__wBar__f extends MixZ__eFooX__wBar__f[C] { class I; ; f; } +/* */class S__Z__eFooX__wBar_I_ extends MixZ__eFooX__wBar_I_[C] { ; def f: I = {sub; null}; f; } +/* */class S__Z__eFooX__wBar_If extends MixZ__eFooX__wBar_If[C] { ; ; f; } +/* */class S__Z__eFooX__wBarY__ extends MixZ__eFooX__wBarY__[C] { class I; def f: I = {sub; null}; f; } +/* */class S__Z__eFooX__wBarY_f extends MixZ__eFooX__wBarY_f[C] { class I; ; f; } +/* */class S__Z__eFooX__wBarYI_ extends MixZ__eFooX__wBarYI_[C] { ; def f: I = {sub; null}; f; } +/* */class S__Z__eFooX__wBarYIf extends MixZ__eFooX__wBarYIf[C] { ; ; f; } +/* */class S__Z__eFooX_f extends MixZ__eFooX_f [C] { class I; ; f; } +/* */class S__Z__eFooX_fwBar___ extends MixZ__eFooX_fwBar___[C] { class I; ; f; } +// */class S__Z__eFooX_fwBar__f extends MixZ__eFooX_fwBar__f[C] { class I; ; f; } +/* */class S__Z__eFooX_fwBar_I_ extends MixZ__eFooX_fwBar_I_[C] { ; ; f; } +// */class S__Z__eFooX_fwBar_If extends MixZ__eFooX_fwBar_If[C] { ; ; f; } +/* */class S__Z__eFooX_fwBarY__ extends MixZ__eFooX_fwBarY__[C] { class I; ; f; } +// */class S__Z__eFooX_fwBarY_f extends MixZ__eFooX_fwBarY_f[C] { class I; ; f; } +/* */class S__Z__eFooX_fwBarYI_ extends MixZ__eFooX_fwBarYI_[C] { ; ; f; } +// */class S__Z__eFooX_fwBarYIf extends MixZ__eFooX_fwBarYIf[C] { ; ; f; } +/* */class S__Z__eFooXI_ extends MixZ__eFooXI_ [C] { ; def f: I = {sub; null}; f; } +/* */class S__Z__eFooXI_wBar___ extends MixZ__eFooXI_wBar___[C] { ; def f: I = {sub; null}; f; } +/* */class S__Z__eFooXI_wBar__f extends MixZ__eFooXI_wBar__f[C] { ; ; f; } +// */class S__Z__eFooXI_wBar_I_ extends MixZ__eFooXI_wBar_I_[C] { ; def f: I = {sub; null}; f; } +// */class S__Z__eFooXI_wBar_If extends MixZ__eFooXI_wBar_If[C] { ; ; f; } +/* */class S__Z__eFooXI_wBarY__ extends MixZ__eFooXI_wBarY__[C] { ; def f: I = {sub; null}; f; } +/* */class S__Z__eFooXI_wBarY_f extends MixZ__eFooXI_wBarY_f[C] { ; ; f; } +// */class S__Z__eFooXI_wBarYI_ extends MixZ__eFooXI_wBarYI_[C] { ; def f: I = {sub; null}; f; } +// */class S__Z__eFooXI_wBarYIf extends MixZ__eFooXI_wBarYIf[C] { ; ; f; } +/* */class S__Z__eFooXIf extends MixZ__eFooXIf [C] { ; ; f; } +/* */class S__Z__eFooXIfwBar___ extends MixZ__eFooXIfwBar___[C] { ; ; f; } +// */class S__Z__eFooXIfwBar__f extends MixZ__eFooXIfwBar__f[C] { ; ; f; } +// */class S__Z__eFooXIfwBar_I_ extends MixZ__eFooXIfwBar_I_[C] { ; ; f; } +// */class S__Z__eFooXIfwBar_If extends MixZ__eFooXIfwBar_If[C] { ; ; f; } +/* */class S__Z__eFooXIfwBarY__ extends MixZ__eFooXIfwBarY__[C] { ; ; f; } +// */class S__Z__eFooXIfwBarY_f extends MixZ__eFooXIfwBarY_f[C] { ; ; f; } +// */class S__Z__eFooXIfwBarYI_ extends MixZ__eFooXIfwBarYI_[C] { ; ; f; } +// */class S__Z__eFooXIfwBarYIf extends MixZ__eFooXIfwBarYIf[C] { ; ; f; } + +/* */class S__Z_feFoo___ extends MixZ_feFoo___ [C] { class I; ; f; } +/* */class S__Z_feFoo___wBar___ extends MixZ_feFoo___wBar___[C] { class I; ; f; } +/* */class S__Z_feFoo___wBar__f extends MixZ_feFoo___wBar__f[C] { class I; ; f; } +/* */class S__Z_feFoo___wBar_I_ extends MixZ_feFoo___wBar_I_[C] { ; ; f; } +/* */class S__Z_feFoo___wBar_If extends MixZ_feFoo___wBar_If[C] { ; ; f; } +/* */class S__Z_feFoo___wBarY__ extends MixZ_feFoo___wBarY__[C] { class I; ; f; } +/* */class S__Z_feFoo___wBarY_f extends MixZ_feFoo___wBarY_f[C] { class I; ; f; } +/* */class S__Z_feFoo___wBarYI_ extends MixZ_feFoo___wBarYI_[C] { ; ; f; } +/* */class S__Z_feFoo___wBarYIf extends MixZ_feFoo___wBarYIf[C] { ; ; f; } +/* */class S__Z_feFoo__f extends MixZ_feFoo__f [C] { class I; ; f; } +/* */class S__Z_feFoo__fwBar___ extends MixZ_feFoo__fwBar___[C] { class I; ; f; } +/* */class S__Z_feFoo__fwBar__f extends MixZ_feFoo__fwBar__f[C] { class I; ; f; } +/* */class S__Z_feFoo__fwBar_I_ extends MixZ_feFoo__fwBar_I_[C] { ; ; f; } +/* */class S__Z_feFoo__fwBar_If extends MixZ_feFoo__fwBar_If[C] { ; ; f; } +/* */class S__Z_feFoo__fwBarY__ extends MixZ_feFoo__fwBarY__[C] { class I; ; f; } +/* */class S__Z_feFoo__fwBarY_f extends MixZ_feFoo__fwBarY_f[C] { class I; ; f; } +/* */class S__Z_feFoo__fwBarYI_ extends MixZ_feFoo__fwBarYI_[C] { ; ; f; } +/* */class S__Z_feFoo__fwBarYIf extends MixZ_feFoo__fwBarYIf[C] { ; ; f; } +/* */class S__Z_feFoo_I_ extends MixZ_feFoo_I_ [C] { ; ; f; } +/* */class S__Z_feFoo_I_wBar___ extends MixZ_feFoo_I_wBar___[C] { ; ; f; } +/* */class S__Z_feFoo_I_wBar__f extends MixZ_feFoo_I_wBar__f[C] { ; ; f; } +// */class S__Z_feFoo_I_wBar_I_ extends MixZ_feFoo_I_wBar_I_[C] { ; ; f; } +// */class S__Z_feFoo_I_wBar_If extends MixZ_feFoo_I_wBar_If[C] { ; ; f; } +/* */class S__Z_feFoo_I_wBarY__ extends MixZ_feFoo_I_wBarY__[C] { ; ; f; } +/* */class S__Z_feFoo_I_wBarY_f extends MixZ_feFoo_I_wBarY_f[C] { ; ; f; } +// */class S__Z_feFoo_I_wBarYI_ extends MixZ_feFoo_I_wBarYI_[C] { ; ; f; } +// */class S__Z_feFoo_I_wBarYIf extends MixZ_feFoo_I_wBarYIf[C] { ; ; f; } +/* */class S__Z_feFoo_If extends MixZ_feFoo_If [C] { ; ; f; } +/* */class S__Z_feFoo_IfwBar___ extends MixZ_feFoo_IfwBar___[C] { ; ; f; } +/* */class S__Z_feFoo_IfwBar__f extends MixZ_feFoo_IfwBar__f[C] { ; ; f; } +// */class S__Z_feFoo_IfwBar_I_ extends MixZ_feFoo_IfwBar_I_[C] { ; ; f; } +// */class S__Z_feFoo_IfwBar_If extends MixZ_feFoo_IfwBar_If[C] { ; ; f; } +/* */class S__Z_feFoo_IfwBarY__ extends MixZ_feFoo_IfwBarY__[C] { ; ; f; } +/* */class S__Z_feFoo_IfwBarY_f extends MixZ_feFoo_IfwBarY_f[C] { ; ; f; } +// */class S__Z_feFoo_IfwBarYI_ extends MixZ_feFoo_IfwBarYI_[C] { ; ; f; } +// */class S__Z_feFoo_IfwBarYIf extends MixZ_feFoo_IfwBarYIf[C] { ; ; f; } +/* */class S__Z_feFooX__ extends MixZ_feFooX__ [C] { class I; ; f; } +/* */class S__Z_feFooX__wBar___ extends MixZ_feFooX__wBar___[C] { class I; ; f; } +/* */class S__Z_feFooX__wBar__f extends MixZ_feFooX__wBar__f[C] { class I; ; f; } +/* */class S__Z_feFooX__wBar_I_ extends MixZ_feFooX__wBar_I_[C] { ; ; f; } +/* */class S__Z_feFooX__wBar_If extends MixZ_feFooX__wBar_If[C] { ; ; f; } +/* */class S__Z_feFooX__wBarY__ extends MixZ_feFooX__wBarY__[C] { class I; ; f; } +/* */class S__Z_feFooX__wBarY_f extends MixZ_feFooX__wBarY_f[C] { class I; ; f; } +/* */class S__Z_feFooX__wBarYI_ extends MixZ_feFooX__wBarYI_[C] { ; ; f; } +/* */class S__Z_feFooX__wBarYIf extends MixZ_feFooX__wBarYIf[C] { ; ; f; } +/* */class S__Z_feFooX_f extends MixZ_feFooX_f [C] { class I; ; f; } +/* */class S__Z_feFooX_fwBar___ extends MixZ_feFooX_fwBar___[C] { class I; ; f; } +/* */class S__Z_feFooX_fwBar__f extends MixZ_feFooX_fwBar__f[C] { class I; ; f; } +/* */class S__Z_feFooX_fwBar_I_ extends MixZ_feFooX_fwBar_I_[C] { ; ; f; } +/* */class S__Z_feFooX_fwBar_If extends MixZ_feFooX_fwBar_If[C] { ; ; f; } +/* */class S__Z_feFooX_fwBarY__ extends MixZ_feFooX_fwBarY__[C] { class I; ; f; } +/* */class S__Z_feFooX_fwBarY_f extends MixZ_feFooX_fwBarY_f[C] { class I; ; f; } +/* */class S__Z_feFooX_fwBarYI_ extends MixZ_feFooX_fwBarYI_[C] { ; ; f; } +/* */class S__Z_feFooX_fwBarYIf extends MixZ_feFooX_fwBarYIf[C] { ; ; f; } +/* */class S__Z_feFooXI_ extends MixZ_feFooXI_ [C] { ; ; f; } +/* */class S__Z_feFooXI_wBar___ extends MixZ_feFooXI_wBar___[C] { ; ; f; } +/* */class S__Z_feFooXI_wBar__f extends MixZ_feFooXI_wBar__f[C] { ; ; f; } +// */class S__Z_feFooXI_wBar_I_ extends MixZ_feFooXI_wBar_I_[C] { ; ; f; } +// */class S__Z_feFooXI_wBar_If extends MixZ_feFooXI_wBar_If[C] { ; ; f; } +/* */class S__Z_feFooXI_wBarY__ extends MixZ_feFooXI_wBarY__[C] { ; ; f; } +/* */class S__Z_feFooXI_wBarY_f extends MixZ_feFooXI_wBarY_f[C] { ; ; f; } +// */class S__Z_feFooXI_wBarYI_ extends MixZ_feFooXI_wBarYI_[C] { ; ; f; } +// */class S__Z_feFooXI_wBarYIf extends MixZ_feFooXI_wBarYIf[C] { ; ; f; } +/* */class S__Z_feFooXIf extends MixZ_feFooXIf [C] { ; ; f; } +/* */class S__Z_feFooXIfwBar___ extends MixZ_feFooXIfwBar___[C] { ; ; f; } +/* */class S__Z_feFooXIfwBar__f extends MixZ_feFooXIfwBar__f[C] { ; ; f; } +// */class S__Z_feFooXIfwBar_I_ extends MixZ_feFooXIfwBar_I_[C] { ; ; f; } +// */class S__Z_feFooXIfwBar_If extends MixZ_feFooXIfwBar_If[C] { ; ; f; } +/* */class S__Z_feFooXIfwBarY__ extends MixZ_feFooXIfwBarY__[C] { ; ; f; } +/* */class S__Z_feFooXIfwBarY_f extends MixZ_feFooXIfwBarY_f[C] { ; ; f; } +// */class S__Z_feFooXIfwBarYI_ extends MixZ_feFooXIfwBarYI_[C] { ; ; f; } +// */class S__Z_feFooXIfwBarYIf extends MixZ_feFooXIfwBarYIf[C] { ; ; f; } + +/* */class S__ZI_eFoo___ extends MixZI_eFoo___ [C] { ; def f: I = {sub; null}; f; } +/* */class S__ZI_eFoo___wBar___ extends MixZI_eFoo___wBar___[C] { ; def f: I = {sub; null}; f; } +/* */class S__ZI_eFoo___wBar__f extends MixZI_eFoo___wBar__f[C] { ; ; f; } +// */class S__ZI_eFoo___wBar_I_ extends MixZI_eFoo___wBar_I_[C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_eFoo___wBar_If extends MixZI_eFoo___wBar_If[C] { ; ; f; } +/* */class S__ZI_eFoo___wBarY__ extends MixZI_eFoo___wBarY__[C] { ; def f: I = {sub; null}; f; } +/* */class S__ZI_eFoo___wBarY_f extends MixZI_eFoo___wBarY_f[C] { ; ; f; } +// */class S__ZI_eFoo___wBarYI_ extends MixZI_eFoo___wBarYI_[C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_eFoo___wBarYIf extends MixZI_eFoo___wBarYIf[C] { ; ; f; } +/* */class S__ZI_eFoo__f extends MixZI_eFoo__f [C] { ; ; f; } +/* */class S__ZI_eFoo__fwBar___ extends MixZI_eFoo__fwBar___[C] { ; ; f; } +// */class S__ZI_eFoo__fwBar__f extends MixZI_eFoo__fwBar__f[C] { ; ; f; } +// */class S__ZI_eFoo__fwBar_I_ extends MixZI_eFoo__fwBar_I_[C] { ; ; f; } +// */class S__ZI_eFoo__fwBar_If extends MixZI_eFoo__fwBar_If[C] { ; ; f; } +/* */class S__ZI_eFoo__fwBarY__ extends MixZI_eFoo__fwBarY__[C] { ; ; f; } +// */class S__ZI_eFoo__fwBarY_f extends MixZI_eFoo__fwBarY_f[C] { ; ; f; } +// */class S__ZI_eFoo__fwBarYI_ extends MixZI_eFoo__fwBarYI_[C] { ; ; f; } +// */class S__ZI_eFoo__fwBarYIf extends MixZI_eFoo__fwBarYIf[C] { ; ; f; } +// */class S__ZI_eFoo_I_ extends MixZI_eFoo_I_ [C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_eFoo_I_wBar___ extends MixZI_eFoo_I_wBar___[C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_eFoo_I_wBar__f extends MixZI_eFoo_I_wBar__f[C] { ; ; f; } +// */class S__ZI_eFoo_I_wBar_I_ extends MixZI_eFoo_I_wBar_I_[C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_eFoo_I_wBar_If extends MixZI_eFoo_I_wBar_If[C] { ; ; f; } +// */class S__ZI_eFoo_I_wBarY__ extends MixZI_eFoo_I_wBarY__[C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_eFoo_I_wBarY_f extends MixZI_eFoo_I_wBarY_f[C] { ; ; f; } +// */class S__ZI_eFoo_I_wBarYI_ extends MixZI_eFoo_I_wBarYI_[C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_eFoo_I_wBarYIf extends MixZI_eFoo_I_wBarYIf[C] { ; ; f; } +// */class S__ZI_eFoo_If extends MixZI_eFoo_If [C] { ; ; f; } +// */class S__ZI_eFoo_IfwBar___ extends MixZI_eFoo_IfwBar___[C] { ; ; f; } +// */class S__ZI_eFoo_IfwBar__f extends MixZI_eFoo_IfwBar__f[C] { ; ; f; } +// */class S__ZI_eFoo_IfwBar_I_ extends MixZI_eFoo_IfwBar_I_[C] { ; ; f; } +// */class S__ZI_eFoo_IfwBar_If extends MixZI_eFoo_IfwBar_If[C] { ; ; f; } +// */class S__ZI_eFoo_IfwBarY__ extends MixZI_eFoo_IfwBarY__[C] { ; ; f; } +// */class S__ZI_eFoo_IfwBarY_f extends MixZI_eFoo_IfwBarY_f[C] { ; ; f; } +// */class S__ZI_eFoo_IfwBarYI_ extends MixZI_eFoo_IfwBarYI_[C] { ; ; f; } +// */class S__ZI_eFoo_IfwBarYIf extends MixZI_eFoo_IfwBarYIf[C] { ; ; f; } +/* */class S__ZI_eFooX__ extends MixZI_eFooX__ [C] { ; def f: I = {sub; null}; f; } +/* */class S__ZI_eFooX__wBar___ extends MixZI_eFooX__wBar___[C] { ; def f: I = {sub; null}; f; } +/* */class S__ZI_eFooX__wBar__f extends MixZI_eFooX__wBar__f[C] { ; ; f; } +// */class S__ZI_eFooX__wBar_I_ extends MixZI_eFooX__wBar_I_[C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_eFooX__wBar_If extends MixZI_eFooX__wBar_If[C] { ; ; f; } +/* */class S__ZI_eFooX__wBarY__ extends MixZI_eFooX__wBarY__[C] { ; def f: I = {sub; null}; f; } +/* */class S__ZI_eFooX__wBarY_f extends MixZI_eFooX__wBarY_f[C] { ; ; f; } +// */class S__ZI_eFooX__wBarYI_ extends MixZI_eFooX__wBarYI_[C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_eFooX__wBarYIf extends MixZI_eFooX__wBarYIf[C] { ; ; f; } +/* */class S__ZI_eFooX_f extends MixZI_eFooX_f [C] { ; ; f; } +/* */class S__ZI_eFooX_fwBar___ extends MixZI_eFooX_fwBar___[C] { ; ; f; } +// */class S__ZI_eFooX_fwBar__f extends MixZI_eFooX_fwBar__f[C] { ; ; f; } +// */class S__ZI_eFooX_fwBar_I_ extends MixZI_eFooX_fwBar_I_[C] { ; ; f; } +// */class S__ZI_eFooX_fwBar_If extends MixZI_eFooX_fwBar_If[C] { ; ; f; } +/* */class S__ZI_eFooX_fwBarY__ extends MixZI_eFooX_fwBarY__[C] { ; ; f; } +// */class S__ZI_eFooX_fwBarY_f extends MixZI_eFooX_fwBarY_f[C] { ; ; f; } +// */class S__ZI_eFooX_fwBarYI_ extends MixZI_eFooX_fwBarYI_[C] { ; ; f; } +// */class S__ZI_eFooX_fwBarYIf extends MixZI_eFooX_fwBarYIf[C] { ; ; f; } +// */class S__ZI_eFooXI_ extends MixZI_eFooXI_ [C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_eFooXI_wBar___ extends MixZI_eFooXI_wBar___[C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_eFooXI_wBar__f extends MixZI_eFooXI_wBar__f[C] { ; ; f; } +// */class S__ZI_eFooXI_wBar_I_ extends MixZI_eFooXI_wBar_I_[C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_eFooXI_wBar_If extends MixZI_eFooXI_wBar_If[C] { ; ; f; } +// */class S__ZI_eFooXI_wBarY__ extends MixZI_eFooXI_wBarY__[C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_eFooXI_wBarY_f extends MixZI_eFooXI_wBarY_f[C] { ; ; f; } +// */class S__ZI_eFooXI_wBarYI_ extends MixZI_eFooXI_wBarYI_[C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_eFooXI_wBarYIf extends MixZI_eFooXI_wBarYIf[C] { ; ; f; } +// */class S__ZI_eFooXIf extends MixZI_eFooXIf [C] { ; ; f; } +// */class S__ZI_eFooXIfwBar___ extends MixZI_eFooXIfwBar___[C] { ; ; f; } +// */class S__ZI_eFooXIfwBar__f extends MixZI_eFooXIfwBar__f[C] { ; ; f; } +// */class S__ZI_eFooXIfwBar_I_ extends MixZI_eFooXIfwBar_I_[C] { ; ; f; } +// */class S__ZI_eFooXIfwBar_If extends MixZI_eFooXIfwBar_If[C] { ; ; f; } +// */class S__ZI_eFooXIfwBarY__ extends MixZI_eFooXIfwBarY__[C] { ; ; f; } +// */class S__ZI_eFooXIfwBarY_f extends MixZI_eFooXIfwBarY_f[C] { ; ; f; } +// */class S__ZI_eFooXIfwBarYI_ extends MixZI_eFooXIfwBarYI_[C] { ; ; f; } +// */class S__ZI_eFooXIfwBarYIf extends MixZI_eFooXIfwBarYIf[C] { ; ; f; } + +/* */class S__ZIfeFoo___ extends MixZIfeFoo___ [C] { ; ; f; } +/* */class S__ZIfeFoo___wBar___ extends MixZIfeFoo___wBar___[C] { ; ; f; } +/* */class S__ZIfeFoo___wBar__f extends MixZIfeFoo___wBar__f[C] { ; ; f; } +// */class S__ZIfeFoo___wBar_I_ extends MixZIfeFoo___wBar_I_[C] { ; ; f; } +// */class S__ZIfeFoo___wBar_If extends MixZIfeFoo___wBar_If[C] { ; ; f; } +/* */class S__ZIfeFoo___wBarY__ extends MixZIfeFoo___wBarY__[C] { ; ; f; } +/* */class S__ZIfeFoo___wBarY_f extends MixZIfeFoo___wBarY_f[C] { ; ; f; } +// */class S__ZIfeFoo___wBarYI_ extends MixZIfeFoo___wBarYI_[C] { ; ; f; } +// */class S__ZIfeFoo___wBarYIf extends MixZIfeFoo___wBarYIf[C] { ; ; f; } +/* */class S__ZIfeFoo__f extends MixZIfeFoo__f [C] { ; ; f; } +/* */class S__ZIfeFoo__fwBar___ extends MixZIfeFoo__fwBar___[C] { ; ; f; } +/* */class S__ZIfeFoo__fwBar__f extends MixZIfeFoo__fwBar__f[C] { ; ; f; } +// */class S__ZIfeFoo__fwBar_I_ extends MixZIfeFoo__fwBar_I_[C] { ; ; f; } +// */class S__ZIfeFoo__fwBar_If extends MixZIfeFoo__fwBar_If[C] { ; ; f; } +/* */class S__ZIfeFoo__fwBarY__ extends MixZIfeFoo__fwBarY__[C] { ; ; f; } +/* */class S__ZIfeFoo__fwBarY_f extends MixZIfeFoo__fwBarY_f[C] { ; ; f; } +// */class S__ZIfeFoo__fwBarYI_ extends MixZIfeFoo__fwBarYI_[C] { ; ; f; } +// */class S__ZIfeFoo__fwBarYIf extends MixZIfeFoo__fwBarYIf[C] { ; ; f; } +// */class S__ZIfeFoo_I_ extends MixZIfeFoo_I_ [C] { ; ; f; } +// */class S__ZIfeFoo_I_wBar___ extends MixZIfeFoo_I_wBar___[C] { ; ; f; } +// */class S__ZIfeFoo_I_wBar__f extends MixZIfeFoo_I_wBar__f[C] { ; ; f; } +// */class S__ZIfeFoo_I_wBar_I_ extends MixZIfeFoo_I_wBar_I_[C] { ; ; f; } +// */class S__ZIfeFoo_I_wBar_If extends MixZIfeFoo_I_wBar_If[C] { ; ; f; } +// */class S__ZIfeFoo_I_wBarY__ extends MixZIfeFoo_I_wBarY__[C] { ; ; f; } +// */class S__ZIfeFoo_I_wBarY_f extends MixZIfeFoo_I_wBarY_f[C] { ; ; f; } +// */class S__ZIfeFoo_I_wBarYI_ extends MixZIfeFoo_I_wBarYI_[C] { ; ; f; } +// */class S__ZIfeFoo_I_wBarYIf extends MixZIfeFoo_I_wBarYIf[C] { ; ; f; } +// */class S__ZIfeFoo_If extends MixZIfeFoo_If [C] { ; ; f; } +// */class S__ZIfeFoo_IfwBar___ extends MixZIfeFoo_IfwBar___[C] { ; ; f; } +// */class S__ZIfeFoo_IfwBar__f extends MixZIfeFoo_IfwBar__f[C] { ; ; f; } +// */class S__ZIfeFoo_IfwBar_I_ extends MixZIfeFoo_IfwBar_I_[C] { ; ; f; } +// */class S__ZIfeFoo_IfwBar_If extends MixZIfeFoo_IfwBar_If[C] { ; ; f; } +// */class S__ZIfeFoo_IfwBarY__ extends MixZIfeFoo_IfwBarY__[C] { ; ; f; } +// */class S__ZIfeFoo_IfwBarY_f extends MixZIfeFoo_IfwBarY_f[C] { ; ; f; } +// */class S__ZIfeFoo_IfwBarYI_ extends MixZIfeFoo_IfwBarYI_[C] { ; ; f; } +// */class S__ZIfeFoo_IfwBarYIf extends MixZIfeFoo_IfwBarYIf[C] { ; ; f; } +/* */class S__ZIfeFooX__ extends MixZIfeFooX__ [C] { ; ; f; } +/* */class S__ZIfeFooX__wBar___ extends MixZIfeFooX__wBar___[C] { ; ; f; } +/* */class S__ZIfeFooX__wBar__f extends MixZIfeFooX__wBar__f[C] { ; ; f; } +// */class S__ZIfeFooX__wBar_I_ extends MixZIfeFooX__wBar_I_[C] { ; ; f; } +// */class S__ZIfeFooX__wBar_If extends MixZIfeFooX__wBar_If[C] { ; ; f; } +/* */class S__ZIfeFooX__wBarY__ extends MixZIfeFooX__wBarY__[C] { ; ; f; } +/* */class S__ZIfeFooX__wBarY_f extends MixZIfeFooX__wBarY_f[C] { ; ; f; } +// */class S__ZIfeFooX__wBarYI_ extends MixZIfeFooX__wBarYI_[C] { ; ; f; } +// */class S__ZIfeFooX__wBarYIf extends MixZIfeFooX__wBarYIf[C] { ; ; f; } +/* */class S__ZIfeFooX_f extends MixZIfeFooX_f [C] { ; ; f; } +/* */class S__ZIfeFooX_fwBar___ extends MixZIfeFooX_fwBar___[C] { ; ; f; } +/* */class S__ZIfeFooX_fwBar__f extends MixZIfeFooX_fwBar__f[C] { ; ; f; } +// */class S__ZIfeFooX_fwBar_I_ extends MixZIfeFooX_fwBar_I_[C] { ; ; f; } +// */class S__ZIfeFooX_fwBar_If extends MixZIfeFooX_fwBar_If[C] { ; ; f; } +/* */class S__ZIfeFooX_fwBarY__ extends MixZIfeFooX_fwBarY__[C] { ; ; f; } +/* */class S__ZIfeFooX_fwBarY_f extends MixZIfeFooX_fwBarY_f[C] { ; ; f; } +// */class S__ZIfeFooX_fwBarYI_ extends MixZIfeFooX_fwBarYI_[C] { ; ; f; } +// */class S__ZIfeFooX_fwBarYIf extends MixZIfeFooX_fwBarYIf[C] { ; ; f; } +// */class S__ZIfeFooXI_ extends MixZIfeFooXI_ [C] { ; ; f; } +// */class S__ZIfeFooXI_wBar___ extends MixZIfeFooXI_wBar___[C] { ; ; f; } +// */class S__ZIfeFooXI_wBar__f extends MixZIfeFooXI_wBar__f[C] { ; ; f; } +// */class S__ZIfeFooXI_wBar_I_ extends MixZIfeFooXI_wBar_I_[C] { ; ; f; } +// */class S__ZIfeFooXI_wBar_If extends MixZIfeFooXI_wBar_If[C] { ; ; f; } +// */class S__ZIfeFooXI_wBarY__ extends MixZIfeFooXI_wBarY__[C] { ; ; f; } +// */class S__ZIfeFooXI_wBarY_f extends MixZIfeFooXI_wBarY_f[C] { ; ; f; } +// */class S__ZIfeFooXI_wBarYI_ extends MixZIfeFooXI_wBarYI_[C] { ; ; f; } +// */class S__ZIfeFooXI_wBarYIf extends MixZIfeFooXI_wBarYIf[C] { ; ; f; } +// */class S__ZIfeFooXIf extends MixZIfeFooXIf [C] { ; ; f; } +// */class S__ZIfeFooXIfwBar___ extends MixZIfeFooXIfwBar___[C] { ; ; f; } +// */class S__ZIfeFooXIfwBar__f extends MixZIfeFooXIfwBar__f[C] { ; ; f; } +// */class S__ZIfeFooXIfwBar_I_ extends MixZIfeFooXIfwBar_I_[C] { ; ; f; } +// */class S__ZIfeFooXIfwBar_If extends MixZIfeFooXIfwBar_If[C] { ; ; f; } +// */class S__ZIfeFooXIfwBarY__ extends MixZIfeFooXIfwBarY__[C] { ; ; f; } +// */class S__ZIfeFooXIfwBarY_f extends MixZIfeFooXIfwBarY_f[C] { ; ; f; } +// */class S__ZIfeFooXIfwBarYI_ extends MixZIfeFooXIfwBarYI_[C] { ; ; f; } +// */class S__ZIfeFooXIfwBarYIf extends MixZIfeFooXIfwBarYIf[C] { ; ; f; } + + + +/* */class S_____wFoo___ extends Mix___wFoo___ { class I; def f: I = {sub; null}; f; } +/* */class S_____wFoo___wBar___ extends Mix___wFoo___wBar___ { class I; def f: I = {sub; null}; f; } +/* */class S_____wFoo___wBar__f extends Mix___wFoo___wBar__f { class I; ; f; } +/* */class S_____wFoo___wBar_I_ extends Mix___wFoo___wBar_I_ { ; def f: I = {sub; null}; f; } +/* */class S_____wFoo___wBar_If extends Mix___wFoo___wBar_If { ; ; f; } +/* */class S_____wFoo___wBarY__ extends Mix___wFoo___wBarY__ { class I; def f: I = {sub; null}; f; } +/* */class S_____wFoo___wBarY_f extends Mix___wFoo___wBarY_f { class I; ; f; } +/* */class S_____wFoo___wBarYI_ extends Mix___wFoo___wBarYI_ { ; def f: I = {sub; null}; f; } +/* */class S_____wFoo___wBarYIf extends Mix___wFoo___wBarYIf { ; ; f; } +/* */class S_____wFoo__f extends Mix___wFoo__f { class I; ; f; } +/* */class S_____wFoo__fwBar___ extends Mix___wFoo__fwBar___ { class I; ; f; } +// */class S_____wFoo__fwBar__f extends Mix___wFoo__fwBar__f { class I; ; f; } +/* */class S_____wFoo__fwBar_I_ extends Mix___wFoo__fwBar_I_ { ; ; f; } +// */class S_____wFoo__fwBar_If extends Mix___wFoo__fwBar_If { ; ; f; } +/* */class S_____wFoo__fwBarY__ extends Mix___wFoo__fwBarY__ { class I; ; f; } +// */class S_____wFoo__fwBarY_f extends Mix___wFoo__fwBarY_f { class I; ; f; } +/* */class S_____wFoo__fwBarYI_ extends Mix___wFoo__fwBarYI_ { ; ; f; } +// */class S_____wFoo__fwBarYIf extends Mix___wFoo__fwBarYIf { ; ; f; } +/* */class S_____wFoo_I_ extends Mix___wFoo_I_ { ; def f: I = {sub; null}; f; } +/* */class S_____wFoo_I_wBar___ extends Mix___wFoo_I_wBar___ { ; def f: I = {sub; null}; f; } +/* */class S_____wFoo_I_wBar__f extends Mix___wFoo_I_wBar__f { ; ; f; } +// */class S_____wFoo_I_wBar_I_ extends Mix___wFoo_I_wBar_I_ { ; def f: I = {sub; null}; f; } +// */class S_____wFoo_I_wBar_If extends Mix___wFoo_I_wBar_If { ; ; f; } +/* */class S_____wFoo_I_wBarY__ extends Mix___wFoo_I_wBarY__ { ; def f: I = {sub; null}; f; } +/* */class S_____wFoo_I_wBarY_f extends Mix___wFoo_I_wBarY_f { ; ; f; } +// */class S_____wFoo_I_wBarYI_ extends Mix___wFoo_I_wBarYI_ { ; def f: I = {sub; null}; f; } +// */class S_____wFoo_I_wBarYIf extends Mix___wFoo_I_wBarYIf { ; ; f; } +/* */class S_____wFoo_If extends Mix___wFoo_If { ; ; f; } +/* */class S_____wFoo_IfwBar___ extends Mix___wFoo_IfwBar___ { ; ; f; } +// */class S_____wFoo_IfwBar__f extends Mix___wFoo_IfwBar__f { ; ; f; } +// */class S_____wFoo_IfwBar_I_ extends Mix___wFoo_IfwBar_I_ { ; ; f; } +// */class S_____wFoo_IfwBar_If extends Mix___wFoo_IfwBar_If { ; ; f; } +/* */class S_____wFoo_IfwBarY__ extends Mix___wFoo_IfwBarY__ { ; ; f; } +// */class S_____wFoo_IfwBarY_f extends Mix___wFoo_IfwBarY_f { ; ; f; } +// */class S_____wFoo_IfwBarYI_ extends Mix___wFoo_IfwBarYI_ { ; ; f; } +// */class S_____wFoo_IfwBarYIf extends Mix___wFoo_IfwBarYIf { ; ; f; } +/* */class S_____wFooX__ extends Mix___wFooX__ { class I; def f: I = {sub; null}; f; } +/* */class S_____wFooX__wBar___ extends Mix___wFooX__wBar___ { class I; def f: I = {sub; null}; f; } +/* */class S_____wFooX__wBar__f extends Mix___wFooX__wBar__f { class I; ; f; } +/* */class S_____wFooX__wBar_I_ extends Mix___wFooX__wBar_I_ { ; def f: I = {sub; null}; f; } +/* */class S_____wFooX__wBar_If extends Mix___wFooX__wBar_If { ; ; f; } +/* */class S_____wFooX__wBarY__ extends Mix___wFooX__wBarY__ { class I; def f: I = {sub; null}; f; } +/* */class S_____wFooX__wBarY_f extends Mix___wFooX__wBarY_f { class I; ; f; } +/* */class S_____wFooX__wBarYI_ extends Mix___wFooX__wBarYI_ { ; def f: I = {sub; null}; f; } +/* */class S_____wFooX__wBarYIf extends Mix___wFooX__wBarYIf { ; ; f; } +/* */class S_____wFooX_f extends Mix___wFooX_f { class I; ; f; } +/* */class S_____wFooX_fwBar___ extends Mix___wFooX_fwBar___ { class I; ; f; } +// */class S_____wFooX_fwBar__f extends Mix___wFooX_fwBar__f { class I; ; f; } +/* */class S_____wFooX_fwBar_I_ extends Mix___wFooX_fwBar_I_ { ; ; f; } +// */class S_____wFooX_fwBar_If extends Mix___wFooX_fwBar_If { ; ; f; } +/* */class S_____wFooX_fwBarY__ extends Mix___wFooX_fwBarY__ { class I; ; f; } +// */class S_____wFooX_fwBarY_f extends Mix___wFooX_fwBarY_f { class I; ; f; } +/* */class S_____wFooX_fwBarYI_ extends Mix___wFooX_fwBarYI_ { ; ; f; } +// */class S_____wFooX_fwBarYIf extends Mix___wFooX_fwBarYIf { ; ; f; } +/* */class S_____wFooXI_ extends Mix___wFooXI_ { ; def f: I = {sub; null}; f; } +/* */class S_____wFooXI_wBar___ extends Mix___wFooXI_wBar___ { ; def f: I = {sub; null}; f; } +/* */class S_____wFooXI_wBar__f extends Mix___wFooXI_wBar__f { ; ; f; } +// */class S_____wFooXI_wBar_I_ extends Mix___wFooXI_wBar_I_ { ; def f: I = {sub; null}; f; } +// */class S_____wFooXI_wBar_If extends Mix___wFooXI_wBar_If { ; ; f; } +/* */class S_____wFooXI_wBarY__ extends Mix___wFooXI_wBarY__ { ; def f: I = {sub; null}; f; } +/* */class S_____wFooXI_wBarY_f extends Mix___wFooXI_wBarY_f { ; ; f; } +// */class S_____wFooXI_wBarYI_ extends Mix___wFooXI_wBarYI_ { ; def f: I = {sub; null}; f; } +// */class S_____wFooXI_wBarYIf extends Mix___wFooXI_wBarYIf { ; ; f; } +/* */class S_____wFooXIf extends Mix___wFooXIf { ; ; f; } +/* */class S_____wFooXIfwBar___ extends Mix___wFooXIfwBar___ { ; ; f; } +// */class S_____wFooXIfwBar__f extends Mix___wFooXIfwBar__f { ; ; f; } +// */class S_____wFooXIfwBar_I_ extends Mix___wFooXIfwBar_I_ { ; ; f; } +// */class S_____wFooXIfwBar_If extends Mix___wFooXIfwBar_If { ; ; f; } +/* */class S_____wFooXIfwBarY__ extends Mix___wFooXIfwBarY__ { ; ; f; } +// */class S_____wFooXIfwBarY_f extends Mix___wFooXIfwBarY_f { ; ; f; } +// */class S_____wFooXIfwBarYI_ extends Mix___wFooXIfwBarYI_ { ; ; f; } +// */class S_____wFooXIfwBarYIf extends Mix___wFooXIfwBarYIf { ; ; f; } + +/* */class S____fwFoo___ extends Mix__fwFoo___ { class I; ; f; } +/* */class S____fwFoo___wBar___ extends Mix__fwFoo___wBar___ { class I; ; f; } +/* */class S____fwFoo___wBar__f extends Mix__fwFoo___wBar__f { class I; ; f; } +/* */class S____fwFoo___wBar_I_ extends Mix__fwFoo___wBar_I_ { ; ; f; } +/* */class S____fwFoo___wBar_If extends Mix__fwFoo___wBar_If { ; ; f; } +/* */class S____fwFoo___wBarY__ extends Mix__fwFoo___wBarY__ { class I; ; f; } +/* */class S____fwFoo___wBarY_f extends Mix__fwFoo___wBarY_f { class I; ; f; } +/* */class S____fwFoo___wBarYI_ extends Mix__fwFoo___wBarYI_ { ; ; f; } +/* */class S____fwFoo___wBarYIf extends Mix__fwFoo___wBarYIf { ; ; f; } +/* */class S____fwFoo__f extends Mix__fwFoo__f { class I; ; f; } +/* */class S____fwFoo__fwBar___ extends Mix__fwFoo__fwBar___ { class I; ; f; } +/* */class S____fwFoo__fwBar__f extends Mix__fwFoo__fwBar__f { class I; ; f; } +/* */class S____fwFoo__fwBar_I_ extends Mix__fwFoo__fwBar_I_ { ; ; f; } +/* */class S____fwFoo__fwBar_If extends Mix__fwFoo__fwBar_If { ; ; f; } +/* */class S____fwFoo__fwBarY__ extends Mix__fwFoo__fwBarY__ { class I; ; f; } +/* */class S____fwFoo__fwBarY_f extends Mix__fwFoo__fwBarY_f { class I; ; f; } +/* */class S____fwFoo__fwBarYI_ extends Mix__fwFoo__fwBarYI_ { ; ; f; } +/* */class S____fwFoo__fwBarYIf extends Mix__fwFoo__fwBarYIf { ; ; f; } +/* */class S____fwFoo_I_ extends Mix__fwFoo_I_ { ; ; f; } +/* */class S____fwFoo_I_wBar___ extends Mix__fwFoo_I_wBar___ { ; ; f; } +/* */class S____fwFoo_I_wBar__f extends Mix__fwFoo_I_wBar__f { ; ; f; } +// */class S____fwFoo_I_wBar_I_ extends Mix__fwFoo_I_wBar_I_ { ; ; f; } +// */class S____fwFoo_I_wBar_If extends Mix__fwFoo_I_wBar_If { ; ; f; } +/* */class S____fwFoo_I_wBarY__ extends Mix__fwFoo_I_wBarY__ { ; ; f; } +/* */class S____fwFoo_I_wBarY_f extends Mix__fwFoo_I_wBarY_f { ; ; f; } +// */class S____fwFoo_I_wBarYI_ extends Mix__fwFoo_I_wBarYI_ { ; ; f; } +// */class S____fwFoo_I_wBarYIf extends Mix__fwFoo_I_wBarYIf { ; ; f; } +/* */class S____fwFoo_If extends Mix__fwFoo_If { ; ; f; } +/* */class S____fwFoo_IfwBar___ extends Mix__fwFoo_IfwBar___ { ; ; f; } +/* */class S____fwFoo_IfwBar__f extends Mix__fwFoo_IfwBar__f { ; ; f; } +// */class S____fwFoo_IfwBar_I_ extends Mix__fwFoo_IfwBar_I_ { ; ; f; } +// */class S____fwFoo_IfwBar_If extends Mix__fwFoo_IfwBar_If { ; ; f; } +/* */class S____fwFoo_IfwBarY__ extends Mix__fwFoo_IfwBarY__ { ; ; f; } +/* */class S____fwFoo_IfwBarY_f extends Mix__fwFoo_IfwBarY_f { ; ; f; } +// */class S____fwFoo_IfwBarYI_ extends Mix__fwFoo_IfwBarYI_ { ; ; f; } +// */class S____fwFoo_IfwBarYIf extends Mix__fwFoo_IfwBarYIf { ; ; f; } +/* */class S____fwFooX__ extends Mix__fwFooX__ { class I; ; f; } +/* */class S____fwFooX__wBar___ extends Mix__fwFooX__wBar___ { class I; ; f; } +/* */class S____fwFooX__wBar__f extends Mix__fwFooX__wBar__f { class I; ; f; } +/* */class S____fwFooX__wBar_I_ extends Mix__fwFooX__wBar_I_ { ; ; f; } +/* */class S____fwFooX__wBar_If extends Mix__fwFooX__wBar_If { ; ; f; } +/* */class S____fwFooX__wBarY__ extends Mix__fwFooX__wBarY__ { class I; ; f; } +/* */class S____fwFooX__wBarY_f extends Mix__fwFooX__wBarY_f { class I; ; f; } +/* */class S____fwFooX__wBarYI_ extends Mix__fwFooX__wBarYI_ { ; ; f; } +/* */class S____fwFooX__wBarYIf extends Mix__fwFooX__wBarYIf { ; ; f; } +/* */class S____fwFooX_f extends Mix__fwFooX_f { class I; ; f; } +/* */class S____fwFooX_fwBar___ extends Mix__fwFooX_fwBar___ { class I; ; f; } +/* */class S____fwFooX_fwBar__f extends Mix__fwFooX_fwBar__f { class I; ; f; } +/* */class S____fwFooX_fwBar_I_ extends Mix__fwFooX_fwBar_I_ { ; ; f; } +/* */class S____fwFooX_fwBar_If extends Mix__fwFooX_fwBar_If { ; ; f; } +/* */class S____fwFooX_fwBarY__ extends Mix__fwFooX_fwBarY__ { class I; ; f; } +/* */class S____fwFooX_fwBarY_f extends Mix__fwFooX_fwBarY_f { class I; ; f; } +/* */class S____fwFooX_fwBarYI_ extends Mix__fwFooX_fwBarYI_ { ; ; f; } +/* */class S____fwFooX_fwBarYIf extends Mix__fwFooX_fwBarYIf { ; ; f; } +/* */class S____fwFooXI_ extends Mix__fwFooXI_ { ; ; f; } +/* */class S____fwFooXI_wBar___ extends Mix__fwFooXI_wBar___ { ; ; f; } +/* */class S____fwFooXI_wBar__f extends Mix__fwFooXI_wBar__f { ; ; f; } +// */class S____fwFooXI_wBar_I_ extends Mix__fwFooXI_wBar_I_ { ; ; f; } +// */class S____fwFooXI_wBar_If extends Mix__fwFooXI_wBar_If { ; ; f; } +/* */class S____fwFooXI_wBarY__ extends Mix__fwFooXI_wBarY__ { ; ; f; } +/* */class S____fwFooXI_wBarY_f extends Mix__fwFooXI_wBarY_f { ; ; f; } +// */class S____fwFooXI_wBarYI_ extends Mix__fwFooXI_wBarYI_ { ; ; f; } +// */class S____fwFooXI_wBarYIf extends Mix__fwFooXI_wBarYIf { ; ; f; } +/* */class S____fwFooXIf extends Mix__fwFooXIf { ; ; f; } +/* */class S____fwFooXIfwBar___ extends Mix__fwFooXIfwBar___ { ; ; f; } +/* */class S____fwFooXIfwBar__f extends Mix__fwFooXIfwBar__f { ; ; f; } +// */class S____fwFooXIfwBar_I_ extends Mix__fwFooXIfwBar_I_ { ; ; f; } +// */class S____fwFooXIfwBar_If extends Mix__fwFooXIfwBar_If { ; ; f; } +/* */class S____fwFooXIfwBarY__ extends Mix__fwFooXIfwBarY__ { ; ; f; } +/* */class S____fwFooXIfwBarY_f extends Mix__fwFooXIfwBarY_f { ; ; f; } +// */class S____fwFooXIfwBarYI_ extends Mix__fwFooXIfwBarYI_ { ; ; f; } +// */class S____fwFooXIfwBarYIf extends Mix__fwFooXIfwBarYIf { ; ; f; } + +/* */class S___I_wFoo___ extends Mix_I_wFoo___ { ; def f: I = {sub; null}; f; } +/* */class S___I_wFoo___wBar___ extends Mix_I_wFoo___wBar___ { ; def f: I = {sub; null}; f; } +/* */class S___I_wFoo___wBar__f extends Mix_I_wFoo___wBar__f { ; ; f; } +// */class S___I_wFoo___wBar_I_ extends Mix_I_wFoo___wBar_I_ { ; def f: I = {sub; null}; f; } +// */class S___I_wFoo___wBar_If extends Mix_I_wFoo___wBar_If { ; ; f; } +/* */class S___I_wFoo___wBarY__ extends Mix_I_wFoo___wBarY__ { ; def f: I = {sub; null}; f; } +/* */class S___I_wFoo___wBarY_f extends Mix_I_wFoo___wBarY_f { ; ; f; } +// */class S___I_wFoo___wBarYI_ extends Mix_I_wFoo___wBarYI_ { ; def f: I = {sub; null}; f; } +// */class S___I_wFoo___wBarYIf extends Mix_I_wFoo___wBarYIf { ; ; f; } +/* */class S___I_wFoo__f extends Mix_I_wFoo__f { ; ; f; } +/* */class S___I_wFoo__fwBar___ extends Mix_I_wFoo__fwBar___ { ; ; f; } +// */class S___I_wFoo__fwBar__f extends Mix_I_wFoo__fwBar__f { ; ; f; } +// */class S___I_wFoo__fwBar_I_ extends Mix_I_wFoo__fwBar_I_ { ; ; f; } +// */class S___I_wFoo__fwBar_If extends Mix_I_wFoo__fwBar_If { ; ; f; } +/* */class S___I_wFoo__fwBarY__ extends Mix_I_wFoo__fwBarY__ { ; ; f; } +// */class S___I_wFoo__fwBarY_f extends Mix_I_wFoo__fwBarY_f { ; ; f; } +// */class S___I_wFoo__fwBarYI_ extends Mix_I_wFoo__fwBarYI_ { ; ; f; } +// */class S___I_wFoo__fwBarYIf extends Mix_I_wFoo__fwBarYIf { ; ; f; } +// */class S___I_wFoo_I_ extends Mix_I_wFoo_I_ { ; def f: I = {sub; null}; f; } +// */class S___I_wFoo_I_wBar___ extends Mix_I_wFoo_I_wBar___ { ; def f: I = {sub; null}; f; } +// */class S___I_wFoo_I_wBar__f extends Mix_I_wFoo_I_wBar__f { ; ; f; } +// */class S___I_wFoo_I_wBar_I_ extends Mix_I_wFoo_I_wBar_I_ { ; def f: I = {sub; null}; f; } +// */class S___I_wFoo_I_wBar_If extends Mix_I_wFoo_I_wBar_If { ; ; f; } +// */class S___I_wFoo_I_wBarY__ extends Mix_I_wFoo_I_wBarY__ { ; def f: I = {sub; null}; f; } +// */class S___I_wFoo_I_wBarY_f extends Mix_I_wFoo_I_wBarY_f { ; ; f; } +// */class S___I_wFoo_I_wBarYI_ extends Mix_I_wFoo_I_wBarYI_ { ; def f: I = {sub; null}; f; } +// */class S___I_wFoo_I_wBarYIf extends Mix_I_wFoo_I_wBarYIf { ; ; f; } +// */class S___I_wFoo_If extends Mix_I_wFoo_If { ; ; f; } +// */class S___I_wFoo_IfwBar___ extends Mix_I_wFoo_IfwBar___ { ; ; f; } +// */class S___I_wFoo_IfwBar__f extends Mix_I_wFoo_IfwBar__f { ; ; f; } +// */class S___I_wFoo_IfwBar_I_ extends Mix_I_wFoo_IfwBar_I_ { ; ; f; } +// */class S___I_wFoo_IfwBar_If extends Mix_I_wFoo_IfwBar_If { ; ; f; } +// */class S___I_wFoo_IfwBarY__ extends Mix_I_wFoo_IfwBarY__ { ; ; f; } +// */class S___I_wFoo_IfwBarY_f extends Mix_I_wFoo_IfwBarY_f { ; ; f; } +// */class S___I_wFoo_IfwBarYI_ extends Mix_I_wFoo_IfwBarYI_ { ; ; f; } +// */class S___I_wFoo_IfwBarYIf extends Mix_I_wFoo_IfwBarYIf { ; ; f; } +/* */class S___I_wFooX__ extends Mix_I_wFooX__ { ; def f: I = {sub; null}; f; } +/* */class S___I_wFooX__wBar___ extends Mix_I_wFooX__wBar___ { ; def f: I = {sub; null}; f; } +/* */class S___I_wFooX__wBar__f extends Mix_I_wFooX__wBar__f { ; ; f; } +// */class S___I_wFooX__wBar_I_ extends Mix_I_wFooX__wBar_I_ { ; def f: I = {sub; null}; f; } +// */class S___I_wFooX__wBar_If extends Mix_I_wFooX__wBar_If { ; ; f; } +/* */class S___I_wFooX__wBarY__ extends Mix_I_wFooX__wBarY__ { ; def f: I = {sub; null}; f; } +/* */class S___I_wFooX__wBarY_f extends Mix_I_wFooX__wBarY_f { ; ; f; } +// */class S___I_wFooX__wBarYI_ extends Mix_I_wFooX__wBarYI_ { ; def f: I = {sub; null}; f; } +// */class S___I_wFooX__wBarYIf extends Mix_I_wFooX__wBarYIf { ; ; f; } +/* */class S___I_wFooX_f extends Mix_I_wFooX_f { ; ; f; } +/* */class S___I_wFooX_fwBar___ extends Mix_I_wFooX_fwBar___ { ; ; f; } +// */class S___I_wFooX_fwBar__f extends Mix_I_wFooX_fwBar__f { ; ; f; } +// */class S___I_wFooX_fwBar_I_ extends Mix_I_wFooX_fwBar_I_ { ; ; f; } +// */class S___I_wFooX_fwBar_If extends Mix_I_wFooX_fwBar_If { ; ; f; } +/* */class S___I_wFooX_fwBarY__ extends Mix_I_wFooX_fwBarY__ { ; ; f; } +// */class S___I_wFooX_fwBarY_f extends Mix_I_wFooX_fwBarY_f { ; ; f; } +// */class S___I_wFooX_fwBarYI_ extends Mix_I_wFooX_fwBarYI_ { ; ; f; } +// */class S___I_wFooX_fwBarYIf extends Mix_I_wFooX_fwBarYIf { ; ; f; } +// */class S___I_wFooXI_ extends Mix_I_wFooXI_ { ; def f: I = {sub; null}; f; } +// */class S___I_wFooXI_wBar___ extends Mix_I_wFooXI_wBar___ { ; def f: I = {sub; null}; f; } +// */class S___I_wFooXI_wBar__f extends Mix_I_wFooXI_wBar__f { ; ; f; } +// */class S___I_wFooXI_wBar_I_ extends Mix_I_wFooXI_wBar_I_ { ; def f: I = {sub; null}; f; } +// */class S___I_wFooXI_wBar_If extends Mix_I_wFooXI_wBar_If { ; ; f; } +// */class S___I_wFooXI_wBarY__ extends Mix_I_wFooXI_wBarY__ { ; def f: I = {sub; null}; f; } +// */class S___I_wFooXI_wBarY_f extends Mix_I_wFooXI_wBarY_f { ; ; f; } +// */class S___I_wFooXI_wBarYI_ extends Mix_I_wFooXI_wBarYI_ { ; def f: I = {sub; null}; f; } +// */class S___I_wFooXI_wBarYIf extends Mix_I_wFooXI_wBarYIf { ; ; f; } +// */class S___I_wFooXIf extends Mix_I_wFooXIf { ; ; f; } +// */class S___I_wFooXIfwBar___ extends Mix_I_wFooXIfwBar___ { ; ; f; } +// */class S___I_wFooXIfwBar__f extends Mix_I_wFooXIfwBar__f { ; ; f; } +// */class S___I_wFooXIfwBar_I_ extends Mix_I_wFooXIfwBar_I_ { ; ; f; } +// */class S___I_wFooXIfwBar_If extends Mix_I_wFooXIfwBar_If { ; ; f; } +// */class S___I_wFooXIfwBarY__ extends Mix_I_wFooXIfwBarY__ { ; ; f; } +// */class S___I_wFooXIfwBarY_f extends Mix_I_wFooXIfwBarY_f { ; ; f; } +// */class S___I_wFooXIfwBarYI_ extends Mix_I_wFooXIfwBarYI_ { ; ; f; } +// */class S___I_wFooXIfwBarYIf extends Mix_I_wFooXIfwBarYIf { ; ; f; } + +/* */class S___IfwFoo___ extends Mix_IfwFoo___ { ; ; f; } +/* */class S___IfwFoo___wBar___ extends Mix_IfwFoo___wBar___ { ; ; f; } +/* */class S___IfwFoo___wBar__f extends Mix_IfwFoo___wBar__f { ; ; f; } +// */class S___IfwFoo___wBar_I_ extends Mix_IfwFoo___wBar_I_ { ; ; f; } +// */class S___IfwFoo___wBar_If extends Mix_IfwFoo___wBar_If { ; ; f; } +/* */class S___IfwFoo___wBarY__ extends Mix_IfwFoo___wBarY__ { ; ; f; } +/* */class S___IfwFoo___wBarY_f extends Mix_IfwFoo___wBarY_f { ; ; f; } +// */class S___IfwFoo___wBarYI_ extends Mix_IfwFoo___wBarYI_ { ; ; f; } +// */class S___IfwFoo___wBarYIf extends Mix_IfwFoo___wBarYIf { ; ; f; } +/* */class S___IfwFoo__f extends Mix_IfwFoo__f { ; ; f; } +/* */class S___IfwFoo__fwBar___ extends Mix_IfwFoo__fwBar___ { ; ; f; } +/* */class S___IfwFoo__fwBar__f extends Mix_IfwFoo__fwBar__f { ; ; f; } +// */class S___IfwFoo__fwBar_I_ extends Mix_IfwFoo__fwBar_I_ { ; ; f; } +// */class S___IfwFoo__fwBar_If extends Mix_IfwFoo__fwBar_If { ; ; f; } +/* */class S___IfwFoo__fwBarY__ extends Mix_IfwFoo__fwBarY__ { ; ; f; } +/* */class S___IfwFoo__fwBarY_f extends Mix_IfwFoo__fwBarY_f { ; ; f; } +// */class S___IfwFoo__fwBarYI_ extends Mix_IfwFoo__fwBarYI_ { ; ; f; } +// */class S___IfwFoo__fwBarYIf extends Mix_IfwFoo__fwBarYIf { ; ; f; } +// */class S___IfwFoo_I_ extends Mix_IfwFoo_I_ { ; ; f; } +// */class S___IfwFoo_I_wBar___ extends Mix_IfwFoo_I_wBar___ { ; ; f; } +// */class S___IfwFoo_I_wBar__f extends Mix_IfwFoo_I_wBar__f { ; ; f; } +// */class S___IfwFoo_I_wBar_I_ extends Mix_IfwFoo_I_wBar_I_ { ; ; f; } +// */class S___IfwFoo_I_wBar_If extends Mix_IfwFoo_I_wBar_If { ; ; f; } +// */class S___IfwFoo_I_wBarY__ extends Mix_IfwFoo_I_wBarY__ { ; ; f; } +// */class S___IfwFoo_I_wBarY_f extends Mix_IfwFoo_I_wBarY_f { ; ; f; } +// */class S___IfwFoo_I_wBarYI_ extends Mix_IfwFoo_I_wBarYI_ { ; ; f; } +// */class S___IfwFoo_I_wBarYIf extends Mix_IfwFoo_I_wBarYIf { ; ; f; } +// */class S___IfwFoo_If extends Mix_IfwFoo_If { ; ; f; } +// */class S___IfwFoo_IfwBar___ extends Mix_IfwFoo_IfwBar___ { ; ; f; } +// */class S___IfwFoo_IfwBar__f extends Mix_IfwFoo_IfwBar__f { ; ; f; } +// */class S___IfwFoo_IfwBar_I_ extends Mix_IfwFoo_IfwBar_I_ { ; ; f; } +// */class S___IfwFoo_IfwBar_If extends Mix_IfwFoo_IfwBar_If { ; ; f; } +// */class S___IfwFoo_IfwBarY__ extends Mix_IfwFoo_IfwBarY__ { ; ; f; } +// */class S___IfwFoo_IfwBarY_f extends Mix_IfwFoo_IfwBarY_f { ; ; f; } +// */class S___IfwFoo_IfwBarYI_ extends Mix_IfwFoo_IfwBarYI_ { ; ; f; } +// */class S___IfwFoo_IfwBarYIf extends Mix_IfwFoo_IfwBarYIf { ; ; f; } +/* */class S___IfwFooX__ extends Mix_IfwFooX__ { ; ; f; } +/* */class S___IfwFooX__wBar___ extends Mix_IfwFooX__wBar___ { ; ; f; } +/* */class S___IfwFooX__wBar__f extends Mix_IfwFooX__wBar__f { ; ; f; } +// */class S___IfwFooX__wBar_I_ extends Mix_IfwFooX__wBar_I_ { ; ; f; } +// */class S___IfwFooX__wBar_If extends Mix_IfwFooX__wBar_If { ; ; f; } +/* */class S___IfwFooX__wBarY__ extends Mix_IfwFooX__wBarY__ { ; ; f; } +/* */class S___IfwFooX__wBarY_f extends Mix_IfwFooX__wBarY_f { ; ; f; } +// */class S___IfwFooX__wBarYI_ extends Mix_IfwFooX__wBarYI_ { ; ; f; } +// */class S___IfwFooX__wBarYIf extends Mix_IfwFooX__wBarYIf { ; ; f; } +/* */class S___IfwFooX_f extends Mix_IfwFooX_f { ; ; f; } +/* */class S___IfwFooX_fwBar___ extends Mix_IfwFooX_fwBar___ { ; ; f; } +/* */class S___IfwFooX_fwBar__f extends Mix_IfwFooX_fwBar__f { ; ; f; } +// */class S___IfwFooX_fwBar_I_ extends Mix_IfwFooX_fwBar_I_ { ; ; f; } +// */class S___IfwFooX_fwBar_If extends Mix_IfwFooX_fwBar_If { ; ; f; } +/* */class S___IfwFooX_fwBarY__ extends Mix_IfwFooX_fwBarY__ { ; ; f; } +/* */class S___IfwFooX_fwBarY_f extends Mix_IfwFooX_fwBarY_f { ; ; f; } +// */class S___IfwFooX_fwBarYI_ extends Mix_IfwFooX_fwBarYI_ { ; ; f; } +// */class S___IfwFooX_fwBarYIf extends Mix_IfwFooX_fwBarYIf { ; ; f; } +// */class S___IfwFooXI_ extends Mix_IfwFooXI_ { ; ; f; } +// */class S___IfwFooXI_wBar___ extends Mix_IfwFooXI_wBar___ { ; ; f; } +// */class S___IfwFooXI_wBar__f extends Mix_IfwFooXI_wBar__f { ; ; f; } +// */class S___IfwFooXI_wBar_I_ extends Mix_IfwFooXI_wBar_I_ { ; ; f; } +// */class S___IfwFooXI_wBar_If extends Mix_IfwFooXI_wBar_If { ; ; f; } +// */class S___IfwFooXI_wBarY__ extends Mix_IfwFooXI_wBarY__ { ; ; f; } +// */class S___IfwFooXI_wBarY_f extends Mix_IfwFooXI_wBarY_f { ; ; f; } +// */class S___IfwFooXI_wBarYI_ extends Mix_IfwFooXI_wBarYI_ { ; ; f; } +// */class S___IfwFooXI_wBarYIf extends Mix_IfwFooXI_wBarYIf { ; ; f; } +// */class S___IfwFooXIf extends Mix_IfwFooXIf { ; ; f; } +// */class S___IfwFooXIfwBar___ extends Mix_IfwFooXIfwBar___ { ; ; f; } +// */class S___IfwFooXIfwBar__f extends Mix_IfwFooXIfwBar__f { ; ; f; } +// */class S___IfwFooXIfwBar_I_ extends Mix_IfwFooXIfwBar_I_ { ; ; f; } +// */class S___IfwFooXIfwBar_If extends Mix_IfwFooXIfwBar_If { ; ; f; } +// */class S___IfwFooXIfwBarY__ extends Mix_IfwFooXIfwBarY__ { ; ; f; } +// */class S___IfwFooXIfwBarY_f extends Mix_IfwFooXIfwBarY_f { ; ; f; } +// */class S___IfwFooXIfwBarYI_ extends Mix_IfwFooXIfwBarYI_ { ; ; f; } +// */class S___IfwFooXIfwBarYIf extends Mix_IfwFooXIfwBarYIf { ; ; f; } + +/* */class S__Z__wFoo___ extends MixZ__wFoo___ [C] { class I; def f: I = {sub; null}; f; } +/* */class S__Z__wFoo___wBar___ extends MixZ__wFoo___wBar___[C] { class I; def f: I = {sub; null}; f; } +/* */class S__Z__wFoo___wBar__f extends MixZ__wFoo___wBar__f[C] { class I; ; f; } +/* */class S__Z__wFoo___wBar_I_ extends MixZ__wFoo___wBar_I_[C] { ; def f: I = {sub; null}; f; } +/* */class S__Z__wFoo___wBar_If extends MixZ__wFoo___wBar_If[C] { ; ; f; } +/* */class S__Z__wFoo___wBarY__ extends MixZ__wFoo___wBarY__[C] { class I; def f: I = {sub; null}; f; } +/* */class S__Z__wFoo___wBarY_f extends MixZ__wFoo___wBarY_f[C] { class I; ; f; } +/* */class S__Z__wFoo___wBarYI_ extends MixZ__wFoo___wBarYI_[C] { ; def f: I = {sub; null}; f; } +/* */class S__Z__wFoo___wBarYIf extends MixZ__wFoo___wBarYIf[C] { ; ; f; } +/* */class S__Z__wFoo__f extends MixZ__wFoo__f [C] { class I; ; f; } +/* */class S__Z__wFoo__fwBar___ extends MixZ__wFoo__fwBar___[C] { class I; ; f; } +// */class S__Z__wFoo__fwBar__f extends MixZ__wFoo__fwBar__f[C] { class I; ; f; } +/* */class S__Z__wFoo__fwBar_I_ extends MixZ__wFoo__fwBar_I_[C] { ; ; f; } +// */class S__Z__wFoo__fwBar_If extends MixZ__wFoo__fwBar_If[C] { ; ; f; } +/* */class S__Z__wFoo__fwBarY__ extends MixZ__wFoo__fwBarY__[C] { class I; ; f; } +// */class S__Z__wFoo__fwBarY_f extends MixZ__wFoo__fwBarY_f[C] { class I; ; f; } +/* */class S__Z__wFoo__fwBarYI_ extends MixZ__wFoo__fwBarYI_[C] { ; ; f; } +// */class S__Z__wFoo__fwBarYIf extends MixZ__wFoo__fwBarYIf[C] { ; ; f; } +/* */class S__Z__wFoo_I_ extends MixZ__wFoo_I_ [C] { ; def f: I = {sub; null}; f; } +/* */class S__Z__wFoo_I_wBar___ extends MixZ__wFoo_I_wBar___[C] { ; def f: I = {sub; null}; f; } +/* */class S__Z__wFoo_I_wBar__f extends MixZ__wFoo_I_wBar__f[C] { ; ; f; } +// */class S__Z__wFoo_I_wBar_I_ extends MixZ__wFoo_I_wBar_I_[C] { ; def f: I = {sub; null}; f; } +// */class S__Z__wFoo_I_wBar_If extends MixZ__wFoo_I_wBar_If[C] { ; ; f; } +/* */class S__Z__wFoo_I_wBarY__ extends MixZ__wFoo_I_wBarY__[C] { ; def f: I = {sub; null}; f; } +/* */class S__Z__wFoo_I_wBarY_f extends MixZ__wFoo_I_wBarY_f[C] { ; ; f; } +// */class S__Z__wFoo_I_wBarYI_ extends MixZ__wFoo_I_wBarYI_[C] { ; def f: I = {sub; null}; f; } +// */class S__Z__wFoo_I_wBarYIf extends MixZ__wFoo_I_wBarYIf[C] { ; ; f; } +/* */class S__Z__wFoo_If extends MixZ__wFoo_If [C] { ; ; f; } +/* */class S__Z__wFoo_IfwBar___ extends MixZ__wFoo_IfwBar___[C] { ; ; f; } +// */class S__Z__wFoo_IfwBar__f extends MixZ__wFoo_IfwBar__f[C] { ; ; f; } +// */class S__Z__wFoo_IfwBar_I_ extends MixZ__wFoo_IfwBar_I_[C] { ; ; f; } +// */class S__Z__wFoo_IfwBar_If extends MixZ__wFoo_IfwBar_If[C] { ; ; f; } +/* */class S__Z__wFoo_IfwBarY__ extends MixZ__wFoo_IfwBarY__[C] { ; ; f; } +// */class S__Z__wFoo_IfwBarY_f extends MixZ__wFoo_IfwBarY_f[C] { ; ; f; } +// */class S__Z__wFoo_IfwBarYI_ extends MixZ__wFoo_IfwBarYI_[C] { ; ; f; } +// */class S__Z__wFoo_IfwBarYIf extends MixZ__wFoo_IfwBarYIf[C] { ; ; f; } +/* */class S__Z__wFooX__ extends MixZ__wFooX__ [C] { class I; def f: I = {sub; null}; f; } +/* */class S__Z__wFooX__wBar___ extends MixZ__wFooX__wBar___[C] { class I; def f: I = {sub; null}; f; } +/* */class S__Z__wFooX__wBar__f extends MixZ__wFooX__wBar__f[C] { class I; ; f; } +/* */class S__Z__wFooX__wBar_I_ extends MixZ__wFooX__wBar_I_[C] { ; def f: I = {sub; null}; f; } +/* */class S__Z__wFooX__wBar_If extends MixZ__wFooX__wBar_If[C] { ; ; f; } +/* */class S__Z__wFooX__wBarY__ extends MixZ__wFooX__wBarY__[C] { class I; def f: I = {sub; null}; f; } +/* */class S__Z__wFooX__wBarY_f extends MixZ__wFooX__wBarY_f[C] { class I; ; f; } +/* */class S__Z__wFooX__wBarYI_ extends MixZ__wFooX__wBarYI_[C] { ; def f: I = {sub; null}; f; } +/* */class S__Z__wFooX__wBarYIf extends MixZ__wFooX__wBarYIf[C] { ; ; f; } +/* */class S__Z__wFooX_f extends MixZ__wFooX_f [C] { class I; ; f; } +/* */class S__Z__wFooX_fwBar___ extends MixZ__wFooX_fwBar___[C] { class I; ; f; } +// */class S__Z__wFooX_fwBar__f extends MixZ__wFooX_fwBar__f[C] { class I; ; f; } +/* */class S__Z__wFooX_fwBar_I_ extends MixZ__wFooX_fwBar_I_[C] { ; ; f; } +// */class S__Z__wFooX_fwBar_If extends MixZ__wFooX_fwBar_If[C] { ; ; f; } +/* */class S__Z__wFooX_fwBarY__ extends MixZ__wFooX_fwBarY__[C] { class I; ; f; } +// */class S__Z__wFooX_fwBarY_f extends MixZ__wFooX_fwBarY_f[C] { class I; ; f; } +/* */class S__Z__wFooX_fwBarYI_ extends MixZ__wFooX_fwBarYI_[C] { ; ; f; } +// */class S__Z__wFooX_fwBarYIf extends MixZ__wFooX_fwBarYIf[C] { ; ; f; } +/* */class S__Z__wFooXI_ extends MixZ__wFooXI_ [C] { ; def f: I = {sub; null}; f; } +/* */class S__Z__wFooXI_wBar___ extends MixZ__wFooXI_wBar___[C] { ; def f: I = {sub; null}; f; } +/* */class S__Z__wFooXI_wBar__f extends MixZ__wFooXI_wBar__f[C] { ; ; f; } +// */class S__Z__wFooXI_wBar_I_ extends MixZ__wFooXI_wBar_I_[C] { ; def f: I = {sub; null}; f; } +// */class S__Z__wFooXI_wBar_If extends MixZ__wFooXI_wBar_If[C] { ; ; f; } +/* */class S__Z__wFooXI_wBarY__ extends MixZ__wFooXI_wBarY__[C] { ; def f: I = {sub; null}; f; } +/* */class S__Z__wFooXI_wBarY_f extends MixZ__wFooXI_wBarY_f[C] { ; ; f; } +// */class S__Z__wFooXI_wBarYI_ extends MixZ__wFooXI_wBarYI_[C] { ; def f: I = {sub; null}; f; } +// */class S__Z__wFooXI_wBarYIf extends MixZ__wFooXI_wBarYIf[C] { ; ; f; } +/* */class S__Z__wFooXIf extends MixZ__wFooXIf [C] { ; ; f; } +/* */class S__Z__wFooXIfwBar___ extends MixZ__wFooXIfwBar___[C] { ; ; f; } +// */class S__Z__wFooXIfwBar__f extends MixZ__wFooXIfwBar__f[C] { ; ; f; } +// */class S__Z__wFooXIfwBar_I_ extends MixZ__wFooXIfwBar_I_[C] { ; ; f; } +// */class S__Z__wFooXIfwBar_If extends MixZ__wFooXIfwBar_If[C] { ; ; f; } +/* */class S__Z__wFooXIfwBarY__ extends MixZ__wFooXIfwBarY__[C] { ; ; f; } +// */class S__Z__wFooXIfwBarY_f extends MixZ__wFooXIfwBarY_f[C] { ; ; f; } +// */class S__Z__wFooXIfwBarYI_ extends MixZ__wFooXIfwBarYI_[C] { ; ; f; } +// */class S__Z__wFooXIfwBarYIf extends MixZ__wFooXIfwBarYIf[C] { ; ; f; } + +/* */class S__Z_fwFoo___ extends MixZ_fwFoo___ [C] { class I; ; f; } +/* */class S__Z_fwFoo___wBar___ extends MixZ_fwFoo___wBar___[C] { class I; ; f; } +/* */class S__Z_fwFoo___wBar__f extends MixZ_fwFoo___wBar__f[C] { class I; ; f; } +/* */class S__Z_fwFoo___wBar_I_ extends MixZ_fwFoo___wBar_I_[C] { ; ; f; } +/* */class S__Z_fwFoo___wBar_If extends MixZ_fwFoo___wBar_If[C] { ; ; f; } +/* */class S__Z_fwFoo___wBarY__ extends MixZ_fwFoo___wBarY__[C] { class I; ; f; } +/* */class S__Z_fwFoo___wBarY_f extends MixZ_fwFoo___wBarY_f[C] { class I; ; f; } +/* */class S__Z_fwFoo___wBarYI_ extends MixZ_fwFoo___wBarYI_[C] { ; ; f; } +/* */class S__Z_fwFoo___wBarYIf extends MixZ_fwFoo___wBarYIf[C] { ; ; f; } +/* */class S__Z_fwFoo__f extends MixZ_fwFoo__f [C] { class I; ; f; } +/* */class S__Z_fwFoo__fwBar___ extends MixZ_fwFoo__fwBar___[C] { class I; ; f; } +/* */class S__Z_fwFoo__fwBar__f extends MixZ_fwFoo__fwBar__f[C] { class I; ; f; } +/* */class S__Z_fwFoo__fwBar_I_ extends MixZ_fwFoo__fwBar_I_[C] { ; ; f; } +/* */class S__Z_fwFoo__fwBar_If extends MixZ_fwFoo__fwBar_If[C] { ; ; f; } +/* */class S__Z_fwFoo__fwBarY__ extends MixZ_fwFoo__fwBarY__[C] { class I; ; f; } +/* */class S__Z_fwFoo__fwBarY_f extends MixZ_fwFoo__fwBarY_f[C] { class I; ; f; } +/* */class S__Z_fwFoo__fwBarYI_ extends MixZ_fwFoo__fwBarYI_[C] { ; ; f; } +/* */class S__Z_fwFoo__fwBarYIf extends MixZ_fwFoo__fwBarYIf[C] { ; ; f; } +/* */class S__Z_fwFoo_I_ extends MixZ_fwFoo_I_ [C] { ; ; f; } +/* */class S__Z_fwFoo_I_wBar___ extends MixZ_fwFoo_I_wBar___[C] { ; ; f; } +/* */class S__Z_fwFoo_I_wBar__f extends MixZ_fwFoo_I_wBar__f[C] { ; ; f; } +// */class S__Z_fwFoo_I_wBar_I_ extends MixZ_fwFoo_I_wBar_I_[C] { ; ; f; } +// */class S__Z_fwFoo_I_wBar_If extends MixZ_fwFoo_I_wBar_If[C] { ; ; f; } +/* */class S__Z_fwFoo_I_wBarY__ extends MixZ_fwFoo_I_wBarY__[C] { ; ; f; } +/* */class S__Z_fwFoo_I_wBarY_f extends MixZ_fwFoo_I_wBarY_f[C] { ; ; f; } +// */class S__Z_fwFoo_I_wBarYI_ extends MixZ_fwFoo_I_wBarYI_[C] { ; ; f; } +// */class S__Z_fwFoo_I_wBarYIf extends MixZ_fwFoo_I_wBarYIf[C] { ; ; f; } +/* */class S__Z_fwFoo_If extends MixZ_fwFoo_If [C] { ; ; f; } +/* */class S__Z_fwFoo_IfwBar___ extends MixZ_fwFoo_IfwBar___[C] { ; ; f; } +/* */class S__Z_fwFoo_IfwBar__f extends MixZ_fwFoo_IfwBar__f[C] { ; ; f; } +// */class S__Z_fwFoo_IfwBar_I_ extends MixZ_fwFoo_IfwBar_I_[C] { ; ; f; } +// */class S__Z_fwFoo_IfwBar_If extends MixZ_fwFoo_IfwBar_If[C] { ; ; f; } +/* */class S__Z_fwFoo_IfwBarY__ extends MixZ_fwFoo_IfwBarY__[C] { ; ; f; } +/* */class S__Z_fwFoo_IfwBarY_f extends MixZ_fwFoo_IfwBarY_f[C] { ; ; f; } +// */class S__Z_fwFoo_IfwBarYI_ extends MixZ_fwFoo_IfwBarYI_[C] { ; ; f; } +// */class S__Z_fwFoo_IfwBarYIf extends MixZ_fwFoo_IfwBarYIf[C] { ; ; f; } +/* */class S__Z_fwFooX__ extends MixZ_fwFooX__ [C] { class I; ; f; } +/* */class S__Z_fwFooX__wBar___ extends MixZ_fwFooX__wBar___[C] { class I; ; f; } +/* */class S__Z_fwFooX__wBar__f extends MixZ_fwFooX__wBar__f[C] { class I; ; f; } +/* */class S__Z_fwFooX__wBar_I_ extends MixZ_fwFooX__wBar_I_[C] { ; ; f; } +/* */class S__Z_fwFooX__wBar_If extends MixZ_fwFooX__wBar_If[C] { ; ; f; } +/* */class S__Z_fwFooX__wBarY__ extends MixZ_fwFooX__wBarY__[C] { class I; ; f; } +/* */class S__Z_fwFooX__wBarY_f extends MixZ_fwFooX__wBarY_f[C] { class I; ; f; } +/* */class S__Z_fwFooX__wBarYI_ extends MixZ_fwFooX__wBarYI_[C] { ; ; f; } +/* */class S__Z_fwFooX__wBarYIf extends MixZ_fwFooX__wBarYIf[C] { ; ; f; } +/* */class S__Z_fwFooX_f extends MixZ_fwFooX_f [C] { class I; ; f; } +/* */class S__Z_fwFooX_fwBar___ extends MixZ_fwFooX_fwBar___[C] { class I; ; f; } +/* */class S__Z_fwFooX_fwBar__f extends MixZ_fwFooX_fwBar__f[C] { class I; ; f; } +/* */class S__Z_fwFooX_fwBar_I_ extends MixZ_fwFooX_fwBar_I_[C] { ; ; f; } +/* */class S__Z_fwFooX_fwBar_If extends MixZ_fwFooX_fwBar_If[C] { ; ; f; } +/* */class S__Z_fwFooX_fwBarY__ extends MixZ_fwFooX_fwBarY__[C] { class I; ; f; } +/* */class S__Z_fwFooX_fwBarY_f extends MixZ_fwFooX_fwBarY_f[C] { class I; ; f; } +/* */class S__Z_fwFooX_fwBarYI_ extends MixZ_fwFooX_fwBarYI_[C] { ; ; f; } +/* */class S__Z_fwFooX_fwBarYIf extends MixZ_fwFooX_fwBarYIf[C] { ; ; f; } +/* */class S__Z_fwFooXI_ extends MixZ_fwFooXI_ [C] { ; ; f; } +/* */class S__Z_fwFooXI_wBar___ extends MixZ_fwFooXI_wBar___[C] { ; ; f; } +/* */class S__Z_fwFooXI_wBar__f extends MixZ_fwFooXI_wBar__f[C] { ; ; f; } +// */class S__Z_fwFooXI_wBar_I_ extends MixZ_fwFooXI_wBar_I_[C] { ; ; f; } +// */class S__Z_fwFooXI_wBar_If extends MixZ_fwFooXI_wBar_If[C] { ; ; f; } +/* */class S__Z_fwFooXI_wBarY__ extends MixZ_fwFooXI_wBarY__[C] { ; ; f; } +/* */class S__Z_fwFooXI_wBarY_f extends MixZ_fwFooXI_wBarY_f[C] { ; ; f; } +// */class S__Z_fwFooXI_wBarYI_ extends MixZ_fwFooXI_wBarYI_[C] { ; ; f; } +// */class S__Z_fwFooXI_wBarYIf extends MixZ_fwFooXI_wBarYIf[C] { ; ; f; } +/* */class S__Z_fwFooXIf extends MixZ_fwFooXIf [C] { ; ; f; } +/* */class S__Z_fwFooXIfwBar___ extends MixZ_fwFooXIfwBar___[C] { ; ; f; } +/* */class S__Z_fwFooXIfwBar__f extends MixZ_fwFooXIfwBar__f[C] { ; ; f; } +// */class S__Z_fwFooXIfwBar_I_ extends MixZ_fwFooXIfwBar_I_[C] { ; ; f; } +// */class S__Z_fwFooXIfwBar_If extends MixZ_fwFooXIfwBar_If[C] { ; ; f; } +/* */class S__Z_fwFooXIfwBarY__ extends MixZ_fwFooXIfwBarY__[C] { ; ; f; } +/* */class S__Z_fwFooXIfwBarY_f extends MixZ_fwFooXIfwBarY_f[C] { ; ; f; } +// */class S__Z_fwFooXIfwBarYI_ extends MixZ_fwFooXIfwBarYI_[C] { ; ; f; } +// */class S__Z_fwFooXIfwBarYIf extends MixZ_fwFooXIfwBarYIf[C] { ; ; f; } + +/* */class S__ZI_wFoo___ extends MixZI_wFoo___ [C] { ; def f: I = {sub; null}; f; } +/* */class S__ZI_wFoo___wBar___ extends MixZI_wFoo___wBar___[C] { ; def f: I = {sub; null}; f; } +/* */class S__ZI_wFoo___wBar__f extends MixZI_wFoo___wBar__f[C] { ; ; f; } +// */class S__ZI_wFoo___wBar_I_ extends MixZI_wFoo___wBar_I_[C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_wFoo___wBar_If extends MixZI_wFoo___wBar_If[C] { ; ; f; } +/* */class S__ZI_wFoo___wBarY__ extends MixZI_wFoo___wBarY__[C] { ; def f: I = {sub; null}; f; } +/* */class S__ZI_wFoo___wBarY_f extends MixZI_wFoo___wBarY_f[C] { ; ; f; } +// */class S__ZI_wFoo___wBarYI_ extends MixZI_wFoo___wBarYI_[C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_wFoo___wBarYIf extends MixZI_wFoo___wBarYIf[C] { ; ; f; } +/* */class S__ZI_wFoo__f extends MixZI_wFoo__f [C] { ; ; f; } +/* */class S__ZI_wFoo__fwBar___ extends MixZI_wFoo__fwBar___[C] { ; ; f; } +// */class S__ZI_wFoo__fwBar__f extends MixZI_wFoo__fwBar__f[C] { ; ; f; } +// */class S__ZI_wFoo__fwBar_I_ extends MixZI_wFoo__fwBar_I_[C] { ; ; f; } +// */class S__ZI_wFoo__fwBar_If extends MixZI_wFoo__fwBar_If[C] { ; ; f; } +/* */class S__ZI_wFoo__fwBarY__ extends MixZI_wFoo__fwBarY__[C] { ; ; f; } +// */class S__ZI_wFoo__fwBarY_f extends MixZI_wFoo__fwBarY_f[C] { ; ; f; } +// */class S__ZI_wFoo__fwBarYI_ extends MixZI_wFoo__fwBarYI_[C] { ; ; f; } +// */class S__ZI_wFoo__fwBarYIf extends MixZI_wFoo__fwBarYIf[C] { ; ; f; } +// */class S__ZI_wFoo_I_ extends MixZI_wFoo_I_ [C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_wFoo_I_wBar___ extends MixZI_wFoo_I_wBar___[C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_wFoo_I_wBar__f extends MixZI_wFoo_I_wBar__f[C] { ; ; f; } +// */class S__ZI_wFoo_I_wBar_I_ extends MixZI_wFoo_I_wBar_I_[C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_wFoo_I_wBar_If extends MixZI_wFoo_I_wBar_If[C] { ; ; f; } +// */class S__ZI_wFoo_I_wBarY__ extends MixZI_wFoo_I_wBarY__[C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_wFoo_I_wBarY_f extends MixZI_wFoo_I_wBarY_f[C] { ; ; f; } +// */class S__ZI_wFoo_I_wBarYI_ extends MixZI_wFoo_I_wBarYI_[C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_wFoo_I_wBarYIf extends MixZI_wFoo_I_wBarYIf[C] { ; ; f; } +// */class S__ZI_wFoo_If extends MixZI_wFoo_If [C] { ; ; f; } +// */class S__ZI_wFoo_IfwBar___ extends MixZI_wFoo_IfwBar___[C] { ; ; f; } +// */class S__ZI_wFoo_IfwBar__f extends MixZI_wFoo_IfwBar__f[C] { ; ; f; } +// */class S__ZI_wFoo_IfwBar_I_ extends MixZI_wFoo_IfwBar_I_[C] { ; ; f; } +// */class S__ZI_wFoo_IfwBar_If extends MixZI_wFoo_IfwBar_If[C] { ; ; f; } +// */class S__ZI_wFoo_IfwBarY__ extends MixZI_wFoo_IfwBarY__[C] { ; ; f; } +// */class S__ZI_wFoo_IfwBarY_f extends MixZI_wFoo_IfwBarY_f[C] { ; ; f; } +// */class S__ZI_wFoo_IfwBarYI_ extends MixZI_wFoo_IfwBarYI_[C] { ; ; f; } +// */class S__ZI_wFoo_IfwBarYIf extends MixZI_wFoo_IfwBarYIf[C] { ; ; f; } +/* */class S__ZI_wFooX__ extends MixZI_wFooX__ [C] { ; def f: I = {sub; null}; f; } +/* */class S__ZI_wFooX__wBar___ extends MixZI_wFooX__wBar___[C] { ; def f: I = {sub; null}; f; } +/* */class S__ZI_wFooX__wBar__f extends MixZI_wFooX__wBar__f[C] { ; ; f; } +// */class S__ZI_wFooX__wBar_I_ extends MixZI_wFooX__wBar_I_[C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_wFooX__wBar_If extends MixZI_wFooX__wBar_If[C] { ; ; f; } +/* */class S__ZI_wFooX__wBarY__ extends MixZI_wFooX__wBarY__[C] { ; def f: I = {sub; null}; f; } +/* */class S__ZI_wFooX__wBarY_f extends MixZI_wFooX__wBarY_f[C] { ; ; f; } +// */class S__ZI_wFooX__wBarYI_ extends MixZI_wFooX__wBarYI_[C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_wFooX__wBarYIf extends MixZI_wFooX__wBarYIf[C] { ; ; f; } +/* */class S__ZI_wFooX_f extends MixZI_wFooX_f [C] { ; ; f; } +/* */class S__ZI_wFooX_fwBar___ extends MixZI_wFooX_fwBar___[C] { ; ; f; } +// */class S__ZI_wFooX_fwBar__f extends MixZI_wFooX_fwBar__f[C] { ; ; f; } +// */class S__ZI_wFooX_fwBar_I_ extends MixZI_wFooX_fwBar_I_[C] { ; ; f; } +// */class S__ZI_wFooX_fwBar_If extends MixZI_wFooX_fwBar_If[C] { ; ; f; } +/* */class S__ZI_wFooX_fwBarY__ extends MixZI_wFooX_fwBarY__[C] { ; ; f; } +// */class S__ZI_wFooX_fwBarY_f extends MixZI_wFooX_fwBarY_f[C] { ; ; f; } +// */class S__ZI_wFooX_fwBarYI_ extends MixZI_wFooX_fwBarYI_[C] { ; ; f; } +// */class S__ZI_wFooX_fwBarYIf extends MixZI_wFooX_fwBarYIf[C] { ; ; f; } +// */class S__ZI_wFooXI_ extends MixZI_wFooXI_ [C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_wFooXI_wBar___ extends MixZI_wFooXI_wBar___[C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_wFooXI_wBar__f extends MixZI_wFooXI_wBar__f[C] { ; ; f; } +// */class S__ZI_wFooXI_wBar_I_ extends MixZI_wFooXI_wBar_I_[C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_wFooXI_wBar_If extends MixZI_wFooXI_wBar_If[C] { ; ; f; } +// */class S__ZI_wFooXI_wBarY__ extends MixZI_wFooXI_wBarY__[C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_wFooXI_wBarY_f extends MixZI_wFooXI_wBarY_f[C] { ; ; f; } +// */class S__ZI_wFooXI_wBarYI_ extends MixZI_wFooXI_wBarYI_[C] { ; def f: I = {sub; null}; f; } +// */class S__ZI_wFooXI_wBarYIf extends MixZI_wFooXI_wBarYIf[C] { ; ; f; } +// */class S__ZI_wFooXIf extends MixZI_wFooXIf [C] { ; ; f; } +// */class S__ZI_wFooXIfwBar___ extends MixZI_wFooXIfwBar___[C] { ; ; f; } +// */class S__ZI_wFooXIfwBar__f extends MixZI_wFooXIfwBar__f[C] { ; ; f; } +// */class S__ZI_wFooXIfwBar_I_ extends MixZI_wFooXIfwBar_I_[C] { ; ; f; } +// */class S__ZI_wFooXIfwBar_If extends MixZI_wFooXIfwBar_If[C] { ; ; f; } +// */class S__ZI_wFooXIfwBarY__ extends MixZI_wFooXIfwBarY__[C] { ; ; f; } +// */class S__ZI_wFooXIfwBarY_f extends MixZI_wFooXIfwBarY_f[C] { ; ; f; } +// */class S__ZI_wFooXIfwBarYI_ extends MixZI_wFooXIfwBarYI_[C] { ; ; f; } +// */class S__ZI_wFooXIfwBarYIf extends MixZI_wFooXIfwBarYIf[C] { ; ; f; } + +/* */class S__ZIfwFoo___ extends MixZIfwFoo___ [C] { ; ; f; } +/* */class S__ZIfwFoo___wBar___ extends MixZIfwFoo___wBar___[C] { ; ; f; } +/* */class S__ZIfwFoo___wBar__f extends MixZIfwFoo___wBar__f[C] { ; ; f; } +// */class S__ZIfwFoo___wBar_I_ extends MixZIfwFoo___wBar_I_[C] { ; ; f; } +// */class S__ZIfwFoo___wBar_If extends MixZIfwFoo___wBar_If[C] { ; ; f; } +/* */class S__ZIfwFoo___wBarY__ extends MixZIfwFoo___wBarY__[C] { ; ; f; } +/* */class S__ZIfwFoo___wBarY_f extends MixZIfwFoo___wBarY_f[C] { ; ; f; } +// */class S__ZIfwFoo___wBarYI_ extends MixZIfwFoo___wBarYI_[C] { ; ; f; } +// */class S__ZIfwFoo___wBarYIf extends MixZIfwFoo___wBarYIf[C] { ; ; f; } +/* */class S__ZIfwFoo__f extends MixZIfwFoo__f [C] { ; ; f; } +/* */class S__ZIfwFoo__fwBar___ extends MixZIfwFoo__fwBar___[C] { ; ; f; } +/* */class S__ZIfwFoo__fwBar__f extends MixZIfwFoo__fwBar__f[C] { ; ; f; } +// */class S__ZIfwFoo__fwBar_I_ extends MixZIfwFoo__fwBar_I_[C] { ; ; f; } +// */class S__ZIfwFoo__fwBar_If extends MixZIfwFoo__fwBar_If[C] { ; ; f; } +/* */class S__ZIfwFoo__fwBarY__ extends MixZIfwFoo__fwBarY__[C] { ; ; f; } +/* */class S__ZIfwFoo__fwBarY_f extends MixZIfwFoo__fwBarY_f[C] { ; ; f; } +// */class S__ZIfwFoo__fwBarYI_ extends MixZIfwFoo__fwBarYI_[C] { ; ; f; } +// */class S__ZIfwFoo__fwBarYIf extends MixZIfwFoo__fwBarYIf[C] { ; ; f; } +// */class S__ZIfwFoo_I_ extends MixZIfwFoo_I_ [C] { ; ; f; } +// */class S__ZIfwFoo_I_wBar___ extends MixZIfwFoo_I_wBar___[C] { ; ; f; } +// */class S__ZIfwFoo_I_wBar__f extends MixZIfwFoo_I_wBar__f[C] { ; ; f; } +// */class S__ZIfwFoo_I_wBar_I_ extends MixZIfwFoo_I_wBar_I_[C] { ; ; f; } +// */class S__ZIfwFoo_I_wBar_If extends MixZIfwFoo_I_wBar_If[C] { ; ; f; } +// */class S__ZIfwFoo_I_wBarY__ extends MixZIfwFoo_I_wBarY__[C] { ; ; f; } +// */class S__ZIfwFoo_I_wBarY_f extends MixZIfwFoo_I_wBarY_f[C] { ; ; f; } +// */class S__ZIfwFoo_I_wBarYI_ extends MixZIfwFoo_I_wBarYI_[C] { ; ; f; } +// */class S__ZIfwFoo_I_wBarYIf extends MixZIfwFoo_I_wBarYIf[C] { ; ; f; } +// */class S__ZIfwFoo_If extends MixZIfwFoo_If [C] { ; ; f; } +// */class S__ZIfwFoo_IfwBar___ extends MixZIfwFoo_IfwBar___[C] { ; ; f; } +// */class S__ZIfwFoo_IfwBar__f extends MixZIfwFoo_IfwBar__f[C] { ; ; f; } +// */class S__ZIfwFoo_IfwBar_I_ extends MixZIfwFoo_IfwBar_I_[C] { ; ; f; } +// */class S__ZIfwFoo_IfwBar_If extends MixZIfwFoo_IfwBar_If[C] { ; ; f; } +// */class S__ZIfwFoo_IfwBarY__ extends MixZIfwFoo_IfwBarY__[C] { ; ; f; } +// */class S__ZIfwFoo_IfwBarY_f extends MixZIfwFoo_IfwBarY_f[C] { ; ; f; } +// */class S__ZIfwFoo_IfwBarYI_ extends MixZIfwFoo_IfwBarYI_[C] { ; ; f; } +// */class S__ZIfwFoo_IfwBarYIf extends MixZIfwFoo_IfwBarYIf[C] { ; ; f; } +/* */class S__ZIfwFooX__ extends MixZIfwFooX__ [C] { ; ; f; } +/* */class S__ZIfwFooX__wBar___ extends MixZIfwFooX__wBar___[C] { ; ; f; } +/* */class S__ZIfwFooX__wBar__f extends MixZIfwFooX__wBar__f[C] { ; ; f; } +// */class S__ZIfwFooX__wBar_I_ extends MixZIfwFooX__wBar_I_[C] { ; ; f; } +// */class S__ZIfwFooX__wBar_If extends MixZIfwFooX__wBar_If[C] { ; ; f; } +/* */class S__ZIfwFooX__wBarY__ extends MixZIfwFooX__wBarY__[C] { ; ; f; } +/* */class S__ZIfwFooX__wBarY_f extends MixZIfwFooX__wBarY_f[C] { ; ; f; } +// */class S__ZIfwFooX__wBarYI_ extends MixZIfwFooX__wBarYI_[C] { ; ; f; } +// */class S__ZIfwFooX__wBarYIf extends MixZIfwFooX__wBarYIf[C] { ; ; f; } +/* */class S__ZIfwFooX_f extends MixZIfwFooX_f [C] { ; ; f; } +/* */class S__ZIfwFooX_fwBar___ extends MixZIfwFooX_fwBar___[C] { ; ; f; } +/* */class S__ZIfwFooX_fwBar__f extends MixZIfwFooX_fwBar__f[C] { ; ; f; } +// */class S__ZIfwFooX_fwBar_I_ extends MixZIfwFooX_fwBar_I_[C] { ; ; f; } +// */class S__ZIfwFooX_fwBar_If extends MixZIfwFooX_fwBar_If[C] { ; ; f; } +/* */class S__ZIfwFooX_fwBarY__ extends MixZIfwFooX_fwBarY__[C] { ; ; f; } +/* */class S__ZIfwFooX_fwBarY_f extends MixZIfwFooX_fwBarY_f[C] { ; ; f; } +// */class S__ZIfwFooX_fwBarYI_ extends MixZIfwFooX_fwBarYI_[C] { ; ; f; } +// */class S__ZIfwFooX_fwBarYIf extends MixZIfwFooX_fwBarYIf[C] { ; ; f; } +// */class S__ZIfwFooXI_ extends MixZIfwFooXI_ [C] { ; ; f; } +// */class S__ZIfwFooXI_wBar___ extends MixZIfwFooXI_wBar___[C] { ; ; f; } +// */class S__ZIfwFooXI_wBar__f extends MixZIfwFooXI_wBar__f[C] { ; ; f; } +// */class S__ZIfwFooXI_wBar_I_ extends MixZIfwFooXI_wBar_I_[C] { ; ; f; } +// */class S__ZIfwFooXI_wBar_If extends MixZIfwFooXI_wBar_If[C] { ; ; f; } +// */class S__ZIfwFooXI_wBarY__ extends MixZIfwFooXI_wBarY__[C] { ; ; f; } +// */class S__ZIfwFooXI_wBarY_f extends MixZIfwFooXI_wBarY_f[C] { ; ; f; } +// */class S__ZIfwFooXI_wBarYI_ extends MixZIfwFooXI_wBarYI_[C] { ; ; f; } +// */class S__ZIfwFooXI_wBarYIf extends MixZIfwFooXI_wBarYIf[C] { ; ; f; } +// */class S__ZIfwFooXIf extends MixZIfwFooXIf [C] { ; ; f; } +// */class S__ZIfwFooXIfwBar___ extends MixZIfwFooXIfwBar___[C] { ; ; f; } +// */class S__ZIfwFooXIfwBar__f extends MixZIfwFooXIfwBar__f[C] { ; ; f; } +// */class S__ZIfwFooXIfwBar_I_ extends MixZIfwFooXIfwBar_I_[C] { ; ; f; } +// */class S__ZIfwFooXIfwBar_If extends MixZIfwFooXIfwBar_If[C] { ; ; f; } +// */class S__ZIfwFooXIfwBarY__ extends MixZIfwFooXIfwBarY__[C] { ; ; f; } +// */class S__ZIfwFooXIfwBarY_f extends MixZIfwFooXIfwBarY_f[C] { ; ; f; } +// */class S__ZIfwFooXIfwBarYI_ extends MixZIfwFooXIfwBarYI_[C] { ; ; f; } +// */class S__ZIfwFooXIfwBarYIf extends MixZIfwFooXIfwBarYIf[C] { ; ; f; } + + + +/* */class S_T___eFoo___ [T] extends Mix___eFoo___ { class I; def f: I = {sub; null}; f; } +/* */class S_T___eFoo___wBar___[T] extends Mix___eFoo___wBar___ { class I; def f: I = {sub; null}; f; } +/* */class S_T___eFoo___wBar__f[T] extends Mix___eFoo___wBar__f { class I; ; f; } +/* */class S_T___eFoo___wBar_I_[T] extends Mix___eFoo___wBar_I_ { ; def f: I = {sub; null}; f; } +/* */class S_T___eFoo___wBar_If[T] extends Mix___eFoo___wBar_If { ; ; f; } +/* */class S_T___eFoo___wBarY__[T] extends Mix___eFoo___wBarY__ { class I; def f: I = {sub; null}; f; } +/* */class S_T___eFoo___wBarY_f[T] extends Mix___eFoo___wBarY_f { class I; ; f; } +/* */class S_T___eFoo___wBarYI_[T] extends Mix___eFoo___wBarYI_ { ; def f: I = {sub; null}; f; } +/* */class S_T___eFoo___wBarYIf[T] extends Mix___eFoo___wBarYIf { ; ; f; } +/* */class S_T___eFoo__f [T] extends Mix___eFoo__f { class I; ; f; } +/* */class S_T___eFoo__fwBar___[T] extends Mix___eFoo__fwBar___ { class I; ; f; } +// */class S_T___eFoo__fwBar__f[T] extends Mix___eFoo__fwBar__f { class I; ; f; } +/* */class S_T___eFoo__fwBar_I_[T] extends Mix___eFoo__fwBar_I_ { ; ; f; } +// */class S_T___eFoo__fwBar_If[T] extends Mix___eFoo__fwBar_If { ; ; f; } +/* */class S_T___eFoo__fwBarY__[T] extends Mix___eFoo__fwBarY__ { class I; ; f; } +// */class S_T___eFoo__fwBarY_f[T] extends Mix___eFoo__fwBarY_f { class I; ; f; } +/* */class S_T___eFoo__fwBarYI_[T] extends Mix___eFoo__fwBarYI_ { ; ; f; } +// */class S_T___eFoo__fwBarYIf[T] extends Mix___eFoo__fwBarYIf { ; ; f; } +/* */class S_T___eFoo_I_ [T] extends Mix___eFoo_I_ { ; def f: I = {sub; null}; f; } +/* */class S_T___eFoo_I_wBar___[T] extends Mix___eFoo_I_wBar___ { ; def f: I = {sub; null}; f; } +/* */class S_T___eFoo_I_wBar__f[T] extends Mix___eFoo_I_wBar__f { ; ; f; } +// */class S_T___eFoo_I_wBar_I_[T] extends Mix___eFoo_I_wBar_I_ { ; def f: I = {sub; null}; f; } +// */class S_T___eFoo_I_wBar_If[T] extends Mix___eFoo_I_wBar_If { ; ; f; } +/* */class S_T___eFoo_I_wBarY__[T] extends Mix___eFoo_I_wBarY__ { ; def f: I = {sub; null}; f; } +/* */class S_T___eFoo_I_wBarY_f[T] extends Mix___eFoo_I_wBarY_f { ; ; f; } +// */class S_T___eFoo_I_wBarYI_[T] extends Mix___eFoo_I_wBarYI_ { ; def f: I = {sub; null}; f; } +// */class S_T___eFoo_I_wBarYIf[T] extends Mix___eFoo_I_wBarYIf { ; ; f; } +/* */class S_T___eFoo_If [T] extends Mix___eFoo_If { ; ; f; } +/* */class S_T___eFoo_IfwBar___[T] extends Mix___eFoo_IfwBar___ { ; ; f; } +// */class S_T___eFoo_IfwBar__f[T] extends Mix___eFoo_IfwBar__f { ; ; f; } +// */class S_T___eFoo_IfwBar_I_[T] extends Mix___eFoo_IfwBar_I_ { ; ; f; } +// */class S_T___eFoo_IfwBar_If[T] extends Mix___eFoo_IfwBar_If { ; ; f; } +/* */class S_T___eFoo_IfwBarY__[T] extends Mix___eFoo_IfwBarY__ { ; ; f; } +// */class S_T___eFoo_IfwBarY_f[T] extends Mix___eFoo_IfwBarY_f { ; ; f; } +// */class S_T___eFoo_IfwBarYI_[T] extends Mix___eFoo_IfwBarYI_ { ; ; f; } +// */class S_T___eFoo_IfwBarYIf[T] extends Mix___eFoo_IfwBarYIf { ; ; f; } +/* */class S_T___eFooX__ [T] extends Mix___eFooX__ { class I; def f: I = {sub; null}; f; } +/* */class S_T___eFooX__wBar___[T] extends Mix___eFooX__wBar___ { class I; def f: I = {sub; null}; f; } +/* */class S_T___eFooX__wBar__f[T] extends Mix___eFooX__wBar__f { class I; ; f; } +/* */class S_T___eFooX__wBar_I_[T] extends Mix___eFooX__wBar_I_ { ; def f: I = {sub; null}; f; } +/* */class S_T___eFooX__wBar_If[T] extends Mix___eFooX__wBar_If { ; ; f; } +/* */class S_T___eFooX__wBarY__[T] extends Mix___eFooX__wBarY__ { class I; def f: I = {sub; null}; f; } +/* */class S_T___eFooX__wBarY_f[T] extends Mix___eFooX__wBarY_f { class I; ; f; } +/* */class S_T___eFooX__wBarYI_[T] extends Mix___eFooX__wBarYI_ { ; def f: I = {sub; null}; f; } +/* */class S_T___eFooX__wBarYIf[T] extends Mix___eFooX__wBarYIf { ; ; f; } +/* */class S_T___eFooX_f [T] extends Mix___eFooX_f { class I; ; f; } +/* */class S_T___eFooX_fwBar___[T] extends Mix___eFooX_fwBar___ { class I; ; f; } +// */class S_T___eFooX_fwBar__f[T] extends Mix___eFooX_fwBar__f { class I; ; f; } +/* */class S_T___eFooX_fwBar_I_[T] extends Mix___eFooX_fwBar_I_ { ; ; f; } +// */class S_T___eFooX_fwBar_If[T] extends Mix___eFooX_fwBar_If { ; ; f; } +/* */class S_T___eFooX_fwBarY__[T] extends Mix___eFooX_fwBarY__ { class I; ; f; } +// */class S_T___eFooX_fwBarY_f[T] extends Mix___eFooX_fwBarY_f { class I; ; f; } +/* */class S_T___eFooX_fwBarYI_[T] extends Mix___eFooX_fwBarYI_ { ; ; f; } +// */class S_T___eFooX_fwBarYIf[T] extends Mix___eFooX_fwBarYIf { ; ; f; } +/* */class S_T___eFooXI_ [T] extends Mix___eFooXI_ { ; def f: I = {sub; null}; f; } +/* */class S_T___eFooXI_wBar___[T] extends Mix___eFooXI_wBar___ { ; def f: I = {sub; null}; f; } +/* */class S_T___eFooXI_wBar__f[T] extends Mix___eFooXI_wBar__f { ; ; f; } +// */class S_T___eFooXI_wBar_I_[T] extends Mix___eFooXI_wBar_I_ { ; def f: I = {sub; null}; f; } +// */class S_T___eFooXI_wBar_If[T] extends Mix___eFooXI_wBar_If { ; ; f; } +/* */class S_T___eFooXI_wBarY__[T] extends Mix___eFooXI_wBarY__ { ; def f: I = {sub; null}; f; } +/* */class S_T___eFooXI_wBarY_f[T] extends Mix___eFooXI_wBarY_f { ; ; f; } +// */class S_T___eFooXI_wBarYI_[T] extends Mix___eFooXI_wBarYI_ { ; def f: I = {sub; null}; f; } +// */class S_T___eFooXI_wBarYIf[T] extends Mix___eFooXI_wBarYIf { ; ; f; } +/* */class S_T___eFooXIf [T] extends Mix___eFooXIf { ; ; f; } +/* */class S_T___eFooXIfwBar___[T] extends Mix___eFooXIfwBar___ { ; ; f; } +// */class S_T___eFooXIfwBar__f[T] extends Mix___eFooXIfwBar__f { ; ; f; } +// */class S_T___eFooXIfwBar_I_[T] extends Mix___eFooXIfwBar_I_ { ; ; f; } +// */class S_T___eFooXIfwBar_If[T] extends Mix___eFooXIfwBar_If { ; ; f; } +/* */class S_T___eFooXIfwBarY__[T] extends Mix___eFooXIfwBarY__ { ; ; f; } +// */class S_T___eFooXIfwBarY_f[T] extends Mix___eFooXIfwBarY_f { ; ; f; } +// */class S_T___eFooXIfwBarYI_[T] extends Mix___eFooXIfwBarYI_ { ; ; f; } +// */class S_T___eFooXIfwBarYIf[T] extends Mix___eFooXIfwBarYIf { ; ; f; } + +/* */class S_T__feFoo___ [T] extends Mix__feFoo___ { class I; ; f; } +/* */class S_T__feFoo___wBar___[T] extends Mix__feFoo___wBar___ { class I; ; f; } +/* */class S_T__feFoo___wBar__f[T] extends Mix__feFoo___wBar__f { class I; ; f; } +/* */class S_T__feFoo___wBar_I_[T] extends Mix__feFoo___wBar_I_ { ; ; f; } +/* */class S_T__feFoo___wBar_If[T] extends Mix__feFoo___wBar_If { ; ; f; } +/* */class S_T__feFoo___wBarY__[T] extends Mix__feFoo___wBarY__ { class I; ; f; } +/* */class S_T__feFoo___wBarY_f[T] extends Mix__feFoo___wBarY_f { class I; ; f; } +/* */class S_T__feFoo___wBarYI_[T] extends Mix__feFoo___wBarYI_ { ; ; f; } +/* */class S_T__feFoo___wBarYIf[T] extends Mix__feFoo___wBarYIf { ; ; f; } +/* */class S_T__feFoo__f [T] extends Mix__feFoo__f { class I; ; f; } +/* */class S_T__feFoo__fwBar___[T] extends Mix__feFoo__fwBar___ { class I; ; f; } +/* */class S_T__feFoo__fwBar__f[T] extends Mix__feFoo__fwBar__f { class I; ; f; } +/* */class S_T__feFoo__fwBar_I_[T] extends Mix__feFoo__fwBar_I_ { ; ; f; } +/* */class S_T__feFoo__fwBar_If[T] extends Mix__feFoo__fwBar_If { ; ; f; } +/* */class S_T__feFoo__fwBarY__[T] extends Mix__feFoo__fwBarY__ { class I; ; f; } +/* */class S_T__feFoo__fwBarY_f[T] extends Mix__feFoo__fwBarY_f { class I; ; f; } +/* */class S_T__feFoo__fwBarYI_[T] extends Mix__feFoo__fwBarYI_ { ; ; f; } +/* */class S_T__feFoo__fwBarYIf[T] extends Mix__feFoo__fwBarYIf { ; ; f; } +/* */class S_T__feFoo_I_ [T] extends Mix__feFoo_I_ { ; ; f; } +/* */class S_T__feFoo_I_wBar___[T] extends Mix__feFoo_I_wBar___ { ; ; f; } +/* */class S_T__feFoo_I_wBar__f[T] extends Mix__feFoo_I_wBar__f { ; ; f; } +// */class S_T__feFoo_I_wBar_I_[T] extends Mix__feFoo_I_wBar_I_ { ; ; f; } +// */class S_T__feFoo_I_wBar_If[T] extends Mix__feFoo_I_wBar_If { ; ; f; } +/* */class S_T__feFoo_I_wBarY__[T] extends Mix__feFoo_I_wBarY__ { ; ; f; } +/* */class S_T__feFoo_I_wBarY_f[T] extends Mix__feFoo_I_wBarY_f { ; ; f; } +// */class S_T__feFoo_I_wBarYI_[T] extends Mix__feFoo_I_wBarYI_ { ; ; f; } +// */class S_T__feFoo_I_wBarYIf[T] extends Mix__feFoo_I_wBarYIf { ; ; f; } +/* */class S_T__feFoo_If [T] extends Mix__feFoo_If { ; ; f; } +/* */class S_T__feFoo_IfwBar___[T] extends Mix__feFoo_IfwBar___ { ; ; f; } +/* */class S_T__feFoo_IfwBar__f[T] extends Mix__feFoo_IfwBar__f { ; ; f; } +// */class S_T__feFoo_IfwBar_I_[T] extends Mix__feFoo_IfwBar_I_ { ; ; f; } +// */class S_T__feFoo_IfwBar_If[T] extends Mix__feFoo_IfwBar_If { ; ; f; } +/* */class S_T__feFoo_IfwBarY__[T] extends Mix__feFoo_IfwBarY__ { ; ; f; } +/* */class S_T__feFoo_IfwBarY_f[T] extends Mix__feFoo_IfwBarY_f { ; ; f; } +// */class S_T__feFoo_IfwBarYI_[T] extends Mix__feFoo_IfwBarYI_ { ; ; f; } +// */class S_T__feFoo_IfwBarYIf[T] extends Mix__feFoo_IfwBarYIf { ; ; f; } +/* */class S_T__feFooX__ [T] extends Mix__feFooX__ { class I; ; f; } +/* */class S_T__feFooX__wBar___[T] extends Mix__feFooX__wBar___ { class I; ; f; } +/* */class S_T__feFooX__wBar__f[T] extends Mix__feFooX__wBar__f { class I; ; f; } +/* */class S_T__feFooX__wBar_I_[T] extends Mix__feFooX__wBar_I_ { ; ; f; } +/* */class S_T__feFooX__wBar_If[T] extends Mix__feFooX__wBar_If { ; ; f; } +/* */class S_T__feFooX__wBarY__[T] extends Mix__feFooX__wBarY__ { class I; ; f; } +/* */class S_T__feFooX__wBarY_f[T] extends Mix__feFooX__wBarY_f { class I; ; f; } +/* */class S_T__feFooX__wBarYI_[T] extends Mix__feFooX__wBarYI_ { ; ; f; } +/* */class S_T__feFooX__wBarYIf[T] extends Mix__feFooX__wBarYIf { ; ; f; } +/* */class S_T__feFooX_f [T] extends Mix__feFooX_f { class I; ; f; } +/* */class S_T__feFooX_fwBar___[T] extends Mix__feFooX_fwBar___ { class I; ; f; } +/* */class S_T__feFooX_fwBar__f[T] extends Mix__feFooX_fwBar__f { class I; ; f; } +/* */class S_T__feFooX_fwBar_I_[T] extends Mix__feFooX_fwBar_I_ { ; ; f; } +/* */class S_T__feFooX_fwBar_If[T] extends Mix__feFooX_fwBar_If { ; ; f; } +/* */class S_T__feFooX_fwBarY__[T] extends Mix__feFooX_fwBarY__ { class I; ; f; } +/* */class S_T__feFooX_fwBarY_f[T] extends Mix__feFooX_fwBarY_f { class I; ; f; } +/* */class S_T__feFooX_fwBarYI_[T] extends Mix__feFooX_fwBarYI_ { ; ; f; } +/* */class S_T__feFooX_fwBarYIf[T] extends Mix__feFooX_fwBarYIf { ; ; f; } +/* */class S_T__feFooXI_ [T] extends Mix__feFooXI_ { ; ; f; } +/* */class S_T__feFooXI_wBar___[T] extends Mix__feFooXI_wBar___ { ; ; f; } +/* */class S_T__feFooXI_wBar__f[T] extends Mix__feFooXI_wBar__f { ; ; f; } +// */class S_T__feFooXI_wBar_I_[T] extends Mix__feFooXI_wBar_I_ { ; ; f; } +// */class S_T__feFooXI_wBar_If[T] extends Mix__feFooXI_wBar_If { ; ; f; } +/* */class S_T__feFooXI_wBarY__[T] extends Mix__feFooXI_wBarY__ { ; ; f; } +/* */class S_T__feFooXI_wBarY_f[T] extends Mix__feFooXI_wBarY_f { ; ; f; } +// */class S_T__feFooXI_wBarYI_[T] extends Mix__feFooXI_wBarYI_ { ; ; f; } +// */class S_T__feFooXI_wBarYIf[T] extends Mix__feFooXI_wBarYIf { ; ; f; } +/* */class S_T__feFooXIf [T] extends Mix__feFooXIf { ; ; f; } +/* */class S_T__feFooXIfwBar___[T] extends Mix__feFooXIfwBar___ { ; ; f; } +/* */class S_T__feFooXIfwBar__f[T] extends Mix__feFooXIfwBar__f { ; ; f; } +// */class S_T__feFooXIfwBar_I_[T] extends Mix__feFooXIfwBar_I_ { ; ; f; } +// */class S_T__feFooXIfwBar_If[T] extends Mix__feFooXIfwBar_If { ; ; f; } +/* */class S_T__feFooXIfwBarY__[T] extends Mix__feFooXIfwBarY__ { ; ; f; } +/* */class S_T__feFooXIfwBarY_f[T] extends Mix__feFooXIfwBarY_f { ; ; f; } +// */class S_T__feFooXIfwBarYI_[T] extends Mix__feFooXIfwBarYI_ { ; ; f; } +// */class S_T__feFooXIfwBarYIf[T] extends Mix__feFooXIfwBarYIf { ; ; f; } + +/* */class S_T_I_eFoo___ [T] extends Mix_I_eFoo___ { ; def f: I = {sub; null}; f; } +/* */class S_T_I_eFoo___wBar___[T] extends Mix_I_eFoo___wBar___ { ; def f: I = {sub; null}; f; } +/* */class S_T_I_eFoo___wBar__f[T] extends Mix_I_eFoo___wBar__f { ; ; f; } +// */class S_T_I_eFoo___wBar_I_[T] extends Mix_I_eFoo___wBar_I_ { ; def f: I = {sub; null}; f; } +// */class S_T_I_eFoo___wBar_If[T] extends Mix_I_eFoo___wBar_If { ; ; f; } +/* */class S_T_I_eFoo___wBarY__[T] extends Mix_I_eFoo___wBarY__ { ; def f: I = {sub; null}; f; } +/* */class S_T_I_eFoo___wBarY_f[T] extends Mix_I_eFoo___wBarY_f { ; ; f; } +// */class S_T_I_eFoo___wBarYI_[T] extends Mix_I_eFoo___wBarYI_ { ; def f: I = {sub; null}; f; } +// */class S_T_I_eFoo___wBarYIf[T] extends Mix_I_eFoo___wBarYIf { ; ; f; } +/* */class S_T_I_eFoo__f [T] extends Mix_I_eFoo__f { ; ; f; } +/* */class S_T_I_eFoo__fwBar___[T] extends Mix_I_eFoo__fwBar___ { ; ; f; } +// */class S_T_I_eFoo__fwBar__f[T] extends Mix_I_eFoo__fwBar__f { ; ; f; } +// */class S_T_I_eFoo__fwBar_I_[T] extends Mix_I_eFoo__fwBar_I_ { ; ; f; } +// */class S_T_I_eFoo__fwBar_If[T] extends Mix_I_eFoo__fwBar_If { ; ; f; } +/* */class S_T_I_eFoo__fwBarY__[T] extends Mix_I_eFoo__fwBarY__ { ; ; f; } +// */class S_T_I_eFoo__fwBarY_f[T] extends Mix_I_eFoo__fwBarY_f { ; ; f; } +// */class S_T_I_eFoo__fwBarYI_[T] extends Mix_I_eFoo__fwBarYI_ { ; ; f; } +// */class S_T_I_eFoo__fwBarYIf[T] extends Mix_I_eFoo__fwBarYIf { ; ; f; } +// */class S_T_I_eFoo_I_ [T] extends Mix_I_eFoo_I_ { ; def f: I = {sub; null}; f; } +// */class S_T_I_eFoo_I_wBar___[T] extends Mix_I_eFoo_I_wBar___ { ; def f: I = {sub; null}; f; } +// */class S_T_I_eFoo_I_wBar__f[T] extends Mix_I_eFoo_I_wBar__f { ; ; f; } +// */class S_T_I_eFoo_I_wBar_I_[T] extends Mix_I_eFoo_I_wBar_I_ { ; def f: I = {sub; null}; f; } +// */class S_T_I_eFoo_I_wBar_If[T] extends Mix_I_eFoo_I_wBar_If { ; ; f; } +// */class S_T_I_eFoo_I_wBarY__[T] extends Mix_I_eFoo_I_wBarY__ { ; def f: I = {sub; null}; f; } +// */class S_T_I_eFoo_I_wBarY_f[T] extends Mix_I_eFoo_I_wBarY_f { ; ; f; } +// */class S_T_I_eFoo_I_wBarYI_[T] extends Mix_I_eFoo_I_wBarYI_ { ; def f: I = {sub; null}; f; } +// */class S_T_I_eFoo_I_wBarYIf[T] extends Mix_I_eFoo_I_wBarYIf { ; ; f; } +// */class S_T_I_eFoo_If [T] extends Mix_I_eFoo_If { ; ; f; } +// */class S_T_I_eFoo_IfwBar___[T] extends Mix_I_eFoo_IfwBar___ { ; ; f; } +// */class S_T_I_eFoo_IfwBar__f[T] extends Mix_I_eFoo_IfwBar__f { ; ; f; } +// */class S_T_I_eFoo_IfwBar_I_[T] extends Mix_I_eFoo_IfwBar_I_ { ; ; f; } +// */class S_T_I_eFoo_IfwBar_If[T] extends Mix_I_eFoo_IfwBar_If { ; ; f; } +// */class S_T_I_eFoo_IfwBarY__[T] extends Mix_I_eFoo_IfwBarY__ { ; ; f; } +// */class S_T_I_eFoo_IfwBarY_f[T] extends Mix_I_eFoo_IfwBarY_f { ; ; f; } +// */class S_T_I_eFoo_IfwBarYI_[T] extends Mix_I_eFoo_IfwBarYI_ { ; ; f; } +// */class S_T_I_eFoo_IfwBarYIf[T] extends Mix_I_eFoo_IfwBarYIf { ; ; f; } +/* */class S_T_I_eFooX__ [T] extends Mix_I_eFooX__ { ; def f: I = {sub; null}; f; } +/* */class S_T_I_eFooX__wBar___[T] extends Mix_I_eFooX__wBar___ { ; def f: I = {sub; null}; f; } +/* */class S_T_I_eFooX__wBar__f[T] extends Mix_I_eFooX__wBar__f { ; ; f; } +// */class S_T_I_eFooX__wBar_I_[T] extends Mix_I_eFooX__wBar_I_ { ; def f: I = {sub; null}; f; } +// */class S_T_I_eFooX__wBar_If[T] extends Mix_I_eFooX__wBar_If { ; ; f; } +/* */class S_T_I_eFooX__wBarY__[T] extends Mix_I_eFooX__wBarY__ { ; def f: I = {sub; null}; f; } +/* */class S_T_I_eFooX__wBarY_f[T] extends Mix_I_eFooX__wBarY_f { ; ; f; } +// */class S_T_I_eFooX__wBarYI_[T] extends Mix_I_eFooX__wBarYI_ { ; def f: I = {sub; null}; f; } +// */class S_T_I_eFooX__wBarYIf[T] extends Mix_I_eFooX__wBarYIf { ; ; f; } +/* */class S_T_I_eFooX_f [T] extends Mix_I_eFooX_f { ; ; f; } +/* */class S_T_I_eFooX_fwBar___[T] extends Mix_I_eFooX_fwBar___ { ; ; f; } +// */class S_T_I_eFooX_fwBar__f[T] extends Mix_I_eFooX_fwBar__f { ; ; f; } +// */class S_T_I_eFooX_fwBar_I_[T] extends Mix_I_eFooX_fwBar_I_ { ; ; f; } +// */class S_T_I_eFooX_fwBar_If[T] extends Mix_I_eFooX_fwBar_If { ; ; f; } +/* */class S_T_I_eFooX_fwBarY__[T] extends Mix_I_eFooX_fwBarY__ { ; ; f; } +// */class S_T_I_eFooX_fwBarY_f[T] extends Mix_I_eFooX_fwBarY_f { ; ; f; } +// */class S_T_I_eFooX_fwBarYI_[T] extends Mix_I_eFooX_fwBarYI_ { ; ; f; } +// */class S_T_I_eFooX_fwBarYIf[T] extends Mix_I_eFooX_fwBarYIf { ; ; f; } +// */class S_T_I_eFooXI_ [T] extends Mix_I_eFooXI_ { ; def f: I = {sub; null}; f; } +// */class S_T_I_eFooXI_wBar___[T] extends Mix_I_eFooXI_wBar___ { ; def f: I = {sub; null}; f; } +// */class S_T_I_eFooXI_wBar__f[T] extends Mix_I_eFooXI_wBar__f { ; ; f; } +// */class S_T_I_eFooXI_wBar_I_[T] extends Mix_I_eFooXI_wBar_I_ { ; def f: I = {sub; null}; f; } +// */class S_T_I_eFooXI_wBar_If[T] extends Mix_I_eFooXI_wBar_If { ; ; f; } +// */class S_T_I_eFooXI_wBarY__[T] extends Mix_I_eFooXI_wBarY__ { ; def f: I = {sub; null}; f; } +// */class S_T_I_eFooXI_wBarY_f[T] extends Mix_I_eFooXI_wBarY_f { ; ; f; } +// */class S_T_I_eFooXI_wBarYI_[T] extends Mix_I_eFooXI_wBarYI_ { ; def f: I = {sub; null}; f; } +// */class S_T_I_eFooXI_wBarYIf[T] extends Mix_I_eFooXI_wBarYIf { ; ; f; } +// */class S_T_I_eFooXIf [T] extends Mix_I_eFooXIf { ; ; f; } +// */class S_T_I_eFooXIfwBar___[T] extends Mix_I_eFooXIfwBar___ { ; ; f; } +// */class S_T_I_eFooXIfwBar__f[T] extends Mix_I_eFooXIfwBar__f { ; ; f; } +// */class S_T_I_eFooXIfwBar_I_[T] extends Mix_I_eFooXIfwBar_I_ { ; ; f; } +// */class S_T_I_eFooXIfwBar_If[T] extends Mix_I_eFooXIfwBar_If { ; ; f; } +// */class S_T_I_eFooXIfwBarY__[T] extends Mix_I_eFooXIfwBarY__ { ; ; f; } +// */class S_T_I_eFooXIfwBarY_f[T] extends Mix_I_eFooXIfwBarY_f { ; ; f; } +// */class S_T_I_eFooXIfwBarYI_[T] extends Mix_I_eFooXIfwBarYI_ { ; ; f; } +// */class S_T_I_eFooXIfwBarYIf[T] extends Mix_I_eFooXIfwBarYIf { ; ; f; } + +/* */class S_T_IfeFoo___ [T] extends Mix_IfeFoo___ { ; ; f; } +/* */class S_T_IfeFoo___wBar___[T] extends Mix_IfeFoo___wBar___ { ; ; f; } +/* */class S_T_IfeFoo___wBar__f[T] extends Mix_IfeFoo___wBar__f { ; ; f; } +// */class S_T_IfeFoo___wBar_I_[T] extends Mix_IfeFoo___wBar_I_ { ; ; f; } +// */class S_T_IfeFoo___wBar_If[T] extends Mix_IfeFoo___wBar_If { ; ; f; } +/* */class S_T_IfeFoo___wBarY__[T] extends Mix_IfeFoo___wBarY__ { ; ; f; } +/* */class S_T_IfeFoo___wBarY_f[T] extends Mix_IfeFoo___wBarY_f { ; ; f; } +// */class S_T_IfeFoo___wBarYI_[T] extends Mix_IfeFoo___wBarYI_ { ; ; f; } +// */class S_T_IfeFoo___wBarYIf[T] extends Mix_IfeFoo___wBarYIf { ; ; f; } +/* */class S_T_IfeFoo__f [T] extends Mix_IfeFoo__f { ; ; f; } +/* */class S_T_IfeFoo__fwBar___[T] extends Mix_IfeFoo__fwBar___ { ; ; f; } +/* */class S_T_IfeFoo__fwBar__f[T] extends Mix_IfeFoo__fwBar__f { ; ; f; } +// */class S_T_IfeFoo__fwBar_I_[T] extends Mix_IfeFoo__fwBar_I_ { ; ; f; } +// */class S_T_IfeFoo__fwBar_If[T] extends Mix_IfeFoo__fwBar_If { ; ; f; } +/* */class S_T_IfeFoo__fwBarY__[T] extends Mix_IfeFoo__fwBarY__ { ; ; f; } +/* */class S_T_IfeFoo__fwBarY_f[T] extends Mix_IfeFoo__fwBarY_f { ; ; f; } +// */class S_T_IfeFoo__fwBarYI_[T] extends Mix_IfeFoo__fwBarYI_ { ; ; f; } +// */class S_T_IfeFoo__fwBarYIf[T] extends Mix_IfeFoo__fwBarYIf { ; ; f; } +// */class S_T_IfeFoo_I_ [T] extends Mix_IfeFoo_I_ { ; ; f; } +// */class S_T_IfeFoo_I_wBar___[T] extends Mix_IfeFoo_I_wBar___ { ; ; f; } +// */class S_T_IfeFoo_I_wBar__f[T] extends Mix_IfeFoo_I_wBar__f { ; ; f; } +// */class S_T_IfeFoo_I_wBar_I_[T] extends Mix_IfeFoo_I_wBar_I_ { ; ; f; } +// */class S_T_IfeFoo_I_wBar_If[T] extends Mix_IfeFoo_I_wBar_If { ; ; f; } +// */class S_T_IfeFoo_I_wBarY__[T] extends Mix_IfeFoo_I_wBarY__ { ; ; f; } +// */class S_T_IfeFoo_I_wBarY_f[T] extends Mix_IfeFoo_I_wBarY_f { ; ; f; } +// */class S_T_IfeFoo_I_wBarYI_[T] extends Mix_IfeFoo_I_wBarYI_ { ; ; f; } +// */class S_T_IfeFoo_I_wBarYIf[T] extends Mix_IfeFoo_I_wBarYIf { ; ; f; } +// */class S_T_IfeFoo_If [T] extends Mix_IfeFoo_If { ; ; f; } +// */class S_T_IfeFoo_IfwBar___[T] extends Mix_IfeFoo_IfwBar___ { ; ; f; } +// */class S_T_IfeFoo_IfwBar__f[T] extends Mix_IfeFoo_IfwBar__f { ; ; f; } +// */class S_T_IfeFoo_IfwBar_I_[T] extends Mix_IfeFoo_IfwBar_I_ { ; ; f; } +// */class S_T_IfeFoo_IfwBar_If[T] extends Mix_IfeFoo_IfwBar_If { ; ; f; } +// */class S_T_IfeFoo_IfwBarY__[T] extends Mix_IfeFoo_IfwBarY__ { ; ; f; } +// */class S_T_IfeFoo_IfwBarY_f[T] extends Mix_IfeFoo_IfwBarY_f { ; ; f; } +// */class S_T_IfeFoo_IfwBarYI_[T] extends Mix_IfeFoo_IfwBarYI_ { ; ; f; } +// */class S_T_IfeFoo_IfwBarYIf[T] extends Mix_IfeFoo_IfwBarYIf { ; ; f; } +/* */class S_T_IfeFooX__ [T] extends Mix_IfeFooX__ { ; ; f; } +/* */class S_T_IfeFooX__wBar___[T] extends Mix_IfeFooX__wBar___ { ; ; f; } +/* */class S_T_IfeFooX__wBar__f[T] extends Mix_IfeFooX__wBar__f { ; ; f; } +// */class S_T_IfeFooX__wBar_I_[T] extends Mix_IfeFooX__wBar_I_ { ; ; f; } +// */class S_T_IfeFooX__wBar_If[T] extends Mix_IfeFooX__wBar_If { ; ; f; } +/* */class S_T_IfeFooX__wBarY__[T] extends Mix_IfeFooX__wBarY__ { ; ; f; } +/* */class S_T_IfeFooX__wBarY_f[T] extends Mix_IfeFooX__wBarY_f { ; ; f; } +// */class S_T_IfeFooX__wBarYI_[T] extends Mix_IfeFooX__wBarYI_ { ; ; f; } +// */class S_T_IfeFooX__wBarYIf[T] extends Mix_IfeFooX__wBarYIf { ; ; f; } +/* */class S_T_IfeFooX_f [T] extends Mix_IfeFooX_f { ; ; f; } +/* */class S_T_IfeFooX_fwBar___[T] extends Mix_IfeFooX_fwBar___ { ; ; f; } +/* */class S_T_IfeFooX_fwBar__f[T] extends Mix_IfeFooX_fwBar__f { ; ; f; } +// */class S_T_IfeFooX_fwBar_I_[T] extends Mix_IfeFooX_fwBar_I_ { ; ; f; } +// */class S_T_IfeFooX_fwBar_If[T] extends Mix_IfeFooX_fwBar_If { ; ; f; } +/* */class S_T_IfeFooX_fwBarY__[T] extends Mix_IfeFooX_fwBarY__ { ; ; f; } +/* */class S_T_IfeFooX_fwBarY_f[T] extends Mix_IfeFooX_fwBarY_f { ; ; f; } +// */class S_T_IfeFooX_fwBarYI_[T] extends Mix_IfeFooX_fwBarYI_ { ; ; f; } +// */class S_T_IfeFooX_fwBarYIf[T] extends Mix_IfeFooX_fwBarYIf { ; ; f; } +// */class S_T_IfeFooXI_ [T] extends Mix_IfeFooXI_ { ; ; f; } +// */class S_T_IfeFooXI_wBar___[T] extends Mix_IfeFooXI_wBar___ { ; ; f; } +// */class S_T_IfeFooXI_wBar__f[T] extends Mix_IfeFooXI_wBar__f { ; ; f; } +// */class S_T_IfeFooXI_wBar_I_[T] extends Mix_IfeFooXI_wBar_I_ { ; ; f; } +// */class S_T_IfeFooXI_wBar_If[T] extends Mix_IfeFooXI_wBar_If { ; ; f; } +// */class S_T_IfeFooXI_wBarY__[T] extends Mix_IfeFooXI_wBarY__ { ; ; f; } +// */class S_T_IfeFooXI_wBarY_f[T] extends Mix_IfeFooXI_wBarY_f { ; ; f; } +// */class S_T_IfeFooXI_wBarYI_[T] extends Mix_IfeFooXI_wBarYI_ { ; ; f; } +// */class S_T_IfeFooXI_wBarYIf[T] extends Mix_IfeFooXI_wBarYIf { ; ; f; } +// */class S_T_IfeFooXIf [T] extends Mix_IfeFooXIf { ; ; f; } +// */class S_T_IfeFooXIfwBar___[T] extends Mix_IfeFooXIfwBar___ { ; ; f; } +// */class S_T_IfeFooXIfwBar__f[T] extends Mix_IfeFooXIfwBar__f { ; ; f; } +// */class S_T_IfeFooXIfwBar_I_[T] extends Mix_IfeFooXIfwBar_I_ { ; ; f; } +// */class S_T_IfeFooXIfwBar_If[T] extends Mix_IfeFooXIfwBar_If { ; ; f; } +// */class S_T_IfeFooXIfwBarY__[T] extends Mix_IfeFooXIfwBarY__ { ; ; f; } +// */class S_T_IfeFooXIfwBarY_f[T] extends Mix_IfeFooXIfwBarY_f { ; ; f; } +// */class S_T_IfeFooXIfwBarYI_[T] extends Mix_IfeFooXIfwBarYI_ { ; ; f; } +// */class S_T_IfeFooXIfwBarYIf[T] extends Mix_IfeFooXIfwBarYIf { ; ; f; } + +/* */class S_TZ__eFoo___ [T] extends MixZ__eFoo___ [C] { class I; def f: I = {sub; null}; f; } +/* */class S_TZ__eFoo___wBar___[T] extends MixZ__eFoo___wBar___[C] { class I; def f: I = {sub; null}; f; } +/* */class S_TZ__eFoo___wBar__f[T] extends MixZ__eFoo___wBar__f[C] { class I; ; f; } +/* */class S_TZ__eFoo___wBar_I_[T] extends MixZ__eFoo___wBar_I_[C] { ; def f: I = {sub; null}; f; } +/* */class S_TZ__eFoo___wBar_If[T] extends MixZ__eFoo___wBar_If[C] { ; ; f; } +/* */class S_TZ__eFoo___wBarY__[T] extends MixZ__eFoo___wBarY__[C] { class I; def f: I = {sub; null}; f; } +/* */class S_TZ__eFoo___wBarY_f[T] extends MixZ__eFoo___wBarY_f[C] { class I; ; f; } +/* */class S_TZ__eFoo___wBarYI_[T] extends MixZ__eFoo___wBarYI_[C] { ; def f: I = {sub; null}; f; } +/* */class S_TZ__eFoo___wBarYIf[T] extends MixZ__eFoo___wBarYIf[C] { ; ; f; } +/* */class S_TZ__eFoo__f [T] extends MixZ__eFoo__f [C] { class I; ; f; } +/* */class S_TZ__eFoo__fwBar___[T] extends MixZ__eFoo__fwBar___[C] { class I; ; f; } +// */class S_TZ__eFoo__fwBar__f[T] extends MixZ__eFoo__fwBar__f[C] { class I; ; f; } +/* */class S_TZ__eFoo__fwBar_I_[T] extends MixZ__eFoo__fwBar_I_[C] { ; ; f; } +// */class S_TZ__eFoo__fwBar_If[T] extends MixZ__eFoo__fwBar_If[C] { ; ; f; } +/* */class S_TZ__eFoo__fwBarY__[T] extends MixZ__eFoo__fwBarY__[C] { class I; ; f; } +// */class S_TZ__eFoo__fwBarY_f[T] extends MixZ__eFoo__fwBarY_f[C] { class I; ; f; } +/* */class S_TZ__eFoo__fwBarYI_[T] extends MixZ__eFoo__fwBarYI_[C] { ; ; f; } +// */class S_TZ__eFoo__fwBarYIf[T] extends MixZ__eFoo__fwBarYIf[C] { ; ; f; } +/* */class S_TZ__eFoo_I_ [T] extends MixZ__eFoo_I_ [C] { ; def f: I = {sub; null}; f; } +/* */class S_TZ__eFoo_I_wBar___[T] extends MixZ__eFoo_I_wBar___[C] { ; def f: I = {sub; null}; f; } +/* */class S_TZ__eFoo_I_wBar__f[T] extends MixZ__eFoo_I_wBar__f[C] { ; ; f; } +// */class S_TZ__eFoo_I_wBar_I_[T] extends MixZ__eFoo_I_wBar_I_[C] { ; def f: I = {sub; null}; f; } +// */class S_TZ__eFoo_I_wBar_If[T] extends MixZ__eFoo_I_wBar_If[C] { ; ; f; } +/* */class S_TZ__eFoo_I_wBarY__[T] extends MixZ__eFoo_I_wBarY__[C] { ; def f: I = {sub; null}; f; } +/* */class S_TZ__eFoo_I_wBarY_f[T] extends MixZ__eFoo_I_wBarY_f[C] { ; ; f; } +// */class S_TZ__eFoo_I_wBarYI_[T] extends MixZ__eFoo_I_wBarYI_[C] { ; def f: I = {sub; null}; f; } +// */class S_TZ__eFoo_I_wBarYIf[T] extends MixZ__eFoo_I_wBarYIf[C] { ; ; f; } +/* */class S_TZ__eFoo_If [T] extends MixZ__eFoo_If [C] { ; ; f; } +/* */class S_TZ__eFoo_IfwBar___[T] extends MixZ__eFoo_IfwBar___[C] { ; ; f; } +// */class S_TZ__eFoo_IfwBar__f[T] extends MixZ__eFoo_IfwBar__f[C] { ; ; f; } +// */class S_TZ__eFoo_IfwBar_I_[T] extends MixZ__eFoo_IfwBar_I_[C] { ; ; f; } +// */class S_TZ__eFoo_IfwBar_If[T] extends MixZ__eFoo_IfwBar_If[C] { ; ; f; } +/* */class S_TZ__eFoo_IfwBarY__[T] extends MixZ__eFoo_IfwBarY__[C] { ; ; f; } +// */class S_TZ__eFoo_IfwBarY_f[T] extends MixZ__eFoo_IfwBarY_f[C] { ; ; f; } +// */class S_TZ__eFoo_IfwBarYI_[T] extends MixZ__eFoo_IfwBarYI_[C] { ; ; f; } +// */class S_TZ__eFoo_IfwBarYIf[T] extends MixZ__eFoo_IfwBarYIf[C] { ; ; f; } +/* */class S_TZ__eFooX__ [T] extends MixZ__eFooX__ [C] { class I; def f: I = {sub; null}; f; } +/* */class S_TZ__eFooX__wBar___[T] extends MixZ__eFooX__wBar___[C] { class I; def f: I = {sub; null}; f; } +/* */class S_TZ__eFooX__wBar__f[T] extends MixZ__eFooX__wBar__f[C] { class I; ; f; } +/* */class S_TZ__eFooX__wBar_I_[T] extends MixZ__eFooX__wBar_I_[C] { ; def f: I = {sub; null}; f; } +/* */class S_TZ__eFooX__wBar_If[T] extends MixZ__eFooX__wBar_If[C] { ; ; f; } +/* */class S_TZ__eFooX__wBarY__[T] extends MixZ__eFooX__wBarY__[C] { class I; def f: I = {sub; null}; f; } +/* */class S_TZ__eFooX__wBarY_f[T] extends MixZ__eFooX__wBarY_f[C] { class I; ; f; } +/* */class S_TZ__eFooX__wBarYI_[T] extends MixZ__eFooX__wBarYI_[C] { ; def f: I = {sub; null}; f; } +/* */class S_TZ__eFooX__wBarYIf[T] extends MixZ__eFooX__wBarYIf[C] { ; ; f; } +/* */class S_TZ__eFooX_f [T] extends MixZ__eFooX_f [C] { class I; ; f; } +/* */class S_TZ__eFooX_fwBar___[T] extends MixZ__eFooX_fwBar___[C] { class I; ; f; } +// */class S_TZ__eFooX_fwBar__f[T] extends MixZ__eFooX_fwBar__f[C] { class I; ; f; } +/* */class S_TZ__eFooX_fwBar_I_[T] extends MixZ__eFooX_fwBar_I_[C] { ; ; f; } +// */class S_TZ__eFooX_fwBar_If[T] extends MixZ__eFooX_fwBar_If[C] { ; ; f; } +/* */class S_TZ__eFooX_fwBarY__[T] extends MixZ__eFooX_fwBarY__[C] { class I; ; f; } +// */class S_TZ__eFooX_fwBarY_f[T] extends MixZ__eFooX_fwBarY_f[C] { class I; ; f; } +/* */class S_TZ__eFooX_fwBarYI_[T] extends MixZ__eFooX_fwBarYI_[C] { ; ; f; } +// */class S_TZ__eFooX_fwBarYIf[T] extends MixZ__eFooX_fwBarYIf[C] { ; ; f; } +/* */class S_TZ__eFooXI_ [T] extends MixZ__eFooXI_ [C] { ; def f: I = {sub; null}; f; } +/* */class S_TZ__eFooXI_wBar___[T] extends MixZ__eFooXI_wBar___[C] { ; def f: I = {sub; null}; f; } +/* */class S_TZ__eFooXI_wBar__f[T] extends MixZ__eFooXI_wBar__f[C] { ; ; f; } +// */class S_TZ__eFooXI_wBar_I_[T] extends MixZ__eFooXI_wBar_I_[C] { ; def f: I = {sub; null}; f; } +// */class S_TZ__eFooXI_wBar_If[T] extends MixZ__eFooXI_wBar_If[C] { ; ; f; } +/* */class S_TZ__eFooXI_wBarY__[T] extends MixZ__eFooXI_wBarY__[C] { ; def f: I = {sub; null}; f; } +/* */class S_TZ__eFooXI_wBarY_f[T] extends MixZ__eFooXI_wBarY_f[C] { ; ; f; } +// */class S_TZ__eFooXI_wBarYI_[T] extends MixZ__eFooXI_wBarYI_[C] { ; def f: I = {sub; null}; f; } +// */class S_TZ__eFooXI_wBarYIf[T] extends MixZ__eFooXI_wBarYIf[C] { ; ; f; } +/* */class S_TZ__eFooXIf [T] extends MixZ__eFooXIf [C] { ; ; f; } +/* */class S_TZ__eFooXIfwBar___[T] extends MixZ__eFooXIfwBar___[C] { ; ; f; } +// */class S_TZ__eFooXIfwBar__f[T] extends MixZ__eFooXIfwBar__f[C] { ; ; f; } +// */class S_TZ__eFooXIfwBar_I_[T] extends MixZ__eFooXIfwBar_I_[C] { ; ; f; } +// */class S_TZ__eFooXIfwBar_If[T] extends MixZ__eFooXIfwBar_If[C] { ; ; f; } +/* */class S_TZ__eFooXIfwBarY__[T] extends MixZ__eFooXIfwBarY__[C] { ; ; f; } +// */class S_TZ__eFooXIfwBarY_f[T] extends MixZ__eFooXIfwBarY_f[C] { ; ; f; } +// */class S_TZ__eFooXIfwBarYI_[T] extends MixZ__eFooXIfwBarYI_[C] { ; ; f; } +// */class S_TZ__eFooXIfwBarYIf[T] extends MixZ__eFooXIfwBarYIf[C] { ; ; f; } + +/* */class S_TZ_feFoo___ [T] extends MixZ_feFoo___ [C] { class I; ; f; } +/* */class S_TZ_feFoo___wBar___[T] extends MixZ_feFoo___wBar___[C] { class I; ; f; } +/* */class S_TZ_feFoo___wBar__f[T] extends MixZ_feFoo___wBar__f[C] { class I; ; f; } +/* */class S_TZ_feFoo___wBar_I_[T] extends MixZ_feFoo___wBar_I_[C] { ; ; f; } +/* */class S_TZ_feFoo___wBar_If[T] extends MixZ_feFoo___wBar_If[C] { ; ; f; } +/* */class S_TZ_feFoo___wBarY__[T] extends MixZ_feFoo___wBarY__[C] { class I; ; f; } +/* */class S_TZ_feFoo___wBarY_f[T] extends MixZ_feFoo___wBarY_f[C] { class I; ; f; } +/* */class S_TZ_feFoo___wBarYI_[T] extends MixZ_feFoo___wBarYI_[C] { ; ; f; } +/* */class S_TZ_feFoo___wBarYIf[T] extends MixZ_feFoo___wBarYIf[C] { ; ; f; } +/* */class S_TZ_feFoo__f [T] extends MixZ_feFoo__f [C] { class I; ; f; } +/* */class S_TZ_feFoo__fwBar___[T] extends MixZ_feFoo__fwBar___[C] { class I; ; f; } +/* */class S_TZ_feFoo__fwBar__f[T] extends MixZ_feFoo__fwBar__f[C] { class I; ; f; } +/* */class S_TZ_feFoo__fwBar_I_[T] extends MixZ_feFoo__fwBar_I_[C] { ; ; f; } +/* */class S_TZ_feFoo__fwBar_If[T] extends MixZ_feFoo__fwBar_If[C] { ; ; f; } +/* */class S_TZ_feFoo__fwBarY__[T] extends MixZ_feFoo__fwBarY__[C] { class I; ; f; } +/* */class S_TZ_feFoo__fwBarY_f[T] extends MixZ_feFoo__fwBarY_f[C] { class I; ; f; } +/* */class S_TZ_feFoo__fwBarYI_[T] extends MixZ_feFoo__fwBarYI_[C] { ; ; f; } +/* */class S_TZ_feFoo__fwBarYIf[T] extends MixZ_feFoo__fwBarYIf[C] { ; ; f; } +/* */class S_TZ_feFoo_I_ [T] extends MixZ_feFoo_I_ [C] { ; ; f; } +/* */class S_TZ_feFoo_I_wBar___[T] extends MixZ_feFoo_I_wBar___[C] { ; ; f; } +/* */class S_TZ_feFoo_I_wBar__f[T] extends MixZ_feFoo_I_wBar__f[C] { ; ; f; } +// */class S_TZ_feFoo_I_wBar_I_[T] extends MixZ_feFoo_I_wBar_I_[C] { ; ; f; } +// */class S_TZ_feFoo_I_wBar_If[T] extends MixZ_feFoo_I_wBar_If[C] { ; ; f; } +/* */class S_TZ_feFoo_I_wBarY__[T] extends MixZ_feFoo_I_wBarY__[C] { ; ; f; } +/* */class S_TZ_feFoo_I_wBarY_f[T] extends MixZ_feFoo_I_wBarY_f[C] { ; ; f; } +// */class S_TZ_feFoo_I_wBarYI_[T] extends MixZ_feFoo_I_wBarYI_[C] { ; ; f; } +// */class S_TZ_feFoo_I_wBarYIf[T] extends MixZ_feFoo_I_wBarYIf[C] { ; ; f; } +/* */class S_TZ_feFoo_If [T] extends MixZ_feFoo_If [C] { ; ; f; } +/* */class S_TZ_feFoo_IfwBar___[T] extends MixZ_feFoo_IfwBar___[C] { ; ; f; } +/* */class S_TZ_feFoo_IfwBar__f[T] extends MixZ_feFoo_IfwBar__f[C] { ; ; f; } +// */class S_TZ_feFoo_IfwBar_I_[T] extends MixZ_feFoo_IfwBar_I_[C] { ; ; f; } +// */class S_TZ_feFoo_IfwBar_If[T] extends MixZ_feFoo_IfwBar_If[C] { ; ; f; } +/* */class S_TZ_feFoo_IfwBarY__[T] extends MixZ_feFoo_IfwBarY__[C] { ; ; f; } +/* */class S_TZ_feFoo_IfwBarY_f[T] extends MixZ_feFoo_IfwBarY_f[C] { ; ; f; } +// */class S_TZ_feFoo_IfwBarYI_[T] extends MixZ_feFoo_IfwBarYI_[C] { ; ; f; } +// */class S_TZ_feFoo_IfwBarYIf[T] extends MixZ_feFoo_IfwBarYIf[C] { ; ; f; } +/* */class S_TZ_feFooX__ [T] extends MixZ_feFooX__ [C] { class I; ; f; } +/* */class S_TZ_feFooX__wBar___[T] extends MixZ_feFooX__wBar___[C] { class I; ; f; } +/* */class S_TZ_feFooX__wBar__f[T] extends MixZ_feFooX__wBar__f[C] { class I; ; f; } +/* */class S_TZ_feFooX__wBar_I_[T] extends MixZ_feFooX__wBar_I_[C] { ; ; f; } +/* */class S_TZ_feFooX__wBar_If[T] extends MixZ_feFooX__wBar_If[C] { ; ; f; } +/* */class S_TZ_feFooX__wBarY__[T] extends MixZ_feFooX__wBarY__[C] { class I; ; f; } +/* */class S_TZ_feFooX__wBarY_f[T] extends MixZ_feFooX__wBarY_f[C] { class I; ; f; } +/* */class S_TZ_feFooX__wBarYI_[T] extends MixZ_feFooX__wBarYI_[C] { ; ; f; } +/* */class S_TZ_feFooX__wBarYIf[T] extends MixZ_feFooX__wBarYIf[C] { ; ; f; } +/* */class S_TZ_feFooX_f [T] extends MixZ_feFooX_f [C] { class I; ; f; } +/* */class S_TZ_feFooX_fwBar___[T] extends MixZ_feFooX_fwBar___[C] { class I; ; f; } +/* */class S_TZ_feFooX_fwBar__f[T] extends MixZ_feFooX_fwBar__f[C] { class I; ; f; } +/* */class S_TZ_feFooX_fwBar_I_[T] extends MixZ_feFooX_fwBar_I_[C] { ; ; f; } +/* */class S_TZ_feFooX_fwBar_If[T] extends MixZ_feFooX_fwBar_If[C] { ; ; f; } +/* */class S_TZ_feFooX_fwBarY__[T] extends MixZ_feFooX_fwBarY__[C] { class I; ; f; } +/* */class S_TZ_feFooX_fwBarY_f[T] extends MixZ_feFooX_fwBarY_f[C] { class I; ; f; } +/* */class S_TZ_feFooX_fwBarYI_[T] extends MixZ_feFooX_fwBarYI_[C] { ; ; f; } +/* */class S_TZ_feFooX_fwBarYIf[T] extends MixZ_feFooX_fwBarYIf[C] { ; ; f; } +/* */class S_TZ_feFooXI_ [T] extends MixZ_feFooXI_ [C] { ; ; f; } +/* */class S_TZ_feFooXI_wBar___[T] extends MixZ_feFooXI_wBar___[C] { ; ; f; } +/* */class S_TZ_feFooXI_wBar__f[T] extends MixZ_feFooXI_wBar__f[C] { ; ; f; } +// */class S_TZ_feFooXI_wBar_I_[T] extends MixZ_feFooXI_wBar_I_[C] { ; ; f; } +// */class S_TZ_feFooXI_wBar_If[T] extends MixZ_feFooXI_wBar_If[C] { ; ; f; } +/* */class S_TZ_feFooXI_wBarY__[T] extends MixZ_feFooXI_wBarY__[C] { ; ; f; } +/* */class S_TZ_feFooXI_wBarY_f[T] extends MixZ_feFooXI_wBarY_f[C] { ; ; f; } +// */class S_TZ_feFooXI_wBarYI_[T] extends MixZ_feFooXI_wBarYI_[C] { ; ; f; } +// */class S_TZ_feFooXI_wBarYIf[T] extends MixZ_feFooXI_wBarYIf[C] { ; ; f; } +/* */class S_TZ_feFooXIf [T] extends MixZ_feFooXIf [C] { ; ; f; } +/* */class S_TZ_feFooXIfwBar___[T] extends MixZ_feFooXIfwBar___[C] { ; ; f; } +/* */class S_TZ_feFooXIfwBar__f[T] extends MixZ_feFooXIfwBar__f[C] { ; ; f; } +// */class S_TZ_feFooXIfwBar_I_[T] extends MixZ_feFooXIfwBar_I_[C] { ; ; f; } +// */class S_TZ_feFooXIfwBar_If[T] extends MixZ_feFooXIfwBar_If[C] { ; ; f; } +/* */class S_TZ_feFooXIfwBarY__[T] extends MixZ_feFooXIfwBarY__[C] { ; ; f; } +/* */class S_TZ_feFooXIfwBarY_f[T] extends MixZ_feFooXIfwBarY_f[C] { ; ; f; } +// */class S_TZ_feFooXIfwBarYI_[T] extends MixZ_feFooXIfwBarYI_[C] { ; ; f; } +// */class S_TZ_feFooXIfwBarYIf[T] extends MixZ_feFooXIfwBarYIf[C] { ; ; f; } + +/* */class S_TZI_eFoo___ [T] extends MixZI_eFoo___ [C] { ; def f: I = {sub; null}; f; } +/* */class S_TZI_eFoo___wBar___[T] extends MixZI_eFoo___wBar___[C] { ; def f: I = {sub; null}; f; } +/* */class S_TZI_eFoo___wBar__f[T] extends MixZI_eFoo___wBar__f[C] { ; ; f; } +// */class S_TZI_eFoo___wBar_I_[T] extends MixZI_eFoo___wBar_I_[C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_eFoo___wBar_If[T] extends MixZI_eFoo___wBar_If[C] { ; ; f; } +/* */class S_TZI_eFoo___wBarY__[T] extends MixZI_eFoo___wBarY__[C] { ; def f: I = {sub; null}; f; } +/* */class S_TZI_eFoo___wBarY_f[T] extends MixZI_eFoo___wBarY_f[C] { ; ; f; } +// */class S_TZI_eFoo___wBarYI_[T] extends MixZI_eFoo___wBarYI_[C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_eFoo___wBarYIf[T] extends MixZI_eFoo___wBarYIf[C] { ; ; f; } +/* */class S_TZI_eFoo__f [T] extends MixZI_eFoo__f [C] { ; ; f; } +/* */class S_TZI_eFoo__fwBar___[T] extends MixZI_eFoo__fwBar___[C] { ; ; f; } +// */class S_TZI_eFoo__fwBar__f[T] extends MixZI_eFoo__fwBar__f[C] { ; ; f; } +// */class S_TZI_eFoo__fwBar_I_[T] extends MixZI_eFoo__fwBar_I_[C] { ; ; f; } +// */class S_TZI_eFoo__fwBar_If[T] extends MixZI_eFoo__fwBar_If[C] { ; ; f; } +/* */class S_TZI_eFoo__fwBarY__[T] extends MixZI_eFoo__fwBarY__[C] { ; ; f; } +// */class S_TZI_eFoo__fwBarY_f[T] extends MixZI_eFoo__fwBarY_f[C] { ; ; f; } +// */class S_TZI_eFoo__fwBarYI_[T] extends MixZI_eFoo__fwBarYI_[C] { ; ; f; } +// */class S_TZI_eFoo__fwBarYIf[T] extends MixZI_eFoo__fwBarYIf[C] { ; ; f; } +// */class S_TZI_eFoo_I_ [T] extends MixZI_eFoo_I_ [C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_eFoo_I_wBar___[T] extends MixZI_eFoo_I_wBar___[C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_eFoo_I_wBar__f[T] extends MixZI_eFoo_I_wBar__f[C] { ; ; f; } +// */class S_TZI_eFoo_I_wBar_I_[T] extends MixZI_eFoo_I_wBar_I_[C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_eFoo_I_wBar_If[T] extends MixZI_eFoo_I_wBar_If[C] { ; ; f; } +// */class S_TZI_eFoo_I_wBarY__[T] extends MixZI_eFoo_I_wBarY__[C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_eFoo_I_wBarY_f[T] extends MixZI_eFoo_I_wBarY_f[C] { ; ; f; } +// */class S_TZI_eFoo_I_wBarYI_[T] extends MixZI_eFoo_I_wBarYI_[C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_eFoo_I_wBarYIf[T] extends MixZI_eFoo_I_wBarYIf[C] { ; ; f; } +// */class S_TZI_eFoo_If [T] extends MixZI_eFoo_If [C] { ; ; f; } +// */class S_TZI_eFoo_IfwBar___[T] extends MixZI_eFoo_IfwBar___[C] { ; ; f; } +// */class S_TZI_eFoo_IfwBar__f[T] extends MixZI_eFoo_IfwBar__f[C] { ; ; f; } +// */class S_TZI_eFoo_IfwBar_I_[T] extends MixZI_eFoo_IfwBar_I_[C] { ; ; f; } +// */class S_TZI_eFoo_IfwBar_If[T] extends MixZI_eFoo_IfwBar_If[C] { ; ; f; } +// */class S_TZI_eFoo_IfwBarY__[T] extends MixZI_eFoo_IfwBarY__[C] { ; ; f; } +// */class S_TZI_eFoo_IfwBarY_f[T] extends MixZI_eFoo_IfwBarY_f[C] { ; ; f; } +// */class S_TZI_eFoo_IfwBarYI_[T] extends MixZI_eFoo_IfwBarYI_[C] { ; ; f; } +// */class S_TZI_eFoo_IfwBarYIf[T] extends MixZI_eFoo_IfwBarYIf[C] { ; ; f; } +/* */class S_TZI_eFooX__ [T] extends MixZI_eFooX__ [C] { ; def f: I = {sub; null}; f; } +/* */class S_TZI_eFooX__wBar___[T] extends MixZI_eFooX__wBar___[C] { ; def f: I = {sub; null}; f; } +/* */class S_TZI_eFooX__wBar__f[T] extends MixZI_eFooX__wBar__f[C] { ; ; f; } +// */class S_TZI_eFooX__wBar_I_[T] extends MixZI_eFooX__wBar_I_[C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_eFooX__wBar_If[T] extends MixZI_eFooX__wBar_If[C] { ; ; f; } +/* */class S_TZI_eFooX__wBarY__[T] extends MixZI_eFooX__wBarY__[C] { ; def f: I = {sub; null}; f; } +/* */class S_TZI_eFooX__wBarY_f[T] extends MixZI_eFooX__wBarY_f[C] { ; ; f; } +// */class S_TZI_eFooX__wBarYI_[T] extends MixZI_eFooX__wBarYI_[C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_eFooX__wBarYIf[T] extends MixZI_eFooX__wBarYIf[C] { ; ; f; } +/* */class S_TZI_eFooX_f [T] extends MixZI_eFooX_f [C] { ; ; f; } +/* */class S_TZI_eFooX_fwBar___[T] extends MixZI_eFooX_fwBar___[C] { ; ; f; } +// */class S_TZI_eFooX_fwBar__f[T] extends MixZI_eFooX_fwBar__f[C] { ; ; f; } +// */class S_TZI_eFooX_fwBar_I_[T] extends MixZI_eFooX_fwBar_I_[C] { ; ; f; } +// */class S_TZI_eFooX_fwBar_If[T] extends MixZI_eFooX_fwBar_If[C] { ; ; f; } +/* */class S_TZI_eFooX_fwBarY__[T] extends MixZI_eFooX_fwBarY__[C] { ; ; f; } +// */class S_TZI_eFooX_fwBarY_f[T] extends MixZI_eFooX_fwBarY_f[C] { ; ; f; } +// */class S_TZI_eFooX_fwBarYI_[T] extends MixZI_eFooX_fwBarYI_[C] { ; ; f; } +// */class S_TZI_eFooX_fwBarYIf[T] extends MixZI_eFooX_fwBarYIf[C] { ; ; f; } +// */class S_TZI_eFooXI_ [T] extends MixZI_eFooXI_ [C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_eFooXI_wBar___[T] extends MixZI_eFooXI_wBar___[C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_eFooXI_wBar__f[T] extends MixZI_eFooXI_wBar__f[C] { ; ; f; } +// */class S_TZI_eFooXI_wBar_I_[T] extends MixZI_eFooXI_wBar_I_[C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_eFooXI_wBar_If[T] extends MixZI_eFooXI_wBar_If[C] { ; ; f; } +// */class S_TZI_eFooXI_wBarY__[T] extends MixZI_eFooXI_wBarY__[C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_eFooXI_wBarY_f[T] extends MixZI_eFooXI_wBarY_f[C] { ; ; f; } +// */class S_TZI_eFooXI_wBarYI_[T] extends MixZI_eFooXI_wBarYI_[C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_eFooXI_wBarYIf[T] extends MixZI_eFooXI_wBarYIf[C] { ; ; f; } +// */class S_TZI_eFooXIf [T] extends MixZI_eFooXIf [C] { ; ; f; } +// */class S_TZI_eFooXIfwBar___[T] extends MixZI_eFooXIfwBar___[C] { ; ; f; } +// */class S_TZI_eFooXIfwBar__f[T] extends MixZI_eFooXIfwBar__f[C] { ; ; f; } +// */class S_TZI_eFooXIfwBar_I_[T] extends MixZI_eFooXIfwBar_I_[C] { ; ; f; } +// */class S_TZI_eFooXIfwBar_If[T] extends MixZI_eFooXIfwBar_If[C] { ; ; f; } +// */class S_TZI_eFooXIfwBarY__[T] extends MixZI_eFooXIfwBarY__[C] { ; ; f; } +// */class S_TZI_eFooXIfwBarY_f[T] extends MixZI_eFooXIfwBarY_f[C] { ; ; f; } +// */class S_TZI_eFooXIfwBarYI_[T] extends MixZI_eFooXIfwBarYI_[C] { ; ; f; } +// */class S_TZI_eFooXIfwBarYIf[T] extends MixZI_eFooXIfwBarYIf[C] { ; ; f; } + +/* */class S_TZIfeFoo___ [T] extends MixZIfeFoo___ [C] { ; ; f; } +/* */class S_TZIfeFoo___wBar___[T] extends MixZIfeFoo___wBar___[C] { ; ; f; } +/* */class S_TZIfeFoo___wBar__f[T] extends MixZIfeFoo___wBar__f[C] { ; ; f; } +// */class S_TZIfeFoo___wBar_I_[T] extends MixZIfeFoo___wBar_I_[C] { ; ; f; } +// */class S_TZIfeFoo___wBar_If[T] extends MixZIfeFoo___wBar_If[C] { ; ; f; } +/* */class S_TZIfeFoo___wBarY__[T] extends MixZIfeFoo___wBarY__[C] { ; ; f; } +/* */class S_TZIfeFoo___wBarY_f[T] extends MixZIfeFoo___wBarY_f[C] { ; ; f; } +// */class S_TZIfeFoo___wBarYI_[T] extends MixZIfeFoo___wBarYI_[C] { ; ; f; } +// */class S_TZIfeFoo___wBarYIf[T] extends MixZIfeFoo___wBarYIf[C] { ; ; f; } +/* */class S_TZIfeFoo__f [T] extends MixZIfeFoo__f [C] { ; ; f; } +/* */class S_TZIfeFoo__fwBar___[T] extends MixZIfeFoo__fwBar___[C] { ; ; f; } +/* */class S_TZIfeFoo__fwBar__f[T] extends MixZIfeFoo__fwBar__f[C] { ; ; f; } +// */class S_TZIfeFoo__fwBar_I_[T] extends MixZIfeFoo__fwBar_I_[C] { ; ; f; } +// */class S_TZIfeFoo__fwBar_If[T] extends MixZIfeFoo__fwBar_If[C] { ; ; f; } +/* */class S_TZIfeFoo__fwBarY__[T] extends MixZIfeFoo__fwBarY__[C] { ; ; f; } +/* */class S_TZIfeFoo__fwBarY_f[T] extends MixZIfeFoo__fwBarY_f[C] { ; ; f; } +// */class S_TZIfeFoo__fwBarYI_[T] extends MixZIfeFoo__fwBarYI_[C] { ; ; f; } +// */class S_TZIfeFoo__fwBarYIf[T] extends MixZIfeFoo__fwBarYIf[C] { ; ; f; } +// */class S_TZIfeFoo_I_ [T] extends MixZIfeFoo_I_ [C] { ; ; f; } +// */class S_TZIfeFoo_I_wBar___[T] extends MixZIfeFoo_I_wBar___[C] { ; ; f; } +// */class S_TZIfeFoo_I_wBar__f[T] extends MixZIfeFoo_I_wBar__f[C] { ; ; f; } +// */class S_TZIfeFoo_I_wBar_I_[T] extends MixZIfeFoo_I_wBar_I_[C] { ; ; f; } +// */class S_TZIfeFoo_I_wBar_If[T] extends MixZIfeFoo_I_wBar_If[C] { ; ; f; } +// */class S_TZIfeFoo_I_wBarY__[T] extends MixZIfeFoo_I_wBarY__[C] { ; ; f; } +// */class S_TZIfeFoo_I_wBarY_f[T] extends MixZIfeFoo_I_wBarY_f[C] { ; ; f; } +// */class S_TZIfeFoo_I_wBarYI_[T] extends MixZIfeFoo_I_wBarYI_[C] { ; ; f; } +// */class S_TZIfeFoo_I_wBarYIf[T] extends MixZIfeFoo_I_wBarYIf[C] { ; ; f; } +// */class S_TZIfeFoo_If [T] extends MixZIfeFoo_If [C] { ; ; f; } +// */class S_TZIfeFoo_IfwBar___[T] extends MixZIfeFoo_IfwBar___[C] { ; ; f; } +// */class S_TZIfeFoo_IfwBar__f[T] extends MixZIfeFoo_IfwBar__f[C] { ; ; f; } +// */class S_TZIfeFoo_IfwBar_I_[T] extends MixZIfeFoo_IfwBar_I_[C] { ; ; f; } +// */class S_TZIfeFoo_IfwBar_If[T] extends MixZIfeFoo_IfwBar_If[C] { ; ; f; } +// */class S_TZIfeFoo_IfwBarY__[T] extends MixZIfeFoo_IfwBarY__[C] { ; ; f; } +// */class S_TZIfeFoo_IfwBarY_f[T] extends MixZIfeFoo_IfwBarY_f[C] { ; ; f; } +// */class S_TZIfeFoo_IfwBarYI_[T] extends MixZIfeFoo_IfwBarYI_[C] { ; ; f; } +// */class S_TZIfeFoo_IfwBarYIf[T] extends MixZIfeFoo_IfwBarYIf[C] { ; ; f; } +/* */class S_TZIfeFooX__ [T] extends MixZIfeFooX__ [C] { ; ; f; } +/* */class S_TZIfeFooX__wBar___[T] extends MixZIfeFooX__wBar___[C] { ; ; f; } +/* */class S_TZIfeFooX__wBar__f[T] extends MixZIfeFooX__wBar__f[C] { ; ; f; } +// */class S_TZIfeFooX__wBar_I_[T] extends MixZIfeFooX__wBar_I_[C] { ; ; f; } +// */class S_TZIfeFooX__wBar_If[T] extends MixZIfeFooX__wBar_If[C] { ; ; f; } +/* */class S_TZIfeFooX__wBarY__[T] extends MixZIfeFooX__wBarY__[C] { ; ; f; } +/* */class S_TZIfeFooX__wBarY_f[T] extends MixZIfeFooX__wBarY_f[C] { ; ; f; } +// */class S_TZIfeFooX__wBarYI_[T] extends MixZIfeFooX__wBarYI_[C] { ; ; f; } +// */class S_TZIfeFooX__wBarYIf[T] extends MixZIfeFooX__wBarYIf[C] { ; ; f; } +/* */class S_TZIfeFooX_f [T] extends MixZIfeFooX_f [C] { ; ; f; } +/* */class S_TZIfeFooX_fwBar___[T] extends MixZIfeFooX_fwBar___[C] { ; ; f; } +/* */class S_TZIfeFooX_fwBar__f[T] extends MixZIfeFooX_fwBar__f[C] { ; ; f; } +// */class S_TZIfeFooX_fwBar_I_[T] extends MixZIfeFooX_fwBar_I_[C] { ; ; f; } +// */class S_TZIfeFooX_fwBar_If[T] extends MixZIfeFooX_fwBar_If[C] { ; ; f; } +/* */class S_TZIfeFooX_fwBarY__[T] extends MixZIfeFooX_fwBarY__[C] { ; ; f; } +/* */class S_TZIfeFooX_fwBarY_f[T] extends MixZIfeFooX_fwBarY_f[C] { ; ; f; } +// */class S_TZIfeFooX_fwBarYI_[T] extends MixZIfeFooX_fwBarYI_[C] { ; ; f; } +// */class S_TZIfeFooX_fwBarYIf[T] extends MixZIfeFooX_fwBarYIf[C] { ; ; f; } +// */class S_TZIfeFooXI_ [T] extends MixZIfeFooXI_ [C] { ; ; f; } +// */class S_TZIfeFooXI_wBar___[T] extends MixZIfeFooXI_wBar___[C] { ; ; f; } +// */class S_TZIfeFooXI_wBar__f[T] extends MixZIfeFooXI_wBar__f[C] { ; ; f; } +// */class S_TZIfeFooXI_wBar_I_[T] extends MixZIfeFooXI_wBar_I_[C] { ; ; f; } +// */class S_TZIfeFooXI_wBar_If[T] extends MixZIfeFooXI_wBar_If[C] { ; ; f; } +// */class S_TZIfeFooXI_wBarY__[T] extends MixZIfeFooXI_wBarY__[C] { ; ; f; } +// */class S_TZIfeFooXI_wBarY_f[T] extends MixZIfeFooXI_wBarY_f[C] { ; ; f; } +// */class S_TZIfeFooXI_wBarYI_[T] extends MixZIfeFooXI_wBarYI_[C] { ; ; f; } +// */class S_TZIfeFooXI_wBarYIf[T] extends MixZIfeFooXI_wBarYIf[C] { ; ; f; } +// */class S_TZIfeFooXIf [T] extends MixZIfeFooXIf [C] { ; ; f; } +// */class S_TZIfeFooXIfwBar___[T] extends MixZIfeFooXIfwBar___[C] { ; ; f; } +// */class S_TZIfeFooXIfwBar__f[T] extends MixZIfeFooXIfwBar__f[C] { ; ; f; } +// */class S_TZIfeFooXIfwBar_I_[T] extends MixZIfeFooXIfwBar_I_[C] { ; ; f; } +// */class S_TZIfeFooXIfwBar_If[T] extends MixZIfeFooXIfwBar_If[C] { ; ; f; } +// */class S_TZIfeFooXIfwBarY__[T] extends MixZIfeFooXIfwBarY__[C] { ; ; f; } +// */class S_TZIfeFooXIfwBarY_f[T] extends MixZIfeFooXIfwBarY_f[C] { ; ; f; } +// */class S_TZIfeFooXIfwBarYI_[T] extends MixZIfeFooXIfwBarYI_[C] { ; ; f; } +// */class S_TZIfeFooXIfwBarYIf[T] extends MixZIfeFooXIfwBarYIf[C] { ; ; f; } + + + +/* */class S_T___wFoo___ [T] extends Mix___wFoo___ { class I; def f: I = {sub; null}; f; } +/* */class S_T___wFoo___wBar___[T] extends Mix___wFoo___wBar___ { class I; def f: I = {sub; null}; f; } +/* */class S_T___wFoo___wBar__f[T] extends Mix___wFoo___wBar__f { class I; ; f; } +/* */class S_T___wFoo___wBar_I_[T] extends Mix___wFoo___wBar_I_ { ; def f: I = {sub; null}; f; } +/* */class S_T___wFoo___wBar_If[T] extends Mix___wFoo___wBar_If { ; ; f; } +/* */class S_T___wFoo___wBarY__[T] extends Mix___wFoo___wBarY__ { class I; def f: I = {sub; null}; f; } +/* */class S_T___wFoo___wBarY_f[T] extends Mix___wFoo___wBarY_f { class I; ; f; } +/* */class S_T___wFoo___wBarYI_[T] extends Mix___wFoo___wBarYI_ { ; def f: I = {sub; null}; f; } +/* */class S_T___wFoo___wBarYIf[T] extends Mix___wFoo___wBarYIf { ; ; f; } +/* */class S_T___wFoo__f [T] extends Mix___wFoo__f { class I; ; f; } +/* */class S_T___wFoo__fwBar___[T] extends Mix___wFoo__fwBar___ { class I; ; f; } +// */class S_T___wFoo__fwBar__f[T] extends Mix___wFoo__fwBar__f { class I; ; f; } +/* */class S_T___wFoo__fwBar_I_[T] extends Mix___wFoo__fwBar_I_ { ; ; f; } +// */class S_T___wFoo__fwBar_If[T] extends Mix___wFoo__fwBar_If { ; ; f; } +/* */class S_T___wFoo__fwBarY__[T] extends Mix___wFoo__fwBarY__ { class I; ; f; } +// */class S_T___wFoo__fwBarY_f[T] extends Mix___wFoo__fwBarY_f { class I; ; f; } +/* */class S_T___wFoo__fwBarYI_[T] extends Mix___wFoo__fwBarYI_ { ; ; f; } +// */class S_T___wFoo__fwBarYIf[T] extends Mix___wFoo__fwBarYIf { ; ; f; } +/* */class S_T___wFoo_I_ [T] extends Mix___wFoo_I_ { ; def f: I = {sub; null}; f; } +/* */class S_T___wFoo_I_wBar___[T] extends Mix___wFoo_I_wBar___ { ; def f: I = {sub; null}; f; } +/* */class S_T___wFoo_I_wBar__f[T] extends Mix___wFoo_I_wBar__f { ; ; f; } +// */class S_T___wFoo_I_wBar_I_[T] extends Mix___wFoo_I_wBar_I_ { ; def f: I = {sub; null}; f; } +// */class S_T___wFoo_I_wBar_If[T] extends Mix___wFoo_I_wBar_If { ; ; f; } +/* */class S_T___wFoo_I_wBarY__[T] extends Mix___wFoo_I_wBarY__ { ; def f: I = {sub; null}; f; } +/* */class S_T___wFoo_I_wBarY_f[T] extends Mix___wFoo_I_wBarY_f { ; ; f; } +// */class S_T___wFoo_I_wBarYI_[T] extends Mix___wFoo_I_wBarYI_ { ; def f: I = {sub; null}; f; } +// */class S_T___wFoo_I_wBarYIf[T] extends Mix___wFoo_I_wBarYIf { ; ; f; } +/* */class S_T___wFoo_If [T] extends Mix___wFoo_If { ; ; f; } +/* */class S_T___wFoo_IfwBar___[T] extends Mix___wFoo_IfwBar___ { ; ; f; } +// */class S_T___wFoo_IfwBar__f[T] extends Mix___wFoo_IfwBar__f { ; ; f; } +// */class S_T___wFoo_IfwBar_I_[T] extends Mix___wFoo_IfwBar_I_ { ; ; f; } +// */class S_T___wFoo_IfwBar_If[T] extends Mix___wFoo_IfwBar_If { ; ; f; } +/* */class S_T___wFoo_IfwBarY__[T] extends Mix___wFoo_IfwBarY__ { ; ; f; } +// */class S_T___wFoo_IfwBarY_f[T] extends Mix___wFoo_IfwBarY_f { ; ; f; } +// */class S_T___wFoo_IfwBarYI_[T] extends Mix___wFoo_IfwBarYI_ { ; ; f; } +// */class S_T___wFoo_IfwBarYIf[T] extends Mix___wFoo_IfwBarYIf { ; ; f; } +/* */class S_T___wFooX__ [T] extends Mix___wFooX__ { class I; def f: I = {sub; null}; f; } +/* */class S_T___wFooX__wBar___[T] extends Mix___wFooX__wBar___ { class I; def f: I = {sub; null}; f; } +/* */class S_T___wFooX__wBar__f[T] extends Mix___wFooX__wBar__f { class I; ; f; } +/* */class S_T___wFooX__wBar_I_[T] extends Mix___wFooX__wBar_I_ { ; def f: I = {sub; null}; f; } +/* */class S_T___wFooX__wBar_If[T] extends Mix___wFooX__wBar_If { ; ; f; } +/* */class S_T___wFooX__wBarY__[T] extends Mix___wFooX__wBarY__ { class I; def f: I = {sub; null}; f; } +/* */class S_T___wFooX__wBarY_f[T] extends Mix___wFooX__wBarY_f { class I; ; f; } +/* */class S_T___wFooX__wBarYI_[T] extends Mix___wFooX__wBarYI_ { ; def f: I = {sub; null}; f; } +/* */class S_T___wFooX__wBarYIf[T] extends Mix___wFooX__wBarYIf { ; ; f; } +/* */class S_T___wFooX_f [T] extends Mix___wFooX_f { class I; ; f; } +/* */class S_T___wFooX_fwBar___[T] extends Mix___wFooX_fwBar___ { class I; ; f; } +// */class S_T___wFooX_fwBar__f[T] extends Mix___wFooX_fwBar__f { class I; ; f; } +/* */class S_T___wFooX_fwBar_I_[T] extends Mix___wFooX_fwBar_I_ { ; ; f; } +// */class S_T___wFooX_fwBar_If[T] extends Mix___wFooX_fwBar_If { ; ; f; } +/* */class S_T___wFooX_fwBarY__[T] extends Mix___wFooX_fwBarY__ { class I; ; f; } +// */class S_T___wFooX_fwBarY_f[T] extends Mix___wFooX_fwBarY_f { class I; ; f; } +/* */class S_T___wFooX_fwBarYI_[T] extends Mix___wFooX_fwBarYI_ { ; ; f; } +// */class S_T___wFooX_fwBarYIf[T] extends Mix___wFooX_fwBarYIf { ; ; f; } +/* */class S_T___wFooXI_ [T] extends Mix___wFooXI_ { ; def f: I = {sub; null}; f; } +/* */class S_T___wFooXI_wBar___[T] extends Mix___wFooXI_wBar___ { ; def f: I = {sub; null}; f; } +/* */class S_T___wFooXI_wBar__f[T] extends Mix___wFooXI_wBar__f { ; ; f; } +// */class S_T___wFooXI_wBar_I_[T] extends Mix___wFooXI_wBar_I_ { ; def f: I = {sub; null}; f; } +// */class S_T___wFooXI_wBar_If[T] extends Mix___wFooXI_wBar_If { ; ; f; } +/* */class S_T___wFooXI_wBarY__[T] extends Mix___wFooXI_wBarY__ { ; def f: I = {sub; null}; f; } +/* */class S_T___wFooXI_wBarY_f[T] extends Mix___wFooXI_wBarY_f { ; ; f; } +// */class S_T___wFooXI_wBarYI_[T] extends Mix___wFooXI_wBarYI_ { ; def f: I = {sub; null}; f; } +// */class S_T___wFooXI_wBarYIf[T] extends Mix___wFooXI_wBarYIf { ; ; f; } +/* */class S_T___wFooXIf [T] extends Mix___wFooXIf { ; ; f; } +/* */class S_T___wFooXIfwBar___[T] extends Mix___wFooXIfwBar___ { ; ; f; } +// */class S_T___wFooXIfwBar__f[T] extends Mix___wFooXIfwBar__f { ; ; f; } +// */class S_T___wFooXIfwBar_I_[T] extends Mix___wFooXIfwBar_I_ { ; ; f; } +// */class S_T___wFooXIfwBar_If[T] extends Mix___wFooXIfwBar_If { ; ; f; } +/* */class S_T___wFooXIfwBarY__[T] extends Mix___wFooXIfwBarY__ { ; ; f; } +// */class S_T___wFooXIfwBarY_f[T] extends Mix___wFooXIfwBarY_f { ; ; f; } +// */class S_T___wFooXIfwBarYI_[T] extends Mix___wFooXIfwBarYI_ { ; ; f; } +// */class S_T___wFooXIfwBarYIf[T] extends Mix___wFooXIfwBarYIf { ; ; f; } + +/* */class S_T__fwFoo___ [T] extends Mix__fwFoo___ { class I; ; f; } +/* */class S_T__fwFoo___wBar___[T] extends Mix__fwFoo___wBar___ { class I; ; f; } +/* */class S_T__fwFoo___wBar__f[T] extends Mix__fwFoo___wBar__f { class I; ; f; } +/* */class S_T__fwFoo___wBar_I_[T] extends Mix__fwFoo___wBar_I_ { ; ; f; } +/* */class S_T__fwFoo___wBar_If[T] extends Mix__fwFoo___wBar_If { ; ; f; } +/* */class S_T__fwFoo___wBarY__[T] extends Mix__fwFoo___wBarY__ { class I; ; f; } +/* */class S_T__fwFoo___wBarY_f[T] extends Mix__fwFoo___wBarY_f { class I; ; f; } +/* */class S_T__fwFoo___wBarYI_[T] extends Mix__fwFoo___wBarYI_ { ; ; f; } +/* */class S_T__fwFoo___wBarYIf[T] extends Mix__fwFoo___wBarYIf { ; ; f; } +/* */class S_T__fwFoo__f [T] extends Mix__fwFoo__f { class I; ; f; } +/* */class S_T__fwFoo__fwBar___[T] extends Mix__fwFoo__fwBar___ { class I; ; f; } +/* */class S_T__fwFoo__fwBar__f[T] extends Mix__fwFoo__fwBar__f { class I; ; f; } +/* */class S_T__fwFoo__fwBar_I_[T] extends Mix__fwFoo__fwBar_I_ { ; ; f; } +/* */class S_T__fwFoo__fwBar_If[T] extends Mix__fwFoo__fwBar_If { ; ; f; } +/* */class S_T__fwFoo__fwBarY__[T] extends Mix__fwFoo__fwBarY__ { class I; ; f; } +/* */class S_T__fwFoo__fwBarY_f[T] extends Mix__fwFoo__fwBarY_f { class I; ; f; } +/* */class S_T__fwFoo__fwBarYI_[T] extends Mix__fwFoo__fwBarYI_ { ; ; f; } +/* */class S_T__fwFoo__fwBarYIf[T] extends Mix__fwFoo__fwBarYIf { ; ; f; } +/* */class S_T__fwFoo_I_ [T] extends Mix__fwFoo_I_ { ; ; f; } +/* */class S_T__fwFoo_I_wBar___[T] extends Mix__fwFoo_I_wBar___ { ; ; f; } +/* */class S_T__fwFoo_I_wBar__f[T] extends Mix__fwFoo_I_wBar__f { ; ; f; } +// */class S_T__fwFoo_I_wBar_I_[T] extends Mix__fwFoo_I_wBar_I_ { ; ; f; } +// */class S_T__fwFoo_I_wBar_If[T] extends Mix__fwFoo_I_wBar_If { ; ; f; } +/* */class S_T__fwFoo_I_wBarY__[T] extends Mix__fwFoo_I_wBarY__ { ; ; f; } +/* */class S_T__fwFoo_I_wBarY_f[T] extends Mix__fwFoo_I_wBarY_f { ; ; f; } +// */class S_T__fwFoo_I_wBarYI_[T] extends Mix__fwFoo_I_wBarYI_ { ; ; f; } +// */class S_T__fwFoo_I_wBarYIf[T] extends Mix__fwFoo_I_wBarYIf { ; ; f; } +/* */class S_T__fwFoo_If [T] extends Mix__fwFoo_If { ; ; f; } +/* */class S_T__fwFoo_IfwBar___[T] extends Mix__fwFoo_IfwBar___ { ; ; f; } +/* */class S_T__fwFoo_IfwBar__f[T] extends Mix__fwFoo_IfwBar__f { ; ; f; } +// */class S_T__fwFoo_IfwBar_I_[T] extends Mix__fwFoo_IfwBar_I_ { ; ; f; } +// */class S_T__fwFoo_IfwBar_If[T] extends Mix__fwFoo_IfwBar_If { ; ; f; } +/* */class S_T__fwFoo_IfwBarY__[T] extends Mix__fwFoo_IfwBarY__ { ; ; f; } +/* */class S_T__fwFoo_IfwBarY_f[T] extends Mix__fwFoo_IfwBarY_f { ; ; f; } +// */class S_T__fwFoo_IfwBarYI_[T] extends Mix__fwFoo_IfwBarYI_ { ; ; f; } +// */class S_T__fwFoo_IfwBarYIf[T] extends Mix__fwFoo_IfwBarYIf { ; ; f; } +/* */class S_T__fwFooX__ [T] extends Mix__fwFooX__ { class I; ; f; } +/* */class S_T__fwFooX__wBar___[T] extends Mix__fwFooX__wBar___ { class I; ; f; } +/* */class S_T__fwFooX__wBar__f[T] extends Mix__fwFooX__wBar__f { class I; ; f; } +/* */class S_T__fwFooX__wBar_I_[T] extends Mix__fwFooX__wBar_I_ { ; ; f; } +/* */class S_T__fwFooX__wBar_If[T] extends Mix__fwFooX__wBar_If { ; ; f; } +/* */class S_T__fwFooX__wBarY__[T] extends Mix__fwFooX__wBarY__ { class I; ; f; } +/* */class S_T__fwFooX__wBarY_f[T] extends Mix__fwFooX__wBarY_f { class I; ; f; } +/* */class S_T__fwFooX__wBarYI_[T] extends Mix__fwFooX__wBarYI_ { ; ; f; } +/* */class S_T__fwFooX__wBarYIf[T] extends Mix__fwFooX__wBarYIf { ; ; f; } +/* */class S_T__fwFooX_f [T] extends Mix__fwFooX_f { class I; ; f; } +/* */class S_T__fwFooX_fwBar___[T] extends Mix__fwFooX_fwBar___ { class I; ; f; } +/* */class S_T__fwFooX_fwBar__f[T] extends Mix__fwFooX_fwBar__f { class I; ; f; } +/* */class S_T__fwFooX_fwBar_I_[T] extends Mix__fwFooX_fwBar_I_ { ; ; f; } +/* */class S_T__fwFooX_fwBar_If[T] extends Mix__fwFooX_fwBar_If { ; ; f; } +/* */class S_T__fwFooX_fwBarY__[T] extends Mix__fwFooX_fwBarY__ { class I; ; f; } +/* */class S_T__fwFooX_fwBarY_f[T] extends Mix__fwFooX_fwBarY_f { class I; ; f; } +/* */class S_T__fwFooX_fwBarYI_[T] extends Mix__fwFooX_fwBarYI_ { ; ; f; } +/* */class S_T__fwFooX_fwBarYIf[T] extends Mix__fwFooX_fwBarYIf { ; ; f; } +/* */class S_T__fwFooXI_ [T] extends Mix__fwFooXI_ { ; ; f; } +/* */class S_T__fwFooXI_wBar___[T] extends Mix__fwFooXI_wBar___ { ; ; f; } +/* */class S_T__fwFooXI_wBar__f[T] extends Mix__fwFooXI_wBar__f { ; ; f; } +// */class S_T__fwFooXI_wBar_I_[T] extends Mix__fwFooXI_wBar_I_ { ; ; f; } +// */class S_T__fwFooXI_wBar_If[T] extends Mix__fwFooXI_wBar_If { ; ; f; } +/* */class S_T__fwFooXI_wBarY__[T] extends Mix__fwFooXI_wBarY__ { ; ; f; } +/* */class S_T__fwFooXI_wBarY_f[T] extends Mix__fwFooXI_wBarY_f { ; ; f; } +// */class S_T__fwFooXI_wBarYI_[T] extends Mix__fwFooXI_wBarYI_ { ; ; f; } +// */class S_T__fwFooXI_wBarYIf[T] extends Mix__fwFooXI_wBarYIf { ; ; f; } +/* */class S_T__fwFooXIf [T] extends Mix__fwFooXIf { ; ; f; } +/* */class S_T__fwFooXIfwBar___[T] extends Mix__fwFooXIfwBar___ { ; ; f; } +/* */class S_T__fwFooXIfwBar__f[T] extends Mix__fwFooXIfwBar__f { ; ; f; } +// */class S_T__fwFooXIfwBar_I_[T] extends Mix__fwFooXIfwBar_I_ { ; ; f; } +// */class S_T__fwFooXIfwBar_If[T] extends Mix__fwFooXIfwBar_If { ; ; f; } +/* */class S_T__fwFooXIfwBarY__[T] extends Mix__fwFooXIfwBarY__ { ; ; f; } +/* */class S_T__fwFooXIfwBarY_f[T] extends Mix__fwFooXIfwBarY_f { ; ; f; } +// */class S_T__fwFooXIfwBarYI_[T] extends Mix__fwFooXIfwBarYI_ { ; ; f; } +// */class S_T__fwFooXIfwBarYIf[T] extends Mix__fwFooXIfwBarYIf { ; ; f; } + +/* */class S_T_I_wFoo___ [T] extends Mix_I_wFoo___ { ; def f: I = {sub; null}; f; } +/* */class S_T_I_wFoo___wBar___[T] extends Mix_I_wFoo___wBar___ { ; def f: I = {sub; null}; f; } +/* */class S_T_I_wFoo___wBar__f[T] extends Mix_I_wFoo___wBar__f { ; ; f; } +// */class S_T_I_wFoo___wBar_I_[T] extends Mix_I_wFoo___wBar_I_ { ; def f: I = {sub; null}; f; } +// */class S_T_I_wFoo___wBar_If[T] extends Mix_I_wFoo___wBar_If { ; ; f; } +/* */class S_T_I_wFoo___wBarY__[T] extends Mix_I_wFoo___wBarY__ { ; def f: I = {sub; null}; f; } +/* */class S_T_I_wFoo___wBarY_f[T] extends Mix_I_wFoo___wBarY_f { ; ; f; } +// */class S_T_I_wFoo___wBarYI_[T] extends Mix_I_wFoo___wBarYI_ { ; def f: I = {sub; null}; f; } +// */class S_T_I_wFoo___wBarYIf[T] extends Mix_I_wFoo___wBarYIf { ; ; f; } +/* */class S_T_I_wFoo__f [T] extends Mix_I_wFoo__f { ; ; f; } +/* */class S_T_I_wFoo__fwBar___[T] extends Mix_I_wFoo__fwBar___ { ; ; f; } +// */class S_T_I_wFoo__fwBar__f[T] extends Mix_I_wFoo__fwBar__f { ; ; f; } +// */class S_T_I_wFoo__fwBar_I_[T] extends Mix_I_wFoo__fwBar_I_ { ; ; f; } +// */class S_T_I_wFoo__fwBar_If[T] extends Mix_I_wFoo__fwBar_If { ; ; f; } +/* */class S_T_I_wFoo__fwBarY__[T] extends Mix_I_wFoo__fwBarY__ { ; ; f; } +// */class S_T_I_wFoo__fwBarY_f[T] extends Mix_I_wFoo__fwBarY_f { ; ; f; } +// */class S_T_I_wFoo__fwBarYI_[T] extends Mix_I_wFoo__fwBarYI_ { ; ; f; } +// */class S_T_I_wFoo__fwBarYIf[T] extends Mix_I_wFoo__fwBarYIf { ; ; f; } +// */class S_T_I_wFoo_I_ [T] extends Mix_I_wFoo_I_ { ; def f: I = {sub; null}; f; } +// */class S_T_I_wFoo_I_wBar___[T] extends Mix_I_wFoo_I_wBar___ { ; def f: I = {sub; null}; f; } +// */class S_T_I_wFoo_I_wBar__f[T] extends Mix_I_wFoo_I_wBar__f { ; ; f; } +// */class S_T_I_wFoo_I_wBar_I_[T] extends Mix_I_wFoo_I_wBar_I_ { ; def f: I = {sub; null}; f; } +// */class S_T_I_wFoo_I_wBar_If[T] extends Mix_I_wFoo_I_wBar_If { ; ; f; } +// */class S_T_I_wFoo_I_wBarY__[T] extends Mix_I_wFoo_I_wBarY__ { ; def f: I = {sub; null}; f; } +// */class S_T_I_wFoo_I_wBarY_f[T] extends Mix_I_wFoo_I_wBarY_f { ; ; f; } +// */class S_T_I_wFoo_I_wBarYI_[T] extends Mix_I_wFoo_I_wBarYI_ { ; def f: I = {sub; null}; f; } +// */class S_T_I_wFoo_I_wBarYIf[T] extends Mix_I_wFoo_I_wBarYIf { ; ; f; } +// */class S_T_I_wFoo_If [T] extends Mix_I_wFoo_If { ; ; f; } +// */class S_T_I_wFoo_IfwBar___[T] extends Mix_I_wFoo_IfwBar___ { ; ; f; } +// */class S_T_I_wFoo_IfwBar__f[T] extends Mix_I_wFoo_IfwBar__f { ; ; f; } +// */class S_T_I_wFoo_IfwBar_I_[T] extends Mix_I_wFoo_IfwBar_I_ { ; ; f; } +// */class S_T_I_wFoo_IfwBar_If[T] extends Mix_I_wFoo_IfwBar_If { ; ; f; } +// */class S_T_I_wFoo_IfwBarY__[T] extends Mix_I_wFoo_IfwBarY__ { ; ; f; } +// */class S_T_I_wFoo_IfwBarY_f[T] extends Mix_I_wFoo_IfwBarY_f { ; ; f; } +// */class S_T_I_wFoo_IfwBarYI_[T] extends Mix_I_wFoo_IfwBarYI_ { ; ; f; } +// */class S_T_I_wFoo_IfwBarYIf[T] extends Mix_I_wFoo_IfwBarYIf { ; ; f; } +/* */class S_T_I_wFooX__ [T] extends Mix_I_wFooX__ { ; def f: I = {sub; null}; f; } +/* */class S_T_I_wFooX__wBar___[T] extends Mix_I_wFooX__wBar___ { ; def f: I = {sub; null}; f; } +/* */class S_T_I_wFooX__wBar__f[T] extends Mix_I_wFooX__wBar__f { ; ; f; } +// */class S_T_I_wFooX__wBar_I_[T] extends Mix_I_wFooX__wBar_I_ { ; def f: I = {sub; null}; f; } +// */class S_T_I_wFooX__wBar_If[T] extends Mix_I_wFooX__wBar_If { ; ; f; } +/* */class S_T_I_wFooX__wBarY__[T] extends Mix_I_wFooX__wBarY__ { ; def f: I = {sub; null}; f; } +/* */class S_T_I_wFooX__wBarY_f[T] extends Mix_I_wFooX__wBarY_f { ; ; f; } +// */class S_T_I_wFooX__wBarYI_[T] extends Mix_I_wFooX__wBarYI_ { ; def f: I = {sub; null}; f; } +// */class S_T_I_wFooX__wBarYIf[T] extends Mix_I_wFooX__wBarYIf { ; ; f; } +/* */class S_T_I_wFooX_f [T] extends Mix_I_wFooX_f { ; ; f; } +/* */class S_T_I_wFooX_fwBar___[T] extends Mix_I_wFooX_fwBar___ { ; ; f; } +// */class S_T_I_wFooX_fwBar__f[T] extends Mix_I_wFooX_fwBar__f { ; ; f; } +// */class S_T_I_wFooX_fwBar_I_[T] extends Mix_I_wFooX_fwBar_I_ { ; ; f; } +// */class S_T_I_wFooX_fwBar_If[T] extends Mix_I_wFooX_fwBar_If { ; ; f; } +/* */class S_T_I_wFooX_fwBarY__[T] extends Mix_I_wFooX_fwBarY__ { ; ; f; } +// */class S_T_I_wFooX_fwBarY_f[T] extends Mix_I_wFooX_fwBarY_f { ; ; f; } +// */class S_T_I_wFooX_fwBarYI_[T] extends Mix_I_wFooX_fwBarYI_ { ; ; f; } +// */class S_T_I_wFooX_fwBarYIf[T] extends Mix_I_wFooX_fwBarYIf { ; ; f; } +// */class S_T_I_wFooXI_ [T] extends Mix_I_wFooXI_ { ; def f: I = {sub; null}; f; } +// */class S_T_I_wFooXI_wBar___[T] extends Mix_I_wFooXI_wBar___ { ; def f: I = {sub; null}; f; } +// */class S_T_I_wFooXI_wBar__f[T] extends Mix_I_wFooXI_wBar__f { ; ; f; } +// */class S_T_I_wFooXI_wBar_I_[T] extends Mix_I_wFooXI_wBar_I_ { ; def f: I = {sub; null}; f; } +// */class S_T_I_wFooXI_wBar_If[T] extends Mix_I_wFooXI_wBar_If { ; ; f; } +// */class S_T_I_wFooXI_wBarY__[T] extends Mix_I_wFooXI_wBarY__ { ; def f: I = {sub; null}; f; } +// */class S_T_I_wFooXI_wBarY_f[T] extends Mix_I_wFooXI_wBarY_f { ; ; f; } +// */class S_T_I_wFooXI_wBarYI_[T] extends Mix_I_wFooXI_wBarYI_ { ; def f: I = {sub; null}; f; } +// */class S_T_I_wFooXI_wBarYIf[T] extends Mix_I_wFooXI_wBarYIf { ; ; f; } +// */class S_T_I_wFooXIf [T] extends Mix_I_wFooXIf { ; ; f; } +// */class S_T_I_wFooXIfwBar___[T] extends Mix_I_wFooXIfwBar___ { ; ; f; } +// */class S_T_I_wFooXIfwBar__f[T] extends Mix_I_wFooXIfwBar__f { ; ; f; } +// */class S_T_I_wFooXIfwBar_I_[T] extends Mix_I_wFooXIfwBar_I_ { ; ; f; } +// */class S_T_I_wFooXIfwBar_If[T] extends Mix_I_wFooXIfwBar_If { ; ; f; } +// */class S_T_I_wFooXIfwBarY__[T] extends Mix_I_wFooXIfwBarY__ { ; ; f; } +// */class S_T_I_wFooXIfwBarY_f[T] extends Mix_I_wFooXIfwBarY_f { ; ; f; } +// */class S_T_I_wFooXIfwBarYI_[T] extends Mix_I_wFooXIfwBarYI_ { ; ; f; } +// */class S_T_I_wFooXIfwBarYIf[T] extends Mix_I_wFooXIfwBarYIf { ; ; f; } + +/* */class S_T_IfwFoo___ [T] extends Mix_IfwFoo___ { ; ; f; } +/* */class S_T_IfwFoo___wBar___[T] extends Mix_IfwFoo___wBar___ { ; ; f; } +/* */class S_T_IfwFoo___wBar__f[T] extends Mix_IfwFoo___wBar__f { ; ; f; } +// */class S_T_IfwFoo___wBar_I_[T] extends Mix_IfwFoo___wBar_I_ { ; ; f; } +// */class S_T_IfwFoo___wBar_If[T] extends Mix_IfwFoo___wBar_If { ; ; f; } +/* */class S_T_IfwFoo___wBarY__[T] extends Mix_IfwFoo___wBarY__ { ; ; f; } +/* */class S_T_IfwFoo___wBarY_f[T] extends Mix_IfwFoo___wBarY_f { ; ; f; } +// */class S_T_IfwFoo___wBarYI_[T] extends Mix_IfwFoo___wBarYI_ { ; ; f; } +// */class S_T_IfwFoo___wBarYIf[T] extends Mix_IfwFoo___wBarYIf { ; ; f; } +/* */class S_T_IfwFoo__f [T] extends Mix_IfwFoo__f { ; ; f; } +/* */class S_T_IfwFoo__fwBar___[T] extends Mix_IfwFoo__fwBar___ { ; ; f; } +/* */class S_T_IfwFoo__fwBar__f[T] extends Mix_IfwFoo__fwBar__f { ; ; f; } +// */class S_T_IfwFoo__fwBar_I_[T] extends Mix_IfwFoo__fwBar_I_ { ; ; f; } +// */class S_T_IfwFoo__fwBar_If[T] extends Mix_IfwFoo__fwBar_If { ; ; f; } +/* */class S_T_IfwFoo__fwBarY__[T] extends Mix_IfwFoo__fwBarY__ { ; ; f; } +/* */class S_T_IfwFoo__fwBarY_f[T] extends Mix_IfwFoo__fwBarY_f { ; ; f; } +// */class S_T_IfwFoo__fwBarYI_[T] extends Mix_IfwFoo__fwBarYI_ { ; ; f; } +// */class S_T_IfwFoo__fwBarYIf[T] extends Mix_IfwFoo__fwBarYIf { ; ; f; } +// */class S_T_IfwFoo_I_ [T] extends Mix_IfwFoo_I_ { ; ; f; } +// */class S_T_IfwFoo_I_wBar___[T] extends Mix_IfwFoo_I_wBar___ { ; ; f; } +// */class S_T_IfwFoo_I_wBar__f[T] extends Mix_IfwFoo_I_wBar__f { ; ; f; } +// */class S_T_IfwFoo_I_wBar_I_[T] extends Mix_IfwFoo_I_wBar_I_ { ; ; f; } +// */class S_T_IfwFoo_I_wBar_If[T] extends Mix_IfwFoo_I_wBar_If { ; ; f; } +// */class S_T_IfwFoo_I_wBarY__[T] extends Mix_IfwFoo_I_wBarY__ { ; ; f; } +// */class S_T_IfwFoo_I_wBarY_f[T] extends Mix_IfwFoo_I_wBarY_f { ; ; f; } +// */class S_T_IfwFoo_I_wBarYI_[T] extends Mix_IfwFoo_I_wBarYI_ { ; ; f; } +// */class S_T_IfwFoo_I_wBarYIf[T] extends Mix_IfwFoo_I_wBarYIf { ; ; f; } +// */class S_T_IfwFoo_If [T] extends Mix_IfwFoo_If { ; ; f; } +// */class S_T_IfwFoo_IfwBar___[T] extends Mix_IfwFoo_IfwBar___ { ; ; f; } +// */class S_T_IfwFoo_IfwBar__f[T] extends Mix_IfwFoo_IfwBar__f { ; ; f; } +// */class S_T_IfwFoo_IfwBar_I_[T] extends Mix_IfwFoo_IfwBar_I_ { ; ; f; } +// */class S_T_IfwFoo_IfwBar_If[T] extends Mix_IfwFoo_IfwBar_If { ; ; f; } +// */class S_T_IfwFoo_IfwBarY__[T] extends Mix_IfwFoo_IfwBarY__ { ; ; f; } +// */class S_T_IfwFoo_IfwBarY_f[T] extends Mix_IfwFoo_IfwBarY_f { ; ; f; } +// */class S_T_IfwFoo_IfwBarYI_[T] extends Mix_IfwFoo_IfwBarYI_ { ; ; f; } +// */class S_T_IfwFoo_IfwBarYIf[T] extends Mix_IfwFoo_IfwBarYIf { ; ; f; } +/* */class S_T_IfwFooX__ [T] extends Mix_IfwFooX__ { ; ; f; } +/* */class S_T_IfwFooX__wBar___[T] extends Mix_IfwFooX__wBar___ { ; ; f; } +/* */class S_T_IfwFooX__wBar__f[T] extends Mix_IfwFooX__wBar__f { ; ; f; } +// */class S_T_IfwFooX__wBar_I_[T] extends Mix_IfwFooX__wBar_I_ { ; ; f; } +// */class S_T_IfwFooX__wBar_If[T] extends Mix_IfwFooX__wBar_If { ; ; f; } +/* */class S_T_IfwFooX__wBarY__[T] extends Mix_IfwFooX__wBarY__ { ; ; f; } +/* */class S_T_IfwFooX__wBarY_f[T] extends Mix_IfwFooX__wBarY_f { ; ; f; } +// */class S_T_IfwFooX__wBarYI_[T] extends Mix_IfwFooX__wBarYI_ { ; ; f; } +// */class S_T_IfwFooX__wBarYIf[T] extends Mix_IfwFooX__wBarYIf { ; ; f; } +/* */class S_T_IfwFooX_f [T] extends Mix_IfwFooX_f { ; ; f; } +/* */class S_T_IfwFooX_fwBar___[T] extends Mix_IfwFooX_fwBar___ { ; ; f; } +/* */class S_T_IfwFooX_fwBar__f[T] extends Mix_IfwFooX_fwBar__f { ; ; f; } +// */class S_T_IfwFooX_fwBar_I_[T] extends Mix_IfwFooX_fwBar_I_ { ; ; f; } +// */class S_T_IfwFooX_fwBar_If[T] extends Mix_IfwFooX_fwBar_If { ; ; f; } +/* */class S_T_IfwFooX_fwBarY__[T] extends Mix_IfwFooX_fwBarY__ { ; ; f; } +/* */class S_T_IfwFooX_fwBarY_f[T] extends Mix_IfwFooX_fwBarY_f { ; ; f; } +// */class S_T_IfwFooX_fwBarYI_[T] extends Mix_IfwFooX_fwBarYI_ { ; ; f; } +// */class S_T_IfwFooX_fwBarYIf[T] extends Mix_IfwFooX_fwBarYIf { ; ; f; } +// */class S_T_IfwFooXI_ [T] extends Mix_IfwFooXI_ { ; ; f; } +// */class S_T_IfwFooXI_wBar___[T] extends Mix_IfwFooXI_wBar___ { ; ; f; } +// */class S_T_IfwFooXI_wBar__f[T] extends Mix_IfwFooXI_wBar__f { ; ; f; } +// */class S_T_IfwFooXI_wBar_I_[T] extends Mix_IfwFooXI_wBar_I_ { ; ; f; } +// */class S_T_IfwFooXI_wBar_If[T] extends Mix_IfwFooXI_wBar_If { ; ; f; } +// */class S_T_IfwFooXI_wBarY__[T] extends Mix_IfwFooXI_wBarY__ { ; ; f; } +// */class S_T_IfwFooXI_wBarY_f[T] extends Mix_IfwFooXI_wBarY_f { ; ; f; } +// */class S_T_IfwFooXI_wBarYI_[T] extends Mix_IfwFooXI_wBarYI_ { ; ; f; } +// */class S_T_IfwFooXI_wBarYIf[T] extends Mix_IfwFooXI_wBarYIf { ; ; f; } +// */class S_T_IfwFooXIf [T] extends Mix_IfwFooXIf { ; ; f; } +// */class S_T_IfwFooXIfwBar___[T] extends Mix_IfwFooXIfwBar___ { ; ; f; } +// */class S_T_IfwFooXIfwBar__f[T] extends Mix_IfwFooXIfwBar__f { ; ; f; } +// */class S_T_IfwFooXIfwBar_I_[T] extends Mix_IfwFooXIfwBar_I_ { ; ; f; } +// */class S_T_IfwFooXIfwBar_If[T] extends Mix_IfwFooXIfwBar_If { ; ; f; } +// */class S_T_IfwFooXIfwBarY__[T] extends Mix_IfwFooXIfwBarY__ { ; ; f; } +// */class S_T_IfwFooXIfwBarY_f[T] extends Mix_IfwFooXIfwBarY_f { ; ; f; } +// */class S_T_IfwFooXIfwBarYI_[T] extends Mix_IfwFooXIfwBarYI_ { ; ; f; } +// */class S_T_IfwFooXIfwBarYIf[T] extends Mix_IfwFooXIfwBarYIf { ; ; f; } + +/* */class S_TZ__wFoo___ [T] extends MixZ__wFoo___ [C] { class I; def f: I = {sub; null}; f; } +/* */class S_TZ__wFoo___wBar___[T] extends MixZ__wFoo___wBar___[C] { class I; def f: I = {sub; null}; f; } +/* */class S_TZ__wFoo___wBar__f[T] extends MixZ__wFoo___wBar__f[C] { class I; ; f; } +/* */class S_TZ__wFoo___wBar_I_[T] extends MixZ__wFoo___wBar_I_[C] { ; def f: I = {sub; null}; f; } +/* */class S_TZ__wFoo___wBar_If[T] extends MixZ__wFoo___wBar_If[C] { ; ; f; } +/* */class S_TZ__wFoo___wBarY__[T] extends MixZ__wFoo___wBarY__[C] { class I; def f: I = {sub; null}; f; } +/* */class S_TZ__wFoo___wBarY_f[T] extends MixZ__wFoo___wBarY_f[C] { class I; ; f; } +/* */class S_TZ__wFoo___wBarYI_[T] extends MixZ__wFoo___wBarYI_[C] { ; def f: I = {sub; null}; f; } +/* */class S_TZ__wFoo___wBarYIf[T] extends MixZ__wFoo___wBarYIf[C] { ; ; f; } +/* */class S_TZ__wFoo__f [T] extends MixZ__wFoo__f [C] { class I; ; f; } +/* */class S_TZ__wFoo__fwBar___[T] extends MixZ__wFoo__fwBar___[C] { class I; ; f; } +// */class S_TZ__wFoo__fwBar__f[T] extends MixZ__wFoo__fwBar__f[C] { class I; ; f; } +/* */class S_TZ__wFoo__fwBar_I_[T] extends MixZ__wFoo__fwBar_I_[C] { ; ; f; } +// */class S_TZ__wFoo__fwBar_If[T] extends MixZ__wFoo__fwBar_If[C] { ; ; f; } +/* */class S_TZ__wFoo__fwBarY__[T] extends MixZ__wFoo__fwBarY__[C] { class I; ; f; } +// */class S_TZ__wFoo__fwBarY_f[T] extends MixZ__wFoo__fwBarY_f[C] { class I; ; f; } +/* */class S_TZ__wFoo__fwBarYI_[T] extends MixZ__wFoo__fwBarYI_[C] { ; ; f; } +// */class S_TZ__wFoo__fwBarYIf[T] extends MixZ__wFoo__fwBarYIf[C] { ; ; f; } +/* */class S_TZ__wFoo_I_ [T] extends MixZ__wFoo_I_ [C] { ; def f: I = {sub; null}; f; } +/* */class S_TZ__wFoo_I_wBar___[T] extends MixZ__wFoo_I_wBar___[C] { ; def f: I = {sub; null}; f; } +/* */class S_TZ__wFoo_I_wBar__f[T] extends MixZ__wFoo_I_wBar__f[C] { ; ; f; } +// */class S_TZ__wFoo_I_wBar_I_[T] extends MixZ__wFoo_I_wBar_I_[C] { ; def f: I = {sub; null}; f; } +// */class S_TZ__wFoo_I_wBar_If[T] extends MixZ__wFoo_I_wBar_If[C] { ; ; f; } +/* */class S_TZ__wFoo_I_wBarY__[T] extends MixZ__wFoo_I_wBarY__[C] { ; def f: I = {sub; null}; f; } +/* */class S_TZ__wFoo_I_wBarY_f[T] extends MixZ__wFoo_I_wBarY_f[C] { ; ; f; } +// */class S_TZ__wFoo_I_wBarYI_[T] extends MixZ__wFoo_I_wBarYI_[C] { ; def f: I = {sub; null}; f; } +// */class S_TZ__wFoo_I_wBarYIf[T] extends MixZ__wFoo_I_wBarYIf[C] { ; ; f; } +/* */class S_TZ__wFoo_If [T] extends MixZ__wFoo_If [C] { ; ; f; } +/* */class S_TZ__wFoo_IfwBar___[T] extends MixZ__wFoo_IfwBar___[C] { ; ; f; } +// */class S_TZ__wFoo_IfwBar__f[T] extends MixZ__wFoo_IfwBar__f[C] { ; ; f; } +// */class S_TZ__wFoo_IfwBar_I_[T] extends MixZ__wFoo_IfwBar_I_[C] { ; ; f; } +// */class S_TZ__wFoo_IfwBar_If[T] extends MixZ__wFoo_IfwBar_If[C] { ; ; f; } +/* */class S_TZ__wFoo_IfwBarY__[T] extends MixZ__wFoo_IfwBarY__[C] { ; ; f; } +// */class S_TZ__wFoo_IfwBarY_f[T] extends MixZ__wFoo_IfwBarY_f[C] { ; ; f; } +// */class S_TZ__wFoo_IfwBarYI_[T] extends MixZ__wFoo_IfwBarYI_[C] { ; ; f; } +// */class S_TZ__wFoo_IfwBarYIf[T] extends MixZ__wFoo_IfwBarYIf[C] { ; ; f; } +/* */class S_TZ__wFooX__ [T] extends MixZ__wFooX__ [C] { class I; def f: I = {sub; null}; f; } +/* */class S_TZ__wFooX__wBar___[T] extends MixZ__wFooX__wBar___[C] { class I; def f: I = {sub; null}; f; } +/* */class S_TZ__wFooX__wBar__f[T] extends MixZ__wFooX__wBar__f[C] { class I; ; f; } +/* */class S_TZ__wFooX__wBar_I_[T] extends MixZ__wFooX__wBar_I_[C] { ; def f: I = {sub; null}; f; } +/* */class S_TZ__wFooX__wBar_If[T] extends MixZ__wFooX__wBar_If[C] { ; ; f; } +/* */class S_TZ__wFooX__wBarY__[T] extends MixZ__wFooX__wBarY__[C] { class I; def f: I = {sub; null}; f; } +/* */class S_TZ__wFooX__wBarY_f[T] extends MixZ__wFooX__wBarY_f[C] { class I; ; f; } +/* */class S_TZ__wFooX__wBarYI_[T] extends MixZ__wFooX__wBarYI_[C] { ; def f: I = {sub; null}; f; } +/* */class S_TZ__wFooX__wBarYIf[T] extends MixZ__wFooX__wBarYIf[C] { ; ; f; } +/* */class S_TZ__wFooX_f [T] extends MixZ__wFooX_f [C] { class I; ; f; } +/* */class S_TZ__wFooX_fwBar___[T] extends MixZ__wFooX_fwBar___[C] { class I; ; f; } +// */class S_TZ__wFooX_fwBar__f[T] extends MixZ__wFooX_fwBar__f[C] { class I; ; f; } +/* */class S_TZ__wFooX_fwBar_I_[T] extends MixZ__wFooX_fwBar_I_[C] { ; ; f; } +// */class S_TZ__wFooX_fwBar_If[T] extends MixZ__wFooX_fwBar_If[C] { ; ; f; } +/* */class S_TZ__wFooX_fwBarY__[T] extends MixZ__wFooX_fwBarY__[C] { class I; ; f; } +// */class S_TZ__wFooX_fwBarY_f[T] extends MixZ__wFooX_fwBarY_f[C] { class I; ; f; } +/* */class S_TZ__wFooX_fwBarYI_[T] extends MixZ__wFooX_fwBarYI_[C] { ; ; f; } +// */class S_TZ__wFooX_fwBarYIf[T] extends MixZ__wFooX_fwBarYIf[C] { ; ; f; } +/* */class S_TZ__wFooXI_ [T] extends MixZ__wFooXI_ [C] { ; def f: I = {sub; null}; f; } +/* */class S_TZ__wFooXI_wBar___[T] extends MixZ__wFooXI_wBar___[C] { ; def f: I = {sub; null}; f; } +/* */class S_TZ__wFooXI_wBar__f[T] extends MixZ__wFooXI_wBar__f[C] { ; ; f; } +// */class S_TZ__wFooXI_wBar_I_[T] extends MixZ__wFooXI_wBar_I_[C] { ; def f: I = {sub; null}; f; } +// */class S_TZ__wFooXI_wBar_If[T] extends MixZ__wFooXI_wBar_If[C] { ; ; f; } +/* */class S_TZ__wFooXI_wBarY__[T] extends MixZ__wFooXI_wBarY__[C] { ; def f: I = {sub; null}; f; } +/* */class S_TZ__wFooXI_wBarY_f[T] extends MixZ__wFooXI_wBarY_f[C] { ; ; f; } +// */class S_TZ__wFooXI_wBarYI_[T] extends MixZ__wFooXI_wBarYI_[C] { ; def f: I = {sub; null}; f; } +// */class S_TZ__wFooXI_wBarYIf[T] extends MixZ__wFooXI_wBarYIf[C] { ; ; f; } +/* */class S_TZ__wFooXIf [T] extends MixZ__wFooXIf [C] { ; ; f; } +/* */class S_TZ__wFooXIfwBar___[T] extends MixZ__wFooXIfwBar___[C] { ; ; f; } +// */class S_TZ__wFooXIfwBar__f[T] extends MixZ__wFooXIfwBar__f[C] { ; ; f; } +// */class S_TZ__wFooXIfwBar_I_[T] extends MixZ__wFooXIfwBar_I_[C] { ; ; f; } +// */class S_TZ__wFooXIfwBar_If[T] extends MixZ__wFooXIfwBar_If[C] { ; ; f; } +/* */class S_TZ__wFooXIfwBarY__[T] extends MixZ__wFooXIfwBarY__[C] { ; ; f; } +// */class S_TZ__wFooXIfwBarY_f[T] extends MixZ__wFooXIfwBarY_f[C] { ; ; f; } +// */class S_TZ__wFooXIfwBarYI_[T] extends MixZ__wFooXIfwBarYI_[C] { ; ; f; } +// */class S_TZ__wFooXIfwBarYIf[T] extends MixZ__wFooXIfwBarYIf[C] { ; ; f; } + +/* */class S_TZ_fwFoo___ [T] extends MixZ_fwFoo___ [C] { class I; ; f; } +/* */class S_TZ_fwFoo___wBar___[T] extends MixZ_fwFoo___wBar___[C] { class I; ; f; } +/* */class S_TZ_fwFoo___wBar__f[T] extends MixZ_fwFoo___wBar__f[C] { class I; ; f; } +/* */class S_TZ_fwFoo___wBar_I_[T] extends MixZ_fwFoo___wBar_I_[C] { ; ; f; } +/* */class S_TZ_fwFoo___wBar_If[T] extends MixZ_fwFoo___wBar_If[C] { ; ; f; } +/* */class S_TZ_fwFoo___wBarY__[T] extends MixZ_fwFoo___wBarY__[C] { class I; ; f; } +/* */class S_TZ_fwFoo___wBarY_f[T] extends MixZ_fwFoo___wBarY_f[C] { class I; ; f; } +/* */class S_TZ_fwFoo___wBarYI_[T] extends MixZ_fwFoo___wBarYI_[C] { ; ; f; } +/* */class S_TZ_fwFoo___wBarYIf[T] extends MixZ_fwFoo___wBarYIf[C] { ; ; f; } +/* */class S_TZ_fwFoo__f [T] extends MixZ_fwFoo__f [C] { class I; ; f; } +/* */class S_TZ_fwFoo__fwBar___[T] extends MixZ_fwFoo__fwBar___[C] { class I; ; f; } +/* */class S_TZ_fwFoo__fwBar__f[T] extends MixZ_fwFoo__fwBar__f[C] { class I; ; f; } +/* */class S_TZ_fwFoo__fwBar_I_[T] extends MixZ_fwFoo__fwBar_I_[C] { ; ; f; } +/* */class S_TZ_fwFoo__fwBar_If[T] extends MixZ_fwFoo__fwBar_If[C] { ; ; f; } +/* */class S_TZ_fwFoo__fwBarY__[T] extends MixZ_fwFoo__fwBarY__[C] { class I; ; f; } +/* */class S_TZ_fwFoo__fwBarY_f[T] extends MixZ_fwFoo__fwBarY_f[C] { class I; ; f; } +/* */class S_TZ_fwFoo__fwBarYI_[T] extends MixZ_fwFoo__fwBarYI_[C] { ; ; f; } +/* */class S_TZ_fwFoo__fwBarYIf[T] extends MixZ_fwFoo__fwBarYIf[C] { ; ; f; } +/* */class S_TZ_fwFoo_I_ [T] extends MixZ_fwFoo_I_ [C] { ; ; f; } +/* */class S_TZ_fwFoo_I_wBar___[T] extends MixZ_fwFoo_I_wBar___[C] { ; ; f; } +/* */class S_TZ_fwFoo_I_wBar__f[T] extends MixZ_fwFoo_I_wBar__f[C] { ; ; f; } +// */class S_TZ_fwFoo_I_wBar_I_[T] extends MixZ_fwFoo_I_wBar_I_[C] { ; ; f; } +// */class S_TZ_fwFoo_I_wBar_If[T] extends MixZ_fwFoo_I_wBar_If[C] { ; ; f; } +/* */class S_TZ_fwFoo_I_wBarY__[T] extends MixZ_fwFoo_I_wBarY__[C] { ; ; f; } +/* */class S_TZ_fwFoo_I_wBarY_f[T] extends MixZ_fwFoo_I_wBarY_f[C] { ; ; f; } +// */class S_TZ_fwFoo_I_wBarYI_[T] extends MixZ_fwFoo_I_wBarYI_[C] { ; ; f; } +// */class S_TZ_fwFoo_I_wBarYIf[T] extends MixZ_fwFoo_I_wBarYIf[C] { ; ; f; } +/* */class S_TZ_fwFoo_If [T] extends MixZ_fwFoo_If [C] { ; ; f; } +/* */class S_TZ_fwFoo_IfwBar___[T] extends MixZ_fwFoo_IfwBar___[C] { ; ; f; } +/* */class S_TZ_fwFoo_IfwBar__f[T] extends MixZ_fwFoo_IfwBar__f[C] { ; ; f; } +// */class S_TZ_fwFoo_IfwBar_I_[T] extends MixZ_fwFoo_IfwBar_I_[C] { ; ; f; } +// */class S_TZ_fwFoo_IfwBar_If[T] extends MixZ_fwFoo_IfwBar_If[C] { ; ; f; } +/* */class S_TZ_fwFoo_IfwBarY__[T] extends MixZ_fwFoo_IfwBarY__[C] { ; ; f; } +/* */class S_TZ_fwFoo_IfwBarY_f[T] extends MixZ_fwFoo_IfwBarY_f[C] { ; ; f; } +// */class S_TZ_fwFoo_IfwBarYI_[T] extends MixZ_fwFoo_IfwBarYI_[C] { ; ; f; } +// */class S_TZ_fwFoo_IfwBarYIf[T] extends MixZ_fwFoo_IfwBarYIf[C] { ; ; f; } +/* */class S_TZ_fwFooX__ [T] extends MixZ_fwFooX__ [C] { class I; ; f; } +/* */class S_TZ_fwFooX__wBar___[T] extends MixZ_fwFooX__wBar___[C] { class I; ; f; } +/* */class S_TZ_fwFooX__wBar__f[T] extends MixZ_fwFooX__wBar__f[C] { class I; ; f; } +/* */class S_TZ_fwFooX__wBar_I_[T] extends MixZ_fwFooX__wBar_I_[C] { ; ; f; } +/* */class S_TZ_fwFooX__wBar_If[T] extends MixZ_fwFooX__wBar_If[C] { ; ; f; } +/* */class S_TZ_fwFooX__wBarY__[T] extends MixZ_fwFooX__wBarY__[C] { class I; ; f; } +/* */class S_TZ_fwFooX__wBarY_f[T] extends MixZ_fwFooX__wBarY_f[C] { class I; ; f; } +/* */class S_TZ_fwFooX__wBarYI_[T] extends MixZ_fwFooX__wBarYI_[C] { ; ; f; } +/* */class S_TZ_fwFooX__wBarYIf[T] extends MixZ_fwFooX__wBarYIf[C] { ; ; f; } +/* */class S_TZ_fwFooX_f [T] extends MixZ_fwFooX_f [C] { class I; ; f; } +/* */class S_TZ_fwFooX_fwBar___[T] extends MixZ_fwFooX_fwBar___[C] { class I; ; f; } +/* */class S_TZ_fwFooX_fwBar__f[T] extends MixZ_fwFooX_fwBar__f[C] { class I; ; f; } +/* */class S_TZ_fwFooX_fwBar_I_[T] extends MixZ_fwFooX_fwBar_I_[C] { ; ; f; } +/* */class S_TZ_fwFooX_fwBar_If[T] extends MixZ_fwFooX_fwBar_If[C] { ; ; f; } +/* */class S_TZ_fwFooX_fwBarY__[T] extends MixZ_fwFooX_fwBarY__[C] { class I; ; f; } +/* */class S_TZ_fwFooX_fwBarY_f[T] extends MixZ_fwFooX_fwBarY_f[C] { class I; ; f; } +/* */class S_TZ_fwFooX_fwBarYI_[T] extends MixZ_fwFooX_fwBarYI_[C] { ; ; f; } +/* */class S_TZ_fwFooX_fwBarYIf[T] extends MixZ_fwFooX_fwBarYIf[C] { ; ; f; } +/* */class S_TZ_fwFooXI_ [T] extends MixZ_fwFooXI_ [C] { ; ; f; } +/* */class S_TZ_fwFooXI_wBar___[T] extends MixZ_fwFooXI_wBar___[C] { ; ; f; } +/* */class S_TZ_fwFooXI_wBar__f[T] extends MixZ_fwFooXI_wBar__f[C] { ; ; f; } +// */class S_TZ_fwFooXI_wBar_I_[T] extends MixZ_fwFooXI_wBar_I_[C] { ; ; f; } +// */class S_TZ_fwFooXI_wBar_If[T] extends MixZ_fwFooXI_wBar_If[C] { ; ; f; } +/* */class S_TZ_fwFooXI_wBarY__[T] extends MixZ_fwFooXI_wBarY__[C] { ; ; f; } +/* */class S_TZ_fwFooXI_wBarY_f[T] extends MixZ_fwFooXI_wBarY_f[C] { ; ; f; } +// */class S_TZ_fwFooXI_wBarYI_[T] extends MixZ_fwFooXI_wBarYI_[C] { ; ; f; } +// */class S_TZ_fwFooXI_wBarYIf[T] extends MixZ_fwFooXI_wBarYIf[C] { ; ; f; } +/* */class S_TZ_fwFooXIf [T] extends MixZ_fwFooXIf [C] { ; ; f; } +/* */class S_TZ_fwFooXIfwBar___[T] extends MixZ_fwFooXIfwBar___[C] { ; ; f; } +/* */class S_TZ_fwFooXIfwBar__f[T] extends MixZ_fwFooXIfwBar__f[C] { ; ; f; } +// */class S_TZ_fwFooXIfwBar_I_[T] extends MixZ_fwFooXIfwBar_I_[C] { ; ; f; } +// */class S_TZ_fwFooXIfwBar_If[T] extends MixZ_fwFooXIfwBar_If[C] { ; ; f; } +/* */class S_TZ_fwFooXIfwBarY__[T] extends MixZ_fwFooXIfwBarY__[C] { ; ; f; } +/* */class S_TZ_fwFooXIfwBarY_f[T] extends MixZ_fwFooXIfwBarY_f[C] { ; ; f; } +// */class S_TZ_fwFooXIfwBarYI_[T] extends MixZ_fwFooXIfwBarYI_[C] { ; ; f; } +// */class S_TZ_fwFooXIfwBarYIf[T] extends MixZ_fwFooXIfwBarYIf[C] { ; ; f; } + +/* */class S_TZI_wFoo___ [T] extends MixZI_wFoo___ [C] { ; def f: I = {sub; null}; f; } +/* */class S_TZI_wFoo___wBar___[T] extends MixZI_wFoo___wBar___[C] { ; def f: I = {sub; null}; f; } +/* */class S_TZI_wFoo___wBar__f[T] extends MixZI_wFoo___wBar__f[C] { ; ; f; } +// */class S_TZI_wFoo___wBar_I_[T] extends MixZI_wFoo___wBar_I_[C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_wFoo___wBar_If[T] extends MixZI_wFoo___wBar_If[C] { ; ; f; } +/* */class S_TZI_wFoo___wBarY__[T] extends MixZI_wFoo___wBarY__[C] { ; def f: I = {sub; null}; f; } +/* */class S_TZI_wFoo___wBarY_f[T] extends MixZI_wFoo___wBarY_f[C] { ; ; f; } +// */class S_TZI_wFoo___wBarYI_[T] extends MixZI_wFoo___wBarYI_[C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_wFoo___wBarYIf[T] extends MixZI_wFoo___wBarYIf[C] { ; ; f; } +/* */class S_TZI_wFoo__f [T] extends MixZI_wFoo__f [C] { ; ; f; } +/* */class S_TZI_wFoo__fwBar___[T] extends MixZI_wFoo__fwBar___[C] { ; ; f; } +// */class S_TZI_wFoo__fwBar__f[T] extends MixZI_wFoo__fwBar__f[C] { ; ; f; } +// */class S_TZI_wFoo__fwBar_I_[T] extends MixZI_wFoo__fwBar_I_[C] { ; ; f; } +// */class S_TZI_wFoo__fwBar_If[T] extends MixZI_wFoo__fwBar_If[C] { ; ; f; } +/* */class S_TZI_wFoo__fwBarY__[T] extends MixZI_wFoo__fwBarY__[C] { ; ; f; } +// */class S_TZI_wFoo__fwBarY_f[T] extends MixZI_wFoo__fwBarY_f[C] { ; ; f; } +// */class S_TZI_wFoo__fwBarYI_[T] extends MixZI_wFoo__fwBarYI_[C] { ; ; f; } +// */class S_TZI_wFoo__fwBarYIf[T] extends MixZI_wFoo__fwBarYIf[C] { ; ; f; } +// */class S_TZI_wFoo_I_ [T] extends MixZI_wFoo_I_ [C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_wFoo_I_wBar___[T] extends MixZI_wFoo_I_wBar___[C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_wFoo_I_wBar__f[T] extends MixZI_wFoo_I_wBar__f[C] { ; ; f; } +// */class S_TZI_wFoo_I_wBar_I_[T] extends MixZI_wFoo_I_wBar_I_[C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_wFoo_I_wBar_If[T] extends MixZI_wFoo_I_wBar_If[C] { ; ; f; } +// */class S_TZI_wFoo_I_wBarY__[T] extends MixZI_wFoo_I_wBarY__[C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_wFoo_I_wBarY_f[T] extends MixZI_wFoo_I_wBarY_f[C] { ; ; f; } +// */class S_TZI_wFoo_I_wBarYI_[T] extends MixZI_wFoo_I_wBarYI_[C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_wFoo_I_wBarYIf[T] extends MixZI_wFoo_I_wBarYIf[C] { ; ; f; } +// */class S_TZI_wFoo_If [T] extends MixZI_wFoo_If [C] { ; ; f; } +// */class S_TZI_wFoo_IfwBar___[T] extends MixZI_wFoo_IfwBar___[C] { ; ; f; } +// */class S_TZI_wFoo_IfwBar__f[T] extends MixZI_wFoo_IfwBar__f[C] { ; ; f; } +// */class S_TZI_wFoo_IfwBar_I_[T] extends MixZI_wFoo_IfwBar_I_[C] { ; ; f; } +// */class S_TZI_wFoo_IfwBar_If[T] extends MixZI_wFoo_IfwBar_If[C] { ; ; f; } +// */class S_TZI_wFoo_IfwBarY__[T] extends MixZI_wFoo_IfwBarY__[C] { ; ; f; } +// */class S_TZI_wFoo_IfwBarY_f[T] extends MixZI_wFoo_IfwBarY_f[C] { ; ; f; } +// */class S_TZI_wFoo_IfwBarYI_[T] extends MixZI_wFoo_IfwBarYI_[C] { ; ; f; } +// */class S_TZI_wFoo_IfwBarYIf[T] extends MixZI_wFoo_IfwBarYIf[C] { ; ; f; } +/* */class S_TZI_wFooX__ [T] extends MixZI_wFooX__ [C] { ; def f: I = {sub; null}; f; } +/* */class S_TZI_wFooX__wBar___[T] extends MixZI_wFooX__wBar___[C] { ; def f: I = {sub; null}; f; } +/* */class S_TZI_wFooX__wBar__f[T] extends MixZI_wFooX__wBar__f[C] { ; ; f; } +// */class S_TZI_wFooX__wBar_I_[T] extends MixZI_wFooX__wBar_I_[C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_wFooX__wBar_If[T] extends MixZI_wFooX__wBar_If[C] { ; ; f; } +/* */class S_TZI_wFooX__wBarY__[T] extends MixZI_wFooX__wBarY__[C] { ; def f: I = {sub; null}; f; } +/* */class S_TZI_wFooX__wBarY_f[T] extends MixZI_wFooX__wBarY_f[C] { ; ; f; } +// */class S_TZI_wFooX__wBarYI_[T] extends MixZI_wFooX__wBarYI_[C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_wFooX__wBarYIf[T] extends MixZI_wFooX__wBarYIf[C] { ; ; f; } +/* */class S_TZI_wFooX_f [T] extends MixZI_wFooX_f [C] { ; ; f; } +/* */class S_TZI_wFooX_fwBar___[T] extends MixZI_wFooX_fwBar___[C] { ; ; f; } +// */class S_TZI_wFooX_fwBar__f[T] extends MixZI_wFooX_fwBar__f[C] { ; ; f; } +// */class S_TZI_wFooX_fwBar_I_[T] extends MixZI_wFooX_fwBar_I_[C] { ; ; f; } +// */class S_TZI_wFooX_fwBar_If[T] extends MixZI_wFooX_fwBar_If[C] { ; ; f; } +/* */class S_TZI_wFooX_fwBarY__[T] extends MixZI_wFooX_fwBarY__[C] { ; ; f; } +// */class S_TZI_wFooX_fwBarY_f[T] extends MixZI_wFooX_fwBarY_f[C] { ; ; f; } +// */class S_TZI_wFooX_fwBarYI_[T] extends MixZI_wFooX_fwBarYI_[C] { ; ; f; } +// */class S_TZI_wFooX_fwBarYIf[T] extends MixZI_wFooX_fwBarYIf[C] { ; ; f; } +// */class S_TZI_wFooXI_ [T] extends MixZI_wFooXI_ [C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_wFooXI_wBar___[T] extends MixZI_wFooXI_wBar___[C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_wFooXI_wBar__f[T] extends MixZI_wFooXI_wBar__f[C] { ; ; f; } +// */class S_TZI_wFooXI_wBar_I_[T] extends MixZI_wFooXI_wBar_I_[C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_wFooXI_wBar_If[T] extends MixZI_wFooXI_wBar_If[C] { ; ; f; } +// */class S_TZI_wFooXI_wBarY__[T] extends MixZI_wFooXI_wBarY__[C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_wFooXI_wBarY_f[T] extends MixZI_wFooXI_wBarY_f[C] { ; ; f; } +// */class S_TZI_wFooXI_wBarYI_[T] extends MixZI_wFooXI_wBarYI_[C] { ; def f: I = {sub; null}; f; } +// */class S_TZI_wFooXI_wBarYIf[T] extends MixZI_wFooXI_wBarYIf[C] { ; ; f; } +// */class S_TZI_wFooXIf [T] extends MixZI_wFooXIf [C] { ; ; f; } +// */class S_TZI_wFooXIfwBar___[T] extends MixZI_wFooXIfwBar___[C] { ; ; f; } +// */class S_TZI_wFooXIfwBar__f[T] extends MixZI_wFooXIfwBar__f[C] { ; ; f; } +// */class S_TZI_wFooXIfwBar_I_[T] extends MixZI_wFooXIfwBar_I_[C] { ; ; f; } +// */class S_TZI_wFooXIfwBar_If[T] extends MixZI_wFooXIfwBar_If[C] { ; ; f; } +// */class S_TZI_wFooXIfwBarY__[T] extends MixZI_wFooXIfwBarY__[C] { ; ; f; } +// */class S_TZI_wFooXIfwBarY_f[T] extends MixZI_wFooXIfwBarY_f[C] { ; ; f; } +// */class S_TZI_wFooXIfwBarYI_[T] extends MixZI_wFooXIfwBarYI_[C] { ; ; f; } +// */class S_TZI_wFooXIfwBarYIf[T] extends MixZI_wFooXIfwBarYIf[C] { ; ; f; } + +/* */class S_TZIfwFoo___ [T] extends MixZIfwFoo___ [C] { ; ; f; } +/* */class S_TZIfwFoo___wBar___[T] extends MixZIfwFoo___wBar___[C] { ; ; f; } +/* */class S_TZIfwFoo___wBar__f[T] extends MixZIfwFoo___wBar__f[C] { ; ; f; } +// */class S_TZIfwFoo___wBar_I_[T] extends MixZIfwFoo___wBar_I_[C] { ; ; f; } +// */class S_TZIfwFoo___wBar_If[T] extends MixZIfwFoo___wBar_If[C] { ; ; f; } +/* */class S_TZIfwFoo___wBarY__[T] extends MixZIfwFoo___wBarY__[C] { ; ; f; } +/* */class S_TZIfwFoo___wBarY_f[T] extends MixZIfwFoo___wBarY_f[C] { ; ; f; } +// */class S_TZIfwFoo___wBarYI_[T] extends MixZIfwFoo___wBarYI_[C] { ; ; f; } +// */class S_TZIfwFoo___wBarYIf[T] extends MixZIfwFoo___wBarYIf[C] { ; ; f; } +/* */class S_TZIfwFoo__f [T] extends MixZIfwFoo__f [C] { ; ; f; } +/* */class S_TZIfwFoo__fwBar___[T] extends MixZIfwFoo__fwBar___[C] { ; ; f; } +/* */class S_TZIfwFoo__fwBar__f[T] extends MixZIfwFoo__fwBar__f[C] { ; ; f; } +// */class S_TZIfwFoo__fwBar_I_[T] extends MixZIfwFoo__fwBar_I_[C] { ; ; f; } +// */class S_TZIfwFoo__fwBar_If[T] extends MixZIfwFoo__fwBar_If[C] { ; ; f; } +/* */class S_TZIfwFoo__fwBarY__[T] extends MixZIfwFoo__fwBarY__[C] { ; ; f; } +/* */class S_TZIfwFoo__fwBarY_f[T] extends MixZIfwFoo__fwBarY_f[C] { ; ; f; } +// */class S_TZIfwFoo__fwBarYI_[T] extends MixZIfwFoo__fwBarYI_[C] { ; ; f; } +// */class S_TZIfwFoo__fwBarYIf[T] extends MixZIfwFoo__fwBarYIf[C] { ; ; f; } +// */class S_TZIfwFoo_I_ [T] extends MixZIfwFoo_I_ [C] { ; ; f; } +// */class S_TZIfwFoo_I_wBar___[T] extends MixZIfwFoo_I_wBar___[C] { ; ; f; } +// */class S_TZIfwFoo_I_wBar__f[T] extends MixZIfwFoo_I_wBar__f[C] { ; ; f; } +// */class S_TZIfwFoo_I_wBar_I_[T] extends MixZIfwFoo_I_wBar_I_[C] { ; ; f; } +// */class S_TZIfwFoo_I_wBar_If[T] extends MixZIfwFoo_I_wBar_If[C] { ; ; f; } +// */class S_TZIfwFoo_I_wBarY__[T] extends MixZIfwFoo_I_wBarY__[C] { ; ; f; } +// */class S_TZIfwFoo_I_wBarY_f[T] extends MixZIfwFoo_I_wBarY_f[C] { ; ; f; } +// */class S_TZIfwFoo_I_wBarYI_[T] extends MixZIfwFoo_I_wBarYI_[C] { ; ; f; } +// */class S_TZIfwFoo_I_wBarYIf[T] extends MixZIfwFoo_I_wBarYIf[C] { ; ; f; } +// */class S_TZIfwFoo_If [T] extends MixZIfwFoo_If [C] { ; ; f; } +// */class S_TZIfwFoo_IfwBar___[T] extends MixZIfwFoo_IfwBar___[C] { ; ; f; } +// */class S_TZIfwFoo_IfwBar__f[T] extends MixZIfwFoo_IfwBar__f[C] { ; ; f; } +// */class S_TZIfwFoo_IfwBar_I_[T] extends MixZIfwFoo_IfwBar_I_[C] { ; ; f; } +// */class S_TZIfwFoo_IfwBar_If[T] extends MixZIfwFoo_IfwBar_If[C] { ; ; f; } +// */class S_TZIfwFoo_IfwBarY__[T] extends MixZIfwFoo_IfwBarY__[C] { ; ; f; } +// */class S_TZIfwFoo_IfwBarY_f[T] extends MixZIfwFoo_IfwBarY_f[C] { ; ; f; } +// */class S_TZIfwFoo_IfwBarYI_[T] extends MixZIfwFoo_IfwBarYI_[C] { ; ; f; } +// */class S_TZIfwFoo_IfwBarYIf[T] extends MixZIfwFoo_IfwBarYIf[C] { ; ; f; } +/* */class S_TZIfwFooX__ [T] extends MixZIfwFooX__ [C] { ; ; f; } +/* */class S_TZIfwFooX__wBar___[T] extends MixZIfwFooX__wBar___[C] { ; ; f; } +/* */class S_TZIfwFooX__wBar__f[T] extends MixZIfwFooX__wBar__f[C] { ; ; f; } +// */class S_TZIfwFooX__wBar_I_[T] extends MixZIfwFooX__wBar_I_[C] { ; ; f; } +// */class S_TZIfwFooX__wBar_If[T] extends MixZIfwFooX__wBar_If[C] { ; ; f; } +/* */class S_TZIfwFooX__wBarY__[T] extends MixZIfwFooX__wBarY__[C] { ; ; f; } +/* */class S_TZIfwFooX__wBarY_f[T] extends MixZIfwFooX__wBarY_f[C] { ; ; f; } +// */class S_TZIfwFooX__wBarYI_[T] extends MixZIfwFooX__wBarYI_[C] { ; ; f; } +// */class S_TZIfwFooX__wBarYIf[T] extends MixZIfwFooX__wBarYIf[C] { ; ; f; } +/* */class S_TZIfwFooX_f [T] extends MixZIfwFooX_f [C] { ; ; f; } +/* */class S_TZIfwFooX_fwBar___[T] extends MixZIfwFooX_fwBar___[C] { ; ; f; } +/* */class S_TZIfwFooX_fwBar__f[T] extends MixZIfwFooX_fwBar__f[C] { ; ; f; } +// */class S_TZIfwFooX_fwBar_I_[T] extends MixZIfwFooX_fwBar_I_[C] { ; ; f; } +// */class S_TZIfwFooX_fwBar_If[T] extends MixZIfwFooX_fwBar_If[C] { ; ; f; } +/* */class S_TZIfwFooX_fwBarY__[T] extends MixZIfwFooX_fwBarY__[C] { ; ; f; } +/* */class S_TZIfwFooX_fwBarY_f[T] extends MixZIfwFooX_fwBarY_f[C] { ; ; f; } +// */class S_TZIfwFooX_fwBarYI_[T] extends MixZIfwFooX_fwBarYI_[C] { ; ; f; } +// */class S_TZIfwFooX_fwBarYIf[T] extends MixZIfwFooX_fwBarYIf[C] { ; ; f; } +// */class S_TZIfwFooXI_ [T] extends MixZIfwFooXI_ [C] { ; ; f; } +// */class S_TZIfwFooXI_wBar___[T] extends MixZIfwFooXI_wBar___[C] { ; ; f; } +// */class S_TZIfwFooXI_wBar__f[T] extends MixZIfwFooXI_wBar__f[C] { ; ; f; } +// */class S_TZIfwFooXI_wBar_I_[T] extends MixZIfwFooXI_wBar_I_[C] { ; ; f; } +// */class S_TZIfwFooXI_wBar_If[T] extends MixZIfwFooXI_wBar_If[C] { ; ; f; } +// */class S_TZIfwFooXI_wBarY__[T] extends MixZIfwFooXI_wBarY__[C] { ; ; f; } +// */class S_TZIfwFooXI_wBarY_f[T] extends MixZIfwFooXI_wBarY_f[C] { ; ; f; } +// */class S_TZIfwFooXI_wBarYI_[T] extends MixZIfwFooXI_wBarYI_[C] { ; ; f; } +// */class S_TZIfwFooXI_wBarYIf[T] extends MixZIfwFooXI_wBarYIf[C] { ; ; f; } +// */class S_TZIfwFooXIf [T] extends MixZIfwFooXIf [C] { ; ; f; } +// */class S_TZIfwFooXIfwBar___[T] extends MixZIfwFooXIfwBar___[C] { ; ; f; } +// */class S_TZIfwFooXIfwBar__f[T] extends MixZIfwFooXIfwBar__f[C] { ; ; f; } +// */class S_TZIfwFooXIfwBar_I_[T] extends MixZIfwFooXIfwBar_I_[C] { ; ; f; } +// */class S_TZIfwFooXIfwBar_If[T] extends MixZIfwFooXIfwBar_If[C] { ; ; f; } +// */class S_TZIfwFooXIfwBarY__[T] extends MixZIfwFooXIfwBarY__[C] { ; ; f; } +// */class S_TZIfwFooXIfwBarY_f[T] extends MixZIfwFooXIfwBarY_f[C] { ; ; f; } +// */class S_TZIfwFooXIfwBarYI_[T] extends MixZIfwFooXIfwBarYI_[C] { ; ; f; } +// */class S_TZIfwFooXIfwBarYIf[T] extends MixZIfwFooXIfwBarYIf[C] { ; ; f; } + + + +object Test { + var errors: Int = 0; + def test(name: String, test: => Any, count: Int, value: String) = { + try { + Help.init; + test; + if (!Help.check(count, value)) { + Console.print(name + " failed: "); + Help.print; + Console.println; + errors = errors + 1; + } + } catch { + case exception => { + Console.print(name + " raised exception " + exception); + Console.println; + errors = errors + 1; + } + } + } + + def main(args:Array[String]): Unit = { + + // */abstract test("Mix___eFoo___ ", new Mix___eFoo___ , 2, null ); + // */abstract test("Mix___eFoo___wBar___", new Mix___eFoo___wBar___ , 3, null ); + // */abstract test("Mix___eFoo___wBar__f", new Mix___eFoo___wBar__f , 3, "bar"); + // */abstract test("Mix___eFoo___wBar_I_", new Mix___eFoo___wBar_I_ , 3, null ); + /* *//* */ test("Mix___eFoo___wBar_If", new Mix___eFoo___wBar_If , 3, "bar"); + // */abstract test("Mix___eFoo___wBarY__", new Mix___eFoo___wBarY__ , 3, null ); + // */abstract test("Mix___eFoo___wBarY_f", new Mix___eFoo___wBarY_f , 3, "bar"); + // */abstract test("Mix___eFoo___wBarYI_", new Mix___eFoo___wBarYI_ , 3, null ); + /* *//* */ test("Mix___eFoo___wBarYIf", new Mix___eFoo___wBarYIf , 3, "bar"); + // */abstract test("Mix___eFoo__f ", new Mix___eFoo__f , 2, "foo"); + // */abstract test("Mix___eFoo__fwBar___", new Mix___eFoo__fwBar___ , 3, "foo"); + // */abstract test("Mix___eFoo__fwBar__f", new Mix___eFoo__fwBar__f , 3, "bar"); + /* *//* */ test("Mix___eFoo__fwBar_I_", new Mix___eFoo__fwBar_I_ , 3, "foo"); + // *//* */ test("Mix___eFoo__fwBar_If", new Mix___eFoo__fwBar_If , 3, "bar"); + // */abstract test("Mix___eFoo__fwBarY__", new Mix___eFoo__fwBarY__ , 3, "foo"); + // */abstract test("Mix___eFoo__fwBarY_f", new Mix___eFoo__fwBarY_f , 3, "bar"); + /* *//* */ test("Mix___eFoo__fwBarYI_", new Mix___eFoo__fwBarYI_ , 3, "foo"); + // *//* */ test("Mix___eFoo__fwBarYIf", new Mix___eFoo__fwBarYIf , 3, "bar"); + // */abstract test("Mix___eFoo_I_ ", new Mix___eFoo_I_ , 2, null ); + // */abstract test("Mix___eFoo_I_wBar___", new Mix___eFoo_I_wBar___ , 3, null ); + /* *//* */ test("Mix___eFoo_I_wBar__f", new Mix___eFoo_I_wBar__f , 3, "bar"); + // */abstract test("Mix___eFoo_I_wBar_I_", new Mix___eFoo_I_wBar_I_ , 3, null ); + // *//* */ test("Mix___eFoo_I_wBar_If", new Mix___eFoo_I_wBar_If , 3, "bar"); + // */abstract test("Mix___eFoo_I_wBarY__", new Mix___eFoo_I_wBarY__ , 3, null ); + /* *//* */ test("Mix___eFoo_I_wBarY_f", new Mix___eFoo_I_wBarY_f , 3, "bar"); + // */abstract test("Mix___eFoo_I_wBarYI_", new Mix___eFoo_I_wBarYI_ , 3, null ); + // *//* */ test("Mix___eFoo_I_wBarYIf", new Mix___eFoo_I_wBarYIf , 3, "bar"); + /* *//* */ test("Mix___eFoo_If ", new Mix___eFoo_If , 2, "foo"); + /* *//* */ test("Mix___eFoo_IfwBar___", new Mix___eFoo_IfwBar___ , 3, "foo"); + // *//* */ test("Mix___eFoo_IfwBar__f", new Mix___eFoo_IfwBar__f , 3, "bar"); + // *//* */ test("Mix___eFoo_IfwBar_I_", new Mix___eFoo_IfwBar_I_ , 3, "foo"); + // *//* */ test("Mix___eFoo_IfwBar_If", new Mix___eFoo_IfwBar_If , 3, "bar"); + /* *//* */ test("Mix___eFoo_IfwBarY__", new Mix___eFoo_IfwBarY__ , 3, "foo"); + // *//* */ test("Mix___eFoo_IfwBarY_f", new Mix___eFoo_IfwBarY_f , 3, "bar"); + // *//* */ test("Mix___eFoo_IfwBarYI_", new Mix___eFoo_IfwBarYI_ , 3, "foo"); + // *//* */ test("Mix___eFoo_IfwBarYIf", new Mix___eFoo_IfwBarYIf , 3, "bar"); + // */abstract test("Mix___eFooX__ ", new Mix___eFooX__ , 2, null ); + // */abstract test("Mix___eFooX__wBar___", new Mix___eFooX__wBar___ , 3, null ); + // */abstract test("Mix___eFooX__wBar__f", new Mix___eFooX__wBar__f , 3, "bar"); + // */abstract test("Mix___eFooX__wBar_I_", new Mix___eFooX__wBar_I_ , 3, null ); + /* *//* */ test("Mix___eFooX__wBar_If", new Mix___eFooX__wBar_If , 3, "bar"); + // */abstract test("Mix___eFooX__wBarY__", new Mix___eFooX__wBarY__ , 3, null ); + // */abstract test("Mix___eFooX__wBarY_f", new Mix___eFooX__wBarY_f , 3, "bar"); + // */abstract test("Mix___eFooX__wBarYI_", new Mix___eFooX__wBarYI_ , 3, null ); + /* *//* */ test("Mix___eFooX__wBarYIf", new Mix___eFooX__wBarYIf , 3, "bar"); + // */abstract test("Mix___eFooX_f ", new Mix___eFooX_f , 2, "foo"); + // */abstract test("Mix___eFooX_fwBar___", new Mix___eFooX_fwBar___ , 3, "foo"); + // */abstract test("Mix___eFooX_fwBar__f", new Mix___eFooX_fwBar__f , 3, "bar"); + /* *//* */ test("Mix___eFooX_fwBar_I_", new Mix___eFooX_fwBar_I_ , 3, "foo"); + // *//* */ test("Mix___eFooX_fwBar_If", new Mix___eFooX_fwBar_If , 3, "bar"); + // */abstract test("Mix___eFooX_fwBarY__", new Mix___eFooX_fwBarY__ , 3, "foo"); + // */abstract test("Mix___eFooX_fwBarY_f", new Mix___eFooX_fwBarY_f , 3, "bar"); + /* *//* */ test("Mix___eFooX_fwBarYI_", new Mix___eFooX_fwBarYI_ , 3, "foo"); + // *//* */ test("Mix___eFooX_fwBarYIf", new Mix___eFooX_fwBarYIf , 3, "bar"); + // */abstract test("Mix___eFooXI_ ", new Mix___eFooXI_ , 2, null ); + // */abstract test("Mix___eFooXI_wBar___", new Mix___eFooXI_wBar___ , 3, null ); + /* *//* */ test("Mix___eFooXI_wBar__f", new Mix___eFooXI_wBar__f , 3, "bar"); + // */abstract test("Mix___eFooXI_wBar_I_", new Mix___eFooXI_wBar_I_ , 3, null ); + // *//* */ test("Mix___eFooXI_wBar_If", new Mix___eFooXI_wBar_If , 3, "bar"); + // */abstract test("Mix___eFooXI_wBarY__", new Mix___eFooXI_wBarY__ , 3, null ); + /* *//* */ test("Mix___eFooXI_wBarY_f", new Mix___eFooXI_wBarY_f , 3, "bar"); + // */abstract test("Mix___eFooXI_wBarYI_", new Mix___eFooXI_wBarYI_ , 3, null ); + // *//* */ test("Mix___eFooXI_wBarYIf", new Mix___eFooXI_wBarYIf , 3, "bar"); + /* *//* */ test("Mix___eFooXIf ", new Mix___eFooXIf , 2, "foo"); + /* *//* */ test("Mix___eFooXIfwBar___", new Mix___eFooXIfwBar___ , 3, "foo"); + // *//* */ test("Mix___eFooXIfwBar__f", new Mix___eFooXIfwBar__f , 3, "bar"); + // *//* */ test("Mix___eFooXIfwBar_I_", new Mix___eFooXIfwBar_I_ , 3, "foo"); + // *//* */ test("Mix___eFooXIfwBar_If", new Mix___eFooXIfwBar_If , 3, "bar"); + /* *//* */ test("Mix___eFooXIfwBarY__", new Mix___eFooXIfwBarY__ , 3, "foo"); + // *//* */ test("Mix___eFooXIfwBarY_f", new Mix___eFooXIfwBarY_f , 3, "bar"); + // *//* */ test("Mix___eFooXIfwBarYI_", new Mix___eFooXIfwBarYI_ , 3, "foo"); + // *//* */ test("Mix___eFooXIfwBarYIf", new Mix___eFooXIfwBarYIf , 3, "bar"); + + // */abstract test("Mix__feFoo___ ", new Mix__feFoo___ , 2, "mix"); + // */abstract test("Mix__feFoo___wBar___", new Mix__feFoo___wBar___ , 3, "mix"); + // */abstract test("Mix__feFoo___wBar__f", new Mix__feFoo___wBar__f , 3, "mix"); + /* *//* */ test("Mix__feFoo___wBar_I_", new Mix__feFoo___wBar_I_ , 3, "mix"); + /* *//* */ test("Mix__feFoo___wBar_If", new Mix__feFoo___wBar_If , 3, "mix"); + // */abstract test("Mix__feFoo___wBarY__", new Mix__feFoo___wBarY__ , 3, "mix"); + // */abstract test("Mix__feFoo___wBarY_f", new Mix__feFoo___wBarY_f , 3, "mix"); + /* *//* */ test("Mix__feFoo___wBarYI_", new Mix__feFoo___wBarYI_ , 3, "mix"); + /* *//* */ test("Mix__feFoo___wBarYIf", new Mix__feFoo___wBarYIf , 3, "mix"); + // */abstract test("Mix__feFoo__f ", new Mix__feFoo__f , 2, "mix"); + // */abstract test("Mix__feFoo__fwBar___", new Mix__feFoo__fwBar___ , 3, "mix"); + // */abstract test("Mix__feFoo__fwBar__f", new Mix__feFoo__fwBar__f , 3, "mix"); + /* *//* */ test("Mix__feFoo__fwBar_I_", new Mix__feFoo__fwBar_I_ , 3, "mix"); + /* *//* */ test("Mix__feFoo__fwBar_If", new Mix__feFoo__fwBar_If , 3, "mix"); + // */abstract test("Mix__feFoo__fwBarY__", new Mix__feFoo__fwBarY__ , 3, "mix"); + // */abstract test("Mix__feFoo__fwBarY_f", new Mix__feFoo__fwBarY_f , 3, "mix"); + /* *//* */ test("Mix__feFoo__fwBarYI_", new Mix__feFoo__fwBarYI_ , 3, "mix"); + /* *//* */ test("Mix__feFoo__fwBarYIf", new Mix__feFoo__fwBarYIf , 3, "mix"); + /* *//* */ test("Mix__feFoo_I_ ", new Mix__feFoo_I_ , 2, "mix"); + /* *//* */ test("Mix__feFoo_I_wBar___", new Mix__feFoo_I_wBar___ , 3, "mix"); + /* *//* */ test("Mix__feFoo_I_wBar__f", new Mix__feFoo_I_wBar__f , 3, "mix"); + // *//* */ test("Mix__feFoo_I_wBar_I_", new Mix__feFoo_I_wBar_I_ , 3, "mix"); + // *//* */ test("Mix__feFoo_I_wBar_If", new Mix__feFoo_I_wBar_If , 3, "mix"); + /* *//* */ test("Mix__feFoo_I_wBarY__", new Mix__feFoo_I_wBarY__ , 3, "mix"); + /* *//* */ test("Mix__feFoo_I_wBarY_f", new Mix__feFoo_I_wBarY_f , 3, "mix"); + // *//* */ test("Mix__feFoo_I_wBarYI_", new Mix__feFoo_I_wBarYI_ , 3, "mix"); + // *//* */ test("Mix__feFoo_I_wBarYIf", new Mix__feFoo_I_wBarYIf , 3, "mix"); + /* *//* */ test("Mix__feFoo_If ", new Mix__feFoo_If , 2, "mix"); + /* *//* */ test("Mix__feFoo_IfwBar___", new Mix__feFoo_IfwBar___ , 3, "mix"); + /* *//* */ test("Mix__feFoo_IfwBar__f", new Mix__feFoo_IfwBar__f , 3, "mix"); + // *//* */ test("Mix__feFoo_IfwBar_I_", new Mix__feFoo_IfwBar_I_ , 3, "mix"); + // *//* */ test("Mix__feFoo_IfwBar_If", new Mix__feFoo_IfwBar_If , 3, "mix"); + /* *//* */ test("Mix__feFoo_IfwBarY__", new Mix__feFoo_IfwBarY__ , 3, "mix"); + /* *//* */ test("Mix__feFoo_IfwBarY_f", new Mix__feFoo_IfwBarY_f , 3, "mix"); + // *//* */ test("Mix__feFoo_IfwBarYI_", new Mix__feFoo_IfwBarYI_ , 3, "mix"); + // *//* */ test("Mix__feFoo_IfwBarYIf", new Mix__feFoo_IfwBarYIf , 3, "mix"); + // */abstract test("Mix__feFooX__ ", new Mix__feFooX__ , 2, "mix"); + // */abstract test("Mix__feFooX__wBar___", new Mix__feFooX__wBar___ , 3, "mix"); + // */abstract test("Mix__feFooX__wBar__f", new Mix__feFooX__wBar__f , 3, "mix"); + /* *//* */ test("Mix__feFooX__wBar_I_", new Mix__feFooX__wBar_I_ , 3, "mix"); + /* *//* */ test("Mix__feFooX__wBar_If", new Mix__feFooX__wBar_If , 3, "mix"); + // */abstract test("Mix__feFooX__wBarY__", new Mix__feFooX__wBarY__ , 3, "mix"); + // */abstract test("Mix__feFooX__wBarY_f", new Mix__feFooX__wBarY_f , 3, "mix"); + /* *//* */ test("Mix__feFooX__wBarYI_", new Mix__feFooX__wBarYI_ , 3, "mix"); + /* *//* */ test("Mix__feFooX__wBarYIf", new Mix__feFooX__wBarYIf , 3, "mix"); + // */abstract test("Mix__feFooX_f ", new Mix__feFooX_f , 2, "mix"); + // */abstract test("Mix__feFooX_fwBar___", new Mix__feFooX_fwBar___ , 3, "mix"); + // */abstract test("Mix__feFooX_fwBar__f", new Mix__feFooX_fwBar__f , 3, "mix"); + /* *//* */ test("Mix__feFooX_fwBar_I_", new Mix__feFooX_fwBar_I_ , 3, "mix"); + /* *//* */ test("Mix__feFooX_fwBar_If", new Mix__feFooX_fwBar_If , 3, "mix"); + // */abstract test("Mix__feFooX_fwBarY__", new Mix__feFooX_fwBarY__ , 3, "mix"); + // */abstract test("Mix__feFooX_fwBarY_f", new Mix__feFooX_fwBarY_f , 3, "mix"); + /* *//* */ test("Mix__feFooX_fwBarYI_", new Mix__feFooX_fwBarYI_ , 3, "mix"); + /* *//* */ test("Mix__feFooX_fwBarYIf", new Mix__feFooX_fwBarYIf , 3, "mix"); + /* *//* */ test("Mix__feFooXI_ ", new Mix__feFooXI_ , 2, "mix"); + /* *//* */ test("Mix__feFooXI_wBar___", new Mix__feFooXI_wBar___ , 3, "mix"); + /* *//* */ test("Mix__feFooXI_wBar__f", new Mix__feFooXI_wBar__f , 3, "mix"); + // *//* */ test("Mix__feFooXI_wBar_I_", new Mix__feFooXI_wBar_I_ , 3, "mix"); + // *//* */ test("Mix__feFooXI_wBar_If", new Mix__feFooXI_wBar_If , 3, "mix"); + /* *//* */ test("Mix__feFooXI_wBarY__", new Mix__feFooXI_wBarY__ , 3, "mix"); + /* *//* */ test("Mix__feFooXI_wBarY_f", new Mix__feFooXI_wBarY_f , 3, "mix"); + // *//* */ test("Mix__feFooXI_wBarYI_", new Mix__feFooXI_wBarYI_ , 3, "mix"); + // *//* */ test("Mix__feFooXI_wBarYIf", new Mix__feFooXI_wBarYIf , 3, "mix"); + /* *//* */ test("Mix__feFooXIf ", new Mix__feFooXIf , 2, "mix"); + /* *//* */ test("Mix__feFooXIfwBar___", new Mix__feFooXIfwBar___ , 3, "mix"); + /* *//* */ test("Mix__feFooXIfwBar__f", new Mix__feFooXIfwBar__f , 3, "mix"); + // *//* */ test("Mix__feFooXIfwBar_I_", new Mix__feFooXIfwBar_I_ , 3, "mix"); + // *//* */ test("Mix__feFooXIfwBar_If", new Mix__feFooXIfwBar_If , 3, "mix"); + /* *//* */ test("Mix__feFooXIfwBarY__", new Mix__feFooXIfwBarY__ , 3, "mix"); + /* *//* */ test("Mix__feFooXIfwBarY_f", new Mix__feFooXIfwBarY_f , 3, "mix"); + // *//* */ test("Mix__feFooXIfwBarYI_", new Mix__feFooXIfwBarYI_ , 3, "mix"); + // *//* */ test("Mix__feFooXIfwBarYIf", new Mix__feFooXIfwBarYIf , 3, "mix"); + + // */abstract test("Mix_I_eFoo___ ", new Mix_I_eFoo___ , 2, null ); + // */abstract test("Mix_I_eFoo___wBar___", new Mix_I_eFoo___wBar___ , 3, null ); + /* *//* */ test("Mix_I_eFoo___wBar__f", new Mix_I_eFoo___wBar__f , 3, "bar"); + // */abstract test("Mix_I_eFoo___wBar_I_", new Mix_I_eFoo___wBar_I_ , 3, null ); + // *//* */ test("Mix_I_eFoo___wBar_If", new Mix_I_eFoo___wBar_If , 3, "bar"); + // */abstract test("Mix_I_eFoo___wBarY__", new Mix_I_eFoo___wBarY__ , 3, null ); + /* *//* */ test("Mix_I_eFoo___wBarY_f", new Mix_I_eFoo___wBarY_f , 3, "bar"); + // */abstract test("Mix_I_eFoo___wBarYI_", new Mix_I_eFoo___wBarYI_ , 3, null ); + // *//* */ test("Mix_I_eFoo___wBarYIf", new Mix_I_eFoo___wBarYIf , 3, "bar"); + /* *//* */ test("Mix_I_eFoo__f ", new Mix_I_eFoo__f , 2, "foo"); + /* *//* */ test("Mix_I_eFoo__fwBar___", new Mix_I_eFoo__fwBar___ , 3, "foo"); + // *//* */ test("Mix_I_eFoo__fwBar__f", new Mix_I_eFoo__fwBar__f , 3, "bar"); + // *//* */ test("Mix_I_eFoo__fwBar_I_", new Mix_I_eFoo__fwBar_I_ , 3, "foo"); + // *//* */ test("Mix_I_eFoo__fwBar_If", new Mix_I_eFoo__fwBar_If , 3, "bar"); + /* *//* */ test("Mix_I_eFoo__fwBarY__", new Mix_I_eFoo__fwBarY__ , 3, "foo"); + // *//* */ test("Mix_I_eFoo__fwBarY_f", new Mix_I_eFoo__fwBarY_f , 3, "bar"); + // *//* */ test("Mix_I_eFoo__fwBarYI_", new Mix_I_eFoo__fwBarYI_ , 3, "foo"); + // *//* */ test("Mix_I_eFoo__fwBarYIf", new Mix_I_eFoo__fwBarYIf , 3, "bar"); + // */abstract test("Mix_I_eFoo_I_ ", new Mix_I_eFoo_I_ , 2, null ); + // */abstract test("Mix_I_eFoo_I_wBar___", new Mix_I_eFoo_I_wBar___ , 3, null ); + // *//* */ test("Mix_I_eFoo_I_wBar__f", new Mix_I_eFoo_I_wBar__f , 3, "bar"); + // */abstract test("Mix_I_eFoo_I_wBar_I_", new Mix_I_eFoo_I_wBar_I_ , 3, null ); + // *//* */ test("Mix_I_eFoo_I_wBar_If", new Mix_I_eFoo_I_wBar_If , 3, "bar"); + // */abstract test("Mix_I_eFoo_I_wBarY__", new Mix_I_eFoo_I_wBarY__ , 3, null ); + // *//* */ test("Mix_I_eFoo_I_wBarY_f", new Mix_I_eFoo_I_wBarY_f , 3, "bar"); + // */abstract test("Mix_I_eFoo_I_wBarYI_", new Mix_I_eFoo_I_wBarYI_ , 3, null ); + // *//* */ test("Mix_I_eFoo_I_wBarYIf", new Mix_I_eFoo_I_wBarYIf , 3, "bar"); + // *//* */ test("Mix_I_eFoo_If ", new Mix_I_eFoo_If , 2, "foo"); + // *//* */ test("Mix_I_eFoo_IfwBar___", new Mix_I_eFoo_IfwBar___ , 3, "foo"); + // *//* */ test("Mix_I_eFoo_IfwBar__f", new Mix_I_eFoo_IfwBar__f , 3, "bar"); + // *//* */ test("Mix_I_eFoo_IfwBar_I_", new Mix_I_eFoo_IfwBar_I_ , 3, "foo"); + // *//* */ test("Mix_I_eFoo_IfwBar_If", new Mix_I_eFoo_IfwBar_If , 3, "bar"); + // *//* */ test("Mix_I_eFoo_IfwBarY__", new Mix_I_eFoo_IfwBarY__ , 3, "foo"); + // *//* */ test("Mix_I_eFoo_IfwBarY_f", new Mix_I_eFoo_IfwBarY_f , 3, "bar"); + // *//* */ test("Mix_I_eFoo_IfwBarYI_", new Mix_I_eFoo_IfwBarYI_ , 3, "foo"); + // *//* */ test("Mix_I_eFoo_IfwBarYIf", new Mix_I_eFoo_IfwBarYIf , 3, "bar"); + // */abstract test("Mix_I_eFooX__ ", new Mix_I_eFooX__ , 2, null ); + // */abstract test("Mix_I_eFooX__wBar___", new Mix_I_eFooX__wBar___ , 3, null ); + /* *//* */ test("Mix_I_eFooX__wBar__f", new Mix_I_eFooX__wBar__f , 3, "bar"); + // */abstract test("Mix_I_eFooX__wBar_I_", new Mix_I_eFooX__wBar_I_ , 3, null ); + // *//* */ test("Mix_I_eFooX__wBar_If", new Mix_I_eFooX__wBar_If , 3, "bar"); + // */abstract test("Mix_I_eFooX__wBarY__", new Mix_I_eFooX__wBarY__ , 3, null ); + /* *//* */ test("Mix_I_eFooX__wBarY_f", new Mix_I_eFooX__wBarY_f , 3, "bar"); + // */abstract test("Mix_I_eFooX__wBarYI_", new Mix_I_eFooX__wBarYI_ , 3, null ); + // *//* */ test("Mix_I_eFooX__wBarYIf", new Mix_I_eFooX__wBarYIf , 3, "bar"); + /* *//* */ test("Mix_I_eFooX_f ", new Mix_I_eFooX_f , 2, "foo"); + /* *//* */ test("Mix_I_eFooX_fwBar___", new Mix_I_eFooX_fwBar___ , 3, "foo"); + // *//* */ test("Mix_I_eFooX_fwBar__f", new Mix_I_eFooX_fwBar__f , 3, "bar"); + // *//* */ test("Mix_I_eFooX_fwBar_I_", new Mix_I_eFooX_fwBar_I_ , 3, "foo"); + // *//* */ test("Mix_I_eFooX_fwBar_If", new Mix_I_eFooX_fwBar_If , 3, "bar"); + /* *//* */ test("Mix_I_eFooX_fwBarY__", new Mix_I_eFooX_fwBarY__ , 3, "foo"); + // *//* */ test("Mix_I_eFooX_fwBarY_f", new Mix_I_eFooX_fwBarY_f , 3, "bar"); + // *//* */ test("Mix_I_eFooX_fwBarYI_", new Mix_I_eFooX_fwBarYI_ , 3, "foo"); + // *//* */ test("Mix_I_eFooX_fwBarYIf", new Mix_I_eFooX_fwBarYIf , 3, "bar"); + // */abstract test("Mix_I_eFooXI_ ", new Mix_I_eFooXI_ , 2, null ); + // */abstract test("Mix_I_eFooXI_wBar___", new Mix_I_eFooXI_wBar___ , 3, null ); + // *//* */ test("Mix_I_eFooXI_wBar__f", new Mix_I_eFooXI_wBar__f , 3, "bar"); + // */abstract test("Mix_I_eFooXI_wBar_I_", new Mix_I_eFooXI_wBar_I_ , 3, null ); + // *//* */ test("Mix_I_eFooXI_wBar_If", new Mix_I_eFooXI_wBar_If , 3, "bar"); + // */abstract test("Mix_I_eFooXI_wBarY__", new Mix_I_eFooXI_wBarY__ , 3, null ); + // *//* */ test("Mix_I_eFooXI_wBarY_f", new Mix_I_eFooXI_wBarY_f , 3, "bar"); + // */abstract test("Mix_I_eFooXI_wBarYI_", new Mix_I_eFooXI_wBarYI_ , 3, null ); + // *//* */ test("Mix_I_eFooXI_wBarYIf", new Mix_I_eFooXI_wBarYIf , 3, "bar"); + // *//* */ test("Mix_I_eFooXIf ", new Mix_I_eFooXIf , 2, "foo"); + // *//* */ test("Mix_I_eFooXIfwBar___", new Mix_I_eFooXIfwBar___ , 3, "foo"); + // *//* */ test("Mix_I_eFooXIfwBar__f", new Mix_I_eFooXIfwBar__f , 3, "bar"); + // *//* */ test("Mix_I_eFooXIfwBar_I_", new Mix_I_eFooXIfwBar_I_ , 3, "foo"); + // *//* */ test("Mix_I_eFooXIfwBar_If", new Mix_I_eFooXIfwBar_If , 3, "bar"); + // *//* */ test("Mix_I_eFooXIfwBarY__", new Mix_I_eFooXIfwBarY__ , 3, "foo"); + // *//* */ test("Mix_I_eFooXIfwBarY_f", new Mix_I_eFooXIfwBarY_f , 3, "bar"); + // *//* */ test("Mix_I_eFooXIfwBarYI_", new Mix_I_eFooXIfwBarYI_ , 3, "foo"); + // *//* */ test("Mix_I_eFooXIfwBarYIf", new Mix_I_eFooXIfwBarYIf , 3, "bar"); + + /* *//* */ test("Mix_IfeFoo___ ", new Mix_IfeFoo___ , 2, "mix"); + /* *//* */ test("Mix_IfeFoo___wBar___", new Mix_IfeFoo___wBar___ , 3, "mix"); + /* *//* */ test("Mix_IfeFoo___wBar__f", new Mix_IfeFoo___wBar__f , 3, "mix"); + // *//* */ test("Mix_IfeFoo___wBar_I_", new Mix_IfeFoo___wBar_I_ , 3, "mix"); + // *//* */ test("Mix_IfeFoo___wBar_If", new Mix_IfeFoo___wBar_If , 3, "mix"); + /* *//* */ test("Mix_IfeFoo___wBarY__", new Mix_IfeFoo___wBarY__ , 3, "mix"); + /* *//* */ test("Mix_IfeFoo___wBarY_f", new Mix_IfeFoo___wBarY_f , 3, "mix"); + // *//* */ test("Mix_IfeFoo___wBarYI_", new Mix_IfeFoo___wBarYI_ , 3, "mix"); + // *//* */ test("Mix_IfeFoo___wBarYIf", new Mix_IfeFoo___wBarYIf , 3, "mix"); + /* *//* */ test("Mix_IfeFoo__f ", new Mix_IfeFoo__f , 2, "mix"); + /* *//* */ test("Mix_IfeFoo__fwBar___", new Mix_IfeFoo__fwBar___ , 3, "mix"); + /* *//* */ test("Mix_IfeFoo__fwBar__f", new Mix_IfeFoo__fwBar__f , 3, "mix"); + // *//* */ test("Mix_IfeFoo__fwBar_I_", new Mix_IfeFoo__fwBar_I_ , 3, "mix"); + // *//* */ test("Mix_IfeFoo__fwBar_If", new Mix_IfeFoo__fwBar_If , 3, "mix"); + /* *//* */ test("Mix_IfeFoo__fwBarY__", new Mix_IfeFoo__fwBarY__ , 3, "mix"); + /* *//* */ test("Mix_IfeFoo__fwBarY_f", new Mix_IfeFoo__fwBarY_f , 3, "mix"); + // *//* */ test("Mix_IfeFoo__fwBarYI_", new Mix_IfeFoo__fwBarYI_ , 3, "mix"); + // *//* */ test("Mix_IfeFoo__fwBarYIf", new Mix_IfeFoo__fwBarYIf , 3, "mix"); + // *//* */ test("Mix_IfeFoo_I_ ", new Mix_IfeFoo_I_ , 2, "mix"); + // *//* */ test("Mix_IfeFoo_I_wBar___", new Mix_IfeFoo_I_wBar___ , 3, "mix"); + // *//* */ test("Mix_IfeFoo_I_wBar__f", new Mix_IfeFoo_I_wBar__f , 3, "mix"); + // *//* */ test("Mix_IfeFoo_I_wBar_I_", new Mix_IfeFoo_I_wBar_I_ , 3, "mix"); + // *//* */ test("Mix_IfeFoo_I_wBar_If", new Mix_IfeFoo_I_wBar_If , 3, "mix"); + // *//* */ test("Mix_IfeFoo_I_wBarY__", new Mix_IfeFoo_I_wBarY__ , 3, "mix"); + // *//* */ test("Mix_IfeFoo_I_wBarY_f", new Mix_IfeFoo_I_wBarY_f , 3, "mix"); + // *//* */ test("Mix_IfeFoo_I_wBarYI_", new Mix_IfeFoo_I_wBarYI_ , 3, "mix"); + // *//* */ test("Mix_IfeFoo_I_wBarYIf", new Mix_IfeFoo_I_wBarYIf , 3, "mix"); + // *//* */ test("Mix_IfeFoo_If ", new Mix_IfeFoo_If , 2, "mix"); + // *//* */ test("Mix_IfeFoo_IfwBar___", new Mix_IfeFoo_IfwBar___ , 3, "mix"); + // *//* */ test("Mix_IfeFoo_IfwBar__f", new Mix_IfeFoo_IfwBar__f , 3, "mix"); + // *//* */ test("Mix_IfeFoo_IfwBar_I_", new Mix_IfeFoo_IfwBar_I_ , 3, "mix"); + // *//* */ test("Mix_IfeFoo_IfwBar_If", new Mix_IfeFoo_IfwBar_If , 3, "mix"); + // *//* */ test("Mix_IfeFoo_IfwBarY__", new Mix_IfeFoo_IfwBarY__ , 3, "mix"); + // *//* */ test("Mix_IfeFoo_IfwBarY_f", new Mix_IfeFoo_IfwBarY_f , 3, "mix"); + // *//* */ test("Mix_IfeFoo_IfwBarYI_", new Mix_IfeFoo_IfwBarYI_ , 3, "mix"); + // *//* */ test("Mix_IfeFoo_IfwBarYIf", new Mix_IfeFoo_IfwBarYIf , 3, "mix"); + /* *//* */ test("Mix_IfeFooX__ ", new Mix_IfeFooX__ , 2, "mix"); + /* *//* */ test("Mix_IfeFooX__wBar___", new Mix_IfeFooX__wBar___ , 3, "mix"); + /* *//* */ test("Mix_IfeFooX__wBar__f", new Mix_IfeFooX__wBar__f , 3, "mix"); + // *//* */ test("Mix_IfeFooX__wBar_I_", new Mix_IfeFooX__wBar_I_ , 3, "mix"); + // *//* */ test("Mix_IfeFooX__wBar_If", new Mix_IfeFooX__wBar_If , 3, "mix"); + /* *//* */ test("Mix_IfeFooX__wBarY__", new Mix_IfeFooX__wBarY__ , 3, "mix"); + /* *//* */ test("Mix_IfeFooX__wBarY_f", new Mix_IfeFooX__wBarY_f , 3, "mix"); + // *//* */ test("Mix_IfeFooX__wBarYI_", new Mix_IfeFooX__wBarYI_ , 3, "mix"); + // *//* */ test("Mix_IfeFooX__wBarYIf", new Mix_IfeFooX__wBarYIf , 3, "mix"); + /* *//* */ test("Mix_IfeFooX_f ", new Mix_IfeFooX_f , 2, "mix"); + /* *//* */ test("Mix_IfeFooX_fwBar___", new Mix_IfeFooX_fwBar___ , 3, "mix"); + /* *//* */ test("Mix_IfeFooX_fwBar__f", new Mix_IfeFooX_fwBar__f , 3, "mix"); + // *//* */ test("Mix_IfeFooX_fwBar_I_", new Mix_IfeFooX_fwBar_I_ , 3, "mix"); + // *//* */ test("Mix_IfeFooX_fwBar_If", new Mix_IfeFooX_fwBar_If , 3, "mix"); + /* *//* */ test("Mix_IfeFooX_fwBarY__", new Mix_IfeFooX_fwBarY__ , 3, "mix"); + /* *//* */ test("Mix_IfeFooX_fwBarY_f", new Mix_IfeFooX_fwBarY_f , 3, "mix"); + // *//* */ test("Mix_IfeFooX_fwBarYI_", new Mix_IfeFooX_fwBarYI_ , 3, "mix"); + // *//* */ test("Mix_IfeFooX_fwBarYIf", new Mix_IfeFooX_fwBarYIf , 3, "mix"); + // *//* */ test("Mix_IfeFooXI_ ", new Mix_IfeFooXI_ , 2, "mix"); + // *//* */ test("Mix_IfeFooXI_wBar___", new Mix_IfeFooXI_wBar___ , 3, "mix"); + // *//* */ test("Mix_IfeFooXI_wBar__f", new Mix_IfeFooXI_wBar__f , 3, "mix"); + // *//* */ test("Mix_IfeFooXI_wBar_I_", new Mix_IfeFooXI_wBar_I_ , 3, "mix"); + // *//* */ test("Mix_IfeFooXI_wBar_If", new Mix_IfeFooXI_wBar_If , 3, "mix"); + // *//* */ test("Mix_IfeFooXI_wBarY__", new Mix_IfeFooXI_wBarY__ , 3, "mix"); + // *//* */ test("Mix_IfeFooXI_wBarY_f", new Mix_IfeFooXI_wBarY_f , 3, "mix"); + // *//* */ test("Mix_IfeFooXI_wBarYI_", new Mix_IfeFooXI_wBarYI_ , 3, "mix"); + // *//* */ test("Mix_IfeFooXI_wBarYIf", new Mix_IfeFooXI_wBarYIf , 3, "mix"); + // *//* */ test("Mix_IfeFooXIf ", new Mix_IfeFooXIf , 2, "mix"); + // *//* */ test("Mix_IfeFooXIfwBar___", new Mix_IfeFooXIfwBar___ , 3, "mix"); + // *//* */ test("Mix_IfeFooXIfwBar__f", new Mix_IfeFooXIfwBar__f , 3, "mix"); + // *//* */ test("Mix_IfeFooXIfwBar_I_", new Mix_IfeFooXIfwBar_I_ , 3, "mix"); + // *//* */ test("Mix_IfeFooXIfwBar_If", new Mix_IfeFooXIfwBar_If , 3, "mix"); + // *//* */ test("Mix_IfeFooXIfwBarY__", new Mix_IfeFooXIfwBarY__ , 3, "mix"); + // *//* */ test("Mix_IfeFooXIfwBarY_f", new Mix_IfeFooXIfwBarY_f , 3, "mix"); + // *//* */ test("Mix_IfeFooXIfwBarYI_", new Mix_IfeFooXIfwBarYI_ , 3, "mix"); + // *//* */ test("Mix_IfeFooXIfwBarYIf", new Mix_IfeFooXIfwBarYIf , 3, "mix"); + + // */abstract test("MixZ__eFoo___ ", new MixZ__eFoo___ [C], 2, null ); + // */abstract test("MixZ__eFoo___wBar___", new MixZ__eFoo___wBar___[C], 3, null ); + // */abstract test("MixZ__eFoo___wBar__f", new MixZ__eFoo___wBar__f[C], 3, "bar"); + // */abstract test("MixZ__eFoo___wBar_I_", new MixZ__eFoo___wBar_I_[C], 3, null ); + /* *//* */ test("MixZ__eFoo___wBar_If", new MixZ__eFoo___wBar_If[C], 3, "bar"); + // */abstract test("MixZ__eFoo___wBarY__", new MixZ__eFoo___wBarY__[C], 3, null ); + // */abstract test("MixZ__eFoo___wBarY_f", new MixZ__eFoo___wBarY_f[C], 3, "bar"); + // */abstract test("MixZ__eFoo___wBarYI_", new MixZ__eFoo___wBarYI_[C], 3, null ); + /* *//* */ test("MixZ__eFoo___wBarYIf", new MixZ__eFoo___wBarYIf[C], 3, "bar"); + // */abstract test("MixZ__eFoo__f ", new MixZ__eFoo__f [C], 2, "foo"); + // */abstract test("MixZ__eFoo__fwBar___", new MixZ__eFoo__fwBar___[C], 3, "foo"); + // */abstract test("MixZ__eFoo__fwBar__f", new MixZ__eFoo__fwBar__f[C], 3, "bar"); + /* *//* */ test("MixZ__eFoo__fwBar_I_", new MixZ__eFoo__fwBar_I_[C], 3, "foo"); + // *//* */ test("MixZ__eFoo__fwBar_If", new MixZ__eFoo__fwBar_If[C], 3, "bar"); + // */abstract test("MixZ__eFoo__fwBarY__", new MixZ__eFoo__fwBarY__[C], 3, "foo"); + // */abstract test("MixZ__eFoo__fwBarY_f", new MixZ__eFoo__fwBarY_f[C], 3, "bar"); + /* *//* */ test("MixZ__eFoo__fwBarYI_", new MixZ__eFoo__fwBarYI_[C], 3, "foo"); + // *//* */ test("MixZ__eFoo__fwBarYIf", new MixZ__eFoo__fwBarYIf[C], 3, "bar"); + // */abstract test("MixZ__eFoo_I_ ", new MixZ__eFoo_I_ [C], 2, null ); + // */abstract test("MixZ__eFoo_I_wBar___", new MixZ__eFoo_I_wBar___[C], 3, null ); + /* *//* */ test("MixZ__eFoo_I_wBar__f", new MixZ__eFoo_I_wBar__f[C], 3, "bar"); + // */abstract test("MixZ__eFoo_I_wBar_I_", new MixZ__eFoo_I_wBar_I_[C], 3, null ); + // *//* */ test("MixZ__eFoo_I_wBar_If", new MixZ__eFoo_I_wBar_If[C], 3, "bar"); + // */abstract test("MixZ__eFoo_I_wBarY__", new MixZ__eFoo_I_wBarY__[C], 3, null ); + /* *//* */ test("MixZ__eFoo_I_wBarY_f", new MixZ__eFoo_I_wBarY_f[C], 3, "bar"); + // */abstract test("MixZ__eFoo_I_wBarYI_", new MixZ__eFoo_I_wBarYI_[C], 3, null ); + // *//* */ test("MixZ__eFoo_I_wBarYIf", new MixZ__eFoo_I_wBarYIf[C], 3, "bar"); + /* *//* */ test("MixZ__eFoo_If ", new MixZ__eFoo_If [C], 2, "foo"); + /* *//* */ test("MixZ__eFoo_IfwBar___", new MixZ__eFoo_IfwBar___[C], 3, "foo"); + // *//* */ test("MixZ__eFoo_IfwBar__f", new MixZ__eFoo_IfwBar__f[C], 3, "bar"); + // *//* */ test("MixZ__eFoo_IfwBar_I_", new MixZ__eFoo_IfwBar_I_[C], 3, "foo"); + // *//* */ test("MixZ__eFoo_IfwBar_If", new MixZ__eFoo_IfwBar_If[C], 3, "bar"); + /* *//* */ test("MixZ__eFoo_IfwBarY__", new MixZ__eFoo_IfwBarY__[C], 3, "foo"); + // *//* */ test("MixZ__eFoo_IfwBarY_f", new MixZ__eFoo_IfwBarY_f[C], 3, "bar"); + // *//* */ test("MixZ__eFoo_IfwBarYI_", new MixZ__eFoo_IfwBarYI_[C], 3, "foo"); + // *//* */ test("MixZ__eFoo_IfwBarYIf", new MixZ__eFoo_IfwBarYIf[C], 3, "bar"); + // */abstract test("MixZ__eFooX__ ", new MixZ__eFooX__ [C], 2, null ); + // */abstract test("MixZ__eFooX__wBar___", new MixZ__eFooX__wBar___[C], 3, null ); + // */abstract test("MixZ__eFooX__wBar__f", new MixZ__eFooX__wBar__f[C], 3, "bar"); + // */abstract test("MixZ__eFooX__wBar_I_", new MixZ__eFooX__wBar_I_[C], 3, null ); + /* *//* */ test("MixZ__eFooX__wBar_If", new MixZ__eFooX__wBar_If[C], 3, "bar"); + // */abstract test("MixZ__eFooX__wBarY__", new MixZ__eFooX__wBarY__[C], 3, null ); + // */abstract test("MixZ__eFooX__wBarY_f", new MixZ__eFooX__wBarY_f[C], 3, "bar"); + // */abstract test("MixZ__eFooX__wBarYI_", new MixZ__eFooX__wBarYI_[C], 3, null ); + /* *//* */ test("MixZ__eFooX__wBarYIf", new MixZ__eFooX__wBarYIf[C], 3, "bar"); + // */abstract test("MixZ__eFooX_f ", new MixZ__eFooX_f [C], 2, "foo"); + // */abstract test("MixZ__eFooX_fwBar___", new MixZ__eFooX_fwBar___[C], 3, "foo"); + // */abstract test("MixZ__eFooX_fwBar__f", new MixZ__eFooX_fwBar__f[C], 3, "bar"); + /* *//* */ test("MixZ__eFooX_fwBar_I_", new MixZ__eFooX_fwBar_I_[C], 3, "foo"); + // *//* */ test("MixZ__eFooX_fwBar_If", new MixZ__eFooX_fwBar_If[C], 3, "bar"); + // */abstract test("MixZ__eFooX_fwBarY__", new MixZ__eFooX_fwBarY__[C], 3, "foo"); + // */abstract test("MixZ__eFooX_fwBarY_f", new MixZ__eFooX_fwBarY_f[C], 3, "bar"); + /* *//* */ test("MixZ__eFooX_fwBarYI_", new MixZ__eFooX_fwBarYI_[C], 3, "foo"); + // *//* */ test("MixZ__eFooX_fwBarYIf", new MixZ__eFooX_fwBarYIf[C], 3, "bar"); + // */abstract test("MixZ__eFooXI_ ", new MixZ__eFooXI_ [C], 2, null ); + // */abstract test("MixZ__eFooXI_wBar___", new MixZ__eFooXI_wBar___[C], 3, null ); + /* *//* */ test("MixZ__eFooXI_wBar__f", new MixZ__eFooXI_wBar__f[C], 3, "bar"); + // */abstract test("MixZ__eFooXI_wBar_I_", new MixZ__eFooXI_wBar_I_[C], 3, null ); + // *//* */ test("MixZ__eFooXI_wBar_If", new MixZ__eFooXI_wBar_If[C], 3, "bar"); + // */abstract test("MixZ__eFooXI_wBarY__", new MixZ__eFooXI_wBarY__[C], 3, null ); + /* *//* */ test("MixZ__eFooXI_wBarY_f", new MixZ__eFooXI_wBarY_f[C], 3, "bar"); + // */abstract test("MixZ__eFooXI_wBarYI_", new MixZ__eFooXI_wBarYI_[C], 3, null ); + // *//* */ test("MixZ__eFooXI_wBarYIf", new MixZ__eFooXI_wBarYIf[C], 3, "bar"); + /* *//* */ test("MixZ__eFooXIf ", new MixZ__eFooXIf [C], 2, "foo"); + /* *//* */ test("MixZ__eFooXIfwBar___", new MixZ__eFooXIfwBar___[C], 3, "foo"); + // *//* */ test("MixZ__eFooXIfwBar__f", new MixZ__eFooXIfwBar__f[C], 3, "bar"); + // *//* */ test("MixZ__eFooXIfwBar_I_", new MixZ__eFooXIfwBar_I_[C], 3, "foo"); + // *//* */ test("MixZ__eFooXIfwBar_If", new MixZ__eFooXIfwBar_If[C], 3, "bar"); + /* *//* */ test("MixZ__eFooXIfwBarY__", new MixZ__eFooXIfwBarY__[C], 3, "foo"); + // *//* */ test("MixZ__eFooXIfwBarY_f", new MixZ__eFooXIfwBarY_f[C], 3, "bar"); + // *//* */ test("MixZ__eFooXIfwBarYI_", new MixZ__eFooXIfwBarYI_[C], 3, "foo"); + // *//* */ test("MixZ__eFooXIfwBarYIf", new MixZ__eFooXIfwBarYIf[C], 3, "bar"); + + // */abstract test("MixZ_feFoo___ ", new MixZ_feFoo___ [C], 2, "mix"); + // */abstract test("MixZ_feFoo___wBar___", new MixZ_feFoo___wBar___[C], 3, "mix"); + // */abstract test("MixZ_feFoo___wBar__f", new MixZ_feFoo___wBar__f[C], 3, "mix"); + /* *//* */ test("MixZ_feFoo___wBar_I_", new MixZ_feFoo___wBar_I_[C], 3, "mix"); + /* *//* */ test("MixZ_feFoo___wBar_If", new MixZ_feFoo___wBar_If[C], 3, "mix"); + // */abstract test("MixZ_feFoo___wBarY__", new MixZ_feFoo___wBarY__[C], 3, "mix"); + // */abstract test("MixZ_feFoo___wBarY_f", new MixZ_feFoo___wBarY_f[C], 3, "mix"); + /* *//* */ test("MixZ_feFoo___wBarYI_", new MixZ_feFoo___wBarYI_[C], 3, "mix"); + /* *//* */ test("MixZ_feFoo___wBarYIf", new MixZ_feFoo___wBarYIf[C], 3, "mix"); + // */abstract test("MixZ_feFoo__f ", new MixZ_feFoo__f [C], 2, "mix"); + // */abstract test("MixZ_feFoo__fwBar___", new MixZ_feFoo__fwBar___[C], 3, "mix"); + // */abstract test("MixZ_feFoo__fwBar__f", new MixZ_feFoo__fwBar__f[C], 3, "mix"); + /* *//* */ test("MixZ_feFoo__fwBar_I_", new MixZ_feFoo__fwBar_I_[C], 3, "mix"); + /* *//* */ test("MixZ_feFoo__fwBar_If", new MixZ_feFoo__fwBar_If[C], 3, "mix"); + // */abstract test("MixZ_feFoo__fwBarY__", new MixZ_feFoo__fwBarY__[C], 3, "mix"); + // */abstract test("MixZ_feFoo__fwBarY_f", new MixZ_feFoo__fwBarY_f[C], 3, "mix"); + /* *//* */ test("MixZ_feFoo__fwBarYI_", new MixZ_feFoo__fwBarYI_[C], 3, "mix"); + /* *//* */ test("MixZ_feFoo__fwBarYIf", new MixZ_feFoo__fwBarYIf[C], 3, "mix"); + /* *//* */ test("MixZ_feFoo_I_ ", new MixZ_feFoo_I_ [C], 2, "mix"); + /* *//* */ test("MixZ_feFoo_I_wBar___", new MixZ_feFoo_I_wBar___[C], 3, "mix"); + /* *//* */ test("MixZ_feFoo_I_wBar__f", new MixZ_feFoo_I_wBar__f[C], 3, "mix"); + // *//* */ test("MixZ_feFoo_I_wBar_I_", new MixZ_feFoo_I_wBar_I_[C], 3, "mix"); + // *//* */ test("MixZ_feFoo_I_wBar_If", new MixZ_feFoo_I_wBar_If[C], 3, "mix"); + /* *//* */ test("MixZ_feFoo_I_wBarY__", new MixZ_feFoo_I_wBarY__[C], 3, "mix"); + /* *//* */ test("MixZ_feFoo_I_wBarY_f", new MixZ_feFoo_I_wBarY_f[C], 3, "mix"); + // *//* */ test("MixZ_feFoo_I_wBarYI_", new MixZ_feFoo_I_wBarYI_[C], 3, "mix"); + // *//* */ test("MixZ_feFoo_I_wBarYIf", new MixZ_feFoo_I_wBarYIf[C], 3, "mix"); + /* *//* */ test("MixZ_feFoo_If ", new MixZ_feFoo_If [C], 2, "mix"); + /* *//* */ test("MixZ_feFoo_IfwBar___", new MixZ_feFoo_IfwBar___[C], 3, "mix"); + /* *//* */ test("MixZ_feFoo_IfwBar__f", new MixZ_feFoo_IfwBar__f[C], 3, "mix"); + // *//* */ test("MixZ_feFoo_IfwBar_I_", new MixZ_feFoo_IfwBar_I_[C], 3, "mix"); + // *//* */ test("MixZ_feFoo_IfwBar_If", new MixZ_feFoo_IfwBar_If[C], 3, "mix"); + /* *//* */ test("MixZ_feFoo_IfwBarY__", new MixZ_feFoo_IfwBarY__[C], 3, "mix"); + /* *//* */ test("MixZ_feFoo_IfwBarY_f", new MixZ_feFoo_IfwBarY_f[C], 3, "mix"); + // *//* */ test("MixZ_feFoo_IfwBarYI_", new MixZ_feFoo_IfwBarYI_[C], 3, "mix"); + // *//* */ test("MixZ_feFoo_IfwBarYIf", new MixZ_feFoo_IfwBarYIf[C], 3, "mix"); + // */abstract test("MixZ_feFooX__ ", new MixZ_feFooX__ [C], 2, "mix"); + // */abstract test("MixZ_feFooX__wBar___", new MixZ_feFooX__wBar___[C], 3, "mix"); + // */abstract test("MixZ_feFooX__wBar__f", new MixZ_feFooX__wBar__f[C], 3, "mix"); + /* *//* */ test("MixZ_feFooX__wBar_I_", new MixZ_feFooX__wBar_I_[C], 3, "mix"); + /* *//* */ test("MixZ_feFooX__wBar_If", new MixZ_feFooX__wBar_If[C], 3, "mix"); + // */abstract test("MixZ_feFooX__wBarY__", new MixZ_feFooX__wBarY__[C], 3, "mix"); + // */abstract test("MixZ_feFooX__wBarY_f", new MixZ_feFooX__wBarY_f[C], 3, "mix"); + /* *//* */ test("MixZ_feFooX__wBarYI_", new MixZ_feFooX__wBarYI_[C], 3, "mix"); + /* *//* */ test("MixZ_feFooX__wBarYIf", new MixZ_feFooX__wBarYIf[C], 3, "mix"); + // */abstract test("MixZ_feFooX_f ", new MixZ_feFooX_f [C], 2, "mix"); + // */abstract test("MixZ_feFooX_fwBar___", new MixZ_feFooX_fwBar___[C], 3, "mix"); + // */abstract test("MixZ_feFooX_fwBar__f", new MixZ_feFooX_fwBar__f[C], 3, "mix"); + /* *//* */ test("MixZ_feFooX_fwBar_I_", new MixZ_feFooX_fwBar_I_[C], 3, "mix"); + /* *//* */ test("MixZ_feFooX_fwBar_If", new MixZ_feFooX_fwBar_If[C], 3, "mix"); + // */abstract test("MixZ_feFooX_fwBarY__", new MixZ_feFooX_fwBarY__[C], 3, "mix"); + // */abstract test("MixZ_feFooX_fwBarY_f", new MixZ_feFooX_fwBarY_f[C], 3, "mix"); + /* *//* */ test("MixZ_feFooX_fwBarYI_", new MixZ_feFooX_fwBarYI_[C], 3, "mix"); + /* *//* */ test("MixZ_feFooX_fwBarYIf", new MixZ_feFooX_fwBarYIf[C], 3, "mix"); + /* *//* */ test("MixZ_feFooXI_ ", new MixZ_feFooXI_ [C], 2, "mix"); + /* *//* */ test("MixZ_feFooXI_wBar___", new MixZ_feFooXI_wBar___[C], 3, "mix"); + /* *//* */ test("MixZ_feFooXI_wBar__f", new MixZ_feFooXI_wBar__f[C], 3, "mix"); + // *//* */ test("MixZ_feFooXI_wBar_I_", new MixZ_feFooXI_wBar_I_[C], 3, "mix"); + // *//* */ test("MixZ_feFooXI_wBar_If", new MixZ_feFooXI_wBar_If[C], 3, "mix"); + /* *//* */ test("MixZ_feFooXI_wBarY__", new MixZ_feFooXI_wBarY__[C], 3, "mix"); + /* *//* */ test("MixZ_feFooXI_wBarY_f", new MixZ_feFooXI_wBarY_f[C], 3, "mix"); + // *//* */ test("MixZ_feFooXI_wBarYI_", new MixZ_feFooXI_wBarYI_[C], 3, "mix"); + // *//* */ test("MixZ_feFooXI_wBarYIf", new MixZ_feFooXI_wBarYIf[C], 3, "mix"); + /* *//* */ test("MixZ_feFooXIf ", new MixZ_feFooXIf [C], 2, "mix"); + /* *//* */ test("MixZ_feFooXIfwBar___", new MixZ_feFooXIfwBar___[C], 3, "mix"); + /* *//* */ test("MixZ_feFooXIfwBar__f", new MixZ_feFooXIfwBar__f[C], 3, "mix"); + // *//* */ test("MixZ_feFooXIfwBar_I_", new MixZ_feFooXIfwBar_I_[C], 3, "mix"); + // *//* */ test("MixZ_feFooXIfwBar_If", new MixZ_feFooXIfwBar_If[C], 3, "mix"); + /* *//* */ test("MixZ_feFooXIfwBarY__", new MixZ_feFooXIfwBarY__[C], 3, "mix"); + /* *//* */ test("MixZ_feFooXIfwBarY_f", new MixZ_feFooXIfwBarY_f[C], 3, "mix"); + // *//* */ test("MixZ_feFooXIfwBarYI_", new MixZ_feFooXIfwBarYI_[C], 3, "mix"); + // *//* */ test("MixZ_feFooXIfwBarYIf", new MixZ_feFooXIfwBarYIf[C], 3, "mix"); + + // */abstract test("MixZI_eFoo___ ", new MixZI_eFoo___ [C], 2, null ); + // */abstract test("MixZI_eFoo___wBar___", new MixZI_eFoo___wBar___[C], 3, null ); + /* *//* */ test("MixZI_eFoo___wBar__f", new MixZI_eFoo___wBar__f[C], 3, "bar"); + // */abstract test("MixZI_eFoo___wBar_I_", new MixZI_eFoo___wBar_I_[C], 3, null ); + // *//* */ test("MixZI_eFoo___wBar_If", new MixZI_eFoo___wBar_If[C], 3, "bar"); + // */abstract test("MixZI_eFoo___wBarY__", new MixZI_eFoo___wBarY__[C], 3, null ); + /* *//* */ test("MixZI_eFoo___wBarY_f", new MixZI_eFoo___wBarY_f[C], 3, "bar"); + // */abstract test("MixZI_eFoo___wBarYI_", new MixZI_eFoo___wBarYI_[C], 3, null ); + // *//* */ test("MixZI_eFoo___wBarYIf", new MixZI_eFoo___wBarYIf[C], 3, "bar"); + /* *//* */ test("MixZI_eFoo__f ", new MixZI_eFoo__f [C], 2, "foo"); + /* *//* */ test("MixZI_eFoo__fwBar___", new MixZI_eFoo__fwBar___[C], 3, "foo"); + // *//* */ test("MixZI_eFoo__fwBar__f", new MixZI_eFoo__fwBar__f[C], 3, "bar"); + // *//* */ test("MixZI_eFoo__fwBar_I_", new MixZI_eFoo__fwBar_I_[C], 3, "foo"); + // *//* */ test("MixZI_eFoo__fwBar_If", new MixZI_eFoo__fwBar_If[C], 3, "bar"); + /* *//* */ test("MixZI_eFoo__fwBarY__", new MixZI_eFoo__fwBarY__[C], 3, "foo"); + // *//* */ test("MixZI_eFoo__fwBarY_f", new MixZI_eFoo__fwBarY_f[C], 3, "bar"); + // *//* */ test("MixZI_eFoo__fwBarYI_", new MixZI_eFoo__fwBarYI_[C], 3, "foo"); + // *//* */ test("MixZI_eFoo__fwBarYIf", new MixZI_eFoo__fwBarYIf[C], 3, "bar"); + // */abstract test("MixZI_eFoo_I_ ", new MixZI_eFoo_I_ [C], 2, null ); + // */abstract test("MixZI_eFoo_I_wBar___", new MixZI_eFoo_I_wBar___[C], 3, null ); + // *//* */ test("MixZI_eFoo_I_wBar__f", new MixZI_eFoo_I_wBar__f[C], 3, "bar"); + // */abstract test("MixZI_eFoo_I_wBar_I_", new MixZI_eFoo_I_wBar_I_[C], 3, null ); + // *//* */ test("MixZI_eFoo_I_wBar_If", new MixZI_eFoo_I_wBar_If[C], 3, "bar"); + // */abstract test("MixZI_eFoo_I_wBarY__", new MixZI_eFoo_I_wBarY__[C], 3, null ); + // *//* */ test("MixZI_eFoo_I_wBarY_f", new MixZI_eFoo_I_wBarY_f[C], 3, "bar"); + // */abstract test("MixZI_eFoo_I_wBarYI_", new MixZI_eFoo_I_wBarYI_[C], 3, null ); + // *//* */ test("MixZI_eFoo_I_wBarYIf", new MixZI_eFoo_I_wBarYIf[C], 3, "bar"); + // *//* */ test("MixZI_eFoo_If ", new MixZI_eFoo_If [C], 2, "foo"); + // *//* */ test("MixZI_eFoo_IfwBar___", new MixZI_eFoo_IfwBar___[C], 3, "foo"); + // *//* */ test("MixZI_eFoo_IfwBar__f", new MixZI_eFoo_IfwBar__f[C], 3, "bar"); + // *//* */ test("MixZI_eFoo_IfwBar_I_", new MixZI_eFoo_IfwBar_I_[C], 3, "foo"); + // *//* */ test("MixZI_eFoo_IfwBar_If", new MixZI_eFoo_IfwBar_If[C], 3, "bar"); + // *//* */ test("MixZI_eFoo_IfwBarY__", new MixZI_eFoo_IfwBarY__[C], 3, "foo"); + // *//* */ test("MixZI_eFoo_IfwBarY_f", new MixZI_eFoo_IfwBarY_f[C], 3, "bar"); + // *//* */ test("MixZI_eFoo_IfwBarYI_", new MixZI_eFoo_IfwBarYI_[C], 3, "foo"); + // *//* */ test("MixZI_eFoo_IfwBarYIf", new MixZI_eFoo_IfwBarYIf[C], 3, "bar"); + // */abstract test("MixZI_eFooX__ ", new MixZI_eFooX__ [C], 2, null ); + // */abstract test("MixZI_eFooX__wBar___", new MixZI_eFooX__wBar___[C], 3, null ); + /* *//* */ test("MixZI_eFooX__wBar__f", new MixZI_eFooX__wBar__f[C], 3, "bar"); + // */abstract test("MixZI_eFooX__wBar_I_", new MixZI_eFooX__wBar_I_[C], 3, null ); + // *//* */ test("MixZI_eFooX__wBar_If", new MixZI_eFooX__wBar_If[C], 3, "bar"); + // */abstract test("MixZI_eFooX__wBarY__", new MixZI_eFooX__wBarY__[C], 3, null ); + /* *//* */ test("MixZI_eFooX__wBarY_f", new MixZI_eFooX__wBarY_f[C], 3, "bar"); + // */abstract test("MixZI_eFooX__wBarYI_", new MixZI_eFooX__wBarYI_[C], 3, null ); + // *//* */ test("MixZI_eFooX__wBarYIf", new MixZI_eFooX__wBarYIf[C], 3, "bar"); + /* *//* */ test("MixZI_eFooX_f ", new MixZI_eFooX_f [C], 2, "foo"); + /* *//* */ test("MixZI_eFooX_fwBar___", new MixZI_eFooX_fwBar___[C], 3, "foo"); + // *//* */ test("MixZI_eFooX_fwBar__f", new MixZI_eFooX_fwBar__f[C], 3, "bar"); + // *//* */ test("MixZI_eFooX_fwBar_I_", new MixZI_eFooX_fwBar_I_[C], 3, "foo"); + // *//* */ test("MixZI_eFooX_fwBar_If", new MixZI_eFooX_fwBar_If[C], 3, "bar"); + /* *//* */ test("MixZI_eFooX_fwBarY__", new MixZI_eFooX_fwBarY__[C], 3, "foo"); + // *//* */ test("MixZI_eFooX_fwBarY_f", new MixZI_eFooX_fwBarY_f[C], 3, "bar"); + // *//* */ test("MixZI_eFooX_fwBarYI_", new MixZI_eFooX_fwBarYI_[C], 3, "foo"); + // *//* */ test("MixZI_eFooX_fwBarYIf", new MixZI_eFooX_fwBarYIf[C], 3, "bar"); + // */abstract test("MixZI_eFooXI_ ", new MixZI_eFooXI_ [C], 2, null ); + // */abstract test("MixZI_eFooXI_wBar___", new MixZI_eFooXI_wBar___[C], 3, null ); + // *//* */ test("MixZI_eFooXI_wBar__f", new MixZI_eFooXI_wBar__f[C], 3, "bar"); + // */abstract test("MixZI_eFooXI_wBar_I_", new MixZI_eFooXI_wBar_I_[C], 3, null ); + // *//* */ test("MixZI_eFooXI_wBar_If", new MixZI_eFooXI_wBar_If[C], 3, "bar"); + // */abstract test("MixZI_eFooXI_wBarY__", new MixZI_eFooXI_wBarY__[C], 3, null ); + // *//* */ test("MixZI_eFooXI_wBarY_f", new MixZI_eFooXI_wBarY_f[C], 3, "bar"); + // */abstract test("MixZI_eFooXI_wBarYI_", new MixZI_eFooXI_wBarYI_[C], 3, null ); + // *//* */ test("MixZI_eFooXI_wBarYIf", new MixZI_eFooXI_wBarYIf[C], 3, "bar"); + // *//* */ test("MixZI_eFooXIf ", new MixZI_eFooXIf [C], 2, "foo"); + // *//* */ test("MixZI_eFooXIfwBar___", new MixZI_eFooXIfwBar___[C], 3, "foo"); + // *//* */ test("MixZI_eFooXIfwBar__f", new MixZI_eFooXIfwBar__f[C], 3, "bar"); + // *//* */ test("MixZI_eFooXIfwBar_I_", new MixZI_eFooXIfwBar_I_[C], 3, "foo"); + // *//* */ test("MixZI_eFooXIfwBar_If", new MixZI_eFooXIfwBar_If[C], 3, "bar"); + // *//* */ test("MixZI_eFooXIfwBarY__", new MixZI_eFooXIfwBarY__[C], 3, "foo"); + // *//* */ test("MixZI_eFooXIfwBarY_f", new MixZI_eFooXIfwBarY_f[C], 3, "bar"); + // *//* */ test("MixZI_eFooXIfwBarYI_", new MixZI_eFooXIfwBarYI_[C], 3, "foo"); + // *//* */ test("MixZI_eFooXIfwBarYIf", new MixZI_eFooXIfwBarYIf[C], 3, "bar"); + + /* *//* */ test("MixZIfeFoo___ ", new MixZIfeFoo___ [C], 2, "mix"); + /* *//* */ test("MixZIfeFoo___wBar___", new MixZIfeFoo___wBar___[C], 3, "mix"); + /* *//* */ test("MixZIfeFoo___wBar__f", new MixZIfeFoo___wBar__f[C], 3, "mix"); + // *//* */ test("MixZIfeFoo___wBar_I_", new MixZIfeFoo___wBar_I_[C], 3, "mix"); + // *//* */ test("MixZIfeFoo___wBar_If", new MixZIfeFoo___wBar_If[C], 3, "mix"); + /* *//* */ test("MixZIfeFoo___wBarY__", new MixZIfeFoo___wBarY__[C], 3, "mix"); + /* *//* */ test("MixZIfeFoo___wBarY_f", new MixZIfeFoo___wBarY_f[C], 3, "mix"); + // *//* */ test("MixZIfeFoo___wBarYI_", new MixZIfeFoo___wBarYI_[C], 3, "mix"); + // *//* */ test("MixZIfeFoo___wBarYIf", new MixZIfeFoo___wBarYIf[C], 3, "mix"); + /* *//* */ test("MixZIfeFoo__f ", new MixZIfeFoo__f [C], 2, "mix"); + /* *//* */ test("MixZIfeFoo__fwBar___", new MixZIfeFoo__fwBar___[C], 3, "mix"); + /* *//* */ test("MixZIfeFoo__fwBar__f", new MixZIfeFoo__fwBar__f[C], 3, "mix"); + // *//* */ test("MixZIfeFoo__fwBar_I_", new MixZIfeFoo__fwBar_I_[C], 3, "mix"); + // *//* */ test("MixZIfeFoo__fwBar_If", new MixZIfeFoo__fwBar_If[C], 3, "mix"); + /* *//* */ test("MixZIfeFoo__fwBarY__", new MixZIfeFoo__fwBarY__[C], 3, "mix"); + /* *//* */ test("MixZIfeFoo__fwBarY_f", new MixZIfeFoo__fwBarY_f[C], 3, "mix"); + // *//* */ test("MixZIfeFoo__fwBarYI_", new MixZIfeFoo__fwBarYI_[C], 3, "mix"); + // *//* */ test("MixZIfeFoo__fwBarYIf", new MixZIfeFoo__fwBarYIf[C], 3, "mix"); + // *//* */ test("MixZIfeFoo_I_ ", new MixZIfeFoo_I_ [C], 2, "mix"); + // *//* */ test("MixZIfeFoo_I_wBar___", new MixZIfeFoo_I_wBar___[C], 3, "mix"); + // *//* */ test("MixZIfeFoo_I_wBar__f", new MixZIfeFoo_I_wBar__f[C], 3, "mix"); + // *//* */ test("MixZIfeFoo_I_wBar_I_", new MixZIfeFoo_I_wBar_I_[C], 3, "mix"); + // *//* */ test("MixZIfeFoo_I_wBar_If", new MixZIfeFoo_I_wBar_If[C], 3, "mix"); + // *//* */ test("MixZIfeFoo_I_wBarY__", new MixZIfeFoo_I_wBarY__[C], 3, "mix"); + // *//* */ test("MixZIfeFoo_I_wBarY_f", new MixZIfeFoo_I_wBarY_f[C], 3, "mix"); + // *//* */ test("MixZIfeFoo_I_wBarYI_", new MixZIfeFoo_I_wBarYI_[C], 3, "mix"); + // *//* */ test("MixZIfeFoo_I_wBarYIf", new MixZIfeFoo_I_wBarYIf[C], 3, "mix"); + // *//* */ test("MixZIfeFoo_If ", new MixZIfeFoo_If [C], 2, "mix"); + // *//* */ test("MixZIfeFoo_IfwBar___", new MixZIfeFoo_IfwBar___[C], 3, "mix"); + // *//* */ test("MixZIfeFoo_IfwBar__f", new MixZIfeFoo_IfwBar__f[C], 3, "mix"); + // *//* */ test("MixZIfeFoo_IfwBar_I_", new MixZIfeFoo_IfwBar_I_[C], 3, "mix"); + // *//* */ test("MixZIfeFoo_IfwBar_If", new MixZIfeFoo_IfwBar_If[C], 3, "mix"); + // *//* */ test("MixZIfeFoo_IfwBarY__", new MixZIfeFoo_IfwBarY__[C], 3, "mix"); + // *//* */ test("MixZIfeFoo_IfwBarY_f", new MixZIfeFoo_IfwBarY_f[C], 3, "mix"); + // *//* */ test("MixZIfeFoo_IfwBarYI_", new MixZIfeFoo_IfwBarYI_[C], 3, "mix"); + // *//* */ test("MixZIfeFoo_IfwBarYIf", new MixZIfeFoo_IfwBarYIf[C], 3, "mix"); + /* *//* */ test("MixZIfeFooX__ ", new MixZIfeFooX__ [C], 2, "mix"); + /* *//* */ test("MixZIfeFooX__wBar___", new MixZIfeFooX__wBar___[C], 3, "mix"); + /* *//* */ test("MixZIfeFooX__wBar__f", new MixZIfeFooX__wBar__f[C], 3, "mix"); + // *//* */ test("MixZIfeFooX__wBar_I_", new MixZIfeFooX__wBar_I_[C], 3, "mix"); + // *//* */ test("MixZIfeFooX__wBar_If", new MixZIfeFooX__wBar_If[C], 3, "mix"); + /* *//* */ test("MixZIfeFooX__wBarY__", new MixZIfeFooX__wBarY__[C], 3, "mix"); + /* *//* */ test("MixZIfeFooX__wBarY_f", new MixZIfeFooX__wBarY_f[C], 3, "mix"); + // *//* */ test("MixZIfeFooX__wBarYI_", new MixZIfeFooX__wBarYI_[C], 3, "mix"); + // *//* */ test("MixZIfeFooX__wBarYIf", new MixZIfeFooX__wBarYIf[C], 3, "mix"); + /* *//* */ test("MixZIfeFooX_f ", new MixZIfeFooX_f [C], 2, "mix"); + /* *//* */ test("MixZIfeFooX_fwBar___", new MixZIfeFooX_fwBar___[C], 3, "mix"); + /* *//* */ test("MixZIfeFooX_fwBar__f", new MixZIfeFooX_fwBar__f[C], 3, "mix"); + // *//* */ test("MixZIfeFooX_fwBar_I_", new MixZIfeFooX_fwBar_I_[C], 3, "mix"); + // *//* */ test("MixZIfeFooX_fwBar_If", new MixZIfeFooX_fwBar_If[C], 3, "mix"); + /* *//* */ test("MixZIfeFooX_fwBarY__", new MixZIfeFooX_fwBarY__[C], 3, "mix"); + /* *//* */ test("MixZIfeFooX_fwBarY_f", new MixZIfeFooX_fwBarY_f[C], 3, "mix"); + // *//* */ test("MixZIfeFooX_fwBarYI_", new MixZIfeFooX_fwBarYI_[C], 3, "mix"); + // *//* */ test("MixZIfeFooX_fwBarYIf", new MixZIfeFooX_fwBarYIf[C], 3, "mix"); + // *//* */ test("MixZIfeFooXI_ ", new MixZIfeFooXI_ [C], 2, "mix"); + // *//* */ test("MixZIfeFooXI_wBar___", new MixZIfeFooXI_wBar___[C], 3, "mix"); + // *//* */ test("MixZIfeFooXI_wBar__f", new MixZIfeFooXI_wBar__f[C], 3, "mix"); + // *//* */ test("MixZIfeFooXI_wBar_I_", new MixZIfeFooXI_wBar_I_[C], 3, "mix"); + // *//* */ test("MixZIfeFooXI_wBar_If", new MixZIfeFooXI_wBar_If[C], 3, "mix"); + // *//* */ test("MixZIfeFooXI_wBarY__", new MixZIfeFooXI_wBarY__[C], 3, "mix"); + // *//* */ test("MixZIfeFooXI_wBarY_f", new MixZIfeFooXI_wBarY_f[C], 3, "mix"); + // *//* */ test("MixZIfeFooXI_wBarYI_", new MixZIfeFooXI_wBarYI_[C], 3, "mix"); + // *//* */ test("MixZIfeFooXI_wBarYIf", new MixZIfeFooXI_wBarYIf[C], 3, "mix"); + // *//* */ test("MixZIfeFooXIf ", new MixZIfeFooXIf [C], 2, "mix"); + // *//* */ test("MixZIfeFooXIfwBar___", new MixZIfeFooXIfwBar___[C], 3, "mix"); + // *//* */ test("MixZIfeFooXIfwBar__f", new MixZIfeFooXIfwBar__f[C], 3, "mix"); + // *//* */ test("MixZIfeFooXIfwBar_I_", new MixZIfeFooXIfwBar_I_[C], 3, "mix"); + // *//* */ test("MixZIfeFooXIfwBar_If", new MixZIfeFooXIfwBar_If[C], 3, "mix"); + // *//* */ test("MixZIfeFooXIfwBarY__", new MixZIfeFooXIfwBarY__[C], 3, "mix"); + // *//* */ test("MixZIfeFooXIfwBarY_f", new MixZIfeFooXIfwBarY_f[C], 3, "mix"); + // *//* */ test("MixZIfeFooXIfwBarYI_", new MixZIfeFooXIfwBarYI_[C], 3, "mix"); + // *//* */ test("MixZIfeFooXIfwBarYIf", new MixZIfeFooXIfwBarYIf[C], 3, "mix"); + + + + // */abstract test("Mix___wFoo___ ", new Mix___wFoo___ , 2, null ); + // */abstract test("Mix___wFoo___wBar___", new Mix___wFoo___wBar___ , 3, null ); + // */abstract test("Mix___wFoo___wBar__f", new Mix___wFoo___wBar__f , 3, "bar"); + // */abstract test("Mix___wFoo___wBar_I_", new Mix___wFoo___wBar_I_ , 3, null ); + /* *//* */ test("Mix___wFoo___wBar_If", new Mix___wFoo___wBar_If , 3, "bar"); + // */abstract test("Mix___wFoo___wBarY__", new Mix___wFoo___wBarY__ , 3, null ); + // */abstract test("Mix___wFoo___wBarY_f", new Mix___wFoo___wBarY_f , 3, "bar"); + // */abstract test("Mix___wFoo___wBarYI_", new Mix___wFoo___wBarYI_ , 3, null ); + /* *//* */ test("Mix___wFoo___wBarYIf", new Mix___wFoo___wBarYIf , 3, "bar"); + // */abstract test("Mix___wFoo__f ", new Mix___wFoo__f , 2, "foo"); + // */abstract test("Mix___wFoo__fwBar___", new Mix___wFoo__fwBar___ , 3, "foo"); + // */abstract test("Mix___wFoo__fwBar__f", new Mix___wFoo__fwBar__f , 3, "bar"); + /* *//* */ test("Mix___wFoo__fwBar_I_", new Mix___wFoo__fwBar_I_ , 3, "foo"); + // *//* */ test("Mix___wFoo__fwBar_If", new Mix___wFoo__fwBar_If , 3, "bar"); + // */abstract test("Mix___wFoo__fwBarY__", new Mix___wFoo__fwBarY__ , 3, "foo"); + // */abstract test("Mix___wFoo__fwBarY_f", new Mix___wFoo__fwBarY_f , 3, "bar"); + /* *//* */ test("Mix___wFoo__fwBarYI_", new Mix___wFoo__fwBarYI_ , 3, "foo"); + // *//* */ test("Mix___wFoo__fwBarYIf", new Mix___wFoo__fwBarYIf , 3, "bar"); + // */abstract test("Mix___wFoo_I_ ", new Mix___wFoo_I_ , 2, null ); + // */abstract test("Mix___wFoo_I_wBar___", new Mix___wFoo_I_wBar___ , 3, null ); + /* *//* */ test("Mix___wFoo_I_wBar__f", new Mix___wFoo_I_wBar__f , 3, "bar"); + // */abstract test("Mix___wFoo_I_wBar_I_", new Mix___wFoo_I_wBar_I_ , 3, null ); + // *//* */ test("Mix___wFoo_I_wBar_If", new Mix___wFoo_I_wBar_If , 3, "bar"); + // */abstract test("Mix___wFoo_I_wBarY__", new Mix___wFoo_I_wBarY__ , 3, null ); + /* *//* */ test("Mix___wFoo_I_wBarY_f", new Mix___wFoo_I_wBarY_f , 3, "bar"); + // */abstract test("Mix___wFoo_I_wBarYI_", new Mix___wFoo_I_wBarYI_ , 3, null ); + // *//* */ test("Mix___wFoo_I_wBarYIf", new Mix___wFoo_I_wBarYIf , 3, "bar"); + /* *//* */ test("Mix___wFoo_If ", new Mix___wFoo_If , 2, "foo"); + /* *//* */ test("Mix___wFoo_IfwBar___", new Mix___wFoo_IfwBar___ , 3, "foo"); + // *//* */ test("Mix___wFoo_IfwBar__f", new Mix___wFoo_IfwBar__f , 3, "bar"); + // *//* */ test("Mix___wFoo_IfwBar_I_", new Mix___wFoo_IfwBar_I_ , 3, "foo"); + // *//* */ test("Mix___wFoo_IfwBar_If", new Mix___wFoo_IfwBar_If , 3, "bar"); + /* *//* */ test("Mix___wFoo_IfwBarY__", new Mix___wFoo_IfwBarY__ , 3, "foo"); + // *//* */ test("Mix___wFoo_IfwBarY_f", new Mix___wFoo_IfwBarY_f , 3, "bar"); + // *//* */ test("Mix___wFoo_IfwBarYI_", new Mix___wFoo_IfwBarYI_ , 3, "foo"); + // *//* */ test("Mix___wFoo_IfwBarYIf", new Mix___wFoo_IfwBarYIf , 3, "bar"); + // */abstract test("Mix___wFooX__ ", new Mix___wFooX__ , 2, null ); + // */abstract test("Mix___wFooX__wBar___", new Mix___wFooX__wBar___ , 3, null ); + // */abstract test("Mix___wFooX__wBar__f", new Mix___wFooX__wBar__f , 3, "bar"); + // */abstract test("Mix___wFooX__wBar_I_", new Mix___wFooX__wBar_I_ , 3, null ); + /* *//* */ test("Mix___wFooX__wBar_If", new Mix___wFooX__wBar_If , 3, "bar"); + // */abstract test("Mix___wFooX__wBarY__", new Mix___wFooX__wBarY__ , 3, null ); + // */abstract test("Mix___wFooX__wBarY_f", new Mix___wFooX__wBarY_f , 3, "bar"); + // */abstract test("Mix___wFooX__wBarYI_", new Mix___wFooX__wBarYI_ , 3, null ); + /* *//* */ test("Mix___wFooX__wBarYIf", new Mix___wFooX__wBarYIf , 3, "bar"); + // */abstract test("Mix___wFooX_f ", new Mix___wFooX_f , 2, "foo"); + // */abstract test("Mix___wFooX_fwBar___", new Mix___wFooX_fwBar___ , 3, "foo"); + // */abstract test("Mix___wFooX_fwBar__f", new Mix___wFooX_fwBar__f , 3, "bar"); + /* *//* */ test("Mix___wFooX_fwBar_I_", new Mix___wFooX_fwBar_I_ , 3, "foo"); + // *//* */ test("Mix___wFooX_fwBar_If", new Mix___wFooX_fwBar_If , 3, "bar"); + // */abstract test("Mix___wFooX_fwBarY__", new Mix___wFooX_fwBarY__ , 3, "foo"); + // */abstract test("Mix___wFooX_fwBarY_f", new Mix___wFooX_fwBarY_f , 3, "bar"); + /* *//* */ test("Mix___wFooX_fwBarYI_", new Mix___wFooX_fwBarYI_ , 3, "foo"); + // *//* */ test("Mix___wFooX_fwBarYIf", new Mix___wFooX_fwBarYIf , 3, "bar"); + // */abstract test("Mix___wFooXI_ ", new Mix___wFooXI_ , 2, null ); + // */abstract test("Mix___wFooXI_wBar___", new Mix___wFooXI_wBar___ , 3, null ); + /* *//* */ test("Mix___wFooXI_wBar__f", new Mix___wFooXI_wBar__f , 3, "bar"); + // */abstract test("Mix___wFooXI_wBar_I_", new Mix___wFooXI_wBar_I_ , 3, null ); + // *//* */ test("Mix___wFooXI_wBar_If", new Mix___wFooXI_wBar_If , 3, "bar"); + // */abstract test("Mix___wFooXI_wBarY__", new Mix___wFooXI_wBarY__ , 3, null ); + /* *//* */ test("Mix___wFooXI_wBarY_f", new Mix___wFooXI_wBarY_f , 3, "bar"); + // */abstract test("Mix___wFooXI_wBarYI_", new Mix___wFooXI_wBarYI_ , 3, null ); + // *//* */ test("Mix___wFooXI_wBarYIf", new Mix___wFooXI_wBarYIf , 3, "bar"); + /* *//* */ test("Mix___wFooXIf ", new Mix___wFooXIf , 2, "foo"); + /* *//* */ test("Mix___wFooXIfwBar___", new Mix___wFooXIfwBar___ , 3, "foo"); + // *//* */ test("Mix___wFooXIfwBar__f", new Mix___wFooXIfwBar__f , 3, "bar"); + // *//* */ test("Mix___wFooXIfwBar_I_", new Mix___wFooXIfwBar_I_ , 3, "foo"); + // *//* */ test("Mix___wFooXIfwBar_If", new Mix___wFooXIfwBar_If , 3, "bar"); + /* *//* */ test("Mix___wFooXIfwBarY__", new Mix___wFooXIfwBarY__ , 3, "foo"); + // *//* */ test("Mix___wFooXIfwBarY_f", new Mix___wFooXIfwBarY_f , 3, "bar"); + // *//* */ test("Mix___wFooXIfwBarYI_", new Mix___wFooXIfwBarYI_ , 3, "foo"); + // *//* */ test("Mix___wFooXIfwBarYIf", new Mix___wFooXIfwBarYIf , 3, "bar"); + + // */abstract test("Mix__fwFoo___ ", new Mix__fwFoo___ , 2, "mix"); + // */abstract test("Mix__fwFoo___wBar___", new Mix__fwFoo___wBar___ , 3, "mix"); + // */abstract test("Mix__fwFoo___wBar__f", new Mix__fwFoo___wBar__f , 3, "mix"); + /* *//* */ test("Mix__fwFoo___wBar_I_", new Mix__fwFoo___wBar_I_ , 3, "mix"); + /* *//* */ test("Mix__fwFoo___wBar_If", new Mix__fwFoo___wBar_If , 3, "mix"); + // */abstract test("Mix__fwFoo___wBarY__", new Mix__fwFoo___wBarY__ , 3, "mix"); + // */abstract test("Mix__fwFoo___wBarY_f", new Mix__fwFoo___wBarY_f , 3, "mix"); + /* *//* */ test("Mix__fwFoo___wBarYI_", new Mix__fwFoo___wBarYI_ , 3, "mix"); + /* *//* */ test("Mix__fwFoo___wBarYIf", new Mix__fwFoo___wBarYIf , 3, "mix"); + // */abstract test("Mix__fwFoo__f ", new Mix__fwFoo__f , 2, "mix"); + // */abstract test("Mix__fwFoo__fwBar___", new Mix__fwFoo__fwBar___ , 3, "mix"); + // */abstract test("Mix__fwFoo__fwBar__f", new Mix__fwFoo__fwBar__f , 3, "mix"); + /* *//* */ test("Mix__fwFoo__fwBar_I_", new Mix__fwFoo__fwBar_I_ , 3, "mix"); + /* *//* */ test("Mix__fwFoo__fwBar_If", new Mix__fwFoo__fwBar_If , 3, "mix"); + // */abstract test("Mix__fwFoo__fwBarY__", new Mix__fwFoo__fwBarY__ , 3, "mix"); + // */abstract test("Mix__fwFoo__fwBarY_f", new Mix__fwFoo__fwBarY_f , 3, "mix"); + /* *//* */ test("Mix__fwFoo__fwBarYI_", new Mix__fwFoo__fwBarYI_ , 3, "mix"); + /* *//* */ test("Mix__fwFoo__fwBarYIf", new Mix__fwFoo__fwBarYIf , 3, "mix"); + /* *//* */ test("Mix__fwFoo_I_ ", new Mix__fwFoo_I_ , 2, "mix"); + /* *//* */ test("Mix__fwFoo_I_wBar___", new Mix__fwFoo_I_wBar___ , 3, "mix"); + /* *//* */ test("Mix__fwFoo_I_wBar__f", new Mix__fwFoo_I_wBar__f , 3, "mix"); + // *//* */ test("Mix__fwFoo_I_wBar_I_", new Mix__fwFoo_I_wBar_I_ , 3, "mix"); + // *//* */ test("Mix__fwFoo_I_wBar_If", new Mix__fwFoo_I_wBar_If , 3, "mix"); + /* *//* */ test("Mix__fwFoo_I_wBarY__", new Mix__fwFoo_I_wBarY__ , 3, "mix"); + /* *//* */ test("Mix__fwFoo_I_wBarY_f", new Mix__fwFoo_I_wBarY_f , 3, "mix"); + // *//* */ test("Mix__fwFoo_I_wBarYI_", new Mix__fwFoo_I_wBarYI_ , 3, "mix"); + // *//* */ test("Mix__fwFoo_I_wBarYIf", new Mix__fwFoo_I_wBarYIf , 3, "mix"); + /* *//* */ test("Mix__fwFoo_If ", new Mix__fwFoo_If , 2, "mix"); + /* *//* */ test("Mix__fwFoo_IfwBar___", new Mix__fwFoo_IfwBar___ , 3, "mix"); + /* *//* */ test("Mix__fwFoo_IfwBar__f", new Mix__fwFoo_IfwBar__f , 3, "mix"); + // *//* */ test("Mix__fwFoo_IfwBar_I_", new Mix__fwFoo_IfwBar_I_ , 3, "mix"); + // *//* */ test("Mix__fwFoo_IfwBar_If", new Mix__fwFoo_IfwBar_If , 3, "mix"); + /* *//* */ test("Mix__fwFoo_IfwBarY__", new Mix__fwFoo_IfwBarY__ , 3, "mix"); + /* *//* */ test("Mix__fwFoo_IfwBarY_f", new Mix__fwFoo_IfwBarY_f , 3, "mix"); + // *//* */ test("Mix__fwFoo_IfwBarYI_", new Mix__fwFoo_IfwBarYI_ , 3, "mix"); + // *//* */ test("Mix__fwFoo_IfwBarYIf", new Mix__fwFoo_IfwBarYIf , 3, "mix"); + // */abstract test("Mix__fwFooX__ ", new Mix__fwFooX__ , 2, "mix"); + // */abstract test("Mix__fwFooX__wBar___", new Mix__fwFooX__wBar___ , 3, "mix"); + // */abstract test("Mix__fwFooX__wBar__f", new Mix__fwFooX__wBar__f , 3, "mix"); + /* *//* */ test("Mix__fwFooX__wBar_I_", new Mix__fwFooX__wBar_I_ , 3, "mix"); + /* *//* */ test("Mix__fwFooX__wBar_If", new Mix__fwFooX__wBar_If , 3, "mix"); + // */abstract test("Mix__fwFooX__wBarY__", new Mix__fwFooX__wBarY__ , 3, "mix"); + // */abstract test("Mix__fwFooX__wBarY_f", new Mix__fwFooX__wBarY_f , 3, "mix"); + /* *//* */ test("Mix__fwFooX__wBarYI_", new Mix__fwFooX__wBarYI_ , 3, "mix"); + /* *//* */ test("Mix__fwFooX__wBarYIf", new Mix__fwFooX__wBarYIf , 3, "mix"); + // */abstract test("Mix__fwFooX_f ", new Mix__fwFooX_f , 2, "mix"); + // */abstract test("Mix__fwFooX_fwBar___", new Mix__fwFooX_fwBar___ , 3, "mix"); + // */abstract test("Mix__fwFooX_fwBar__f", new Mix__fwFooX_fwBar__f , 3, "mix"); + /* *//* */ test("Mix__fwFooX_fwBar_I_", new Mix__fwFooX_fwBar_I_ , 3, "mix"); + /* *//* */ test("Mix__fwFooX_fwBar_If", new Mix__fwFooX_fwBar_If , 3, "mix"); + // */abstract test("Mix__fwFooX_fwBarY__", new Mix__fwFooX_fwBarY__ , 3, "mix"); + // */abstract test("Mix__fwFooX_fwBarY_f", new Mix__fwFooX_fwBarY_f , 3, "mix"); + /* *//* */ test("Mix__fwFooX_fwBarYI_", new Mix__fwFooX_fwBarYI_ , 3, "mix"); + /* *//* */ test("Mix__fwFooX_fwBarYIf", new Mix__fwFooX_fwBarYIf , 3, "mix"); + /* *//* */ test("Mix__fwFooXI_ ", new Mix__fwFooXI_ , 2, "mix"); + /* *//* */ test("Mix__fwFooXI_wBar___", new Mix__fwFooXI_wBar___ , 3, "mix"); + /* *//* */ test("Mix__fwFooXI_wBar__f", new Mix__fwFooXI_wBar__f , 3, "mix"); + // *//* */ test("Mix__fwFooXI_wBar_I_", new Mix__fwFooXI_wBar_I_ , 3, "mix"); + // *//* */ test("Mix__fwFooXI_wBar_If", new Mix__fwFooXI_wBar_If , 3, "mix"); + /* *//* */ test("Mix__fwFooXI_wBarY__", new Mix__fwFooXI_wBarY__ , 3, "mix"); + /* *//* */ test("Mix__fwFooXI_wBarY_f", new Mix__fwFooXI_wBarY_f , 3, "mix"); + // *//* */ test("Mix__fwFooXI_wBarYI_", new Mix__fwFooXI_wBarYI_ , 3, "mix"); + // *//* */ test("Mix__fwFooXI_wBarYIf", new Mix__fwFooXI_wBarYIf , 3, "mix"); + /* *//* */ test("Mix__fwFooXIf ", new Mix__fwFooXIf , 2, "mix"); + /* *//* */ test("Mix__fwFooXIfwBar___", new Mix__fwFooXIfwBar___ , 3, "mix"); + /* *//* */ test("Mix__fwFooXIfwBar__f", new Mix__fwFooXIfwBar__f , 3, "mix"); + // *//* */ test("Mix__fwFooXIfwBar_I_", new Mix__fwFooXIfwBar_I_ , 3, "mix"); + // *//* */ test("Mix__fwFooXIfwBar_If", new Mix__fwFooXIfwBar_If , 3, "mix"); + /* *//* */ test("Mix__fwFooXIfwBarY__", new Mix__fwFooXIfwBarY__ , 3, "mix"); + /* *//* */ test("Mix__fwFooXIfwBarY_f", new Mix__fwFooXIfwBarY_f , 3, "mix"); + // *//* */ test("Mix__fwFooXIfwBarYI_", new Mix__fwFooXIfwBarYI_ , 3, "mix"); + // *//* */ test("Mix__fwFooXIfwBarYIf", new Mix__fwFooXIfwBarYIf , 3, "mix"); + + // */abstract test("Mix_I_wFoo___ ", new Mix_I_wFoo___ , 2, null ); + // */abstract test("Mix_I_wFoo___wBar___", new Mix_I_wFoo___wBar___ , 3, null ); + /* *//* */ test("Mix_I_wFoo___wBar__f", new Mix_I_wFoo___wBar__f , 3, "bar"); + // */abstract test("Mix_I_wFoo___wBar_I_", new Mix_I_wFoo___wBar_I_ , 3, null ); + // *//* */ test("Mix_I_wFoo___wBar_If", new Mix_I_wFoo___wBar_If , 3, "bar"); + // */abstract test("Mix_I_wFoo___wBarY__", new Mix_I_wFoo___wBarY__ , 3, null ); + /* *//* */ test("Mix_I_wFoo___wBarY_f", new Mix_I_wFoo___wBarY_f , 3, "bar"); + // */abstract test("Mix_I_wFoo___wBarYI_", new Mix_I_wFoo___wBarYI_ , 3, null ); + // *//* */ test("Mix_I_wFoo___wBarYIf", new Mix_I_wFoo___wBarYIf , 3, "bar"); + /* *//* */ test("Mix_I_wFoo__f ", new Mix_I_wFoo__f , 2, "foo"); + /* *//* */ test("Mix_I_wFoo__fwBar___", new Mix_I_wFoo__fwBar___ , 3, "foo"); + // *//* */ test("Mix_I_wFoo__fwBar__f", new Mix_I_wFoo__fwBar__f , 3, "bar"); + // *//* */ test("Mix_I_wFoo__fwBar_I_", new Mix_I_wFoo__fwBar_I_ , 3, "foo"); + // *//* */ test("Mix_I_wFoo__fwBar_If", new Mix_I_wFoo__fwBar_If , 3, "bar"); + /* *//* */ test("Mix_I_wFoo__fwBarY__", new Mix_I_wFoo__fwBarY__ , 3, "foo"); + // *//* */ test("Mix_I_wFoo__fwBarY_f", new Mix_I_wFoo__fwBarY_f , 3, "bar"); + // *//* */ test("Mix_I_wFoo__fwBarYI_", new Mix_I_wFoo__fwBarYI_ , 3, "foo"); + // *//* */ test("Mix_I_wFoo__fwBarYIf", new Mix_I_wFoo__fwBarYIf , 3, "bar"); + // */abstract test("Mix_I_wFoo_I_ ", new Mix_I_wFoo_I_ , 2, null ); + // */abstract test("Mix_I_wFoo_I_wBar___", new Mix_I_wFoo_I_wBar___ , 3, null ); + // *//* */ test("Mix_I_wFoo_I_wBar__f", new Mix_I_wFoo_I_wBar__f , 3, "bar"); + // */abstract test("Mix_I_wFoo_I_wBar_I_", new Mix_I_wFoo_I_wBar_I_ , 3, null ); + // *//* */ test("Mix_I_wFoo_I_wBar_If", new Mix_I_wFoo_I_wBar_If , 3, "bar"); + // */abstract test("Mix_I_wFoo_I_wBarY__", new Mix_I_wFoo_I_wBarY__ , 3, null ); + // *//* */ test("Mix_I_wFoo_I_wBarY_f", new Mix_I_wFoo_I_wBarY_f , 3, "bar"); + // */abstract test("Mix_I_wFoo_I_wBarYI_", new Mix_I_wFoo_I_wBarYI_ , 3, null ); + // *//* */ test("Mix_I_wFoo_I_wBarYIf", new Mix_I_wFoo_I_wBarYIf , 3, "bar"); + // *//* */ test("Mix_I_wFoo_If ", new Mix_I_wFoo_If , 2, "foo"); + // *//* */ test("Mix_I_wFoo_IfwBar___", new Mix_I_wFoo_IfwBar___ , 3, "foo"); + // *//* */ test("Mix_I_wFoo_IfwBar__f", new Mix_I_wFoo_IfwBar__f , 3, "bar"); + // *//* */ test("Mix_I_wFoo_IfwBar_I_", new Mix_I_wFoo_IfwBar_I_ , 3, "foo"); + // *//* */ test("Mix_I_wFoo_IfwBar_If", new Mix_I_wFoo_IfwBar_If , 3, "bar"); + // *//* */ test("Mix_I_wFoo_IfwBarY__", new Mix_I_wFoo_IfwBarY__ , 3, "foo"); + // *//* */ test("Mix_I_wFoo_IfwBarY_f", new Mix_I_wFoo_IfwBarY_f , 3, "bar"); + // *//* */ test("Mix_I_wFoo_IfwBarYI_", new Mix_I_wFoo_IfwBarYI_ , 3, "foo"); + // *//* */ test("Mix_I_wFoo_IfwBarYIf", new Mix_I_wFoo_IfwBarYIf , 3, "bar"); + // */abstract test("Mix_I_wFooX__ ", new Mix_I_wFooX__ , 2, null ); + // */abstract test("Mix_I_wFooX__wBar___", new Mix_I_wFooX__wBar___ , 3, null ); + /* *//* */ test("Mix_I_wFooX__wBar__f", new Mix_I_wFooX__wBar__f , 3, "bar"); + // */abstract test("Mix_I_wFooX__wBar_I_", new Mix_I_wFooX__wBar_I_ , 3, null ); + // *//* */ test("Mix_I_wFooX__wBar_If", new Mix_I_wFooX__wBar_If , 3, "bar"); + // */abstract test("Mix_I_wFooX__wBarY__", new Mix_I_wFooX__wBarY__ , 3, null ); + /* *//* */ test("Mix_I_wFooX__wBarY_f", new Mix_I_wFooX__wBarY_f , 3, "bar"); + // */abstract test("Mix_I_wFooX__wBarYI_", new Mix_I_wFooX__wBarYI_ , 3, null ); + // *//* */ test("Mix_I_wFooX__wBarYIf", new Mix_I_wFooX__wBarYIf , 3, "bar"); + /* *//* */ test("Mix_I_wFooX_f ", new Mix_I_wFooX_f , 2, "foo"); + /* *//* */ test("Mix_I_wFooX_fwBar___", new Mix_I_wFooX_fwBar___ , 3, "foo"); + // *//* */ test("Mix_I_wFooX_fwBar__f", new Mix_I_wFooX_fwBar__f , 3, "bar"); + // *//* */ test("Mix_I_wFooX_fwBar_I_", new Mix_I_wFooX_fwBar_I_ , 3, "foo"); + // *//* */ test("Mix_I_wFooX_fwBar_If", new Mix_I_wFooX_fwBar_If , 3, "bar"); + /* *//* */ test("Mix_I_wFooX_fwBarY__", new Mix_I_wFooX_fwBarY__ , 3, "foo"); + // *//* */ test("Mix_I_wFooX_fwBarY_f", new Mix_I_wFooX_fwBarY_f , 3, "bar"); + // *//* */ test("Mix_I_wFooX_fwBarYI_", new Mix_I_wFooX_fwBarYI_ , 3, "foo"); + // *//* */ test("Mix_I_wFooX_fwBarYIf", new Mix_I_wFooX_fwBarYIf , 3, "bar"); + // */abstract test("Mix_I_wFooXI_ ", new Mix_I_wFooXI_ , 2, null ); + // */abstract test("Mix_I_wFooXI_wBar___", new Mix_I_wFooXI_wBar___ , 3, null ); + // *//* */ test("Mix_I_wFooXI_wBar__f", new Mix_I_wFooXI_wBar__f , 3, "bar"); + // */abstract test("Mix_I_wFooXI_wBar_I_", new Mix_I_wFooXI_wBar_I_ , 3, null ); + // *//* */ test("Mix_I_wFooXI_wBar_If", new Mix_I_wFooXI_wBar_If , 3, "bar"); + // */abstract test("Mix_I_wFooXI_wBarY__", new Mix_I_wFooXI_wBarY__ , 3, null ); + // *//* */ test("Mix_I_wFooXI_wBarY_f", new Mix_I_wFooXI_wBarY_f , 3, "bar"); + // */abstract test("Mix_I_wFooXI_wBarYI_", new Mix_I_wFooXI_wBarYI_ , 3, null ); + // *//* */ test("Mix_I_wFooXI_wBarYIf", new Mix_I_wFooXI_wBarYIf , 3, "bar"); + // *//* */ test("Mix_I_wFooXIf ", new Mix_I_wFooXIf , 2, "foo"); + // *//* */ test("Mix_I_wFooXIfwBar___", new Mix_I_wFooXIfwBar___ , 3, "foo"); + // *//* */ test("Mix_I_wFooXIfwBar__f", new Mix_I_wFooXIfwBar__f , 3, "bar"); + // *//* */ test("Mix_I_wFooXIfwBar_I_", new Mix_I_wFooXIfwBar_I_ , 3, "foo"); + // *//* */ test("Mix_I_wFooXIfwBar_If", new Mix_I_wFooXIfwBar_If , 3, "bar"); + // *//* */ test("Mix_I_wFooXIfwBarY__", new Mix_I_wFooXIfwBarY__ , 3, "foo"); + // *//* */ test("Mix_I_wFooXIfwBarY_f", new Mix_I_wFooXIfwBarY_f , 3, "bar"); + // *//* */ test("Mix_I_wFooXIfwBarYI_", new Mix_I_wFooXIfwBarYI_ , 3, "foo"); + // *//* */ test("Mix_I_wFooXIfwBarYIf", new Mix_I_wFooXIfwBarYIf , 3, "bar"); + + /* *//* */ test("Mix_IfwFoo___ ", new Mix_IfwFoo___ , 2, "mix"); + /* *//* */ test("Mix_IfwFoo___wBar___", new Mix_IfwFoo___wBar___ , 3, "mix"); + /* *//* */ test("Mix_IfwFoo___wBar__f", new Mix_IfwFoo___wBar__f , 3, "mix"); + // *//* */ test("Mix_IfwFoo___wBar_I_", new Mix_IfwFoo___wBar_I_ , 3, "mix"); + // *//* */ test("Mix_IfwFoo___wBar_If", new Mix_IfwFoo___wBar_If , 3, "mix"); + /* *//* */ test("Mix_IfwFoo___wBarY__", new Mix_IfwFoo___wBarY__ , 3, "mix"); + /* *//* */ test("Mix_IfwFoo___wBarY_f", new Mix_IfwFoo___wBarY_f , 3, "mix"); + // *//* */ test("Mix_IfwFoo___wBarYI_", new Mix_IfwFoo___wBarYI_ , 3, "mix"); + // *//* */ test("Mix_IfwFoo___wBarYIf", new Mix_IfwFoo___wBarYIf , 3, "mix"); + /* *//* */ test("Mix_IfwFoo__f ", new Mix_IfwFoo__f , 2, "mix"); + /* *//* */ test("Mix_IfwFoo__fwBar___", new Mix_IfwFoo__fwBar___ , 3, "mix"); + /* *//* */ test("Mix_IfwFoo__fwBar__f", new Mix_IfwFoo__fwBar__f , 3, "mix"); + // *//* */ test("Mix_IfwFoo__fwBar_I_", new Mix_IfwFoo__fwBar_I_ , 3, "mix"); + // *//* */ test("Mix_IfwFoo__fwBar_If", new Mix_IfwFoo__fwBar_If , 3, "mix"); + /* *//* */ test("Mix_IfwFoo__fwBarY__", new Mix_IfwFoo__fwBarY__ , 3, "mix"); + /* *//* */ test("Mix_IfwFoo__fwBarY_f", new Mix_IfwFoo__fwBarY_f , 3, "mix"); + // *//* */ test("Mix_IfwFoo__fwBarYI_", new Mix_IfwFoo__fwBarYI_ , 3, "mix"); + // *//* */ test("Mix_IfwFoo__fwBarYIf", new Mix_IfwFoo__fwBarYIf , 3, "mix"); + // *//* */ test("Mix_IfwFoo_I_ ", new Mix_IfwFoo_I_ , 2, "mix"); + // *//* */ test("Mix_IfwFoo_I_wBar___", new Mix_IfwFoo_I_wBar___ , 3, "mix"); + // *//* */ test("Mix_IfwFoo_I_wBar__f", new Mix_IfwFoo_I_wBar__f , 3, "mix"); + // *//* */ test("Mix_IfwFoo_I_wBar_I_", new Mix_IfwFoo_I_wBar_I_ , 3, "mix"); + // *//* */ test("Mix_IfwFoo_I_wBar_If", new Mix_IfwFoo_I_wBar_If , 3, "mix"); + // *//* */ test("Mix_IfwFoo_I_wBarY__", new Mix_IfwFoo_I_wBarY__ , 3, "mix"); + // *//* */ test("Mix_IfwFoo_I_wBarY_f", new Mix_IfwFoo_I_wBarY_f , 3, "mix"); + // *//* */ test("Mix_IfwFoo_I_wBarYI_", new Mix_IfwFoo_I_wBarYI_ , 3, "mix"); + // *//* */ test("Mix_IfwFoo_I_wBarYIf", new Mix_IfwFoo_I_wBarYIf , 3, "mix"); + // *//* */ test("Mix_IfwFoo_If ", new Mix_IfwFoo_If , 2, "mix"); + // *//* */ test("Mix_IfwFoo_IfwBar___", new Mix_IfwFoo_IfwBar___ , 3, "mix"); + // *//* */ test("Mix_IfwFoo_IfwBar__f", new Mix_IfwFoo_IfwBar__f , 3, "mix"); + // *//* */ test("Mix_IfwFoo_IfwBar_I_", new Mix_IfwFoo_IfwBar_I_ , 3, "mix"); + // *//* */ test("Mix_IfwFoo_IfwBar_If", new Mix_IfwFoo_IfwBar_If , 3, "mix"); + // *//* */ test("Mix_IfwFoo_IfwBarY__", new Mix_IfwFoo_IfwBarY__ , 3, "mix"); + // *//* */ test("Mix_IfwFoo_IfwBarY_f", new Mix_IfwFoo_IfwBarY_f , 3, "mix"); + // *//* */ test("Mix_IfwFoo_IfwBarYI_", new Mix_IfwFoo_IfwBarYI_ , 3, "mix"); + // *//* */ test("Mix_IfwFoo_IfwBarYIf", new Mix_IfwFoo_IfwBarYIf , 3, "mix"); + /* *//* */ test("Mix_IfwFooX__ ", new Mix_IfwFooX__ , 2, "mix"); + /* *//* */ test("Mix_IfwFooX__wBar___", new Mix_IfwFooX__wBar___ , 3, "mix"); + /* *//* */ test("Mix_IfwFooX__wBar__f", new Mix_IfwFooX__wBar__f , 3, "mix"); + // *//* */ test("Mix_IfwFooX__wBar_I_", new Mix_IfwFooX__wBar_I_ , 3, "mix"); + // *//* */ test("Mix_IfwFooX__wBar_If", new Mix_IfwFooX__wBar_If , 3, "mix"); + /* *//* */ test("Mix_IfwFooX__wBarY__", new Mix_IfwFooX__wBarY__ , 3, "mix"); + /* *//* */ test("Mix_IfwFooX__wBarY_f", new Mix_IfwFooX__wBarY_f , 3, "mix"); + // *//* */ test("Mix_IfwFooX__wBarYI_", new Mix_IfwFooX__wBarYI_ , 3, "mix"); + // *//* */ test("Mix_IfwFooX__wBarYIf", new Mix_IfwFooX__wBarYIf , 3, "mix"); + /* *//* */ test("Mix_IfwFooX_f ", new Mix_IfwFooX_f , 2, "mix"); + /* *//* */ test("Mix_IfwFooX_fwBar___", new Mix_IfwFooX_fwBar___ , 3, "mix"); + /* *//* */ test("Mix_IfwFooX_fwBar__f", new Mix_IfwFooX_fwBar__f , 3, "mix"); + // *//* */ test("Mix_IfwFooX_fwBar_I_", new Mix_IfwFooX_fwBar_I_ , 3, "mix"); + // *//* */ test("Mix_IfwFooX_fwBar_If", new Mix_IfwFooX_fwBar_If , 3, "mix"); + /* *//* */ test("Mix_IfwFooX_fwBarY__", new Mix_IfwFooX_fwBarY__ , 3, "mix"); + /* *//* */ test("Mix_IfwFooX_fwBarY_f", new Mix_IfwFooX_fwBarY_f , 3, "mix"); + // *//* */ test("Mix_IfwFooX_fwBarYI_", new Mix_IfwFooX_fwBarYI_ , 3, "mix"); + // *//* */ test("Mix_IfwFooX_fwBarYIf", new Mix_IfwFooX_fwBarYIf , 3, "mix"); + // *//* */ test("Mix_IfwFooXI_ ", new Mix_IfwFooXI_ , 2, "mix"); + // *//* */ test("Mix_IfwFooXI_wBar___", new Mix_IfwFooXI_wBar___ , 3, "mix"); + // *//* */ test("Mix_IfwFooXI_wBar__f", new Mix_IfwFooXI_wBar__f , 3, "mix"); + // *//* */ test("Mix_IfwFooXI_wBar_I_", new Mix_IfwFooXI_wBar_I_ , 3, "mix"); + // *//* */ test("Mix_IfwFooXI_wBar_If", new Mix_IfwFooXI_wBar_If , 3, "mix"); + // *//* */ test("Mix_IfwFooXI_wBarY__", new Mix_IfwFooXI_wBarY__ , 3, "mix"); + // *//* */ test("Mix_IfwFooXI_wBarY_f", new Mix_IfwFooXI_wBarY_f , 3, "mix"); + // *//* */ test("Mix_IfwFooXI_wBarYI_", new Mix_IfwFooXI_wBarYI_ , 3, "mix"); + // *//* */ test("Mix_IfwFooXI_wBarYIf", new Mix_IfwFooXI_wBarYIf , 3, "mix"); + // *//* */ test("Mix_IfwFooXIf ", new Mix_IfwFooXIf , 2, "mix"); + // *//* */ test("Mix_IfwFooXIfwBar___", new Mix_IfwFooXIfwBar___ , 3, "mix"); + // *//* */ test("Mix_IfwFooXIfwBar__f", new Mix_IfwFooXIfwBar__f , 3, "mix"); + // *//* */ test("Mix_IfwFooXIfwBar_I_", new Mix_IfwFooXIfwBar_I_ , 3, "mix"); + // *//* */ test("Mix_IfwFooXIfwBar_If", new Mix_IfwFooXIfwBar_If , 3, "mix"); + // *//* */ test("Mix_IfwFooXIfwBarY__", new Mix_IfwFooXIfwBarY__ , 3, "mix"); + // *//* */ test("Mix_IfwFooXIfwBarY_f", new Mix_IfwFooXIfwBarY_f , 3, "mix"); + // *//* */ test("Mix_IfwFooXIfwBarYI_", new Mix_IfwFooXIfwBarYI_ , 3, "mix"); + // *//* */ test("Mix_IfwFooXIfwBarYIf", new Mix_IfwFooXIfwBarYIf , 3, "mix"); + + // */abstract test("MixZ__wFoo___ ", new MixZ__wFoo___ [C], 2, null ); + // */abstract test("MixZ__wFoo___wBar___", new MixZ__wFoo___wBar___[C], 3, null ); + // */abstract test("MixZ__wFoo___wBar__f", new MixZ__wFoo___wBar__f[C], 3, "bar"); + // */abstract test("MixZ__wFoo___wBar_I_", new MixZ__wFoo___wBar_I_[C], 3, null ); + /* *//* */ test("MixZ__wFoo___wBar_If", new MixZ__wFoo___wBar_If[C], 3, "bar"); + // */abstract test("MixZ__wFoo___wBarY__", new MixZ__wFoo___wBarY__[C], 3, null ); + // */abstract test("MixZ__wFoo___wBarY_f", new MixZ__wFoo___wBarY_f[C], 3, "bar"); + // */abstract test("MixZ__wFoo___wBarYI_", new MixZ__wFoo___wBarYI_[C], 3, null ); + /* *//* */ test("MixZ__wFoo___wBarYIf", new MixZ__wFoo___wBarYIf[C], 3, "bar"); + // */abstract test("MixZ__wFoo__f ", new MixZ__wFoo__f [C], 2, "foo"); + // */abstract test("MixZ__wFoo__fwBar___", new MixZ__wFoo__fwBar___[C], 3, "foo"); + // */abstract test("MixZ__wFoo__fwBar__f", new MixZ__wFoo__fwBar__f[C], 3, "bar"); + /* *//* */ test("MixZ__wFoo__fwBar_I_", new MixZ__wFoo__fwBar_I_[C], 3, "foo"); + // *//* */ test("MixZ__wFoo__fwBar_If", new MixZ__wFoo__fwBar_If[C], 3, "bar"); + // */abstract test("MixZ__wFoo__fwBarY__", new MixZ__wFoo__fwBarY__[C], 3, "foo"); + // */abstract test("MixZ__wFoo__fwBarY_f", new MixZ__wFoo__fwBarY_f[C], 3, "bar"); + /* *//* */ test("MixZ__wFoo__fwBarYI_", new MixZ__wFoo__fwBarYI_[C], 3, "foo"); + // *//* */ test("MixZ__wFoo__fwBarYIf", new MixZ__wFoo__fwBarYIf[C], 3, "bar"); + // */abstract test("MixZ__wFoo_I_ ", new MixZ__wFoo_I_ [C], 2, null ); + // */abstract test("MixZ__wFoo_I_wBar___", new MixZ__wFoo_I_wBar___[C], 3, null ); + /* *//* */ test("MixZ__wFoo_I_wBar__f", new MixZ__wFoo_I_wBar__f[C], 3, "bar"); + // */abstract test("MixZ__wFoo_I_wBar_I_", new MixZ__wFoo_I_wBar_I_[C], 3, null ); + // *//* */ test("MixZ__wFoo_I_wBar_If", new MixZ__wFoo_I_wBar_If[C], 3, "bar"); + // */abstract test("MixZ__wFoo_I_wBarY__", new MixZ__wFoo_I_wBarY__[C], 3, null ); + /* *//* */ test("MixZ__wFoo_I_wBarY_f", new MixZ__wFoo_I_wBarY_f[C], 3, "bar"); + // */abstract test("MixZ__wFoo_I_wBarYI_", new MixZ__wFoo_I_wBarYI_[C], 3, null ); + // *//* */ test("MixZ__wFoo_I_wBarYIf", new MixZ__wFoo_I_wBarYIf[C], 3, "bar"); + /* *//* */ test("MixZ__wFoo_If ", new MixZ__wFoo_If [C], 2, "foo"); + /* *//* */ test("MixZ__wFoo_IfwBar___", new MixZ__wFoo_IfwBar___[C], 3, "foo"); + // *//* */ test("MixZ__wFoo_IfwBar__f", new MixZ__wFoo_IfwBar__f[C], 3, "bar"); + // *//* */ test("MixZ__wFoo_IfwBar_I_", new MixZ__wFoo_IfwBar_I_[C], 3, "foo"); + // *//* */ test("MixZ__wFoo_IfwBar_If", new MixZ__wFoo_IfwBar_If[C], 3, "bar"); + /* *//* */ test("MixZ__wFoo_IfwBarY__", new MixZ__wFoo_IfwBarY__[C], 3, "foo"); + // *//* */ test("MixZ__wFoo_IfwBarY_f", new MixZ__wFoo_IfwBarY_f[C], 3, "bar"); + // *//* */ test("MixZ__wFoo_IfwBarYI_", new MixZ__wFoo_IfwBarYI_[C], 3, "foo"); + // *//* */ test("MixZ__wFoo_IfwBarYIf", new MixZ__wFoo_IfwBarYIf[C], 3, "bar"); + // */abstract test("MixZ__wFooX__ ", new MixZ__wFooX__ [C], 2, null ); + // */abstract test("MixZ__wFooX__wBar___", new MixZ__wFooX__wBar___[C], 3, null ); + // */abstract test("MixZ__wFooX__wBar__f", new MixZ__wFooX__wBar__f[C], 3, "bar"); + // */abstract test("MixZ__wFooX__wBar_I_", new MixZ__wFooX__wBar_I_[C], 3, null ); + /* *//* */ test("MixZ__wFooX__wBar_If", new MixZ__wFooX__wBar_If[C], 3, "bar"); + // */abstract test("MixZ__wFooX__wBarY__", new MixZ__wFooX__wBarY__[C], 3, null ); + // */abstract test("MixZ__wFooX__wBarY_f", new MixZ__wFooX__wBarY_f[C], 3, "bar"); + // */abstract test("MixZ__wFooX__wBarYI_", new MixZ__wFooX__wBarYI_[C], 3, null ); + /* *//* */ test("MixZ__wFooX__wBarYIf", new MixZ__wFooX__wBarYIf[C], 3, "bar"); + // */abstract test("MixZ__wFooX_f ", new MixZ__wFooX_f [C], 2, "foo"); + // */abstract test("MixZ__wFooX_fwBar___", new MixZ__wFooX_fwBar___[C], 3, "foo"); + // */abstract test("MixZ__wFooX_fwBar__f", new MixZ__wFooX_fwBar__f[C], 3, "bar"); + /* *//* */ test("MixZ__wFooX_fwBar_I_", new MixZ__wFooX_fwBar_I_[C], 3, "foo"); + // *//* */ test("MixZ__wFooX_fwBar_If", new MixZ__wFooX_fwBar_If[C], 3, "bar"); + // */abstract test("MixZ__wFooX_fwBarY__", new MixZ__wFooX_fwBarY__[C], 3, "foo"); + // */abstract test("MixZ__wFooX_fwBarY_f", new MixZ__wFooX_fwBarY_f[C], 3, "bar"); + /* *//* */ test("MixZ__wFooX_fwBarYI_", new MixZ__wFooX_fwBarYI_[C], 3, "foo"); + // *//* */ test("MixZ__wFooX_fwBarYIf", new MixZ__wFooX_fwBarYIf[C], 3, "bar"); + // */abstract test("MixZ__wFooXI_ ", new MixZ__wFooXI_ [C], 2, null ); + // */abstract test("MixZ__wFooXI_wBar___", new MixZ__wFooXI_wBar___[C], 3, null ); + /* *//* */ test("MixZ__wFooXI_wBar__f", new MixZ__wFooXI_wBar__f[C], 3, "bar"); + // */abstract test("MixZ__wFooXI_wBar_I_", new MixZ__wFooXI_wBar_I_[C], 3, null ); + // *//* */ test("MixZ__wFooXI_wBar_If", new MixZ__wFooXI_wBar_If[C], 3, "bar"); + // */abstract test("MixZ__wFooXI_wBarY__", new MixZ__wFooXI_wBarY__[C], 3, null ); + /* *//* */ test("MixZ__wFooXI_wBarY_f", new MixZ__wFooXI_wBarY_f[C], 3, "bar"); + // */abstract test("MixZ__wFooXI_wBarYI_", new MixZ__wFooXI_wBarYI_[C], 3, null ); + // *//* */ test("MixZ__wFooXI_wBarYIf", new MixZ__wFooXI_wBarYIf[C], 3, "bar"); + /* *//* */ test("MixZ__wFooXIf ", new MixZ__wFooXIf [C], 2, "foo"); + /* *//* */ test("MixZ__wFooXIfwBar___", new MixZ__wFooXIfwBar___[C], 3, "foo"); + // *//* */ test("MixZ__wFooXIfwBar__f", new MixZ__wFooXIfwBar__f[C], 3, "bar"); + // *//* */ test("MixZ__wFooXIfwBar_I_", new MixZ__wFooXIfwBar_I_[C], 3, "foo"); + // *//* */ test("MixZ__wFooXIfwBar_If", new MixZ__wFooXIfwBar_If[C], 3, "bar"); + /* *//* */ test("MixZ__wFooXIfwBarY__", new MixZ__wFooXIfwBarY__[C], 3, "foo"); + // *//* */ test("MixZ__wFooXIfwBarY_f", new MixZ__wFooXIfwBarY_f[C], 3, "bar"); + // *//* */ test("MixZ__wFooXIfwBarYI_", new MixZ__wFooXIfwBarYI_[C], 3, "foo"); + // *//* */ test("MixZ__wFooXIfwBarYIf", new MixZ__wFooXIfwBarYIf[C], 3, "bar"); + + // */abstract test("MixZ_fwFoo___ ", new MixZ_fwFoo___ [C], 2, "mix"); + // */abstract test("MixZ_fwFoo___wBar___", new MixZ_fwFoo___wBar___[C], 3, "mix"); + // */abstract test("MixZ_fwFoo___wBar__f", new MixZ_fwFoo___wBar__f[C], 3, "mix"); + /* *//* */ test("MixZ_fwFoo___wBar_I_", new MixZ_fwFoo___wBar_I_[C], 3, "mix"); + /* *//* */ test("MixZ_fwFoo___wBar_If", new MixZ_fwFoo___wBar_If[C], 3, "mix"); + // */abstract test("MixZ_fwFoo___wBarY__", new MixZ_fwFoo___wBarY__[C], 3, "mix"); + // */abstract test("MixZ_fwFoo___wBarY_f", new MixZ_fwFoo___wBarY_f[C], 3, "mix"); + /* *//* */ test("MixZ_fwFoo___wBarYI_", new MixZ_fwFoo___wBarYI_[C], 3, "mix"); + /* *//* */ test("MixZ_fwFoo___wBarYIf", new MixZ_fwFoo___wBarYIf[C], 3, "mix"); + // */abstract test("MixZ_fwFoo__f ", new MixZ_fwFoo__f [C], 2, "mix"); + // */abstract test("MixZ_fwFoo__fwBar___", new MixZ_fwFoo__fwBar___[C], 3, "mix"); + // */abstract test("MixZ_fwFoo__fwBar__f", new MixZ_fwFoo__fwBar__f[C], 3, "mix"); + /* *//* */ test("MixZ_fwFoo__fwBar_I_", new MixZ_fwFoo__fwBar_I_[C], 3, "mix"); + /* *//* */ test("MixZ_fwFoo__fwBar_If", new MixZ_fwFoo__fwBar_If[C], 3, "mix"); + // */abstract test("MixZ_fwFoo__fwBarY__", new MixZ_fwFoo__fwBarY__[C], 3, "mix"); + // */abstract test("MixZ_fwFoo__fwBarY_f", new MixZ_fwFoo__fwBarY_f[C], 3, "mix"); + /* *//* */ test("MixZ_fwFoo__fwBarYI_", new MixZ_fwFoo__fwBarYI_[C], 3, "mix"); + /* *//* */ test("MixZ_fwFoo__fwBarYIf", new MixZ_fwFoo__fwBarYIf[C], 3, "mix"); + /* *//* */ test("MixZ_fwFoo_I_ ", new MixZ_fwFoo_I_ [C], 2, "mix"); + /* *//* */ test("MixZ_fwFoo_I_wBar___", new MixZ_fwFoo_I_wBar___[C], 3, "mix"); + /* *//* */ test("MixZ_fwFoo_I_wBar__f", new MixZ_fwFoo_I_wBar__f[C], 3, "mix"); + // *//* */ test("MixZ_fwFoo_I_wBar_I_", new MixZ_fwFoo_I_wBar_I_[C], 3, "mix"); + // *//* */ test("MixZ_fwFoo_I_wBar_If", new MixZ_fwFoo_I_wBar_If[C], 3, "mix"); + /* *//* */ test("MixZ_fwFoo_I_wBarY__", new MixZ_fwFoo_I_wBarY__[C], 3, "mix"); + /* *//* */ test("MixZ_fwFoo_I_wBarY_f", new MixZ_fwFoo_I_wBarY_f[C], 3, "mix"); + // *//* */ test("MixZ_fwFoo_I_wBarYI_", new MixZ_fwFoo_I_wBarYI_[C], 3, "mix"); + // *//* */ test("MixZ_fwFoo_I_wBarYIf", new MixZ_fwFoo_I_wBarYIf[C], 3, "mix"); + /* *//* */ test("MixZ_fwFoo_If ", new MixZ_fwFoo_If [C], 2, "mix"); + /* *//* */ test("MixZ_fwFoo_IfwBar___", new MixZ_fwFoo_IfwBar___[C], 3, "mix"); + /* *//* */ test("MixZ_fwFoo_IfwBar__f", new MixZ_fwFoo_IfwBar__f[C], 3, "mix"); + // *//* */ test("MixZ_fwFoo_IfwBar_I_", new MixZ_fwFoo_IfwBar_I_[C], 3, "mix"); + // *//* */ test("MixZ_fwFoo_IfwBar_If", new MixZ_fwFoo_IfwBar_If[C], 3, "mix"); + /* *//* */ test("MixZ_fwFoo_IfwBarY__", new MixZ_fwFoo_IfwBarY__[C], 3, "mix"); + /* *//* */ test("MixZ_fwFoo_IfwBarY_f", new MixZ_fwFoo_IfwBarY_f[C], 3, "mix"); + // *//* */ test("MixZ_fwFoo_IfwBarYI_", new MixZ_fwFoo_IfwBarYI_[C], 3, "mix"); + // *//* */ test("MixZ_fwFoo_IfwBarYIf", new MixZ_fwFoo_IfwBarYIf[C], 3, "mix"); + // */abstract test("MixZ_fwFooX__ ", new MixZ_fwFooX__ [C], 2, "mix"); + // */abstract test("MixZ_fwFooX__wBar___", new MixZ_fwFooX__wBar___[C], 3, "mix"); + // */abstract test("MixZ_fwFooX__wBar__f", new MixZ_fwFooX__wBar__f[C], 3, "mix"); + /* *//* */ test("MixZ_fwFooX__wBar_I_", new MixZ_fwFooX__wBar_I_[C], 3, "mix"); + /* *//* */ test("MixZ_fwFooX__wBar_If", new MixZ_fwFooX__wBar_If[C], 3, "mix"); + // */abstract test("MixZ_fwFooX__wBarY__", new MixZ_fwFooX__wBarY__[C], 3, "mix"); + // */abstract test("MixZ_fwFooX__wBarY_f", new MixZ_fwFooX__wBarY_f[C], 3, "mix"); + /* *//* */ test("MixZ_fwFooX__wBarYI_", new MixZ_fwFooX__wBarYI_[C], 3, "mix"); + /* *//* */ test("MixZ_fwFooX__wBarYIf", new MixZ_fwFooX__wBarYIf[C], 3, "mix"); + // */abstract test("MixZ_fwFooX_f ", new MixZ_fwFooX_f [C], 2, "mix"); + // */abstract test("MixZ_fwFooX_fwBar___", new MixZ_fwFooX_fwBar___[C], 3, "mix"); + // */abstract test("MixZ_fwFooX_fwBar__f", new MixZ_fwFooX_fwBar__f[C], 3, "mix"); + /* *//* */ test("MixZ_fwFooX_fwBar_I_", new MixZ_fwFooX_fwBar_I_[C], 3, "mix"); + /* *//* */ test("MixZ_fwFooX_fwBar_If", new MixZ_fwFooX_fwBar_If[C], 3, "mix"); + // */abstract test("MixZ_fwFooX_fwBarY__", new MixZ_fwFooX_fwBarY__[C], 3, "mix"); + // */abstract test("MixZ_fwFooX_fwBarY_f", new MixZ_fwFooX_fwBarY_f[C], 3, "mix"); + /* *//* */ test("MixZ_fwFooX_fwBarYI_", new MixZ_fwFooX_fwBarYI_[C], 3, "mix"); + /* *//* */ test("MixZ_fwFooX_fwBarYIf", new MixZ_fwFooX_fwBarYIf[C], 3, "mix"); + /* *//* */ test("MixZ_fwFooXI_ ", new MixZ_fwFooXI_ [C], 2, "mix"); + /* *//* */ test("MixZ_fwFooXI_wBar___", new MixZ_fwFooXI_wBar___[C], 3, "mix"); + /* *//* */ test("MixZ_fwFooXI_wBar__f", new MixZ_fwFooXI_wBar__f[C], 3, "mix"); + // *//* */ test("MixZ_fwFooXI_wBar_I_", new MixZ_fwFooXI_wBar_I_[C], 3, "mix"); + // *//* */ test("MixZ_fwFooXI_wBar_If", new MixZ_fwFooXI_wBar_If[C], 3, "mix"); + /* *//* */ test("MixZ_fwFooXI_wBarY__", new MixZ_fwFooXI_wBarY__[C], 3, "mix"); + /* *//* */ test("MixZ_fwFooXI_wBarY_f", new MixZ_fwFooXI_wBarY_f[C], 3, "mix"); + // *//* */ test("MixZ_fwFooXI_wBarYI_", new MixZ_fwFooXI_wBarYI_[C], 3, "mix"); + // *//* */ test("MixZ_fwFooXI_wBarYIf", new MixZ_fwFooXI_wBarYIf[C], 3, "mix"); + /* *//* */ test("MixZ_fwFooXIf ", new MixZ_fwFooXIf [C], 2, "mix"); + /* *//* */ test("MixZ_fwFooXIfwBar___", new MixZ_fwFooXIfwBar___[C], 3, "mix"); + /* *//* */ test("MixZ_fwFooXIfwBar__f", new MixZ_fwFooXIfwBar__f[C], 3, "mix"); + // *//* */ test("MixZ_fwFooXIfwBar_I_", new MixZ_fwFooXIfwBar_I_[C], 3, "mix"); + // *//* */ test("MixZ_fwFooXIfwBar_If", new MixZ_fwFooXIfwBar_If[C], 3, "mix"); + /* *//* */ test("MixZ_fwFooXIfwBarY__", new MixZ_fwFooXIfwBarY__[C], 3, "mix"); + /* *//* */ test("MixZ_fwFooXIfwBarY_f", new MixZ_fwFooXIfwBarY_f[C], 3, "mix"); + // *//* */ test("MixZ_fwFooXIfwBarYI_", new MixZ_fwFooXIfwBarYI_[C], 3, "mix"); + // *//* */ test("MixZ_fwFooXIfwBarYIf", new MixZ_fwFooXIfwBarYIf[C], 3, "mix"); + + // */abstract test("MixZI_wFoo___ ", new MixZI_wFoo___ [C], 2, null ); + // */abstract test("MixZI_wFoo___wBar___", new MixZI_wFoo___wBar___[C], 3, null ); + /* *//* */ test("MixZI_wFoo___wBar__f", new MixZI_wFoo___wBar__f[C], 3, "bar"); + // */abstract test("MixZI_wFoo___wBar_I_", new MixZI_wFoo___wBar_I_[C], 3, null ); + // *//* */ test("MixZI_wFoo___wBar_If", new MixZI_wFoo___wBar_If[C], 3, "bar"); + // */abstract test("MixZI_wFoo___wBarY__", new MixZI_wFoo___wBarY__[C], 3, null ); + /* *//* */ test("MixZI_wFoo___wBarY_f", new MixZI_wFoo___wBarY_f[C], 3, "bar"); + // */abstract test("MixZI_wFoo___wBarYI_", new MixZI_wFoo___wBarYI_[C], 3, null ); + // *//* */ test("MixZI_wFoo___wBarYIf", new MixZI_wFoo___wBarYIf[C], 3, "bar"); + /* *//* */ test("MixZI_wFoo__f ", new MixZI_wFoo__f [C], 2, "foo"); + /* *//* */ test("MixZI_wFoo__fwBar___", new MixZI_wFoo__fwBar___[C], 3, "foo"); + // *//* */ test("MixZI_wFoo__fwBar__f", new MixZI_wFoo__fwBar__f[C], 3, "bar"); + // *//* */ test("MixZI_wFoo__fwBar_I_", new MixZI_wFoo__fwBar_I_[C], 3, "foo"); + // *//* */ test("MixZI_wFoo__fwBar_If", new MixZI_wFoo__fwBar_If[C], 3, "bar"); + /* *//* */ test("MixZI_wFoo__fwBarY__", new MixZI_wFoo__fwBarY__[C], 3, "foo"); + // *//* */ test("MixZI_wFoo__fwBarY_f", new MixZI_wFoo__fwBarY_f[C], 3, "bar"); + // *//* */ test("MixZI_wFoo__fwBarYI_", new MixZI_wFoo__fwBarYI_[C], 3, "foo"); + // *//* */ test("MixZI_wFoo__fwBarYIf", new MixZI_wFoo__fwBarYIf[C], 3, "bar"); + // */abstract test("MixZI_wFoo_I_ ", new MixZI_wFoo_I_ [C], 2, null ); + // */abstract test("MixZI_wFoo_I_wBar___", new MixZI_wFoo_I_wBar___[C], 3, null ); + // *//* */ test("MixZI_wFoo_I_wBar__f", new MixZI_wFoo_I_wBar__f[C], 3, "bar"); + // */abstract test("MixZI_wFoo_I_wBar_I_", new MixZI_wFoo_I_wBar_I_[C], 3, null ); + // *//* */ test("MixZI_wFoo_I_wBar_If", new MixZI_wFoo_I_wBar_If[C], 3, "bar"); + // */abstract test("MixZI_wFoo_I_wBarY__", new MixZI_wFoo_I_wBarY__[C], 3, null ); + // *//* */ test("MixZI_wFoo_I_wBarY_f", new MixZI_wFoo_I_wBarY_f[C], 3, "bar"); + // */abstract test("MixZI_wFoo_I_wBarYI_", new MixZI_wFoo_I_wBarYI_[C], 3, null ); + // *//* */ test("MixZI_wFoo_I_wBarYIf", new MixZI_wFoo_I_wBarYIf[C], 3, "bar"); + // *//* */ test("MixZI_wFoo_If ", new MixZI_wFoo_If [C], 2, "foo"); + // *//* */ test("MixZI_wFoo_IfwBar___", new MixZI_wFoo_IfwBar___[C], 3, "foo"); + // *//* */ test("MixZI_wFoo_IfwBar__f", new MixZI_wFoo_IfwBar__f[C], 3, "bar"); + // *//* */ test("MixZI_wFoo_IfwBar_I_", new MixZI_wFoo_IfwBar_I_[C], 3, "foo"); + // *//* */ test("MixZI_wFoo_IfwBar_If", new MixZI_wFoo_IfwBar_If[C], 3, "bar"); + // *//* */ test("MixZI_wFoo_IfwBarY__", new MixZI_wFoo_IfwBarY__[C], 3, "foo"); + // *//* */ test("MixZI_wFoo_IfwBarY_f", new MixZI_wFoo_IfwBarY_f[C], 3, "bar"); + // *//* */ test("MixZI_wFoo_IfwBarYI_", new MixZI_wFoo_IfwBarYI_[C], 3, "foo"); + // *//* */ test("MixZI_wFoo_IfwBarYIf", new MixZI_wFoo_IfwBarYIf[C], 3, "bar"); + // */abstract test("MixZI_wFooX__ ", new MixZI_wFooX__ [C], 2, null ); + // */abstract test("MixZI_wFooX__wBar___", new MixZI_wFooX__wBar___[C], 3, null ); + /* *//* */ test("MixZI_wFooX__wBar__f", new MixZI_wFooX__wBar__f[C], 3, "bar"); + // */abstract test("MixZI_wFooX__wBar_I_", new MixZI_wFooX__wBar_I_[C], 3, null ); + // *//* */ test("MixZI_wFooX__wBar_If", new MixZI_wFooX__wBar_If[C], 3, "bar"); + // */abstract test("MixZI_wFooX__wBarY__", new MixZI_wFooX__wBarY__[C], 3, null ); + /* *//* */ test("MixZI_wFooX__wBarY_f", new MixZI_wFooX__wBarY_f[C], 3, "bar"); + // */abstract test("MixZI_wFooX__wBarYI_", new MixZI_wFooX__wBarYI_[C], 3, null ); + // *//* */ test("MixZI_wFooX__wBarYIf", new MixZI_wFooX__wBarYIf[C], 3, "bar"); + /* *//* */ test("MixZI_wFooX_f ", new MixZI_wFooX_f [C], 2, "foo"); + /* *//* */ test("MixZI_wFooX_fwBar___", new MixZI_wFooX_fwBar___[C], 3, "foo"); + // *//* */ test("MixZI_wFooX_fwBar__f", new MixZI_wFooX_fwBar__f[C], 3, "bar"); + // *//* */ test("MixZI_wFooX_fwBar_I_", new MixZI_wFooX_fwBar_I_[C], 3, "foo"); + // *//* */ test("MixZI_wFooX_fwBar_If", new MixZI_wFooX_fwBar_If[C], 3, "bar"); + /* *//* */ test("MixZI_wFooX_fwBarY__", new MixZI_wFooX_fwBarY__[C], 3, "foo"); + // *//* */ test("MixZI_wFooX_fwBarY_f", new MixZI_wFooX_fwBarY_f[C], 3, "bar"); + // *//* */ test("MixZI_wFooX_fwBarYI_", new MixZI_wFooX_fwBarYI_[C], 3, "foo"); + // *//* */ test("MixZI_wFooX_fwBarYIf", new MixZI_wFooX_fwBarYIf[C], 3, "bar"); + // */abstract test("MixZI_wFooXI_ ", new MixZI_wFooXI_ [C], 2, null ); + // */abstract test("MixZI_wFooXI_wBar___", new MixZI_wFooXI_wBar___[C], 3, null ); + // *//* */ test("MixZI_wFooXI_wBar__f", new MixZI_wFooXI_wBar__f[C], 3, "bar"); + // */abstract test("MixZI_wFooXI_wBar_I_", new MixZI_wFooXI_wBar_I_[C], 3, null ); + // *//* */ test("MixZI_wFooXI_wBar_If", new MixZI_wFooXI_wBar_If[C], 3, "bar"); + // */abstract test("MixZI_wFooXI_wBarY__", new MixZI_wFooXI_wBarY__[C], 3, null ); + // *//* */ test("MixZI_wFooXI_wBarY_f", new MixZI_wFooXI_wBarY_f[C], 3, "bar"); + // */abstract test("MixZI_wFooXI_wBarYI_", new MixZI_wFooXI_wBarYI_[C], 3, null ); + // *//* */ test("MixZI_wFooXI_wBarYIf", new MixZI_wFooXI_wBarYIf[C], 3, "bar"); + // *//* */ test("MixZI_wFooXIf ", new MixZI_wFooXIf [C], 2, "foo"); + // *//* */ test("MixZI_wFooXIfwBar___", new MixZI_wFooXIfwBar___[C], 3, "foo"); + // *//* */ test("MixZI_wFooXIfwBar__f", new MixZI_wFooXIfwBar__f[C], 3, "bar"); + // *//* */ test("MixZI_wFooXIfwBar_I_", new MixZI_wFooXIfwBar_I_[C], 3, "foo"); + // *//* */ test("MixZI_wFooXIfwBar_If", new MixZI_wFooXIfwBar_If[C], 3, "bar"); + // *//* */ test("MixZI_wFooXIfwBarY__", new MixZI_wFooXIfwBarY__[C], 3, "foo"); + // *//* */ test("MixZI_wFooXIfwBarY_f", new MixZI_wFooXIfwBarY_f[C], 3, "bar"); + // *//* */ test("MixZI_wFooXIfwBarYI_", new MixZI_wFooXIfwBarYI_[C], 3, "foo"); + // *//* */ test("MixZI_wFooXIfwBarYIf", new MixZI_wFooXIfwBarYIf[C], 3, "bar"); + + /* *//* */ test("MixZIfwFoo___ ", new MixZIfwFoo___ [C], 2, "mix"); + /* *//* */ test("MixZIfwFoo___wBar___", new MixZIfwFoo___wBar___[C], 3, "mix"); + /* *//* */ test("MixZIfwFoo___wBar__f", new MixZIfwFoo___wBar__f[C], 3, "mix"); + // *//* */ test("MixZIfwFoo___wBar_I_", new MixZIfwFoo___wBar_I_[C], 3, "mix"); + // *//* */ test("MixZIfwFoo___wBar_If", new MixZIfwFoo___wBar_If[C], 3, "mix"); + /* *//* */ test("MixZIfwFoo___wBarY__", new MixZIfwFoo___wBarY__[C], 3, "mix"); + /* *//* */ test("MixZIfwFoo___wBarY_f", new MixZIfwFoo___wBarY_f[C], 3, "mix"); + // *//* */ test("MixZIfwFoo___wBarYI_", new MixZIfwFoo___wBarYI_[C], 3, "mix"); + // *//* */ test("MixZIfwFoo___wBarYIf", new MixZIfwFoo___wBarYIf[C], 3, "mix"); + /* *//* */ test("MixZIfwFoo__f ", new MixZIfwFoo__f [C], 2, "mix"); + /* *//* */ test("MixZIfwFoo__fwBar___", new MixZIfwFoo__fwBar___[C], 3, "mix"); + /* *//* */ test("MixZIfwFoo__fwBar__f", new MixZIfwFoo__fwBar__f[C], 3, "mix"); + // *//* */ test("MixZIfwFoo__fwBar_I_", new MixZIfwFoo__fwBar_I_[C], 3, "mix"); + // *//* */ test("MixZIfwFoo__fwBar_If", new MixZIfwFoo__fwBar_If[C], 3, "mix"); + /* *//* */ test("MixZIfwFoo__fwBarY__", new MixZIfwFoo__fwBarY__[C], 3, "mix"); + /* *//* */ test("MixZIfwFoo__fwBarY_f", new MixZIfwFoo__fwBarY_f[C], 3, "mix"); + // *//* */ test("MixZIfwFoo__fwBarYI_", new MixZIfwFoo__fwBarYI_[C], 3, "mix"); + // *//* */ test("MixZIfwFoo__fwBarYIf", new MixZIfwFoo__fwBarYIf[C], 3, "mix"); + // *//* */ test("MixZIfwFoo_I_ ", new MixZIfwFoo_I_ [C], 2, "mix"); + // *//* */ test("MixZIfwFoo_I_wBar___", new MixZIfwFoo_I_wBar___[C], 3, "mix"); + // *//* */ test("MixZIfwFoo_I_wBar__f", new MixZIfwFoo_I_wBar__f[C], 3, "mix"); + // *//* */ test("MixZIfwFoo_I_wBar_I_", new MixZIfwFoo_I_wBar_I_[C], 3, "mix"); + // *//* */ test("MixZIfwFoo_I_wBar_If", new MixZIfwFoo_I_wBar_If[C], 3, "mix"); + // *//* */ test("MixZIfwFoo_I_wBarY__", new MixZIfwFoo_I_wBarY__[C], 3, "mix"); + // *//* */ test("MixZIfwFoo_I_wBarY_f", new MixZIfwFoo_I_wBarY_f[C], 3, "mix"); + // *//* */ test("MixZIfwFoo_I_wBarYI_", new MixZIfwFoo_I_wBarYI_[C], 3, "mix"); + // *//* */ test("MixZIfwFoo_I_wBarYIf", new MixZIfwFoo_I_wBarYIf[C], 3, "mix"); + // *//* */ test("MixZIfwFoo_If ", new MixZIfwFoo_If [C], 2, "mix"); + // *//* */ test("MixZIfwFoo_IfwBar___", new MixZIfwFoo_IfwBar___[C], 3, "mix"); + // *//* */ test("MixZIfwFoo_IfwBar__f", new MixZIfwFoo_IfwBar__f[C], 3, "mix"); + // *//* */ test("MixZIfwFoo_IfwBar_I_", new MixZIfwFoo_IfwBar_I_[C], 3, "mix"); + // *//* */ test("MixZIfwFoo_IfwBar_If", new MixZIfwFoo_IfwBar_If[C], 3, "mix"); + // *//* */ test("MixZIfwFoo_IfwBarY__", new MixZIfwFoo_IfwBarY__[C], 3, "mix"); + // *//* */ test("MixZIfwFoo_IfwBarY_f", new MixZIfwFoo_IfwBarY_f[C], 3, "mix"); + // *//* */ test("MixZIfwFoo_IfwBarYI_", new MixZIfwFoo_IfwBarYI_[C], 3, "mix"); + // *//* */ test("MixZIfwFoo_IfwBarYIf", new MixZIfwFoo_IfwBarYIf[C], 3, "mix"); + /* *//* */ test("MixZIfwFooX__ ", new MixZIfwFooX__ [C], 2, "mix"); + /* *//* */ test("MixZIfwFooX__wBar___", new MixZIfwFooX__wBar___[C], 3, "mix"); + /* *//* */ test("MixZIfwFooX__wBar__f", new MixZIfwFooX__wBar__f[C], 3, "mix"); + // *//* */ test("MixZIfwFooX__wBar_I_", new MixZIfwFooX__wBar_I_[C], 3, "mix"); + // *//* */ test("MixZIfwFooX__wBar_If", new MixZIfwFooX__wBar_If[C], 3, "mix"); + /* *//* */ test("MixZIfwFooX__wBarY__", new MixZIfwFooX__wBarY__[C], 3, "mix"); + /* *//* */ test("MixZIfwFooX__wBarY_f", new MixZIfwFooX__wBarY_f[C], 3, "mix"); + // *//* */ test("MixZIfwFooX__wBarYI_", new MixZIfwFooX__wBarYI_[C], 3, "mix"); + // *//* */ test("MixZIfwFooX__wBarYIf", new MixZIfwFooX__wBarYIf[C], 3, "mix"); + /* *//* */ test("MixZIfwFooX_f ", new MixZIfwFooX_f [C], 2, "mix"); + /* *//* */ test("MixZIfwFooX_fwBar___", new MixZIfwFooX_fwBar___[C], 3, "mix"); + /* *//* */ test("MixZIfwFooX_fwBar__f", new MixZIfwFooX_fwBar__f[C], 3, "mix"); + // *//* */ test("MixZIfwFooX_fwBar_I_", new MixZIfwFooX_fwBar_I_[C], 3, "mix"); + // *//* */ test("MixZIfwFooX_fwBar_If", new MixZIfwFooX_fwBar_If[C], 3, "mix"); + /* *//* */ test("MixZIfwFooX_fwBarY__", new MixZIfwFooX_fwBarY__[C], 3, "mix"); + /* *//* */ test("MixZIfwFooX_fwBarY_f", new MixZIfwFooX_fwBarY_f[C], 3, "mix"); + // *//* */ test("MixZIfwFooX_fwBarYI_", new MixZIfwFooX_fwBarYI_[C], 3, "mix"); + // *//* */ test("MixZIfwFooX_fwBarYIf", new MixZIfwFooX_fwBarYIf[C], 3, "mix"); + // *//* */ test("MixZIfwFooXI_ ", new MixZIfwFooXI_ [C], 2, "mix"); + // *//* */ test("MixZIfwFooXI_wBar___", new MixZIfwFooXI_wBar___[C], 3, "mix"); + // *//* */ test("MixZIfwFooXI_wBar__f", new MixZIfwFooXI_wBar__f[C], 3, "mix"); + // *//* */ test("MixZIfwFooXI_wBar_I_", new MixZIfwFooXI_wBar_I_[C], 3, "mix"); + // *//* */ test("MixZIfwFooXI_wBar_If", new MixZIfwFooXI_wBar_If[C], 3, "mix"); + // *//* */ test("MixZIfwFooXI_wBarY__", new MixZIfwFooXI_wBarY__[C], 3, "mix"); + // *//* */ test("MixZIfwFooXI_wBarY_f", new MixZIfwFooXI_wBarY_f[C], 3, "mix"); + // *//* */ test("MixZIfwFooXI_wBarYI_", new MixZIfwFooXI_wBarYI_[C], 3, "mix"); + // *//* */ test("MixZIfwFooXI_wBarYIf", new MixZIfwFooXI_wBarYIf[C], 3, "mix"); + // *//* */ test("MixZIfwFooXIf ", new MixZIfwFooXIf [C], 2, "mix"); + // *//* */ test("MixZIfwFooXIfwBar___", new MixZIfwFooXIfwBar___[C], 3, "mix"); + // *//* */ test("MixZIfwFooXIfwBar__f", new MixZIfwFooXIfwBar__f[C], 3, "mix"); + // *//* */ test("MixZIfwFooXIfwBar_I_", new MixZIfwFooXIfwBar_I_[C], 3, "mix"); + // *//* */ test("MixZIfwFooXIfwBar_If", new MixZIfwFooXIfwBar_If[C], 3, "mix"); + // *//* */ test("MixZIfwFooXIfwBarY__", new MixZIfwFooXIfwBarY__[C], 3, "mix"); + // *//* */ test("MixZIfwFooXIfwBarY_f", new MixZIfwFooXIfwBarY_f[C], 3, "mix"); + // *//* */ test("MixZIfwFooXIfwBarYI_", new MixZIfwFooXIfwBarYI_[C], 3, "mix"); + // *//* */ test("MixZIfwFooXIfwBarYIf", new MixZIfwFooXIfwBarYIf[C], 3, "mix"); + + + + + + /* */test("S_____eFoo___ ", new S_____eFoo___ , 3, "sub"); + /* */test("S_____eFoo___wBar___", new S_____eFoo___wBar___ , 4, "sub"); + /* */test("S_____eFoo___wBar__f", new S_____eFoo___wBar__f , 4, "bar"); + /* */test("S_____eFoo___wBar_I_", new S_____eFoo___wBar_I_ , 4, "sub"); + /* */test("S_____eFoo___wBar_If", new S_____eFoo___wBar_If , 4, "bar"); + /* */test("S_____eFoo___wBarY__", new S_____eFoo___wBarY__ , 4, "sub"); + /* */test("S_____eFoo___wBarY_f", new S_____eFoo___wBarY_f , 4, "bar"); + /* */test("S_____eFoo___wBarYI_", new S_____eFoo___wBarYI_ , 4, "sub"); + /* */test("S_____eFoo___wBarYIf", new S_____eFoo___wBarYIf , 4, "bar"); + /* */test("S_____eFoo__f ", new S_____eFoo__f , 3, "foo"); + /* */test("S_____eFoo__fwBar___", new S_____eFoo__fwBar___ , 4, "foo"); + // */test("S_____eFoo__fwBar__f", new S_____eFoo__fwBar__f , 4, "bar"); + /* */test("S_____eFoo__fwBar_I_", new S_____eFoo__fwBar_I_ , 4, "foo"); + // */test("S_____eFoo__fwBar_If", new S_____eFoo__fwBar_If , 4, "bar"); + /* */test("S_____eFoo__fwBarY__", new S_____eFoo__fwBarY__ , 4, "foo"); + // */test("S_____eFoo__fwBarY_f", new S_____eFoo__fwBarY_f , 4, "bar"); + /* */test("S_____eFoo__fwBarYI_", new S_____eFoo__fwBarYI_ , 4, "foo"); + // */test("S_____eFoo__fwBarYIf", new S_____eFoo__fwBarYIf , 4, "bar"); + /* */test("S_____eFoo_I_ ", new S_____eFoo_I_ , 3, "sub"); + /* */test("S_____eFoo_I_wBar___", new S_____eFoo_I_wBar___ , 4, "sub"); + /* */test("S_____eFoo_I_wBar__f", new S_____eFoo_I_wBar__f , 4, "bar"); + // */test("S_____eFoo_I_wBar_I_", new S_____eFoo_I_wBar_I_ , 4, "sub"); + // */test("S_____eFoo_I_wBar_If", new S_____eFoo_I_wBar_If , 4, "bar"); + /* */test("S_____eFoo_I_wBarY__", new S_____eFoo_I_wBarY__ , 4, "sub"); + /* */test("S_____eFoo_I_wBarY_f", new S_____eFoo_I_wBarY_f , 4, "bar"); + // */test("S_____eFoo_I_wBarYI_", new S_____eFoo_I_wBarYI_ , 4, "sub"); + // */test("S_____eFoo_I_wBarYIf", new S_____eFoo_I_wBarYIf , 4, "bar"); + /* */test("S_____eFoo_If ", new S_____eFoo_If , 3, "foo"); + /* */test("S_____eFoo_IfwBar___", new S_____eFoo_IfwBar___ , 4, "foo"); + // */test("S_____eFoo_IfwBar__f", new S_____eFoo_IfwBar__f , 4, "bar"); + // */test("S_____eFoo_IfwBar_I_", new S_____eFoo_IfwBar_I_ , 4, "foo"); + // */test("S_____eFoo_IfwBar_If", new S_____eFoo_IfwBar_If , 4, "bar"); + /* */test("S_____eFoo_IfwBarY__", new S_____eFoo_IfwBarY__ , 4, "foo"); + // */test("S_____eFoo_IfwBarY_f", new S_____eFoo_IfwBarY_f , 4, "bar"); + // */test("S_____eFoo_IfwBarYI_", new S_____eFoo_IfwBarYI_ , 4, "foo"); + // */test("S_____eFoo_IfwBarYIf", new S_____eFoo_IfwBarYIf , 4, "bar"); + /* */test("S_____eFooX__ ", new S_____eFooX__ , 3, "sub"); + /* */test("S_____eFooX__wBar___", new S_____eFooX__wBar___ , 4, "sub"); + /* */test("S_____eFooX__wBar__f", new S_____eFooX__wBar__f , 4, "bar"); + /* */test("S_____eFooX__wBar_I_", new S_____eFooX__wBar_I_ , 4, "sub"); + /* */test("S_____eFooX__wBar_If", new S_____eFooX__wBar_If , 4, "bar"); + /* */test("S_____eFooX__wBarY__", new S_____eFooX__wBarY__ , 4, "sub"); + /* */test("S_____eFooX__wBarY_f", new S_____eFooX__wBarY_f , 4, "bar"); + /* */test("S_____eFooX__wBarYI_", new S_____eFooX__wBarYI_ , 4, "sub"); + /* */test("S_____eFooX__wBarYIf", new S_____eFooX__wBarYIf , 4, "bar"); + /* */test("S_____eFooX_f ", new S_____eFooX_f , 3, "foo"); + /* */test("S_____eFooX_fwBar___", new S_____eFooX_fwBar___ , 4, "foo"); + // */test("S_____eFooX_fwBar__f", new S_____eFooX_fwBar__f , 4, "bar"); + /* */test("S_____eFooX_fwBar_I_", new S_____eFooX_fwBar_I_ , 4, "foo"); + // */test("S_____eFooX_fwBar_If", new S_____eFooX_fwBar_If , 4, "bar"); + /* */test("S_____eFooX_fwBarY__", new S_____eFooX_fwBarY__ , 4, "foo"); + // */test("S_____eFooX_fwBarY_f", new S_____eFooX_fwBarY_f , 4, "bar"); + /* */test("S_____eFooX_fwBarYI_", new S_____eFooX_fwBarYI_ , 4, "foo"); + // */test("S_____eFooX_fwBarYIf", new S_____eFooX_fwBarYIf , 4, "bar"); + /* */test("S_____eFooXI_ ", new S_____eFooXI_ , 3, "sub"); + /* */test("S_____eFooXI_wBar___", new S_____eFooXI_wBar___ , 4, "sub"); + /* */test("S_____eFooXI_wBar__f", new S_____eFooXI_wBar__f , 4, "bar"); + // */test("S_____eFooXI_wBar_I_", new S_____eFooXI_wBar_I_ , 4, "sub"); + // */test("S_____eFooXI_wBar_If", new S_____eFooXI_wBar_If , 4, "bar"); + /* */test("S_____eFooXI_wBarY__", new S_____eFooXI_wBarY__ , 4, "sub"); + /* */test("S_____eFooXI_wBarY_f", new S_____eFooXI_wBarY_f , 4, "bar"); + // */test("S_____eFooXI_wBarYI_", new S_____eFooXI_wBarYI_ , 4, "sub"); + // */test("S_____eFooXI_wBarYIf", new S_____eFooXI_wBarYIf , 4, "bar"); + /* */test("S_____eFooXIf ", new S_____eFooXIf , 3, "foo"); + /* */test("S_____eFooXIfwBar___", new S_____eFooXIfwBar___ , 4, "foo"); + // */test("S_____eFooXIfwBar__f", new S_____eFooXIfwBar__f , 4, "bar"); + // */test("S_____eFooXIfwBar_I_", new S_____eFooXIfwBar_I_ , 4, "foo"); + // */test("S_____eFooXIfwBar_If", new S_____eFooXIfwBar_If , 4, "bar"); + /* */test("S_____eFooXIfwBarY__", new S_____eFooXIfwBarY__ , 4, "foo"); + // */test("S_____eFooXIfwBarY_f", new S_____eFooXIfwBarY_f , 4, "bar"); + // */test("S_____eFooXIfwBarYI_", new S_____eFooXIfwBarYI_ , 4, "foo"); + // */test("S_____eFooXIfwBarYIf", new S_____eFooXIfwBarYIf , 4, "bar"); + + /* */test("S____feFoo___ ", new S____feFoo___ , 3, "mix"); + /* */test("S____feFoo___wBar___", new S____feFoo___wBar___ , 4, "mix"); + /* */test("S____feFoo___wBar__f", new S____feFoo___wBar__f , 4, "mix"); + /* */test("S____feFoo___wBar_I_", new S____feFoo___wBar_I_ , 4, "mix"); + /* */test("S____feFoo___wBar_If", new S____feFoo___wBar_If , 4, "mix"); + /* */test("S____feFoo___wBarY__", new S____feFoo___wBarY__ , 4, "mix"); + /* */test("S____feFoo___wBarY_f", new S____feFoo___wBarY_f , 4, "mix"); + /* */test("S____feFoo___wBarYI_", new S____feFoo___wBarYI_ , 4, "mix"); + /* */test("S____feFoo___wBarYIf", new S____feFoo___wBarYIf , 4, "mix"); + /* */test("S____feFoo__f ", new S____feFoo__f , 3, "mix"); + /* */test("S____feFoo__fwBar___", new S____feFoo__fwBar___ , 4, "mix"); + /* */test("S____feFoo__fwBar__f", new S____feFoo__fwBar__f , 4, "mix"); + /* */test("S____feFoo__fwBar_I_", new S____feFoo__fwBar_I_ , 4, "mix"); + /* */test("S____feFoo__fwBar_If", new S____feFoo__fwBar_If , 4, "mix"); + /* */test("S____feFoo__fwBarY__", new S____feFoo__fwBarY__ , 4, "mix"); + /* */test("S____feFoo__fwBarY_f", new S____feFoo__fwBarY_f , 4, "mix"); + /* */test("S____feFoo__fwBarYI_", new S____feFoo__fwBarYI_ , 4, "mix"); + /* */test("S____feFoo__fwBarYIf", new S____feFoo__fwBarYIf , 4, "mix"); + /* */test("S____feFoo_I_ ", new S____feFoo_I_ , 3, "mix"); + /* */test("S____feFoo_I_wBar___", new S____feFoo_I_wBar___ , 4, "mix"); + /* */test("S____feFoo_I_wBar__f", new S____feFoo_I_wBar__f , 4, "mix"); + // */test("S____feFoo_I_wBar_I_", new S____feFoo_I_wBar_I_ , 4, "mix"); + // */test("S____feFoo_I_wBar_If", new S____feFoo_I_wBar_If , 4, "mix"); + /* */test("S____feFoo_I_wBarY__", new S____feFoo_I_wBarY__ , 4, "mix"); + /* */test("S____feFoo_I_wBarY_f", new S____feFoo_I_wBarY_f , 4, "mix"); + // */test("S____feFoo_I_wBarYI_", new S____feFoo_I_wBarYI_ , 4, "mix"); + // */test("S____feFoo_I_wBarYIf", new S____feFoo_I_wBarYIf , 4, "mix"); + /* */test("S____feFoo_If ", new S____feFoo_If , 3, "mix"); + /* */test("S____feFoo_IfwBar___", new S____feFoo_IfwBar___ , 4, "mix"); + /* */test("S____feFoo_IfwBar__f", new S____feFoo_IfwBar__f , 4, "mix"); + // */test("S____feFoo_IfwBar_I_", new S____feFoo_IfwBar_I_ , 4, "mix"); + // */test("S____feFoo_IfwBar_If", new S____feFoo_IfwBar_If , 4, "mix"); + /* */test("S____feFoo_IfwBarY__", new S____feFoo_IfwBarY__ , 4, "mix"); + /* */test("S____feFoo_IfwBarY_f", new S____feFoo_IfwBarY_f , 4, "mix"); + // */test("S____feFoo_IfwBarYI_", new S____feFoo_IfwBarYI_ , 4, "mix"); + // */test("S____feFoo_IfwBarYIf", new S____feFoo_IfwBarYIf , 4, "mix"); + /* */test("S____feFooX__ ", new S____feFooX__ , 3, "mix"); + /* */test("S____feFooX__wBar___", new S____feFooX__wBar___ , 4, "mix"); + /* */test("S____feFooX__wBar__f", new S____feFooX__wBar__f , 4, "mix"); + /* */test("S____feFooX__wBar_I_", new S____feFooX__wBar_I_ , 4, "mix"); + /* */test("S____feFooX__wBar_If", new S____feFooX__wBar_If , 4, "mix"); + /* */test("S____feFooX__wBarY__", new S____feFooX__wBarY__ , 4, "mix"); + /* */test("S____feFooX__wBarY_f", new S____feFooX__wBarY_f , 4, "mix"); + /* */test("S____feFooX__wBarYI_", new S____feFooX__wBarYI_ , 4, "mix"); + /* */test("S____feFooX__wBarYIf", new S____feFooX__wBarYIf , 4, "mix"); + /* */test("S____feFooX_f ", new S____feFooX_f , 3, "mix"); + /* */test("S____feFooX_fwBar___", new S____feFooX_fwBar___ , 4, "mix"); + /* */test("S____feFooX_fwBar__f", new S____feFooX_fwBar__f , 4, "mix"); + /* */test("S____feFooX_fwBar_I_", new S____feFooX_fwBar_I_ , 4, "mix"); + /* */test("S____feFooX_fwBar_If", new S____feFooX_fwBar_If , 4, "mix"); + /* */test("S____feFooX_fwBarY__", new S____feFooX_fwBarY__ , 4, "mix"); + /* */test("S____feFooX_fwBarY_f", new S____feFooX_fwBarY_f , 4, "mix"); + /* */test("S____feFooX_fwBarYI_", new S____feFooX_fwBarYI_ , 4, "mix"); + /* */test("S____feFooX_fwBarYIf", new S____feFooX_fwBarYIf , 4, "mix"); + /* */test("S____feFooXI_ ", new S____feFooXI_ , 3, "mix"); + /* */test("S____feFooXI_wBar___", new S____feFooXI_wBar___ , 4, "mix"); + /* */test("S____feFooXI_wBar__f", new S____feFooXI_wBar__f , 4, "mix"); + // */test("S____feFooXI_wBar_I_", new S____feFooXI_wBar_I_ , 4, "mix"); + // */test("S____feFooXI_wBar_If", new S____feFooXI_wBar_If , 4, "mix"); + /* */test("S____feFooXI_wBarY__", new S____feFooXI_wBarY__ , 4, "mix"); + /* */test("S____feFooXI_wBarY_f", new S____feFooXI_wBarY_f , 4, "mix"); + // */test("S____feFooXI_wBarYI_", new S____feFooXI_wBarYI_ , 4, "mix"); + // */test("S____feFooXI_wBarYIf", new S____feFooXI_wBarYIf , 4, "mix"); + /* */test("S____feFooXIf ", new S____feFooXIf , 3, "mix"); + /* */test("S____feFooXIfwBar___", new S____feFooXIfwBar___ , 4, "mix"); + /* */test("S____feFooXIfwBar__f", new S____feFooXIfwBar__f , 4, "mix"); + // */test("S____feFooXIfwBar_I_", new S____feFooXIfwBar_I_ , 4, "mix"); + // */test("S____feFooXIfwBar_If", new S____feFooXIfwBar_If , 4, "mix"); + /* */test("S____feFooXIfwBarY__", new S____feFooXIfwBarY__ , 4, "mix"); + /* */test("S____feFooXIfwBarY_f", new S____feFooXIfwBarY_f , 4, "mix"); + // */test("S____feFooXIfwBarYI_", new S____feFooXIfwBarYI_ , 4, "mix"); + // */test("S____feFooXIfwBarYIf", new S____feFooXIfwBarYIf , 4, "mix"); + + /* */test("S___I_eFoo___ ", new S___I_eFoo___ , 3, "sub"); + /* */test("S___I_eFoo___wBar___", new S___I_eFoo___wBar___ , 4, "sub"); + /* */test("S___I_eFoo___wBar__f", new S___I_eFoo___wBar__f , 4, "bar"); + // */test("S___I_eFoo___wBar_I_", new S___I_eFoo___wBar_I_ , 4, "sub"); + // */test("S___I_eFoo___wBar_If", new S___I_eFoo___wBar_If , 4, "bar"); + /* */test("S___I_eFoo___wBarY__", new S___I_eFoo___wBarY__ , 4, "sub"); + /* */test("S___I_eFoo___wBarY_f", new S___I_eFoo___wBarY_f , 4, "bar"); + // */test("S___I_eFoo___wBarYI_", new S___I_eFoo___wBarYI_ , 4, "sub"); + // */test("S___I_eFoo___wBarYIf", new S___I_eFoo___wBarYIf , 4, "bar"); + /* */test("S___I_eFoo__f ", new S___I_eFoo__f , 3, "foo"); + /* */test("S___I_eFoo__fwBar___", new S___I_eFoo__fwBar___ , 4, "foo"); + // */test("S___I_eFoo__fwBar__f", new S___I_eFoo__fwBar__f , 4, "bar"); + // */test("S___I_eFoo__fwBar_I_", new S___I_eFoo__fwBar_I_ , 4, "foo"); + // */test("S___I_eFoo__fwBar_If", new S___I_eFoo__fwBar_If , 4, "bar"); + /* */test("S___I_eFoo__fwBarY__", new S___I_eFoo__fwBarY__ , 4, "foo"); + // */test("S___I_eFoo__fwBarY_f", new S___I_eFoo__fwBarY_f , 4, "bar"); + // */test("S___I_eFoo__fwBarYI_", new S___I_eFoo__fwBarYI_ , 4, "foo"); + // */test("S___I_eFoo__fwBarYIf", new S___I_eFoo__fwBarYIf , 4, "bar"); + // */test("S___I_eFoo_I_ ", new S___I_eFoo_I_ , 3, "sub"); + // */test("S___I_eFoo_I_wBar___", new S___I_eFoo_I_wBar___ , 4, "sub"); + // */test("S___I_eFoo_I_wBar__f", new S___I_eFoo_I_wBar__f , 4, "bar"); + // */test("S___I_eFoo_I_wBar_I_", new S___I_eFoo_I_wBar_I_ , 4, "sub"); + // */test("S___I_eFoo_I_wBar_If", new S___I_eFoo_I_wBar_If , 4, "bar"); + // */test("S___I_eFoo_I_wBarY__", new S___I_eFoo_I_wBarY__ , 4, "sub"); + // */test("S___I_eFoo_I_wBarY_f", new S___I_eFoo_I_wBarY_f , 4, "bar"); + // */test("S___I_eFoo_I_wBarYI_", new S___I_eFoo_I_wBarYI_ , 4, "sub"); + // */test("S___I_eFoo_I_wBarYIf", new S___I_eFoo_I_wBarYIf , 4, "bar"); + // */test("S___I_eFoo_If ", new S___I_eFoo_If , 3, "foo"); + // */test("S___I_eFoo_IfwBar___", new S___I_eFoo_IfwBar___ , 4, "foo"); + // */test("S___I_eFoo_IfwBar__f", new S___I_eFoo_IfwBar__f , 4, "bar"); + // */test("S___I_eFoo_IfwBar_I_", new S___I_eFoo_IfwBar_I_ , 4, "foo"); + // */test("S___I_eFoo_IfwBar_If", new S___I_eFoo_IfwBar_If , 4, "bar"); + // */test("S___I_eFoo_IfwBarY__", new S___I_eFoo_IfwBarY__ , 4, "foo"); + // */test("S___I_eFoo_IfwBarY_f", new S___I_eFoo_IfwBarY_f , 4, "bar"); + // */test("S___I_eFoo_IfwBarYI_", new S___I_eFoo_IfwBarYI_ , 4, "foo"); + // */test("S___I_eFoo_IfwBarYIf", new S___I_eFoo_IfwBarYIf , 4, "bar"); + /* */test("S___I_eFooX__ ", new S___I_eFooX__ , 3, "sub"); + /* */test("S___I_eFooX__wBar___", new S___I_eFooX__wBar___ , 4, "sub"); + /* */test("S___I_eFooX__wBar__f", new S___I_eFooX__wBar__f , 4, "bar"); + // */test("S___I_eFooX__wBar_I_", new S___I_eFooX__wBar_I_ , 4, "sub"); + // */test("S___I_eFooX__wBar_If", new S___I_eFooX__wBar_If , 4, "bar"); + /* */test("S___I_eFooX__wBarY__", new S___I_eFooX__wBarY__ , 4, "sub"); + /* */test("S___I_eFooX__wBarY_f", new S___I_eFooX__wBarY_f , 4, "bar"); + // */test("S___I_eFooX__wBarYI_", new S___I_eFooX__wBarYI_ , 4, "sub"); + // */test("S___I_eFooX__wBarYIf", new S___I_eFooX__wBarYIf , 4, "bar"); + /* */test("S___I_eFooX_f ", new S___I_eFooX_f , 3, "foo"); + /* */test("S___I_eFooX_fwBar___", new S___I_eFooX_fwBar___ , 4, "foo"); + // */test("S___I_eFooX_fwBar__f", new S___I_eFooX_fwBar__f , 4, "bar"); + // */test("S___I_eFooX_fwBar_I_", new S___I_eFooX_fwBar_I_ , 4, "foo"); + // */test("S___I_eFooX_fwBar_If", new S___I_eFooX_fwBar_If , 4, "bar"); + /* */test("S___I_eFooX_fwBarY__", new S___I_eFooX_fwBarY__ , 4, "foo"); + // */test("S___I_eFooX_fwBarY_f", new S___I_eFooX_fwBarY_f , 4, "bar"); + // */test("S___I_eFooX_fwBarYI_", new S___I_eFooX_fwBarYI_ , 4, "foo"); + // */test("S___I_eFooX_fwBarYIf", new S___I_eFooX_fwBarYIf , 4, "bar"); + // */test("S___I_eFooXI_ ", new S___I_eFooXI_ , 3, "sub"); + // */test("S___I_eFooXI_wBar___", new S___I_eFooXI_wBar___ , 4, "sub"); + // */test("S___I_eFooXI_wBar__f", new S___I_eFooXI_wBar__f , 4, "bar"); + // */test("S___I_eFooXI_wBar_I_", new S___I_eFooXI_wBar_I_ , 4, "sub"); + // */test("S___I_eFooXI_wBar_If", new S___I_eFooXI_wBar_If , 4, "bar"); + // */test("S___I_eFooXI_wBarY__", new S___I_eFooXI_wBarY__ , 4, "sub"); + // */test("S___I_eFooXI_wBarY_f", new S___I_eFooXI_wBarY_f , 4, "bar"); + // */test("S___I_eFooXI_wBarYI_", new S___I_eFooXI_wBarYI_ , 4, "sub"); + // */test("S___I_eFooXI_wBarYIf", new S___I_eFooXI_wBarYIf , 4, "bar"); + // */test("S___I_eFooXIf ", new S___I_eFooXIf , 3, "foo"); + // */test("S___I_eFooXIfwBar___", new S___I_eFooXIfwBar___ , 4, "foo"); + // */test("S___I_eFooXIfwBar__f", new S___I_eFooXIfwBar__f , 4, "bar"); + // */test("S___I_eFooXIfwBar_I_", new S___I_eFooXIfwBar_I_ , 4, "foo"); + // */test("S___I_eFooXIfwBar_If", new S___I_eFooXIfwBar_If , 4, "bar"); + // */test("S___I_eFooXIfwBarY__", new S___I_eFooXIfwBarY__ , 4, "foo"); + // */test("S___I_eFooXIfwBarY_f", new S___I_eFooXIfwBarY_f , 4, "bar"); + // */test("S___I_eFooXIfwBarYI_", new S___I_eFooXIfwBarYI_ , 4, "foo"); + // */test("S___I_eFooXIfwBarYIf", new S___I_eFooXIfwBarYIf , 4, "bar"); + + /* */test("S___IfeFoo___ ", new S___IfeFoo___ , 3, "mix"); + /* */test("S___IfeFoo___wBar___", new S___IfeFoo___wBar___ , 4, "mix"); + /* */test("S___IfeFoo___wBar__f", new S___IfeFoo___wBar__f , 4, "mix"); + // */test("S___IfeFoo___wBar_I_", new S___IfeFoo___wBar_I_ , 4, "mix"); + // */test("S___IfeFoo___wBar_If", new S___IfeFoo___wBar_If , 4, "mix"); + /* */test("S___IfeFoo___wBarY__", new S___IfeFoo___wBarY__ , 4, "mix"); + /* */test("S___IfeFoo___wBarY_f", new S___IfeFoo___wBarY_f , 4, "mix"); + // */test("S___IfeFoo___wBarYI_", new S___IfeFoo___wBarYI_ , 4, "mix"); + // */test("S___IfeFoo___wBarYIf", new S___IfeFoo___wBarYIf , 4, "mix"); + /* */test("S___IfeFoo__f ", new S___IfeFoo__f , 3, "mix"); + /* */test("S___IfeFoo__fwBar___", new S___IfeFoo__fwBar___ , 4, "mix"); + /* */test("S___IfeFoo__fwBar__f", new S___IfeFoo__fwBar__f , 4, "mix"); + // */test("S___IfeFoo__fwBar_I_", new S___IfeFoo__fwBar_I_ , 4, "mix"); + // */test("S___IfeFoo__fwBar_If", new S___IfeFoo__fwBar_If , 4, "mix"); + /* */test("S___IfeFoo__fwBarY__", new S___IfeFoo__fwBarY__ , 4, "mix"); + /* */test("S___IfeFoo__fwBarY_f", new S___IfeFoo__fwBarY_f , 4, "mix"); + // */test("S___IfeFoo__fwBarYI_", new S___IfeFoo__fwBarYI_ , 4, "mix"); + // */test("S___IfeFoo__fwBarYIf", new S___IfeFoo__fwBarYIf , 4, "mix"); + // */test("S___IfeFoo_I_ ", new S___IfeFoo_I_ , 3, "mix"); + // */test("S___IfeFoo_I_wBar___", new S___IfeFoo_I_wBar___ , 4, "mix"); + // */test("S___IfeFoo_I_wBar__f", new S___IfeFoo_I_wBar__f , 4, "mix"); + // */test("S___IfeFoo_I_wBar_I_", new S___IfeFoo_I_wBar_I_ , 4, "mix"); + // */test("S___IfeFoo_I_wBar_If", new S___IfeFoo_I_wBar_If , 4, "mix"); + // */test("S___IfeFoo_I_wBarY__", new S___IfeFoo_I_wBarY__ , 4, "mix"); + // */test("S___IfeFoo_I_wBarY_f", new S___IfeFoo_I_wBarY_f , 4, "mix"); + // */test("S___IfeFoo_I_wBarYI_", new S___IfeFoo_I_wBarYI_ , 4, "mix"); + // */test("S___IfeFoo_I_wBarYIf", new S___IfeFoo_I_wBarYIf , 4, "mix"); + // */test("S___IfeFoo_If ", new S___IfeFoo_If , 3, "mix"); + // */test("S___IfeFoo_IfwBar___", new S___IfeFoo_IfwBar___ , 4, "mix"); + // */test("S___IfeFoo_IfwBar__f", new S___IfeFoo_IfwBar__f , 4, "mix"); + // */test("S___IfeFoo_IfwBar_I_", new S___IfeFoo_IfwBar_I_ , 4, "mix"); + // */test("S___IfeFoo_IfwBar_If", new S___IfeFoo_IfwBar_If , 4, "mix"); + // */test("S___IfeFoo_IfwBarY__", new S___IfeFoo_IfwBarY__ , 4, "mix"); + // */test("S___IfeFoo_IfwBarY_f", new S___IfeFoo_IfwBarY_f , 4, "mix"); + // */test("S___IfeFoo_IfwBarYI_", new S___IfeFoo_IfwBarYI_ , 4, "mix"); + // */test("S___IfeFoo_IfwBarYIf", new S___IfeFoo_IfwBarYIf , 4, "mix"); + /* */test("S___IfeFooX__ ", new S___IfeFooX__ , 3, "mix"); + /* */test("S___IfeFooX__wBar___", new S___IfeFooX__wBar___ , 4, "mix"); + /* */test("S___IfeFooX__wBar__f", new S___IfeFooX__wBar__f , 4, "mix"); + // */test("S___IfeFooX__wBar_I_", new S___IfeFooX__wBar_I_ , 4, "mix"); + // */test("S___IfeFooX__wBar_If", new S___IfeFooX__wBar_If , 4, "mix"); + /* */test("S___IfeFooX__wBarY__", new S___IfeFooX__wBarY__ , 4, "mix"); + /* */test("S___IfeFooX__wBarY_f", new S___IfeFooX__wBarY_f , 4, "mix"); + // */test("S___IfeFooX__wBarYI_", new S___IfeFooX__wBarYI_ , 4, "mix"); + // */test("S___IfeFooX__wBarYIf", new S___IfeFooX__wBarYIf , 4, "mix"); + /* */test("S___IfeFooX_f ", new S___IfeFooX_f , 3, "mix"); + /* */test("S___IfeFooX_fwBar___", new S___IfeFooX_fwBar___ , 4, "mix"); + /* */test("S___IfeFooX_fwBar__f", new S___IfeFooX_fwBar__f , 4, "mix"); + // */test("S___IfeFooX_fwBar_I_", new S___IfeFooX_fwBar_I_ , 4, "mix"); + // */test("S___IfeFooX_fwBar_If", new S___IfeFooX_fwBar_If , 4, "mix"); + /* */test("S___IfeFooX_fwBarY__", new S___IfeFooX_fwBarY__ , 4, "mix"); + /* */test("S___IfeFooX_fwBarY_f", new S___IfeFooX_fwBarY_f , 4, "mix"); + // */test("S___IfeFooX_fwBarYI_", new S___IfeFooX_fwBarYI_ , 4, "mix"); + // */test("S___IfeFooX_fwBarYIf", new S___IfeFooX_fwBarYIf , 4, "mix"); + // */test("S___IfeFooXI_ ", new S___IfeFooXI_ , 3, "mix"); + // */test("S___IfeFooXI_wBar___", new S___IfeFooXI_wBar___ , 4, "mix"); + // */test("S___IfeFooXI_wBar__f", new S___IfeFooXI_wBar__f , 4, "mix"); + // */test("S___IfeFooXI_wBar_I_", new S___IfeFooXI_wBar_I_ , 4, "mix"); + // */test("S___IfeFooXI_wBar_If", new S___IfeFooXI_wBar_If , 4, "mix"); + // */test("S___IfeFooXI_wBarY__", new S___IfeFooXI_wBarY__ , 4, "mix"); + // */test("S___IfeFooXI_wBarY_f", new S___IfeFooXI_wBarY_f , 4, "mix"); + // */test("S___IfeFooXI_wBarYI_", new S___IfeFooXI_wBarYI_ , 4, "mix"); + // */test("S___IfeFooXI_wBarYIf", new S___IfeFooXI_wBarYIf , 4, "mix"); + // */test("S___IfeFooXIf ", new S___IfeFooXIf , 3, "mix"); + // */test("S___IfeFooXIfwBar___", new S___IfeFooXIfwBar___ , 4, "mix"); + // */test("S___IfeFooXIfwBar__f", new S___IfeFooXIfwBar__f , 4, "mix"); + // */test("S___IfeFooXIfwBar_I_", new S___IfeFooXIfwBar_I_ , 4, "mix"); + // */test("S___IfeFooXIfwBar_If", new S___IfeFooXIfwBar_If , 4, "mix"); + // */test("S___IfeFooXIfwBarY__", new S___IfeFooXIfwBarY__ , 4, "mix"); + // */test("S___IfeFooXIfwBarY_f", new S___IfeFooXIfwBarY_f , 4, "mix"); + // */test("S___IfeFooXIfwBarYI_", new S___IfeFooXIfwBarYI_ , 4, "mix"); + // */test("S___IfeFooXIfwBarYIf", new S___IfeFooXIfwBarYIf , 4, "mix"); + + /* */test("S__Z__eFoo___ ", new S__Z__eFoo___ , 3, "sub"); + /* */test("S__Z__eFoo___wBar___", new S__Z__eFoo___wBar___ , 4, "sub"); + /* */test("S__Z__eFoo___wBar__f", new S__Z__eFoo___wBar__f , 4, "bar"); + /* */test("S__Z__eFoo___wBar_I_", new S__Z__eFoo___wBar_I_ , 4, "sub"); + /* */test("S__Z__eFoo___wBar_If", new S__Z__eFoo___wBar_If , 4, "bar"); + /* */test("S__Z__eFoo___wBarY__", new S__Z__eFoo___wBarY__ , 4, "sub"); + /* */test("S__Z__eFoo___wBarY_f", new S__Z__eFoo___wBarY_f , 4, "bar"); + /* */test("S__Z__eFoo___wBarYI_", new S__Z__eFoo___wBarYI_ , 4, "sub"); + /* */test("S__Z__eFoo___wBarYIf", new S__Z__eFoo___wBarYIf , 4, "bar"); + /* */test("S__Z__eFoo__f ", new S__Z__eFoo__f , 3, "foo"); + /* */test("S__Z__eFoo__fwBar___", new S__Z__eFoo__fwBar___ , 4, "foo"); + // */test("S__Z__eFoo__fwBar__f", new S__Z__eFoo__fwBar__f , 4, "bar"); + /* */test("S__Z__eFoo__fwBar_I_", new S__Z__eFoo__fwBar_I_ , 4, "foo"); + // */test("S__Z__eFoo__fwBar_If", new S__Z__eFoo__fwBar_If , 4, "bar"); + /* */test("S__Z__eFoo__fwBarY__", new S__Z__eFoo__fwBarY__ , 4, "foo"); + // */test("S__Z__eFoo__fwBarY_f", new S__Z__eFoo__fwBarY_f , 4, "bar"); + /* */test("S__Z__eFoo__fwBarYI_", new S__Z__eFoo__fwBarYI_ , 4, "foo"); + // */test("S__Z__eFoo__fwBarYIf", new S__Z__eFoo__fwBarYIf , 4, "bar"); + /* */test("S__Z__eFoo_I_ ", new S__Z__eFoo_I_ , 3, "sub"); + /* */test("S__Z__eFoo_I_wBar___", new S__Z__eFoo_I_wBar___ , 4, "sub"); + /* */test("S__Z__eFoo_I_wBar__f", new S__Z__eFoo_I_wBar__f , 4, "bar"); + // */test("S__Z__eFoo_I_wBar_I_", new S__Z__eFoo_I_wBar_I_ , 4, "sub"); + // */test("S__Z__eFoo_I_wBar_If", new S__Z__eFoo_I_wBar_If , 4, "bar"); + /* */test("S__Z__eFoo_I_wBarY__", new S__Z__eFoo_I_wBarY__ , 4, "sub"); + /* */test("S__Z__eFoo_I_wBarY_f", new S__Z__eFoo_I_wBarY_f , 4, "bar"); + // */test("S__Z__eFoo_I_wBarYI_", new S__Z__eFoo_I_wBarYI_ , 4, "sub"); + // */test("S__Z__eFoo_I_wBarYIf", new S__Z__eFoo_I_wBarYIf , 4, "bar"); + /* */test("S__Z__eFoo_If ", new S__Z__eFoo_If , 3, "foo"); + /* */test("S__Z__eFoo_IfwBar___", new S__Z__eFoo_IfwBar___ , 4, "foo"); + // */test("S__Z__eFoo_IfwBar__f", new S__Z__eFoo_IfwBar__f , 4, "bar"); + // */test("S__Z__eFoo_IfwBar_I_", new S__Z__eFoo_IfwBar_I_ , 4, "foo"); + // */test("S__Z__eFoo_IfwBar_If", new S__Z__eFoo_IfwBar_If , 4, "bar"); + /* */test("S__Z__eFoo_IfwBarY__", new S__Z__eFoo_IfwBarY__ , 4, "foo"); + // */test("S__Z__eFoo_IfwBarY_f", new S__Z__eFoo_IfwBarY_f , 4, "bar"); + // */test("S__Z__eFoo_IfwBarYI_", new S__Z__eFoo_IfwBarYI_ , 4, "foo"); + // */test("S__Z__eFoo_IfwBarYIf", new S__Z__eFoo_IfwBarYIf , 4, "bar"); + /* */test("S__Z__eFooX__ ", new S__Z__eFooX__ , 3, "sub"); + /* */test("S__Z__eFooX__wBar___", new S__Z__eFooX__wBar___ , 4, "sub"); + /* */test("S__Z__eFooX__wBar__f", new S__Z__eFooX__wBar__f , 4, "bar"); + /* */test("S__Z__eFooX__wBar_I_", new S__Z__eFooX__wBar_I_ , 4, "sub"); + /* */test("S__Z__eFooX__wBar_If", new S__Z__eFooX__wBar_If , 4, "bar"); + /* */test("S__Z__eFooX__wBarY__", new S__Z__eFooX__wBarY__ , 4, "sub"); + /* */test("S__Z__eFooX__wBarY_f", new S__Z__eFooX__wBarY_f , 4, "bar"); + /* */test("S__Z__eFooX__wBarYI_", new S__Z__eFooX__wBarYI_ , 4, "sub"); + /* */test("S__Z__eFooX__wBarYIf", new S__Z__eFooX__wBarYIf , 4, "bar"); + /* */test("S__Z__eFooX_f ", new S__Z__eFooX_f , 3, "foo"); + /* */test("S__Z__eFooX_fwBar___", new S__Z__eFooX_fwBar___ , 4, "foo"); + // */test("S__Z__eFooX_fwBar__f", new S__Z__eFooX_fwBar__f , 4, "bar"); + /* */test("S__Z__eFooX_fwBar_I_", new S__Z__eFooX_fwBar_I_ , 4, "foo"); + // */test("S__Z__eFooX_fwBar_If", new S__Z__eFooX_fwBar_If , 4, "bar"); + /* */test("S__Z__eFooX_fwBarY__", new S__Z__eFooX_fwBarY__ , 4, "foo"); + // */test("S__Z__eFooX_fwBarY_f", new S__Z__eFooX_fwBarY_f , 4, "bar"); + /* */test("S__Z__eFooX_fwBarYI_", new S__Z__eFooX_fwBarYI_ , 4, "foo"); + // */test("S__Z__eFooX_fwBarYIf", new S__Z__eFooX_fwBarYIf , 4, "bar"); + /* */test("S__Z__eFooXI_ ", new S__Z__eFooXI_ , 3, "sub"); + /* */test("S__Z__eFooXI_wBar___", new S__Z__eFooXI_wBar___ , 4, "sub"); + /* */test("S__Z__eFooXI_wBar__f", new S__Z__eFooXI_wBar__f , 4, "bar"); + // */test("S__Z__eFooXI_wBar_I_", new S__Z__eFooXI_wBar_I_ , 4, "sub"); + // */test("S__Z__eFooXI_wBar_If", new S__Z__eFooXI_wBar_If , 4, "bar"); + /* */test("S__Z__eFooXI_wBarY__", new S__Z__eFooXI_wBarY__ , 4, "sub"); + /* */test("S__Z__eFooXI_wBarY_f", new S__Z__eFooXI_wBarY_f , 4, "bar"); + // */test("S__Z__eFooXI_wBarYI_", new S__Z__eFooXI_wBarYI_ , 4, "sub"); + // */test("S__Z__eFooXI_wBarYIf", new S__Z__eFooXI_wBarYIf , 4, "bar"); + /* */test("S__Z__eFooXIf ", new S__Z__eFooXIf , 3, "foo"); + /* */test("S__Z__eFooXIfwBar___", new S__Z__eFooXIfwBar___ , 4, "foo"); + // */test("S__Z__eFooXIfwBar__f", new S__Z__eFooXIfwBar__f , 4, "bar"); + // */test("S__Z__eFooXIfwBar_I_", new S__Z__eFooXIfwBar_I_ , 4, "foo"); + // */test("S__Z__eFooXIfwBar_If", new S__Z__eFooXIfwBar_If , 4, "bar"); + /* */test("S__Z__eFooXIfwBarY__", new S__Z__eFooXIfwBarY__ , 4, "foo"); + // */test("S__Z__eFooXIfwBarY_f", new S__Z__eFooXIfwBarY_f , 4, "bar"); + // */test("S__Z__eFooXIfwBarYI_", new S__Z__eFooXIfwBarYI_ , 4, "foo"); + // */test("S__Z__eFooXIfwBarYIf", new S__Z__eFooXIfwBarYIf , 4, "bar"); + + /* */test("S__Z_feFoo___ ", new S__Z_feFoo___ , 3, "mix"); + /* */test("S__Z_feFoo___wBar___", new S__Z_feFoo___wBar___ , 4, "mix"); + /* */test("S__Z_feFoo___wBar__f", new S__Z_feFoo___wBar__f , 4, "mix"); + /* */test("S__Z_feFoo___wBar_I_", new S__Z_feFoo___wBar_I_ , 4, "mix"); + /* */test("S__Z_feFoo___wBar_If", new S__Z_feFoo___wBar_If , 4, "mix"); + /* */test("S__Z_feFoo___wBarY__", new S__Z_feFoo___wBarY__ , 4, "mix"); + /* */test("S__Z_feFoo___wBarY_f", new S__Z_feFoo___wBarY_f , 4, "mix"); + /* */test("S__Z_feFoo___wBarYI_", new S__Z_feFoo___wBarYI_ , 4, "mix"); + /* */test("S__Z_feFoo___wBarYIf", new S__Z_feFoo___wBarYIf , 4, "mix"); + /* */test("S__Z_feFoo__f ", new S__Z_feFoo__f , 3, "mix"); + /* */test("S__Z_feFoo__fwBar___", new S__Z_feFoo__fwBar___ , 4, "mix"); + /* */test("S__Z_feFoo__fwBar__f", new S__Z_feFoo__fwBar__f , 4, "mix"); + /* */test("S__Z_feFoo__fwBar_I_", new S__Z_feFoo__fwBar_I_ , 4, "mix"); + /* */test("S__Z_feFoo__fwBar_If", new S__Z_feFoo__fwBar_If , 4, "mix"); + /* */test("S__Z_feFoo__fwBarY__", new S__Z_feFoo__fwBarY__ , 4, "mix"); + /* */test("S__Z_feFoo__fwBarY_f", new S__Z_feFoo__fwBarY_f , 4, "mix"); + /* */test("S__Z_feFoo__fwBarYI_", new S__Z_feFoo__fwBarYI_ , 4, "mix"); + /* */test("S__Z_feFoo__fwBarYIf", new S__Z_feFoo__fwBarYIf , 4, "mix"); + /* */test("S__Z_feFoo_I_ ", new S__Z_feFoo_I_ , 3, "mix"); + /* */test("S__Z_feFoo_I_wBar___", new S__Z_feFoo_I_wBar___ , 4, "mix"); + /* */test("S__Z_feFoo_I_wBar__f", new S__Z_feFoo_I_wBar__f , 4, "mix"); + // */test("S__Z_feFoo_I_wBar_I_", new S__Z_feFoo_I_wBar_I_ , 4, "mix"); + // */test("S__Z_feFoo_I_wBar_If", new S__Z_feFoo_I_wBar_If , 4, "mix"); + /* */test("S__Z_feFoo_I_wBarY__", new S__Z_feFoo_I_wBarY__ , 4, "mix"); + /* */test("S__Z_feFoo_I_wBarY_f", new S__Z_feFoo_I_wBarY_f , 4, "mix"); + // */test("S__Z_feFoo_I_wBarYI_", new S__Z_feFoo_I_wBarYI_ , 4, "mix"); + // */test("S__Z_feFoo_I_wBarYIf", new S__Z_feFoo_I_wBarYIf , 4, "mix"); + /* */test("S__Z_feFoo_If ", new S__Z_feFoo_If , 3, "mix"); + /* */test("S__Z_feFoo_IfwBar___", new S__Z_feFoo_IfwBar___ , 4, "mix"); + /* */test("S__Z_feFoo_IfwBar__f", new S__Z_feFoo_IfwBar__f , 4, "mix"); + // */test("S__Z_feFoo_IfwBar_I_", new S__Z_feFoo_IfwBar_I_ , 4, "mix"); + // */test("S__Z_feFoo_IfwBar_If", new S__Z_feFoo_IfwBar_If , 4, "mix"); + /* */test("S__Z_feFoo_IfwBarY__", new S__Z_feFoo_IfwBarY__ , 4, "mix"); + /* */test("S__Z_feFoo_IfwBarY_f", new S__Z_feFoo_IfwBarY_f , 4, "mix"); + // */test("S__Z_feFoo_IfwBarYI_", new S__Z_feFoo_IfwBarYI_ , 4, "mix"); + // */test("S__Z_feFoo_IfwBarYIf", new S__Z_feFoo_IfwBarYIf , 4, "mix"); + /* */test("S__Z_feFooX__ ", new S__Z_feFooX__ , 3, "mix"); + /* */test("S__Z_feFooX__wBar___", new S__Z_feFooX__wBar___ , 4, "mix"); + /* */test("S__Z_feFooX__wBar__f", new S__Z_feFooX__wBar__f , 4, "mix"); + /* */test("S__Z_feFooX__wBar_I_", new S__Z_feFooX__wBar_I_ , 4, "mix"); + /* */test("S__Z_feFooX__wBar_If", new S__Z_feFooX__wBar_If , 4, "mix"); + /* */test("S__Z_feFooX__wBarY__", new S__Z_feFooX__wBarY__ , 4, "mix"); + /* */test("S__Z_feFooX__wBarY_f", new S__Z_feFooX__wBarY_f , 4, "mix"); + /* */test("S__Z_feFooX__wBarYI_", new S__Z_feFooX__wBarYI_ , 4, "mix"); + /* */test("S__Z_feFooX__wBarYIf", new S__Z_feFooX__wBarYIf , 4, "mix"); + /* */test("S__Z_feFooX_f ", new S__Z_feFooX_f , 3, "mix"); + /* */test("S__Z_feFooX_fwBar___", new S__Z_feFooX_fwBar___ , 4, "mix"); + /* */test("S__Z_feFooX_fwBar__f", new S__Z_feFooX_fwBar__f , 4, "mix"); + /* */test("S__Z_feFooX_fwBar_I_", new S__Z_feFooX_fwBar_I_ , 4, "mix"); + /* */test("S__Z_feFooX_fwBar_If", new S__Z_feFooX_fwBar_If , 4, "mix"); + /* */test("S__Z_feFooX_fwBarY__", new S__Z_feFooX_fwBarY__ , 4, "mix"); + /* */test("S__Z_feFooX_fwBarY_f", new S__Z_feFooX_fwBarY_f , 4, "mix"); + /* */test("S__Z_feFooX_fwBarYI_", new S__Z_feFooX_fwBarYI_ , 4, "mix"); + /* */test("S__Z_feFooX_fwBarYIf", new S__Z_feFooX_fwBarYIf , 4, "mix"); + /* */test("S__Z_feFooXI_ ", new S__Z_feFooXI_ , 3, "mix"); + /* */test("S__Z_feFooXI_wBar___", new S__Z_feFooXI_wBar___ , 4, "mix"); + /* */test("S__Z_feFooXI_wBar__f", new S__Z_feFooXI_wBar__f , 4, "mix"); + // */test("S__Z_feFooXI_wBar_I_", new S__Z_feFooXI_wBar_I_ , 4, "mix"); + // */test("S__Z_feFooXI_wBar_If", new S__Z_feFooXI_wBar_If , 4, "mix"); + /* */test("S__Z_feFooXI_wBarY__", new S__Z_feFooXI_wBarY__ , 4, "mix"); + /* */test("S__Z_feFooXI_wBarY_f", new S__Z_feFooXI_wBarY_f , 4, "mix"); + // */test("S__Z_feFooXI_wBarYI_", new S__Z_feFooXI_wBarYI_ , 4, "mix"); + // */test("S__Z_feFooXI_wBarYIf", new S__Z_feFooXI_wBarYIf , 4, "mix"); + /* */test("S__Z_feFooXIf ", new S__Z_feFooXIf , 3, "mix"); + /* */test("S__Z_feFooXIfwBar___", new S__Z_feFooXIfwBar___ , 4, "mix"); + /* */test("S__Z_feFooXIfwBar__f", new S__Z_feFooXIfwBar__f , 4, "mix"); + // */test("S__Z_feFooXIfwBar_I_", new S__Z_feFooXIfwBar_I_ , 4, "mix"); + // */test("S__Z_feFooXIfwBar_If", new S__Z_feFooXIfwBar_If , 4, "mix"); + /* */test("S__Z_feFooXIfwBarY__", new S__Z_feFooXIfwBarY__ , 4, "mix"); + /* */test("S__Z_feFooXIfwBarY_f", new S__Z_feFooXIfwBarY_f , 4, "mix"); + // */test("S__Z_feFooXIfwBarYI_", new S__Z_feFooXIfwBarYI_ , 4, "mix"); + // */test("S__Z_feFooXIfwBarYIf", new S__Z_feFooXIfwBarYIf , 4, "mix"); + + /* */test("S__ZI_eFoo___ ", new S__ZI_eFoo___ , 3, "sub"); + /* */test("S__ZI_eFoo___wBar___", new S__ZI_eFoo___wBar___ , 4, "sub"); + /* */test("S__ZI_eFoo___wBar__f", new S__ZI_eFoo___wBar__f , 4, "bar"); + // */test("S__ZI_eFoo___wBar_I_", new S__ZI_eFoo___wBar_I_ , 4, "sub"); + // */test("S__ZI_eFoo___wBar_If", new S__ZI_eFoo___wBar_If , 4, "bar"); + /* */test("S__ZI_eFoo___wBarY__", new S__ZI_eFoo___wBarY__ , 4, "sub"); + /* */test("S__ZI_eFoo___wBarY_f", new S__ZI_eFoo___wBarY_f , 4, "bar"); + // */test("S__ZI_eFoo___wBarYI_", new S__ZI_eFoo___wBarYI_ , 4, "sub"); + // */test("S__ZI_eFoo___wBarYIf", new S__ZI_eFoo___wBarYIf , 4, "bar"); + /* */test("S__ZI_eFoo__f ", new S__ZI_eFoo__f , 3, "foo"); + /* */test("S__ZI_eFoo__fwBar___", new S__ZI_eFoo__fwBar___ , 4, "foo"); + // */test("S__ZI_eFoo__fwBar__f", new S__ZI_eFoo__fwBar__f , 4, "bar"); + // */test("S__ZI_eFoo__fwBar_I_", new S__ZI_eFoo__fwBar_I_ , 4, "foo"); + // */test("S__ZI_eFoo__fwBar_If", new S__ZI_eFoo__fwBar_If , 4, "bar"); + /* */test("S__ZI_eFoo__fwBarY__", new S__ZI_eFoo__fwBarY__ , 4, "foo"); + // */test("S__ZI_eFoo__fwBarY_f", new S__ZI_eFoo__fwBarY_f , 4, "bar"); + // */test("S__ZI_eFoo__fwBarYI_", new S__ZI_eFoo__fwBarYI_ , 4, "foo"); + // */test("S__ZI_eFoo__fwBarYIf", new S__ZI_eFoo__fwBarYIf , 4, "bar"); + // */test("S__ZI_eFoo_I_ ", new S__ZI_eFoo_I_ , 3, "sub"); + // */test("S__ZI_eFoo_I_wBar___", new S__ZI_eFoo_I_wBar___ , 4, "sub"); + // */test("S__ZI_eFoo_I_wBar__f", new S__ZI_eFoo_I_wBar__f , 4, "bar"); + // */test("S__ZI_eFoo_I_wBar_I_", new S__ZI_eFoo_I_wBar_I_ , 4, "sub"); + // */test("S__ZI_eFoo_I_wBar_If", new S__ZI_eFoo_I_wBar_If , 4, "bar"); + // */test("S__ZI_eFoo_I_wBarY__", new S__ZI_eFoo_I_wBarY__ , 4, "sub"); + // */test("S__ZI_eFoo_I_wBarY_f", new S__ZI_eFoo_I_wBarY_f , 4, "bar"); + // */test("S__ZI_eFoo_I_wBarYI_", new S__ZI_eFoo_I_wBarYI_ , 4, "sub"); + // */test("S__ZI_eFoo_I_wBarYIf", new S__ZI_eFoo_I_wBarYIf , 4, "bar"); + // */test("S__ZI_eFoo_If ", new S__ZI_eFoo_If , 3, "foo"); + // */test("S__ZI_eFoo_IfwBar___", new S__ZI_eFoo_IfwBar___ , 4, "foo"); + // */test("S__ZI_eFoo_IfwBar__f", new S__ZI_eFoo_IfwBar__f , 4, "bar"); + // */test("S__ZI_eFoo_IfwBar_I_", new S__ZI_eFoo_IfwBar_I_ , 4, "foo"); + // */test("S__ZI_eFoo_IfwBar_If", new S__ZI_eFoo_IfwBar_If , 4, "bar"); + // */test("S__ZI_eFoo_IfwBarY__", new S__ZI_eFoo_IfwBarY__ , 4, "foo"); + // */test("S__ZI_eFoo_IfwBarY_f", new S__ZI_eFoo_IfwBarY_f , 4, "bar"); + // */test("S__ZI_eFoo_IfwBarYI_", new S__ZI_eFoo_IfwBarYI_ , 4, "foo"); + // */test("S__ZI_eFoo_IfwBarYIf", new S__ZI_eFoo_IfwBarYIf , 4, "bar"); + /* */test("S__ZI_eFooX__ ", new S__ZI_eFooX__ , 3, "sub"); + /* */test("S__ZI_eFooX__wBar___", new S__ZI_eFooX__wBar___ , 4, "sub"); + /* */test("S__ZI_eFooX__wBar__f", new S__ZI_eFooX__wBar__f , 4, "bar"); + // */test("S__ZI_eFooX__wBar_I_", new S__ZI_eFooX__wBar_I_ , 4, "sub"); + // */test("S__ZI_eFooX__wBar_If", new S__ZI_eFooX__wBar_If , 4, "bar"); + /* */test("S__ZI_eFooX__wBarY__", new S__ZI_eFooX__wBarY__ , 4, "sub"); + /* */test("S__ZI_eFooX__wBarY_f", new S__ZI_eFooX__wBarY_f , 4, "bar"); + // */test("S__ZI_eFooX__wBarYI_", new S__ZI_eFooX__wBarYI_ , 4, "sub"); + // */test("S__ZI_eFooX__wBarYIf", new S__ZI_eFooX__wBarYIf , 4, "bar"); + /* */test("S__ZI_eFooX_f ", new S__ZI_eFooX_f , 3, "foo"); + /* */test("S__ZI_eFooX_fwBar___", new S__ZI_eFooX_fwBar___ , 4, "foo"); + // */test("S__ZI_eFooX_fwBar__f", new S__ZI_eFooX_fwBar__f , 4, "bar"); + // */test("S__ZI_eFooX_fwBar_I_", new S__ZI_eFooX_fwBar_I_ , 4, "foo"); + // */test("S__ZI_eFooX_fwBar_If", new S__ZI_eFooX_fwBar_If , 4, "bar"); + /* */test("S__ZI_eFooX_fwBarY__", new S__ZI_eFooX_fwBarY__ , 4, "foo"); + // */test("S__ZI_eFooX_fwBarY_f", new S__ZI_eFooX_fwBarY_f , 4, "bar"); + // */test("S__ZI_eFooX_fwBarYI_", new S__ZI_eFooX_fwBarYI_ , 4, "foo"); + // */test("S__ZI_eFooX_fwBarYIf", new S__ZI_eFooX_fwBarYIf , 4, "bar"); + // */test("S__ZI_eFooXI_ ", new S__ZI_eFooXI_ , 3, "sub"); + // */test("S__ZI_eFooXI_wBar___", new S__ZI_eFooXI_wBar___ , 4, "sub"); + // */test("S__ZI_eFooXI_wBar__f", new S__ZI_eFooXI_wBar__f , 4, "bar"); + // */test("S__ZI_eFooXI_wBar_I_", new S__ZI_eFooXI_wBar_I_ , 4, "sub"); + // */test("S__ZI_eFooXI_wBar_If", new S__ZI_eFooXI_wBar_If , 4, "bar"); + // */test("S__ZI_eFooXI_wBarY__", new S__ZI_eFooXI_wBarY__ , 4, "sub"); + // */test("S__ZI_eFooXI_wBarY_f", new S__ZI_eFooXI_wBarY_f , 4, "bar"); + // */test("S__ZI_eFooXI_wBarYI_", new S__ZI_eFooXI_wBarYI_ , 4, "sub"); + // */test("S__ZI_eFooXI_wBarYIf", new S__ZI_eFooXI_wBarYIf , 4, "bar"); + // */test("S__ZI_eFooXIf ", new S__ZI_eFooXIf , 3, "foo"); + // */test("S__ZI_eFooXIfwBar___", new S__ZI_eFooXIfwBar___ , 4, "foo"); + // */test("S__ZI_eFooXIfwBar__f", new S__ZI_eFooXIfwBar__f , 4, "bar"); + // */test("S__ZI_eFooXIfwBar_I_", new S__ZI_eFooXIfwBar_I_ , 4, "foo"); + // */test("S__ZI_eFooXIfwBar_If", new S__ZI_eFooXIfwBar_If , 4, "bar"); + // */test("S__ZI_eFooXIfwBarY__", new S__ZI_eFooXIfwBarY__ , 4, "foo"); + // */test("S__ZI_eFooXIfwBarY_f", new S__ZI_eFooXIfwBarY_f , 4, "bar"); + // */test("S__ZI_eFooXIfwBarYI_", new S__ZI_eFooXIfwBarYI_ , 4, "foo"); + // */test("S__ZI_eFooXIfwBarYIf", new S__ZI_eFooXIfwBarYIf , 4, "bar"); + + /* */test("S__ZIfeFoo___ ", new S__ZIfeFoo___ , 3, "mix"); + /* */test("S__ZIfeFoo___wBar___", new S__ZIfeFoo___wBar___ , 4, "mix"); + /* */test("S__ZIfeFoo___wBar__f", new S__ZIfeFoo___wBar__f , 4, "mix"); + // */test("S__ZIfeFoo___wBar_I_", new S__ZIfeFoo___wBar_I_ , 4, "mix"); + // */test("S__ZIfeFoo___wBar_If", new S__ZIfeFoo___wBar_If , 4, "mix"); + /* */test("S__ZIfeFoo___wBarY__", new S__ZIfeFoo___wBarY__ , 4, "mix"); + /* */test("S__ZIfeFoo___wBarY_f", new S__ZIfeFoo___wBarY_f , 4, "mix"); + // */test("S__ZIfeFoo___wBarYI_", new S__ZIfeFoo___wBarYI_ , 4, "mix"); + // */test("S__ZIfeFoo___wBarYIf", new S__ZIfeFoo___wBarYIf , 4, "mix"); + /* */test("S__ZIfeFoo__f ", new S__ZIfeFoo__f , 3, "mix"); + /* */test("S__ZIfeFoo__fwBar___", new S__ZIfeFoo__fwBar___ , 4, "mix"); + /* */test("S__ZIfeFoo__fwBar__f", new S__ZIfeFoo__fwBar__f , 4, "mix"); + // */test("S__ZIfeFoo__fwBar_I_", new S__ZIfeFoo__fwBar_I_ , 4, "mix"); + // */test("S__ZIfeFoo__fwBar_If", new S__ZIfeFoo__fwBar_If , 4, "mix"); + /* */test("S__ZIfeFoo__fwBarY__", new S__ZIfeFoo__fwBarY__ , 4, "mix"); + /* */test("S__ZIfeFoo__fwBarY_f", new S__ZIfeFoo__fwBarY_f , 4, "mix"); + // */test("S__ZIfeFoo__fwBarYI_", new S__ZIfeFoo__fwBarYI_ , 4, "mix"); + // */test("S__ZIfeFoo__fwBarYIf", new S__ZIfeFoo__fwBarYIf , 4, "mix"); + // */test("S__ZIfeFoo_I_ ", new S__ZIfeFoo_I_ , 3, "mix"); + // */test("S__ZIfeFoo_I_wBar___", new S__ZIfeFoo_I_wBar___ , 4, "mix"); + // */test("S__ZIfeFoo_I_wBar__f", new S__ZIfeFoo_I_wBar__f , 4, "mix"); + // */test("S__ZIfeFoo_I_wBar_I_", new S__ZIfeFoo_I_wBar_I_ , 4, "mix"); + // */test("S__ZIfeFoo_I_wBar_If", new S__ZIfeFoo_I_wBar_If , 4, "mix"); + // */test("S__ZIfeFoo_I_wBarY__", new S__ZIfeFoo_I_wBarY__ , 4, "mix"); + // */test("S__ZIfeFoo_I_wBarY_f", new S__ZIfeFoo_I_wBarY_f , 4, "mix"); + // */test("S__ZIfeFoo_I_wBarYI_", new S__ZIfeFoo_I_wBarYI_ , 4, "mix"); + // */test("S__ZIfeFoo_I_wBarYIf", new S__ZIfeFoo_I_wBarYIf , 4, "mix"); + // */test("S__ZIfeFoo_If ", new S__ZIfeFoo_If , 3, "mix"); + // */test("S__ZIfeFoo_IfwBar___", new S__ZIfeFoo_IfwBar___ , 4, "mix"); + // */test("S__ZIfeFoo_IfwBar__f", new S__ZIfeFoo_IfwBar__f , 4, "mix"); + // */test("S__ZIfeFoo_IfwBar_I_", new S__ZIfeFoo_IfwBar_I_ , 4, "mix"); + // */test("S__ZIfeFoo_IfwBar_If", new S__ZIfeFoo_IfwBar_If , 4, "mix"); + // */test("S__ZIfeFoo_IfwBarY__", new S__ZIfeFoo_IfwBarY__ , 4, "mix"); + // */test("S__ZIfeFoo_IfwBarY_f", new S__ZIfeFoo_IfwBarY_f , 4, "mix"); + // */test("S__ZIfeFoo_IfwBarYI_", new S__ZIfeFoo_IfwBarYI_ , 4, "mix"); + // */test("S__ZIfeFoo_IfwBarYIf", new S__ZIfeFoo_IfwBarYIf , 4, "mix"); + /* */test("S__ZIfeFooX__ ", new S__ZIfeFooX__ , 3, "mix"); + /* */test("S__ZIfeFooX__wBar___", new S__ZIfeFooX__wBar___ , 4, "mix"); + /* */test("S__ZIfeFooX__wBar__f", new S__ZIfeFooX__wBar__f , 4, "mix"); + // */test("S__ZIfeFooX__wBar_I_", new S__ZIfeFooX__wBar_I_ , 4, "mix"); + // */test("S__ZIfeFooX__wBar_If", new S__ZIfeFooX__wBar_If , 4, "mix"); + /* */test("S__ZIfeFooX__wBarY__", new S__ZIfeFooX__wBarY__ , 4, "mix"); + /* */test("S__ZIfeFooX__wBarY_f", new S__ZIfeFooX__wBarY_f , 4, "mix"); + // */test("S__ZIfeFooX__wBarYI_", new S__ZIfeFooX__wBarYI_ , 4, "mix"); + // */test("S__ZIfeFooX__wBarYIf", new S__ZIfeFooX__wBarYIf , 4, "mix"); + /* */test("S__ZIfeFooX_f ", new S__ZIfeFooX_f , 3, "mix"); + /* */test("S__ZIfeFooX_fwBar___", new S__ZIfeFooX_fwBar___ , 4, "mix"); + /* */test("S__ZIfeFooX_fwBar__f", new S__ZIfeFooX_fwBar__f , 4, "mix"); + // */test("S__ZIfeFooX_fwBar_I_", new S__ZIfeFooX_fwBar_I_ , 4, "mix"); + // */test("S__ZIfeFooX_fwBar_If", new S__ZIfeFooX_fwBar_If , 4, "mix"); + /* */test("S__ZIfeFooX_fwBarY__", new S__ZIfeFooX_fwBarY__ , 4, "mix"); + /* */test("S__ZIfeFooX_fwBarY_f", new S__ZIfeFooX_fwBarY_f , 4, "mix"); + // */test("S__ZIfeFooX_fwBarYI_", new S__ZIfeFooX_fwBarYI_ , 4, "mix"); + // */test("S__ZIfeFooX_fwBarYIf", new S__ZIfeFooX_fwBarYIf , 4, "mix"); + // */test("S__ZIfeFooXI_ ", new S__ZIfeFooXI_ , 3, "mix"); + // */test("S__ZIfeFooXI_wBar___", new S__ZIfeFooXI_wBar___ , 4, "mix"); + // */test("S__ZIfeFooXI_wBar__f", new S__ZIfeFooXI_wBar__f , 4, "mix"); + // */test("S__ZIfeFooXI_wBar_I_", new S__ZIfeFooXI_wBar_I_ , 4, "mix"); + // */test("S__ZIfeFooXI_wBar_If", new S__ZIfeFooXI_wBar_If , 4, "mix"); + // */test("S__ZIfeFooXI_wBarY__", new S__ZIfeFooXI_wBarY__ , 4, "mix"); + // */test("S__ZIfeFooXI_wBarY_f", new S__ZIfeFooXI_wBarY_f , 4, "mix"); + // */test("S__ZIfeFooXI_wBarYI_", new S__ZIfeFooXI_wBarYI_ , 4, "mix"); + // */test("S__ZIfeFooXI_wBarYIf", new S__ZIfeFooXI_wBarYIf , 4, "mix"); + // */test("S__ZIfeFooXIf ", new S__ZIfeFooXIf , 3, "mix"); + // */test("S__ZIfeFooXIfwBar___", new S__ZIfeFooXIfwBar___ , 4, "mix"); + // */test("S__ZIfeFooXIfwBar__f", new S__ZIfeFooXIfwBar__f , 4, "mix"); + // */test("S__ZIfeFooXIfwBar_I_", new S__ZIfeFooXIfwBar_I_ , 4, "mix"); + // */test("S__ZIfeFooXIfwBar_If", new S__ZIfeFooXIfwBar_If , 4, "mix"); + // */test("S__ZIfeFooXIfwBarY__", new S__ZIfeFooXIfwBarY__ , 4, "mix"); + // */test("S__ZIfeFooXIfwBarY_f", new S__ZIfeFooXIfwBarY_f , 4, "mix"); + // */test("S__ZIfeFooXIfwBarYI_", new S__ZIfeFooXIfwBarYI_ , 4, "mix"); + // */test("S__ZIfeFooXIfwBarYIf", new S__ZIfeFooXIfwBarYIf , 4, "mix"); + + + + /* */test("S_____wFoo___ ", new S_____wFoo___ , 3, "sub"); + /* */test("S_____wFoo___wBar___", new S_____wFoo___wBar___ , 4, "sub"); + /* */test("S_____wFoo___wBar__f", new S_____wFoo___wBar__f , 4, "bar"); + /* */test("S_____wFoo___wBar_I_", new S_____wFoo___wBar_I_ , 4, "sub"); + /* */test("S_____wFoo___wBar_If", new S_____wFoo___wBar_If , 4, "bar"); + /* */test("S_____wFoo___wBarY__", new S_____wFoo___wBarY__ , 4, "sub"); + /* */test("S_____wFoo___wBarY_f", new S_____wFoo___wBarY_f , 4, "bar"); + /* */test("S_____wFoo___wBarYI_", new S_____wFoo___wBarYI_ , 4, "sub"); + /* */test("S_____wFoo___wBarYIf", new S_____wFoo___wBarYIf , 4, "bar"); + /* */test("S_____wFoo__f ", new S_____wFoo__f , 3, "foo"); + /* */test("S_____wFoo__fwBar___", new S_____wFoo__fwBar___ , 4, "foo"); + // */test("S_____wFoo__fwBar__f", new S_____wFoo__fwBar__f , 4, "bar"); + /* */test("S_____wFoo__fwBar_I_", new S_____wFoo__fwBar_I_ , 4, "foo"); + // */test("S_____wFoo__fwBar_If", new S_____wFoo__fwBar_If , 4, "bar"); + /* */test("S_____wFoo__fwBarY__", new S_____wFoo__fwBarY__ , 4, "foo"); + // */test("S_____wFoo__fwBarY_f", new S_____wFoo__fwBarY_f , 4, "bar"); + /* */test("S_____wFoo__fwBarYI_", new S_____wFoo__fwBarYI_ , 4, "foo"); + // */test("S_____wFoo__fwBarYIf", new S_____wFoo__fwBarYIf , 4, "bar"); + /* */test("S_____wFoo_I_ ", new S_____wFoo_I_ , 3, "sub"); + /* */test("S_____wFoo_I_wBar___", new S_____wFoo_I_wBar___ , 4, "sub"); + /* */test("S_____wFoo_I_wBar__f", new S_____wFoo_I_wBar__f , 4, "bar"); + // */test("S_____wFoo_I_wBar_I_", new S_____wFoo_I_wBar_I_ , 4, "sub"); + // */test("S_____wFoo_I_wBar_If", new S_____wFoo_I_wBar_If , 4, "bar"); + /* */test("S_____wFoo_I_wBarY__", new S_____wFoo_I_wBarY__ , 4, "sub"); + /* */test("S_____wFoo_I_wBarY_f", new S_____wFoo_I_wBarY_f , 4, "bar"); + // */test("S_____wFoo_I_wBarYI_", new S_____wFoo_I_wBarYI_ , 4, "sub"); + // */test("S_____wFoo_I_wBarYIf", new S_____wFoo_I_wBarYIf , 4, "bar"); + /* */test("S_____wFoo_If ", new S_____wFoo_If , 3, "foo"); + /* */test("S_____wFoo_IfwBar___", new S_____wFoo_IfwBar___ , 4, "foo"); + // */test("S_____wFoo_IfwBar__f", new S_____wFoo_IfwBar__f , 4, "bar"); + // */test("S_____wFoo_IfwBar_I_", new S_____wFoo_IfwBar_I_ , 4, "foo"); + // */test("S_____wFoo_IfwBar_If", new S_____wFoo_IfwBar_If , 4, "bar"); + /* */test("S_____wFoo_IfwBarY__", new S_____wFoo_IfwBarY__ , 4, "foo"); + // */test("S_____wFoo_IfwBarY_f", new S_____wFoo_IfwBarY_f , 4, "bar"); + // */test("S_____wFoo_IfwBarYI_", new S_____wFoo_IfwBarYI_ , 4, "foo"); + // */test("S_____wFoo_IfwBarYIf", new S_____wFoo_IfwBarYIf , 4, "bar"); + /* */test("S_____wFooX__ ", new S_____wFooX__ , 3, "sub"); + /* */test("S_____wFooX__wBar___", new S_____wFooX__wBar___ , 4, "sub"); + /* */test("S_____wFooX__wBar__f", new S_____wFooX__wBar__f , 4, "bar"); + /* */test("S_____wFooX__wBar_I_", new S_____wFooX__wBar_I_ , 4, "sub"); + /* */test("S_____wFooX__wBar_If", new S_____wFooX__wBar_If , 4, "bar"); + /* */test("S_____wFooX__wBarY__", new S_____wFooX__wBarY__ , 4, "sub"); + /* */test("S_____wFooX__wBarY_f", new S_____wFooX__wBarY_f , 4, "bar"); + /* */test("S_____wFooX__wBarYI_", new S_____wFooX__wBarYI_ , 4, "sub"); + /* */test("S_____wFooX__wBarYIf", new S_____wFooX__wBarYIf , 4, "bar"); + /* */test("S_____wFooX_f ", new S_____wFooX_f , 3, "foo"); + /* */test("S_____wFooX_fwBar___", new S_____wFooX_fwBar___ , 4, "foo"); + // */test("S_____wFooX_fwBar__f", new S_____wFooX_fwBar__f , 4, "bar"); + /* */test("S_____wFooX_fwBar_I_", new S_____wFooX_fwBar_I_ , 4, "foo"); + // */test("S_____wFooX_fwBar_If", new S_____wFooX_fwBar_If , 4, "bar"); + /* */test("S_____wFooX_fwBarY__", new S_____wFooX_fwBarY__ , 4, "foo"); + // */test("S_____wFooX_fwBarY_f", new S_____wFooX_fwBarY_f , 4, "bar"); + /* */test("S_____wFooX_fwBarYI_", new S_____wFooX_fwBarYI_ , 4, "foo"); + // */test("S_____wFooX_fwBarYIf", new S_____wFooX_fwBarYIf , 4, "bar"); + /* */test("S_____wFooXI_ ", new S_____wFooXI_ , 3, "sub"); + /* */test("S_____wFooXI_wBar___", new S_____wFooXI_wBar___ , 4, "sub"); + /* */test("S_____wFooXI_wBar__f", new S_____wFooXI_wBar__f , 4, "bar"); + // */test("S_____wFooXI_wBar_I_", new S_____wFooXI_wBar_I_ , 4, "sub"); + // */test("S_____wFooXI_wBar_If", new S_____wFooXI_wBar_If , 4, "bar"); + /* */test("S_____wFooXI_wBarY__", new S_____wFooXI_wBarY__ , 4, "sub"); + /* */test("S_____wFooXI_wBarY_f", new S_____wFooXI_wBarY_f , 4, "bar"); + // */test("S_____wFooXI_wBarYI_", new S_____wFooXI_wBarYI_ , 4, "sub"); + // */test("S_____wFooXI_wBarYIf", new S_____wFooXI_wBarYIf , 4, "bar"); + /* */test("S_____wFooXIf ", new S_____wFooXIf , 3, "foo"); + /* */test("S_____wFooXIfwBar___", new S_____wFooXIfwBar___ , 4, "foo"); + // */test("S_____wFooXIfwBar__f", new S_____wFooXIfwBar__f , 4, "bar"); + // */test("S_____wFooXIfwBar_I_", new S_____wFooXIfwBar_I_ , 4, "foo"); + // */test("S_____wFooXIfwBar_If", new S_____wFooXIfwBar_If , 4, "bar"); + /* */test("S_____wFooXIfwBarY__", new S_____wFooXIfwBarY__ , 4, "foo"); + // */test("S_____wFooXIfwBarY_f", new S_____wFooXIfwBarY_f , 4, "bar"); + // */test("S_____wFooXIfwBarYI_", new S_____wFooXIfwBarYI_ , 4, "foo"); + // */test("S_____wFooXIfwBarYIf", new S_____wFooXIfwBarYIf , 4, "bar"); + + /* */test("S____fwFoo___ ", new S____fwFoo___ , 3, "mix"); + /* */test("S____fwFoo___wBar___", new S____fwFoo___wBar___ , 4, "mix"); + /* */test("S____fwFoo___wBar__f", new S____fwFoo___wBar__f , 4, "mix"); + /* */test("S____fwFoo___wBar_I_", new S____fwFoo___wBar_I_ , 4, "mix"); + /* */test("S____fwFoo___wBar_If", new S____fwFoo___wBar_If , 4, "mix"); + /* */test("S____fwFoo___wBarY__", new S____fwFoo___wBarY__ , 4, "mix"); + /* */test("S____fwFoo___wBarY_f", new S____fwFoo___wBarY_f , 4, "mix"); + /* */test("S____fwFoo___wBarYI_", new S____fwFoo___wBarYI_ , 4, "mix"); + /* */test("S____fwFoo___wBarYIf", new S____fwFoo___wBarYIf , 4, "mix"); + /* */test("S____fwFoo__f ", new S____fwFoo__f , 3, "mix"); + /* */test("S____fwFoo__fwBar___", new S____fwFoo__fwBar___ , 4, "mix"); + /* */test("S____fwFoo__fwBar__f", new S____fwFoo__fwBar__f , 4, "mix"); + /* */test("S____fwFoo__fwBar_I_", new S____fwFoo__fwBar_I_ , 4, "mix"); + /* */test("S____fwFoo__fwBar_If", new S____fwFoo__fwBar_If , 4, "mix"); + /* */test("S____fwFoo__fwBarY__", new S____fwFoo__fwBarY__ , 4, "mix"); + /* */test("S____fwFoo__fwBarY_f", new S____fwFoo__fwBarY_f , 4, "mix"); + /* */test("S____fwFoo__fwBarYI_", new S____fwFoo__fwBarYI_ , 4, "mix"); + /* */test("S____fwFoo__fwBarYIf", new S____fwFoo__fwBarYIf , 4, "mix"); + /* */test("S____fwFoo_I_ ", new S____fwFoo_I_ , 3, "mix"); + /* */test("S____fwFoo_I_wBar___", new S____fwFoo_I_wBar___ , 4, "mix"); + /* */test("S____fwFoo_I_wBar__f", new S____fwFoo_I_wBar__f , 4, "mix"); + // */test("S____fwFoo_I_wBar_I_", new S____fwFoo_I_wBar_I_ , 4, "mix"); + // */test("S____fwFoo_I_wBar_If", new S____fwFoo_I_wBar_If , 4, "mix"); + /* */test("S____fwFoo_I_wBarY__", new S____fwFoo_I_wBarY__ , 4, "mix"); + /* */test("S____fwFoo_I_wBarY_f", new S____fwFoo_I_wBarY_f , 4, "mix"); + // */test("S____fwFoo_I_wBarYI_", new S____fwFoo_I_wBarYI_ , 4, "mix"); + // */test("S____fwFoo_I_wBarYIf", new S____fwFoo_I_wBarYIf , 4, "mix"); + /* */test("S____fwFoo_If ", new S____fwFoo_If , 3, "mix"); + /* */test("S____fwFoo_IfwBar___", new S____fwFoo_IfwBar___ , 4, "mix"); + /* */test("S____fwFoo_IfwBar__f", new S____fwFoo_IfwBar__f , 4, "mix"); + // */test("S____fwFoo_IfwBar_I_", new S____fwFoo_IfwBar_I_ , 4, "mix"); + // */test("S____fwFoo_IfwBar_If", new S____fwFoo_IfwBar_If , 4, "mix"); + /* */test("S____fwFoo_IfwBarY__", new S____fwFoo_IfwBarY__ , 4, "mix"); + /* */test("S____fwFoo_IfwBarY_f", new S____fwFoo_IfwBarY_f , 4, "mix"); + // */test("S____fwFoo_IfwBarYI_", new S____fwFoo_IfwBarYI_ , 4, "mix"); + // */test("S____fwFoo_IfwBarYIf", new S____fwFoo_IfwBarYIf , 4, "mix"); + /* */test("S____fwFooX__ ", new S____fwFooX__ , 3, "mix"); + /* */test("S____fwFooX__wBar___", new S____fwFooX__wBar___ , 4, "mix"); + /* */test("S____fwFooX__wBar__f", new S____fwFooX__wBar__f , 4, "mix"); + /* */test("S____fwFooX__wBar_I_", new S____fwFooX__wBar_I_ , 4, "mix"); + /* */test("S____fwFooX__wBar_If", new S____fwFooX__wBar_If , 4, "mix"); + /* */test("S____fwFooX__wBarY__", new S____fwFooX__wBarY__ , 4, "mix"); + /* */test("S____fwFooX__wBarY_f", new S____fwFooX__wBarY_f , 4, "mix"); + /* */test("S____fwFooX__wBarYI_", new S____fwFooX__wBarYI_ , 4, "mix"); + /* */test("S____fwFooX__wBarYIf", new S____fwFooX__wBarYIf , 4, "mix"); + /* */test("S____fwFooX_f ", new S____fwFooX_f , 3, "mix"); + /* */test("S____fwFooX_fwBar___", new S____fwFooX_fwBar___ , 4, "mix"); + /* */test("S____fwFooX_fwBar__f", new S____fwFooX_fwBar__f , 4, "mix"); + /* */test("S____fwFooX_fwBar_I_", new S____fwFooX_fwBar_I_ , 4, "mix"); + /* */test("S____fwFooX_fwBar_If", new S____fwFooX_fwBar_If , 4, "mix"); + /* */test("S____fwFooX_fwBarY__", new S____fwFooX_fwBarY__ , 4, "mix"); + /* */test("S____fwFooX_fwBarY_f", new S____fwFooX_fwBarY_f , 4, "mix"); + /* */test("S____fwFooX_fwBarYI_", new S____fwFooX_fwBarYI_ , 4, "mix"); + /* */test("S____fwFooX_fwBarYIf", new S____fwFooX_fwBarYIf , 4, "mix"); + /* */test("S____fwFooXI_ ", new S____fwFooXI_ , 3, "mix"); + /* */test("S____fwFooXI_wBar___", new S____fwFooXI_wBar___ , 4, "mix"); + /* */test("S____fwFooXI_wBar__f", new S____fwFooXI_wBar__f , 4, "mix"); + // */test("S____fwFooXI_wBar_I_", new S____fwFooXI_wBar_I_ , 4, "mix"); + // */test("S____fwFooXI_wBar_If", new S____fwFooXI_wBar_If , 4, "mix"); + /* */test("S____fwFooXI_wBarY__", new S____fwFooXI_wBarY__ , 4, "mix"); + /* */test("S____fwFooXI_wBarY_f", new S____fwFooXI_wBarY_f , 4, "mix"); + // */test("S____fwFooXI_wBarYI_", new S____fwFooXI_wBarYI_ , 4, "mix"); + // */test("S____fwFooXI_wBarYIf", new S____fwFooXI_wBarYIf , 4, "mix"); + /* */test("S____fwFooXIf ", new S____fwFooXIf , 3, "mix"); + /* */test("S____fwFooXIfwBar___", new S____fwFooXIfwBar___ , 4, "mix"); + /* */test("S____fwFooXIfwBar__f", new S____fwFooXIfwBar__f , 4, "mix"); + // */test("S____fwFooXIfwBar_I_", new S____fwFooXIfwBar_I_ , 4, "mix"); + // */test("S____fwFooXIfwBar_If", new S____fwFooXIfwBar_If , 4, "mix"); + /* */test("S____fwFooXIfwBarY__", new S____fwFooXIfwBarY__ , 4, "mix"); + /* */test("S____fwFooXIfwBarY_f", new S____fwFooXIfwBarY_f , 4, "mix"); + // */test("S____fwFooXIfwBarYI_", new S____fwFooXIfwBarYI_ , 4, "mix"); + // */test("S____fwFooXIfwBarYIf", new S____fwFooXIfwBarYIf , 4, "mix"); + + /* */test("S___I_wFoo___ ", new S___I_wFoo___ , 3, "sub"); + /* */test("S___I_wFoo___wBar___", new S___I_wFoo___wBar___ , 4, "sub"); + /* */test("S___I_wFoo___wBar__f", new S___I_wFoo___wBar__f , 4, "bar"); + // */test("S___I_wFoo___wBar_I_", new S___I_wFoo___wBar_I_ , 4, "sub"); + // */test("S___I_wFoo___wBar_If", new S___I_wFoo___wBar_If , 4, "bar"); + /* */test("S___I_wFoo___wBarY__", new S___I_wFoo___wBarY__ , 4, "sub"); + /* */test("S___I_wFoo___wBarY_f", new S___I_wFoo___wBarY_f , 4, "bar"); + // */test("S___I_wFoo___wBarYI_", new S___I_wFoo___wBarYI_ , 4, "sub"); + // */test("S___I_wFoo___wBarYIf", new S___I_wFoo___wBarYIf , 4, "bar"); + /* */test("S___I_wFoo__f ", new S___I_wFoo__f , 3, "foo"); + /* */test("S___I_wFoo__fwBar___", new S___I_wFoo__fwBar___ , 4, "foo"); + // */test("S___I_wFoo__fwBar__f", new S___I_wFoo__fwBar__f , 4, "bar"); + // */test("S___I_wFoo__fwBar_I_", new S___I_wFoo__fwBar_I_ , 4, "foo"); + // */test("S___I_wFoo__fwBar_If", new S___I_wFoo__fwBar_If , 4, "bar"); + /* */test("S___I_wFoo__fwBarY__", new S___I_wFoo__fwBarY__ , 4, "foo"); + // */test("S___I_wFoo__fwBarY_f", new S___I_wFoo__fwBarY_f , 4, "bar"); + // */test("S___I_wFoo__fwBarYI_", new S___I_wFoo__fwBarYI_ , 4, "foo"); + // */test("S___I_wFoo__fwBarYIf", new S___I_wFoo__fwBarYIf , 4, "bar"); + // */test("S___I_wFoo_I_ ", new S___I_wFoo_I_ , 3, "sub"); + // */test("S___I_wFoo_I_wBar___", new S___I_wFoo_I_wBar___ , 4, "sub"); + // */test("S___I_wFoo_I_wBar__f", new S___I_wFoo_I_wBar__f , 4, "bar"); + // */test("S___I_wFoo_I_wBar_I_", new S___I_wFoo_I_wBar_I_ , 4, "sub"); + // */test("S___I_wFoo_I_wBar_If", new S___I_wFoo_I_wBar_If , 4, "bar"); + // */test("S___I_wFoo_I_wBarY__", new S___I_wFoo_I_wBarY__ , 4, "sub"); + // */test("S___I_wFoo_I_wBarY_f", new S___I_wFoo_I_wBarY_f , 4, "bar"); + // */test("S___I_wFoo_I_wBarYI_", new S___I_wFoo_I_wBarYI_ , 4, "sub"); + // */test("S___I_wFoo_I_wBarYIf", new S___I_wFoo_I_wBarYIf , 4, "bar"); + // */test("S___I_wFoo_If ", new S___I_wFoo_If , 3, "foo"); + // */test("S___I_wFoo_IfwBar___", new S___I_wFoo_IfwBar___ , 4, "foo"); + // */test("S___I_wFoo_IfwBar__f", new S___I_wFoo_IfwBar__f , 4, "bar"); + // */test("S___I_wFoo_IfwBar_I_", new S___I_wFoo_IfwBar_I_ , 4, "foo"); + // */test("S___I_wFoo_IfwBar_If", new S___I_wFoo_IfwBar_If , 4, "bar"); + // */test("S___I_wFoo_IfwBarY__", new S___I_wFoo_IfwBarY__ , 4, "foo"); + // */test("S___I_wFoo_IfwBarY_f", new S___I_wFoo_IfwBarY_f , 4, "bar"); + // */test("S___I_wFoo_IfwBarYI_", new S___I_wFoo_IfwBarYI_ , 4, "foo"); + // */test("S___I_wFoo_IfwBarYIf", new S___I_wFoo_IfwBarYIf , 4, "bar"); + /* */test("S___I_wFooX__ ", new S___I_wFooX__ , 3, "sub"); + /* */test("S___I_wFooX__wBar___", new S___I_wFooX__wBar___ , 4, "sub"); + /* */test("S___I_wFooX__wBar__f", new S___I_wFooX__wBar__f , 4, "bar"); + // */test("S___I_wFooX__wBar_I_", new S___I_wFooX__wBar_I_ , 4, "sub"); + // */test("S___I_wFooX__wBar_If", new S___I_wFooX__wBar_If , 4, "bar"); + /* */test("S___I_wFooX__wBarY__", new S___I_wFooX__wBarY__ , 4, "sub"); + /* */test("S___I_wFooX__wBarY_f", new S___I_wFooX__wBarY_f , 4, "bar"); + // */test("S___I_wFooX__wBarYI_", new S___I_wFooX__wBarYI_ , 4, "sub"); + // */test("S___I_wFooX__wBarYIf", new S___I_wFooX__wBarYIf , 4, "bar"); + /* */test("S___I_wFooX_f ", new S___I_wFooX_f , 3, "foo"); + /* */test("S___I_wFooX_fwBar___", new S___I_wFooX_fwBar___ , 4, "foo"); + // */test("S___I_wFooX_fwBar__f", new S___I_wFooX_fwBar__f , 4, "bar"); + // */test("S___I_wFooX_fwBar_I_", new S___I_wFooX_fwBar_I_ , 4, "foo"); + // */test("S___I_wFooX_fwBar_If", new S___I_wFooX_fwBar_If , 4, "bar"); + /* */test("S___I_wFooX_fwBarY__", new S___I_wFooX_fwBarY__ , 4, "foo"); + // */test("S___I_wFooX_fwBarY_f", new S___I_wFooX_fwBarY_f , 4, "bar"); + // */test("S___I_wFooX_fwBarYI_", new S___I_wFooX_fwBarYI_ , 4, "foo"); + // */test("S___I_wFooX_fwBarYIf", new S___I_wFooX_fwBarYIf , 4, "bar"); + // */test("S___I_wFooXI_ ", new S___I_wFooXI_ , 3, "sub"); + // */test("S___I_wFooXI_wBar___", new S___I_wFooXI_wBar___ , 4, "sub"); + // */test("S___I_wFooXI_wBar__f", new S___I_wFooXI_wBar__f , 4, "bar"); + // */test("S___I_wFooXI_wBar_I_", new S___I_wFooXI_wBar_I_ , 4, "sub"); + // */test("S___I_wFooXI_wBar_If", new S___I_wFooXI_wBar_If , 4, "bar"); + // */test("S___I_wFooXI_wBarY__", new S___I_wFooXI_wBarY__ , 4, "sub"); + // */test("S___I_wFooXI_wBarY_f", new S___I_wFooXI_wBarY_f , 4, "bar"); + // */test("S___I_wFooXI_wBarYI_", new S___I_wFooXI_wBarYI_ , 4, "sub"); + // */test("S___I_wFooXI_wBarYIf", new S___I_wFooXI_wBarYIf , 4, "bar"); + // */test("S___I_wFooXIf ", new S___I_wFooXIf , 3, "foo"); + // */test("S___I_wFooXIfwBar___", new S___I_wFooXIfwBar___ , 4, "foo"); + // */test("S___I_wFooXIfwBar__f", new S___I_wFooXIfwBar__f , 4, "bar"); + // */test("S___I_wFooXIfwBar_I_", new S___I_wFooXIfwBar_I_ , 4, "foo"); + // */test("S___I_wFooXIfwBar_If", new S___I_wFooXIfwBar_If , 4, "bar"); + // */test("S___I_wFooXIfwBarY__", new S___I_wFooXIfwBarY__ , 4, "foo"); + // */test("S___I_wFooXIfwBarY_f", new S___I_wFooXIfwBarY_f , 4, "bar"); + // */test("S___I_wFooXIfwBarYI_", new S___I_wFooXIfwBarYI_ , 4, "foo"); + // */test("S___I_wFooXIfwBarYIf", new S___I_wFooXIfwBarYIf , 4, "bar"); + + /* */test("S___IfwFoo___ ", new S___IfwFoo___ , 3, "mix"); + /* */test("S___IfwFoo___wBar___", new S___IfwFoo___wBar___ , 4, "mix"); + /* */test("S___IfwFoo___wBar__f", new S___IfwFoo___wBar__f , 4, "mix"); + // */test("S___IfwFoo___wBar_I_", new S___IfwFoo___wBar_I_ , 4, "mix"); + // */test("S___IfwFoo___wBar_If", new S___IfwFoo___wBar_If , 4, "mix"); + /* */test("S___IfwFoo___wBarY__", new S___IfwFoo___wBarY__ , 4, "mix"); + /* */test("S___IfwFoo___wBarY_f", new S___IfwFoo___wBarY_f , 4, "mix"); + // */test("S___IfwFoo___wBarYI_", new S___IfwFoo___wBarYI_ , 4, "mix"); + // */test("S___IfwFoo___wBarYIf", new S___IfwFoo___wBarYIf , 4, "mix"); + /* */test("S___IfwFoo__f ", new S___IfwFoo__f , 3, "mix"); + /* */test("S___IfwFoo__fwBar___", new S___IfwFoo__fwBar___ , 4, "mix"); + /* */test("S___IfwFoo__fwBar__f", new S___IfwFoo__fwBar__f , 4, "mix"); + // */test("S___IfwFoo__fwBar_I_", new S___IfwFoo__fwBar_I_ , 4, "mix"); + // */test("S___IfwFoo__fwBar_If", new S___IfwFoo__fwBar_If , 4, "mix"); + /* */test("S___IfwFoo__fwBarY__", new S___IfwFoo__fwBarY__ , 4, "mix"); + /* */test("S___IfwFoo__fwBarY_f", new S___IfwFoo__fwBarY_f , 4, "mix"); + // */test("S___IfwFoo__fwBarYI_", new S___IfwFoo__fwBarYI_ , 4, "mix"); + // */test("S___IfwFoo__fwBarYIf", new S___IfwFoo__fwBarYIf , 4, "mix"); + // */test("S___IfwFoo_I_ ", new S___IfwFoo_I_ , 3, "mix"); + // */test("S___IfwFoo_I_wBar___", new S___IfwFoo_I_wBar___ , 4, "mix"); + // */test("S___IfwFoo_I_wBar__f", new S___IfwFoo_I_wBar__f , 4, "mix"); + // */test("S___IfwFoo_I_wBar_I_", new S___IfwFoo_I_wBar_I_ , 4, "mix"); + // */test("S___IfwFoo_I_wBar_If", new S___IfwFoo_I_wBar_If , 4, "mix"); + // */test("S___IfwFoo_I_wBarY__", new S___IfwFoo_I_wBarY__ , 4, "mix"); + // */test("S___IfwFoo_I_wBarY_f", new S___IfwFoo_I_wBarY_f , 4, "mix"); + // */test("S___IfwFoo_I_wBarYI_", new S___IfwFoo_I_wBarYI_ , 4, "mix"); + // */test("S___IfwFoo_I_wBarYIf", new S___IfwFoo_I_wBarYIf , 4, "mix"); + // */test("S___IfwFoo_If ", new S___IfwFoo_If , 3, "mix"); + // */test("S___IfwFoo_IfwBar___", new S___IfwFoo_IfwBar___ , 4, "mix"); + // */test("S___IfwFoo_IfwBar__f", new S___IfwFoo_IfwBar__f , 4, "mix"); + // */test("S___IfwFoo_IfwBar_I_", new S___IfwFoo_IfwBar_I_ , 4, "mix"); + // */test("S___IfwFoo_IfwBar_If", new S___IfwFoo_IfwBar_If , 4, "mix"); + // */test("S___IfwFoo_IfwBarY__", new S___IfwFoo_IfwBarY__ , 4, "mix"); + // */test("S___IfwFoo_IfwBarY_f", new S___IfwFoo_IfwBarY_f , 4, "mix"); + // */test("S___IfwFoo_IfwBarYI_", new S___IfwFoo_IfwBarYI_ , 4, "mix"); + // */test("S___IfwFoo_IfwBarYIf", new S___IfwFoo_IfwBarYIf , 4, "mix"); + /* */test("S___IfwFooX__ ", new S___IfwFooX__ , 3, "mix"); + /* */test("S___IfwFooX__wBar___", new S___IfwFooX__wBar___ , 4, "mix"); + /* */test("S___IfwFooX__wBar__f", new S___IfwFooX__wBar__f , 4, "mix"); + // */test("S___IfwFooX__wBar_I_", new S___IfwFooX__wBar_I_ , 4, "mix"); + // */test("S___IfwFooX__wBar_If", new S___IfwFooX__wBar_If , 4, "mix"); + /* */test("S___IfwFooX__wBarY__", new S___IfwFooX__wBarY__ , 4, "mix"); + /* */test("S___IfwFooX__wBarY_f", new S___IfwFooX__wBarY_f , 4, "mix"); + // */test("S___IfwFooX__wBarYI_", new S___IfwFooX__wBarYI_ , 4, "mix"); + // */test("S___IfwFooX__wBarYIf", new S___IfwFooX__wBarYIf , 4, "mix"); + /* */test("S___IfwFooX_f ", new S___IfwFooX_f , 3, "mix"); + /* */test("S___IfwFooX_fwBar___", new S___IfwFooX_fwBar___ , 4, "mix"); + /* */test("S___IfwFooX_fwBar__f", new S___IfwFooX_fwBar__f , 4, "mix"); + // */test("S___IfwFooX_fwBar_I_", new S___IfwFooX_fwBar_I_ , 4, "mix"); + // */test("S___IfwFooX_fwBar_If", new S___IfwFooX_fwBar_If , 4, "mix"); + /* */test("S___IfwFooX_fwBarY__", new S___IfwFooX_fwBarY__ , 4, "mix"); + /* */test("S___IfwFooX_fwBarY_f", new S___IfwFooX_fwBarY_f , 4, "mix"); + // */test("S___IfwFooX_fwBarYI_", new S___IfwFooX_fwBarYI_ , 4, "mix"); + // */test("S___IfwFooX_fwBarYIf", new S___IfwFooX_fwBarYIf , 4, "mix"); + // */test("S___IfwFooXI_ ", new S___IfwFooXI_ , 3, "mix"); + // */test("S___IfwFooXI_wBar___", new S___IfwFooXI_wBar___ , 4, "mix"); + // */test("S___IfwFooXI_wBar__f", new S___IfwFooXI_wBar__f , 4, "mix"); + // */test("S___IfwFooXI_wBar_I_", new S___IfwFooXI_wBar_I_ , 4, "mix"); + // */test("S___IfwFooXI_wBar_If", new S___IfwFooXI_wBar_If , 4, "mix"); + // */test("S___IfwFooXI_wBarY__", new S___IfwFooXI_wBarY__ , 4, "mix"); + // */test("S___IfwFooXI_wBarY_f", new S___IfwFooXI_wBarY_f , 4, "mix"); + // */test("S___IfwFooXI_wBarYI_", new S___IfwFooXI_wBarYI_ , 4, "mix"); + // */test("S___IfwFooXI_wBarYIf", new S___IfwFooXI_wBarYIf , 4, "mix"); + // */test("S___IfwFooXIf ", new S___IfwFooXIf , 3, "mix"); + // */test("S___IfwFooXIfwBar___", new S___IfwFooXIfwBar___ , 4, "mix"); + // */test("S___IfwFooXIfwBar__f", new S___IfwFooXIfwBar__f , 4, "mix"); + // */test("S___IfwFooXIfwBar_I_", new S___IfwFooXIfwBar_I_ , 4, "mix"); + // */test("S___IfwFooXIfwBar_If", new S___IfwFooXIfwBar_If , 4, "mix"); + // */test("S___IfwFooXIfwBarY__", new S___IfwFooXIfwBarY__ , 4, "mix"); + // */test("S___IfwFooXIfwBarY_f", new S___IfwFooXIfwBarY_f , 4, "mix"); + // */test("S___IfwFooXIfwBarYI_", new S___IfwFooXIfwBarYI_ , 4, "mix"); + // */test("S___IfwFooXIfwBarYIf", new S___IfwFooXIfwBarYIf , 4, "mix"); + + /* */test("S__Z__wFoo___ ", new S__Z__wFoo___ , 3, "sub"); + /* */test("S__Z__wFoo___wBar___", new S__Z__wFoo___wBar___ , 4, "sub"); + /* */test("S__Z__wFoo___wBar__f", new S__Z__wFoo___wBar__f , 4, "bar"); + /* */test("S__Z__wFoo___wBar_I_", new S__Z__wFoo___wBar_I_ , 4, "sub"); + /* */test("S__Z__wFoo___wBar_If", new S__Z__wFoo___wBar_If , 4, "bar"); + /* */test("S__Z__wFoo___wBarY__", new S__Z__wFoo___wBarY__ , 4, "sub"); + /* */test("S__Z__wFoo___wBarY_f", new S__Z__wFoo___wBarY_f , 4, "bar"); + /* */test("S__Z__wFoo___wBarYI_", new S__Z__wFoo___wBarYI_ , 4, "sub"); + /* */test("S__Z__wFoo___wBarYIf", new S__Z__wFoo___wBarYIf , 4, "bar"); + /* */test("S__Z__wFoo__f ", new S__Z__wFoo__f , 3, "foo"); + /* */test("S__Z__wFoo__fwBar___", new S__Z__wFoo__fwBar___ , 4, "foo"); + // */test("S__Z__wFoo__fwBar__f", new S__Z__wFoo__fwBar__f , 4, "bar"); + /* */test("S__Z__wFoo__fwBar_I_", new S__Z__wFoo__fwBar_I_ , 4, "foo"); + // */test("S__Z__wFoo__fwBar_If", new S__Z__wFoo__fwBar_If , 4, "bar"); + /* */test("S__Z__wFoo__fwBarY__", new S__Z__wFoo__fwBarY__ , 4, "foo"); + // */test("S__Z__wFoo__fwBarY_f", new S__Z__wFoo__fwBarY_f , 4, "bar"); + /* */test("S__Z__wFoo__fwBarYI_", new S__Z__wFoo__fwBarYI_ , 4, "foo"); + // */test("S__Z__wFoo__fwBarYIf", new S__Z__wFoo__fwBarYIf , 4, "bar"); + /* */test("S__Z__wFoo_I_ ", new S__Z__wFoo_I_ , 3, "sub"); + /* */test("S__Z__wFoo_I_wBar___", new S__Z__wFoo_I_wBar___ , 4, "sub"); + /* */test("S__Z__wFoo_I_wBar__f", new S__Z__wFoo_I_wBar__f , 4, "bar"); + // */test("S__Z__wFoo_I_wBar_I_", new S__Z__wFoo_I_wBar_I_ , 4, "sub"); + // */test("S__Z__wFoo_I_wBar_If", new S__Z__wFoo_I_wBar_If , 4, "bar"); + /* */test("S__Z__wFoo_I_wBarY__", new S__Z__wFoo_I_wBarY__ , 4, "sub"); + /* */test("S__Z__wFoo_I_wBarY_f", new S__Z__wFoo_I_wBarY_f , 4, "bar"); + // */test("S__Z__wFoo_I_wBarYI_", new S__Z__wFoo_I_wBarYI_ , 4, "sub"); + // */test("S__Z__wFoo_I_wBarYIf", new S__Z__wFoo_I_wBarYIf , 4, "bar"); + /* */test("S__Z__wFoo_If ", new S__Z__wFoo_If , 3, "foo"); + /* */test("S__Z__wFoo_IfwBar___", new S__Z__wFoo_IfwBar___ , 4, "foo"); + // */test("S__Z__wFoo_IfwBar__f", new S__Z__wFoo_IfwBar__f , 4, "bar"); + // */test("S__Z__wFoo_IfwBar_I_", new S__Z__wFoo_IfwBar_I_ , 4, "foo"); + // */test("S__Z__wFoo_IfwBar_If", new S__Z__wFoo_IfwBar_If , 4, "bar"); + /* */test("S__Z__wFoo_IfwBarY__", new S__Z__wFoo_IfwBarY__ , 4, "foo"); + // */test("S__Z__wFoo_IfwBarY_f", new S__Z__wFoo_IfwBarY_f , 4, "bar"); + // */test("S__Z__wFoo_IfwBarYI_", new S__Z__wFoo_IfwBarYI_ , 4, "foo"); + // */test("S__Z__wFoo_IfwBarYIf", new S__Z__wFoo_IfwBarYIf , 4, "bar"); + /* */test("S__Z__wFooX__ ", new S__Z__wFooX__ , 3, "sub"); + /* */test("S__Z__wFooX__wBar___", new S__Z__wFooX__wBar___ , 4, "sub"); + /* */test("S__Z__wFooX__wBar__f", new S__Z__wFooX__wBar__f , 4, "bar"); + /* */test("S__Z__wFooX__wBar_I_", new S__Z__wFooX__wBar_I_ , 4, "sub"); + /* */test("S__Z__wFooX__wBar_If", new S__Z__wFooX__wBar_If , 4, "bar"); + /* */test("S__Z__wFooX__wBarY__", new S__Z__wFooX__wBarY__ , 4, "sub"); + /* */test("S__Z__wFooX__wBarY_f", new S__Z__wFooX__wBarY_f , 4, "bar"); + /* */test("S__Z__wFooX__wBarYI_", new S__Z__wFooX__wBarYI_ , 4, "sub"); + /* */test("S__Z__wFooX__wBarYIf", new S__Z__wFooX__wBarYIf , 4, "bar"); + /* */test("S__Z__wFooX_f ", new S__Z__wFooX_f , 3, "foo"); + /* */test("S__Z__wFooX_fwBar___", new S__Z__wFooX_fwBar___ , 4, "foo"); + // */test("S__Z__wFooX_fwBar__f", new S__Z__wFooX_fwBar__f , 4, "bar"); + /* */test("S__Z__wFooX_fwBar_I_", new S__Z__wFooX_fwBar_I_ , 4, "foo"); + // */test("S__Z__wFooX_fwBar_If", new S__Z__wFooX_fwBar_If , 4, "bar"); + /* */test("S__Z__wFooX_fwBarY__", new S__Z__wFooX_fwBarY__ , 4, "foo"); + // */test("S__Z__wFooX_fwBarY_f", new S__Z__wFooX_fwBarY_f , 4, "bar"); + /* */test("S__Z__wFooX_fwBarYI_", new S__Z__wFooX_fwBarYI_ , 4, "foo"); + // */test("S__Z__wFooX_fwBarYIf", new S__Z__wFooX_fwBarYIf , 4, "bar"); + /* */test("S__Z__wFooXI_ ", new S__Z__wFooXI_ , 3, "sub"); + /* */test("S__Z__wFooXI_wBar___", new S__Z__wFooXI_wBar___ , 4, "sub"); + /* */test("S__Z__wFooXI_wBar__f", new S__Z__wFooXI_wBar__f , 4, "bar"); + // */test("S__Z__wFooXI_wBar_I_", new S__Z__wFooXI_wBar_I_ , 4, "sub"); + // */test("S__Z__wFooXI_wBar_If", new S__Z__wFooXI_wBar_If , 4, "bar"); + /* */test("S__Z__wFooXI_wBarY__", new S__Z__wFooXI_wBarY__ , 4, "sub"); + /* */test("S__Z__wFooXI_wBarY_f", new S__Z__wFooXI_wBarY_f , 4, "bar"); + // */test("S__Z__wFooXI_wBarYI_", new S__Z__wFooXI_wBarYI_ , 4, "sub"); + // */test("S__Z__wFooXI_wBarYIf", new S__Z__wFooXI_wBarYIf , 4, "bar"); + /* */test("S__Z__wFooXIf ", new S__Z__wFooXIf , 3, "foo"); + /* */test("S__Z__wFooXIfwBar___", new S__Z__wFooXIfwBar___ , 4, "foo"); + // */test("S__Z__wFooXIfwBar__f", new S__Z__wFooXIfwBar__f , 4, "bar"); + // */test("S__Z__wFooXIfwBar_I_", new S__Z__wFooXIfwBar_I_ , 4, "foo"); + // */test("S__Z__wFooXIfwBar_If", new S__Z__wFooXIfwBar_If , 4, "bar"); + /* */test("S__Z__wFooXIfwBarY__", new S__Z__wFooXIfwBarY__ , 4, "foo"); + // */test("S__Z__wFooXIfwBarY_f", new S__Z__wFooXIfwBarY_f , 4, "bar"); + // */test("S__Z__wFooXIfwBarYI_", new S__Z__wFooXIfwBarYI_ , 4, "foo"); + // */test("S__Z__wFooXIfwBarYIf", new S__Z__wFooXIfwBarYIf , 4, "bar"); + + /* */test("S__Z_fwFoo___ ", new S__Z_fwFoo___ , 3, "mix"); + /* */test("S__Z_fwFoo___wBar___", new S__Z_fwFoo___wBar___ , 4, "mix"); + /* */test("S__Z_fwFoo___wBar__f", new S__Z_fwFoo___wBar__f , 4, "mix"); + /* */test("S__Z_fwFoo___wBar_I_", new S__Z_fwFoo___wBar_I_ , 4, "mix"); + /* */test("S__Z_fwFoo___wBar_If", new S__Z_fwFoo___wBar_If , 4, "mix"); + /* */test("S__Z_fwFoo___wBarY__", new S__Z_fwFoo___wBarY__ , 4, "mix"); + /* */test("S__Z_fwFoo___wBarY_f", new S__Z_fwFoo___wBarY_f , 4, "mix"); + /* */test("S__Z_fwFoo___wBarYI_", new S__Z_fwFoo___wBarYI_ , 4, "mix"); + /* */test("S__Z_fwFoo___wBarYIf", new S__Z_fwFoo___wBarYIf , 4, "mix"); + /* */test("S__Z_fwFoo__f ", new S__Z_fwFoo__f , 3, "mix"); + /* */test("S__Z_fwFoo__fwBar___", new S__Z_fwFoo__fwBar___ , 4, "mix"); + /* */test("S__Z_fwFoo__fwBar__f", new S__Z_fwFoo__fwBar__f , 4, "mix"); + /* */test("S__Z_fwFoo__fwBar_I_", new S__Z_fwFoo__fwBar_I_ , 4, "mix"); + /* */test("S__Z_fwFoo__fwBar_If", new S__Z_fwFoo__fwBar_If , 4, "mix"); + /* */test("S__Z_fwFoo__fwBarY__", new S__Z_fwFoo__fwBarY__ , 4, "mix"); + /* */test("S__Z_fwFoo__fwBarY_f", new S__Z_fwFoo__fwBarY_f , 4, "mix"); + /* */test("S__Z_fwFoo__fwBarYI_", new S__Z_fwFoo__fwBarYI_ , 4, "mix"); + /* */test("S__Z_fwFoo__fwBarYIf", new S__Z_fwFoo__fwBarYIf , 4, "mix"); + /* */test("S__Z_fwFoo_I_ ", new S__Z_fwFoo_I_ , 3, "mix"); + /* */test("S__Z_fwFoo_I_wBar___", new S__Z_fwFoo_I_wBar___ , 4, "mix"); + /* */test("S__Z_fwFoo_I_wBar__f", new S__Z_fwFoo_I_wBar__f , 4, "mix"); + // */test("S__Z_fwFoo_I_wBar_I_", new S__Z_fwFoo_I_wBar_I_ , 4, "mix"); + // */test("S__Z_fwFoo_I_wBar_If", new S__Z_fwFoo_I_wBar_If , 4, "mix"); + /* */test("S__Z_fwFoo_I_wBarY__", new S__Z_fwFoo_I_wBarY__ , 4, "mix"); + /* */test("S__Z_fwFoo_I_wBarY_f", new S__Z_fwFoo_I_wBarY_f , 4, "mix"); + // */test("S__Z_fwFoo_I_wBarYI_", new S__Z_fwFoo_I_wBarYI_ , 4, "mix"); + // */test("S__Z_fwFoo_I_wBarYIf", new S__Z_fwFoo_I_wBarYIf , 4, "mix"); + /* */test("S__Z_fwFoo_If ", new S__Z_fwFoo_If , 3, "mix"); + /* */test("S__Z_fwFoo_IfwBar___", new S__Z_fwFoo_IfwBar___ , 4, "mix"); + /* */test("S__Z_fwFoo_IfwBar__f", new S__Z_fwFoo_IfwBar__f , 4, "mix"); + // */test("S__Z_fwFoo_IfwBar_I_", new S__Z_fwFoo_IfwBar_I_ , 4, "mix"); + // */test("S__Z_fwFoo_IfwBar_If", new S__Z_fwFoo_IfwBar_If , 4, "mix"); + /* */test("S__Z_fwFoo_IfwBarY__", new S__Z_fwFoo_IfwBarY__ , 4, "mix"); + /* */test("S__Z_fwFoo_IfwBarY_f", new S__Z_fwFoo_IfwBarY_f , 4, "mix"); + // */test("S__Z_fwFoo_IfwBarYI_", new S__Z_fwFoo_IfwBarYI_ , 4, "mix"); + // */test("S__Z_fwFoo_IfwBarYIf", new S__Z_fwFoo_IfwBarYIf , 4, "mix"); + /* */test("S__Z_fwFooX__ ", new S__Z_fwFooX__ , 3, "mix"); + /* */test("S__Z_fwFooX__wBar___", new S__Z_fwFooX__wBar___ , 4, "mix"); + /* */test("S__Z_fwFooX__wBar__f", new S__Z_fwFooX__wBar__f , 4, "mix"); + /* */test("S__Z_fwFooX__wBar_I_", new S__Z_fwFooX__wBar_I_ , 4, "mix"); + /* */test("S__Z_fwFooX__wBar_If", new S__Z_fwFooX__wBar_If , 4, "mix"); + /* */test("S__Z_fwFooX__wBarY__", new S__Z_fwFooX__wBarY__ , 4, "mix"); + /* */test("S__Z_fwFooX__wBarY_f", new S__Z_fwFooX__wBarY_f , 4, "mix"); + /* */test("S__Z_fwFooX__wBarYI_", new S__Z_fwFooX__wBarYI_ , 4, "mix"); + /* */test("S__Z_fwFooX__wBarYIf", new S__Z_fwFooX__wBarYIf , 4, "mix"); + /* */test("S__Z_fwFooX_f ", new S__Z_fwFooX_f , 3, "mix"); + /* */test("S__Z_fwFooX_fwBar___", new S__Z_fwFooX_fwBar___ , 4, "mix"); + /* */test("S__Z_fwFooX_fwBar__f", new S__Z_fwFooX_fwBar__f , 4, "mix"); + /* */test("S__Z_fwFooX_fwBar_I_", new S__Z_fwFooX_fwBar_I_ , 4, "mix"); + /* */test("S__Z_fwFooX_fwBar_If", new S__Z_fwFooX_fwBar_If , 4, "mix"); + /* */test("S__Z_fwFooX_fwBarY__", new S__Z_fwFooX_fwBarY__ , 4, "mix"); + /* */test("S__Z_fwFooX_fwBarY_f", new S__Z_fwFooX_fwBarY_f , 4, "mix"); + /* */test("S__Z_fwFooX_fwBarYI_", new S__Z_fwFooX_fwBarYI_ , 4, "mix"); + /* */test("S__Z_fwFooX_fwBarYIf", new S__Z_fwFooX_fwBarYIf , 4, "mix"); + /* */test("S__Z_fwFooXI_ ", new S__Z_fwFooXI_ , 3, "mix"); + /* */test("S__Z_fwFooXI_wBar___", new S__Z_fwFooXI_wBar___ , 4, "mix"); + /* */test("S__Z_fwFooXI_wBar__f", new S__Z_fwFooXI_wBar__f , 4, "mix"); + // */test("S__Z_fwFooXI_wBar_I_", new S__Z_fwFooXI_wBar_I_ , 4, "mix"); + // */test("S__Z_fwFooXI_wBar_If", new S__Z_fwFooXI_wBar_If , 4, "mix"); + /* */test("S__Z_fwFooXI_wBarY__", new S__Z_fwFooXI_wBarY__ , 4, "mix"); + /* */test("S__Z_fwFooXI_wBarY_f", new S__Z_fwFooXI_wBarY_f , 4, "mix"); + // */test("S__Z_fwFooXI_wBarYI_", new S__Z_fwFooXI_wBarYI_ , 4, "mix"); + // */test("S__Z_fwFooXI_wBarYIf", new S__Z_fwFooXI_wBarYIf , 4, "mix"); + /* */test("S__Z_fwFooXIf ", new S__Z_fwFooXIf , 3, "mix"); + /* */test("S__Z_fwFooXIfwBar___", new S__Z_fwFooXIfwBar___ , 4, "mix"); + /* */test("S__Z_fwFooXIfwBar__f", new S__Z_fwFooXIfwBar__f , 4, "mix"); + // */test("S__Z_fwFooXIfwBar_I_", new S__Z_fwFooXIfwBar_I_ , 4, "mix"); + // */test("S__Z_fwFooXIfwBar_If", new S__Z_fwFooXIfwBar_If , 4, "mix"); + /* */test("S__Z_fwFooXIfwBarY__", new S__Z_fwFooXIfwBarY__ , 4, "mix"); + /* */test("S__Z_fwFooXIfwBarY_f", new S__Z_fwFooXIfwBarY_f , 4, "mix"); + // */test("S__Z_fwFooXIfwBarYI_", new S__Z_fwFooXIfwBarYI_ , 4, "mix"); + // */test("S__Z_fwFooXIfwBarYIf", new S__Z_fwFooXIfwBarYIf , 4, "mix"); + + /* */test("S__ZI_wFoo___ ", new S__ZI_wFoo___ , 3, "sub"); + /* */test("S__ZI_wFoo___wBar___", new S__ZI_wFoo___wBar___ , 4, "sub"); + /* */test("S__ZI_wFoo___wBar__f", new S__ZI_wFoo___wBar__f , 4, "bar"); + // */test("S__ZI_wFoo___wBar_I_", new S__ZI_wFoo___wBar_I_ , 4, "sub"); + // */test("S__ZI_wFoo___wBar_If", new S__ZI_wFoo___wBar_If , 4, "bar"); + /* */test("S__ZI_wFoo___wBarY__", new S__ZI_wFoo___wBarY__ , 4, "sub"); + /* */test("S__ZI_wFoo___wBarY_f", new S__ZI_wFoo___wBarY_f , 4, "bar"); + // */test("S__ZI_wFoo___wBarYI_", new S__ZI_wFoo___wBarYI_ , 4, "sub"); + // */test("S__ZI_wFoo___wBarYIf", new S__ZI_wFoo___wBarYIf , 4, "bar"); + /* */test("S__ZI_wFoo__f ", new S__ZI_wFoo__f , 3, "foo"); + /* */test("S__ZI_wFoo__fwBar___", new S__ZI_wFoo__fwBar___ , 4, "foo"); + // */test("S__ZI_wFoo__fwBar__f", new S__ZI_wFoo__fwBar__f , 4, "bar"); + // */test("S__ZI_wFoo__fwBar_I_", new S__ZI_wFoo__fwBar_I_ , 4, "foo"); + // */test("S__ZI_wFoo__fwBar_If", new S__ZI_wFoo__fwBar_If , 4, "bar"); + /* */test("S__ZI_wFoo__fwBarY__", new S__ZI_wFoo__fwBarY__ , 4, "foo"); + // */test("S__ZI_wFoo__fwBarY_f", new S__ZI_wFoo__fwBarY_f , 4, "bar"); + // */test("S__ZI_wFoo__fwBarYI_", new S__ZI_wFoo__fwBarYI_ , 4, "foo"); + // */test("S__ZI_wFoo__fwBarYIf", new S__ZI_wFoo__fwBarYIf , 4, "bar"); + // */test("S__ZI_wFoo_I_ ", new S__ZI_wFoo_I_ , 3, "sub"); + // */test("S__ZI_wFoo_I_wBar___", new S__ZI_wFoo_I_wBar___ , 4, "sub"); + // */test("S__ZI_wFoo_I_wBar__f", new S__ZI_wFoo_I_wBar__f , 4, "bar"); + // */test("S__ZI_wFoo_I_wBar_I_", new S__ZI_wFoo_I_wBar_I_ , 4, "sub"); + // */test("S__ZI_wFoo_I_wBar_If", new S__ZI_wFoo_I_wBar_If , 4, "bar"); + // */test("S__ZI_wFoo_I_wBarY__", new S__ZI_wFoo_I_wBarY__ , 4, "sub"); + // */test("S__ZI_wFoo_I_wBarY_f", new S__ZI_wFoo_I_wBarY_f , 4, "bar"); + // */test("S__ZI_wFoo_I_wBarYI_", new S__ZI_wFoo_I_wBarYI_ , 4, "sub"); + // */test("S__ZI_wFoo_I_wBarYIf", new S__ZI_wFoo_I_wBarYIf , 4, "bar"); + // */test("S__ZI_wFoo_If ", new S__ZI_wFoo_If , 3, "foo"); + // */test("S__ZI_wFoo_IfwBar___", new S__ZI_wFoo_IfwBar___ , 4, "foo"); + // */test("S__ZI_wFoo_IfwBar__f", new S__ZI_wFoo_IfwBar__f , 4, "bar"); + // */test("S__ZI_wFoo_IfwBar_I_", new S__ZI_wFoo_IfwBar_I_ , 4, "foo"); + // */test("S__ZI_wFoo_IfwBar_If", new S__ZI_wFoo_IfwBar_If , 4, "bar"); + // */test("S__ZI_wFoo_IfwBarY__", new S__ZI_wFoo_IfwBarY__ , 4, "foo"); + // */test("S__ZI_wFoo_IfwBarY_f", new S__ZI_wFoo_IfwBarY_f , 4, "bar"); + // */test("S__ZI_wFoo_IfwBarYI_", new S__ZI_wFoo_IfwBarYI_ , 4, "foo"); + // */test("S__ZI_wFoo_IfwBarYIf", new S__ZI_wFoo_IfwBarYIf , 4, "bar"); + /* */test("S__ZI_wFooX__ ", new S__ZI_wFooX__ , 3, "sub"); + /* */test("S__ZI_wFooX__wBar___", new S__ZI_wFooX__wBar___ , 4, "sub"); + /* */test("S__ZI_wFooX__wBar__f", new S__ZI_wFooX__wBar__f , 4, "bar"); + // */test("S__ZI_wFooX__wBar_I_", new S__ZI_wFooX__wBar_I_ , 4, "sub"); + // */test("S__ZI_wFooX__wBar_If", new S__ZI_wFooX__wBar_If , 4, "bar"); + /* */test("S__ZI_wFooX__wBarY__", new S__ZI_wFooX__wBarY__ , 4, "sub"); + /* */test("S__ZI_wFooX__wBarY_f", new S__ZI_wFooX__wBarY_f , 4, "bar"); + // */test("S__ZI_wFooX__wBarYI_", new S__ZI_wFooX__wBarYI_ , 4, "sub"); + // */test("S__ZI_wFooX__wBarYIf", new S__ZI_wFooX__wBarYIf , 4, "bar"); + /* */test("S__ZI_wFooX_f ", new S__ZI_wFooX_f , 3, "foo"); + /* */test("S__ZI_wFooX_fwBar___", new S__ZI_wFooX_fwBar___ , 4, "foo"); + // */test("S__ZI_wFooX_fwBar__f", new S__ZI_wFooX_fwBar__f , 4, "bar"); + // */test("S__ZI_wFooX_fwBar_I_", new S__ZI_wFooX_fwBar_I_ , 4, "foo"); + // */test("S__ZI_wFooX_fwBar_If", new S__ZI_wFooX_fwBar_If , 4, "bar"); + /* */test("S__ZI_wFooX_fwBarY__", new S__ZI_wFooX_fwBarY__ , 4, "foo"); + // */test("S__ZI_wFooX_fwBarY_f", new S__ZI_wFooX_fwBarY_f , 4, "bar"); + // */test("S__ZI_wFooX_fwBarYI_", new S__ZI_wFooX_fwBarYI_ , 4, "foo"); + // */test("S__ZI_wFooX_fwBarYIf", new S__ZI_wFooX_fwBarYIf , 4, "bar"); + // */test("S__ZI_wFooXI_ ", new S__ZI_wFooXI_ , 3, "sub"); + // */test("S__ZI_wFooXI_wBar___", new S__ZI_wFooXI_wBar___ , 4, "sub"); + // */test("S__ZI_wFooXI_wBar__f", new S__ZI_wFooXI_wBar__f , 4, "bar"); + // */test("S__ZI_wFooXI_wBar_I_", new S__ZI_wFooXI_wBar_I_ , 4, "sub"); + // */test("S__ZI_wFooXI_wBar_If", new S__ZI_wFooXI_wBar_If , 4, "bar"); + // */test("S__ZI_wFooXI_wBarY__", new S__ZI_wFooXI_wBarY__ , 4, "sub"); + // */test("S__ZI_wFooXI_wBarY_f", new S__ZI_wFooXI_wBarY_f , 4, "bar"); + // */test("S__ZI_wFooXI_wBarYI_", new S__ZI_wFooXI_wBarYI_ , 4, "sub"); + // */test("S__ZI_wFooXI_wBarYIf", new S__ZI_wFooXI_wBarYIf , 4, "bar"); + // */test("S__ZI_wFooXIf ", new S__ZI_wFooXIf , 3, "foo"); + // */test("S__ZI_wFooXIfwBar___", new S__ZI_wFooXIfwBar___ , 4, "foo"); + // */test("S__ZI_wFooXIfwBar__f", new S__ZI_wFooXIfwBar__f , 4, "bar"); + // */test("S__ZI_wFooXIfwBar_I_", new S__ZI_wFooXIfwBar_I_ , 4, "foo"); + // */test("S__ZI_wFooXIfwBar_If", new S__ZI_wFooXIfwBar_If , 4, "bar"); + // */test("S__ZI_wFooXIfwBarY__", new S__ZI_wFooXIfwBarY__ , 4, "foo"); + // */test("S__ZI_wFooXIfwBarY_f", new S__ZI_wFooXIfwBarY_f , 4, "bar"); + // */test("S__ZI_wFooXIfwBarYI_", new S__ZI_wFooXIfwBarYI_ , 4, "foo"); + // */test("S__ZI_wFooXIfwBarYIf", new S__ZI_wFooXIfwBarYIf , 4, "bar"); + + /* */test("S__ZIfwFoo___ ", new S__ZIfwFoo___ , 3, "mix"); + /* */test("S__ZIfwFoo___wBar___", new S__ZIfwFoo___wBar___ , 4, "mix"); + /* */test("S__ZIfwFoo___wBar__f", new S__ZIfwFoo___wBar__f , 4, "mix"); + // */test("S__ZIfwFoo___wBar_I_", new S__ZIfwFoo___wBar_I_ , 4, "mix"); + // */test("S__ZIfwFoo___wBar_If", new S__ZIfwFoo___wBar_If , 4, "mix"); + /* */test("S__ZIfwFoo___wBarY__", new S__ZIfwFoo___wBarY__ , 4, "mix"); + /* */test("S__ZIfwFoo___wBarY_f", new S__ZIfwFoo___wBarY_f , 4, "mix"); + // */test("S__ZIfwFoo___wBarYI_", new S__ZIfwFoo___wBarYI_ , 4, "mix"); + // */test("S__ZIfwFoo___wBarYIf", new S__ZIfwFoo___wBarYIf , 4, "mix"); + /* */test("S__ZIfwFoo__f ", new S__ZIfwFoo__f , 3, "mix"); + /* */test("S__ZIfwFoo__fwBar___", new S__ZIfwFoo__fwBar___ , 4, "mix"); + /* */test("S__ZIfwFoo__fwBar__f", new S__ZIfwFoo__fwBar__f , 4, "mix"); + // */test("S__ZIfwFoo__fwBar_I_", new S__ZIfwFoo__fwBar_I_ , 4, "mix"); + // */test("S__ZIfwFoo__fwBar_If", new S__ZIfwFoo__fwBar_If , 4, "mix"); + /* */test("S__ZIfwFoo__fwBarY__", new S__ZIfwFoo__fwBarY__ , 4, "mix"); + /* */test("S__ZIfwFoo__fwBarY_f", new S__ZIfwFoo__fwBarY_f , 4, "mix"); + // */test("S__ZIfwFoo__fwBarYI_", new S__ZIfwFoo__fwBarYI_ , 4, "mix"); + // */test("S__ZIfwFoo__fwBarYIf", new S__ZIfwFoo__fwBarYIf , 4, "mix"); + // */test("S__ZIfwFoo_I_ ", new S__ZIfwFoo_I_ , 3, "mix"); + // */test("S__ZIfwFoo_I_wBar___", new S__ZIfwFoo_I_wBar___ , 4, "mix"); + // */test("S__ZIfwFoo_I_wBar__f", new S__ZIfwFoo_I_wBar__f , 4, "mix"); + // */test("S__ZIfwFoo_I_wBar_I_", new S__ZIfwFoo_I_wBar_I_ , 4, "mix"); + // */test("S__ZIfwFoo_I_wBar_If", new S__ZIfwFoo_I_wBar_If , 4, "mix"); + // */test("S__ZIfwFoo_I_wBarY__", new S__ZIfwFoo_I_wBarY__ , 4, "mix"); + // */test("S__ZIfwFoo_I_wBarY_f", new S__ZIfwFoo_I_wBarY_f , 4, "mix"); + // */test("S__ZIfwFoo_I_wBarYI_", new S__ZIfwFoo_I_wBarYI_ , 4, "mix"); + // */test("S__ZIfwFoo_I_wBarYIf", new S__ZIfwFoo_I_wBarYIf , 4, "mix"); + // */test("S__ZIfwFoo_If ", new S__ZIfwFoo_If , 3, "mix"); + // */test("S__ZIfwFoo_IfwBar___", new S__ZIfwFoo_IfwBar___ , 4, "mix"); + // */test("S__ZIfwFoo_IfwBar__f", new S__ZIfwFoo_IfwBar__f , 4, "mix"); + // */test("S__ZIfwFoo_IfwBar_I_", new S__ZIfwFoo_IfwBar_I_ , 4, "mix"); + // */test("S__ZIfwFoo_IfwBar_If", new S__ZIfwFoo_IfwBar_If , 4, "mix"); + // */test("S__ZIfwFoo_IfwBarY__", new S__ZIfwFoo_IfwBarY__ , 4, "mix"); + // */test("S__ZIfwFoo_IfwBarY_f", new S__ZIfwFoo_IfwBarY_f , 4, "mix"); + // */test("S__ZIfwFoo_IfwBarYI_", new S__ZIfwFoo_IfwBarYI_ , 4, "mix"); + // */test("S__ZIfwFoo_IfwBarYIf", new S__ZIfwFoo_IfwBarYIf , 4, "mix"); + /* */test("S__ZIfwFooX__ ", new S__ZIfwFooX__ , 3, "mix"); + /* */test("S__ZIfwFooX__wBar___", new S__ZIfwFooX__wBar___ , 4, "mix"); + /* */test("S__ZIfwFooX__wBar__f", new S__ZIfwFooX__wBar__f , 4, "mix"); + // */test("S__ZIfwFooX__wBar_I_", new S__ZIfwFooX__wBar_I_ , 4, "mix"); + // */test("S__ZIfwFooX__wBar_If", new S__ZIfwFooX__wBar_If , 4, "mix"); + /* */test("S__ZIfwFooX__wBarY__", new S__ZIfwFooX__wBarY__ , 4, "mix"); + /* */test("S__ZIfwFooX__wBarY_f", new S__ZIfwFooX__wBarY_f , 4, "mix"); + // */test("S__ZIfwFooX__wBarYI_", new S__ZIfwFooX__wBarYI_ , 4, "mix"); + // */test("S__ZIfwFooX__wBarYIf", new S__ZIfwFooX__wBarYIf , 4, "mix"); + /* */test("S__ZIfwFooX_f ", new S__ZIfwFooX_f , 3, "mix"); + /* */test("S__ZIfwFooX_fwBar___", new S__ZIfwFooX_fwBar___ , 4, "mix"); + /* */test("S__ZIfwFooX_fwBar__f", new S__ZIfwFooX_fwBar__f , 4, "mix"); + // */test("S__ZIfwFooX_fwBar_I_", new S__ZIfwFooX_fwBar_I_ , 4, "mix"); + // */test("S__ZIfwFooX_fwBar_If", new S__ZIfwFooX_fwBar_If , 4, "mix"); + /* */test("S__ZIfwFooX_fwBarY__", new S__ZIfwFooX_fwBarY__ , 4, "mix"); + /* */test("S__ZIfwFooX_fwBarY_f", new S__ZIfwFooX_fwBarY_f , 4, "mix"); + // */test("S__ZIfwFooX_fwBarYI_", new S__ZIfwFooX_fwBarYI_ , 4, "mix"); + // */test("S__ZIfwFooX_fwBarYIf", new S__ZIfwFooX_fwBarYIf , 4, "mix"); + // */test("S__ZIfwFooXI_ ", new S__ZIfwFooXI_ , 3, "mix"); + // */test("S__ZIfwFooXI_wBar___", new S__ZIfwFooXI_wBar___ , 4, "mix"); + // */test("S__ZIfwFooXI_wBar__f", new S__ZIfwFooXI_wBar__f , 4, "mix"); + // */test("S__ZIfwFooXI_wBar_I_", new S__ZIfwFooXI_wBar_I_ , 4, "mix"); + // */test("S__ZIfwFooXI_wBar_If", new S__ZIfwFooXI_wBar_If , 4, "mix"); + // */test("S__ZIfwFooXI_wBarY__", new S__ZIfwFooXI_wBarY__ , 4, "mix"); + // */test("S__ZIfwFooXI_wBarY_f", new S__ZIfwFooXI_wBarY_f , 4, "mix"); + // */test("S__ZIfwFooXI_wBarYI_", new S__ZIfwFooXI_wBarYI_ , 4, "mix"); + // */test("S__ZIfwFooXI_wBarYIf", new S__ZIfwFooXI_wBarYIf , 4, "mix"); + // */test("S__ZIfwFooXIf ", new S__ZIfwFooXIf , 3, "mix"); + // */test("S__ZIfwFooXIfwBar___", new S__ZIfwFooXIfwBar___ , 4, "mix"); + // */test("S__ZIfwFooXIfwBar__f", new S__ZIfwFooXIfwBar__f , 4, "mix"); + // */test("S__ZIfwFooXIfwBar_I_", new S__ZIfwFooXIfwBar_I_ , 4, "mix"); + // */test("S__ZIfwFooXIfwBar_If", new S__ZIfwFooXIfwBar_If , 4, "mix"); + // */test("S__ZIfwFooXIfwBarY__", new S__ZIfwFooXIfwBarY__ , 4, "mix"); + // */test("S__ZIfwFooXIfwBarY_f", new S__ZIfwFooXIfwBarY_f , 4, "mix"); + // */test("S__ZIfwFooXIfwBarYI_", new S__ZIfwFooXIfwBarYI_ , 4, "mix"); + // */test("S__ZIfwFooXIfwBarYIf", new S__ZIfwFooXIfwBarYIf , 4, "mix"); + + + + /* */test("S_T___eFoo___ ", new S_T___eFoo___ [D], 3, "sub"); + /* */test("S_T___eFoo___wBar___", new S_T___eFoo___wBar___[D], 4, "sub"); + /* */test("S_T___eFoo___wBar__f", new S_T___eFoo___wBar__f[D], 4, "bar"); + /* */test("S_T___eFoo___wBar_I_", new S_T___eFoo___wBar_I_[D], 4, "sub"); + /* */test("S_T___eFoo___wBar_If", new S_T___eFoo___wBar_If[D], 4, "bar"); + /* */test("S_T___eFoo___wBarY__", new S_T___eFoo___wBarY__[D], 4, "sub"); + /* */test("S_T___eFoo___wBarY_f", new S_T___eFoo___wBarY_f[D], 4, "bar"); + /* */test("S_T___eFoo___wBarYI_", new S_T___eFoo___wBarYI_[D], 4, "sub"); + /* */test("S_T___eFoo___wBarYIf", new S_T___eFoo___wBarYIf[D], 4, "bar"); + /* */test("S_T___eFoo__f ", new S_T___eFoo__f [D], 3, "foo"); + /* */test("S_T___eFoo__fwBar___", new S_T___eFoo__fwBar___[D], 4, "foo"); + // */test("S_T___eFoo__fwBar__f", new S_T___eFoo__fwBar__f[D], 4, "bar"); + /* */test("S_T___eFoo__fwBar_I_", new S_T___eFoo__fwBar_I_[D], 4, "foo"); + // */test("S_T___eFoo__fwBar_If", new S_T___eFoo__fwBar_If[D], 4, "bar"); + /* */test("S_T___eFoo__fwBarY__", new S_T___eFoo__fwBarY__[D], 4, "foo"); + // */test("S_T___eFoo__fwBarY_f", new S_T___eFoo__fwBarY_f[D], 4, "bar"); + /* */test("S_T___eFoo__fwBarYI_", new S_T___eFoo__fwBarYI_[D], 4, "foo"); + // */test("S_T___eFoo__fwBarYIf", new S_T___eFoo__fwBarYIf[D], 4, "bar"); + /* */test("S_T___eFoo_I_ ", new S_T___eFoo_I_ [D], 3, "sub"); + /* */test("S_T___eFoo_I_wBar___", new S_T___eFoo_I_wBar___[D], 4, "sub"); + /* */test("S_T___eFoo_I_wBar__f", new S_T___eFoo_I_wBar__f[D], 4, "bar"); + // */test("S_T___eFoo_I_wBar_I_", new S_T___eFoo_I_wBar_I_[D], 4, "sub"); + // */test("S_T___eFoo_I_wBar_If", new S_T___eFoo_I_wBar_If[D], 4, "bar"); + /* */test("S_T___eFoo_I_wBarY__", new S_T___eFoo_I_wBarY__[D], 4, "sub"); + /* */test("S_T___eFoo_I_wBarY_f", new S_T___eFoo_I_wBarY_f[D], 4, "bar"); + // */test("S_T___eFoo_I_wBarYI_", new S_T___eFoo_I_wBarYI_[D], 4, "sub"); + // */test("S_T___eFoo_I_wBarYIf", new S_T___eFoo_I_wBarYIf[D], 4, "bar"); + /* */test("S_T___eFoo_If ", new S_T___eFoo_If [D], 3, "foo"); + /* */test("S_T___eFoo_IfwBar___", new S_T___eFoo_IfwBar___[D], 4, "foo"); + // */test("S_T___eFoo_IfwBar__f", new S_T___eFoo_IfwBar__f[D], 4, "bar"); + // */test("S_T___eFoo_IfwBar_I_", new S_T___eFoo_IfwBar_I_[D], 4, "foo"); + // */test("S_T___eFoo_IfwBar_If", new S_T___eFoo_IfwBar_If[D], 4, "bar"); + /* */test("S_T___eFoo_IfwBarY__", new S_T___eFoo_IfwBarY__[D], 4, "foo"); + // */test("S_T___eFoo_IfwBarY_f", new S_T___eFoo_IfwBarY_f[D], 4, "bar"); + // */test("S_T___eFoo_IfwBarYI_", new S_T___eFoo_IfwBarYI_[D], 4, "foo"); + // */test("S_T___eFoo_IfwBarYIf", new S_T___eFoo_IfwBarYIf[D], 4, "bar"); + /* */test("S_T___eFooX__ ", new S_T___eFooX__ [D], 3, "sub"); + /* */test("S_T___eFooX__wBar___", new S_T___eFooX__wBar___[D], 4, "sub"); + /* */test("S_T___eFooX__wBar__f", new S_T___eFooX__wBar__f[D], 4, "bar"); + /* */test("S_T___eFooX__wBar_I_", new S_T___eFooX__wBar_I_[D], 4, "sub"); + /* */test("S_T___eFooX__wBar_If", new S_T___eFooX__wBar_If[D], 4, "bar"); + /* */test("S_T___eFooX__wBarY__", new S_T___eFooX__wBarY__[D], 4, "sub"); + /* */test("S_T___eFooX__wBarY_f", new S_T___eFooX__wBarY_f[D], 4, "bar"); + /* */test("S_T___eFooX__wBarYI_", new S_T___eFooX__wBarYI_[D], 4, "sub"); + /* */test("S_T___eFooX__wBarYIf", new S_T___eFooX__wBarYIf[D], 4, "bar"); + /* */test("S_T___eFooX_f ", new S_T___eFooX_f [D], 3, "foo"); + /* */test("S_T___eFooX_fwBar___", new S_T___eFooX_fwBar___[D], 4, "foo"); + // */test("S_T___eFooX_fwBar__f", new S_T___eFooX_fwBar__f[D], 4, "bar"); + /* */test("S_T___eFooX_fwBar_I_", new S_T___eFooX_fwBar_I_[D], 4, "foo"); + // */test("S_T___eFooX_fwBar_If", new S_T___eFooX_fwBar_If[D], 4, "bar"); + /* */test("S_T___eFooX_fwBarY__", new S_T___eFooX_fwBarY__[D], 4, "foo"); + // */test("S_T___eFooX_fwBarY_f", new S_T___eFooX_fwBarY_f[D], 4, "bar"); + /* */test("S_T___eFooX_fwBarYI_", new S_T___eFooX_fwBarYI_[D], 4, "foo"); + // */test("S_T___eFooX_fwBarYIf", new S_T___eFooX_fwBarYIf[D], 4, "bar"); + /* */test("S_T___eFooXI_ ", new S_T___eFooXI_ [D], 3, "sub"); + /* */test("S_T___eFooXI_wBar___", new S_T___eFooXI_wBar___[D], 4, "sub"); + /* */test("S_T___eFooXI_wBar__f", new S_T___eFooXI_wBar__f[D], 4, "bar"); + // */test("S_T___eFooXI_wBar_I_", new S_T___eFooXI_wBar_I_[D], 4, "sub"); + // */test("S_T___eFooXI_wBar_If", new S_T___eFooXI_wBar_If[D], 4, "bar"); + /* */test("S_T___eFooXI_wBarY__", new S_T___eFooXI_wBarY__[D], 4, "sub"); + /* */test("S_T___eFooXI_wBarY_f", new S_T___eFooXI_wBarY_f[D], 4, "bar"); + // */test("S_T___eFooXI_wBarYI_", new S_T___eFooXI_wBarYI_[D], 4, "sub"); + // */test("S_T___eFooXI_wBarYIf", new S_T___eFooXI_wBarYIf[D], 4, "bar"); + /* */test("S_T___eFooXIf ", new S_T___eFooXIf [D], 3, "foo"); + /* */test("S_T___eFooXIfwBar___", new S_T___eFooXIfwBar___[D], 4, "foo"); + // */test("S_T___eFooXIfwBar__f", new S_T___eFooXIfwBar__f[D], 4, "bar"); + // */test("S_T___eFooXIfwBar_I_", new S_T___eFooXIfwBar_I_[D], 4, "foo"); + // */test("S_T___eFooXIfwBar_If", new S_T___eFooXIfwBar_If[D], 4, "bar"); + /* */test("S_T___eFooXIfwBarY__", new S_T___eFooXIfwBarY__[D], 4, "foo"); + // */test("S_T___eFooXIfwBarY_f", new S_T___eFooXIfwBarY_f[D], 4, "bar"); + // */test("S_T___eFooXIfwBarYI_", new S_T___eFooXIfwBarYI_[D], 4, "foo"); + // */test("S_T___eFooXIfwBarYIf", new S_T___eFooXIfwBarYIf[D], 4, "bar"); + + /* */test("S_T__feFoo___ ", new S_T__feFoo___ [D], 3, "mix"); + /* */test("S_T__feFoo___wBar___", new S_T__feFoo___wBar___[D], 4, "mix"); + /* */test("S_T__feFoo___wBar__f", new S_T__feFoo___wBar__f[D], 4, "mix"); + /* */test("S_T__feFoo___wBar_I_", new S_T__feFoo___wBar_I_[D], 4, "mix"); + /* */test("S_T__feFoo___wBar_If", new S_T__feFoo___wBar_If[D], 4, "mix"); + /* */test("S_T__feFoo___wBarY__", new S_T__feFoo___wBarY__[D], 4, "mix"); + /* */test("S_T__feFoo___wBarY_f", new S_T__feFoo___wBarY_f[D], 4, "mix"); + /* */test("S_T__feFoo___wBarYI_", new S_T__feFoo___wBarYI_[D], 4, "mix"); + /* */test("S_T__feFoo___wBarYIf", new S_T__feFoo___wBarYIf[D], 4, "mix"); + /* */test("S_T__feFoo__f ", new S_T__feFoo__f [D], 3, "mix"); + /* */test("S_T__feFoo__fwBar___", new S_T__feFoo__fwBar___[D], 4, "mix"); + /* */test("S_T__feFoo__fwBar__f", new S_T__feFoo__fwBar__f[D], 4, "mix"); + /* */test("S_T__feFoo__fwBar_I_", new S_T__feFoo__fwBar_I_[D], 4, "mix"); + /* */test("S_T__feFoo__fwBar_If", new S_T__feFoo__fwBar_If[D], 4, "mix"); + /* */test("S_T__feFoo__fwBarY__", new S_T__feFoo__fwBarY__[D], 4, "mix"); + /* */test("S_T__feFoo__fwBarY_f", new S_T__feFoo__fwBarY_f[D], 4, "mix"); + /* */test("S_T__feFoo__fwBarYI_", new S_T__feFoo__fwBarYI_[D], 4, "mix"); + /* */test("S_T__feFoo__fwBarYIf", new S_T__feFoo__fwBarYIf[D], 4, "mix"); + /* */test("S_T__feFoo_I_ ", new S_T__feFoo_I_ [D], 3, "mix"); + /* */test("S_T__feFoo_I_wBar___", new S_T__feFoo_I_wBar___[D], 4, "mix"); + /* */test("S_T__feFoo_I_wBar__f", new S_T__feFoo_I_wBar__f[D], 4, "mix"); + // */test("S_T__feFoo_I_wBar_I_", new S_T__feFoo_I_wBar_I_[D], 4, "mix"); + // */test("S_T__feFoo_I_wBar_If", new S_T__feFoo_I_wBar_If[D], 4, "mix"); + /* */test("S_T__feFoo_I_wBarY__", new S_T__feFoo_I_wBarY__[D], 4, "mix"); + /* */test("S_T__feFoo_I_wBarY_f", new S_T__feFoo_I_wBarY_f[D], 4, "mix"); + // */test("S_T__feFoo_I_wBarYI_", new S_T__feFoo_I_wBarYI_[D], 4, "mix"); + // */test("S_T__feFoo_I_wBarYIf", new S_T__feFoo_I_wBarYIf[D], 4, "mix"); + /* */test("S_T__feFoo_If ", new S_T__feFoo_If [D], 3, "mix"); + /* */test("S_T__feFoo_IfwBar___", new S_T__feFoo_IfwBar___[D], 4, "mix"); + /* */test("S_T__feFoo_IfwBar__f", new S_T__feFoo_IfwBar__f[D], 4, "mix"); + // */test("S_T__feFoo_IfwBar_I_", new S_T__feFoo_IfwBar_I_[D], 4, "mix"); + // */test("S_T__feFoo_IfwBar_If", new S_T__feFoo_IfwBar_If[D], 4, "mix"); + /* */test("S_T__feFoo_IfwBarY__", new S_T__feFoo_IfwBarY__[D], 4, "mix"); + /* */test("S_T__feFoo_IfwBarY_f", new S_T__feFoo_IfwBarY_f[D], 4, "mix"); + // */test("S_T__feFoo_IfwBarYI_", new S_T__feFoo_IfwBarYI_[D], 4, "mix"); + // */test("S_T__feFoo_IfwBarYIf", new S_T__feFoo_IfwBarYIf[D], 4, "mix"); + /* */test("S_T__feFooX__ ", new S_T__feFooX__ [D], 3, "mix"); + /* */test("S_T__feFooX__wBar___", new S_T__feFooX__wBar___[D], 4, "mix"); + /* */test("S_T__feFooX__wBar__f", new S_T__feFooX__wBar__f[D], 4, "mix"); + /* */test("S_T__feFooX__wBar_I_", new S_T__feFooX__wBar_I_[D], 4, "mix"); + /* */test("S_T__feFooX__wBar_If", new S_T__feFooX__wBar_If[D], 4, "mix"); + /* */test("S_T__feFooX__wBarY__", new S_T__feFooX__wBarY__[D], 4, "mix"); + /* */test("S_T__feFooX__wBarY_f", new S_T__feFooX__wBarY_f[D], 4, "mix"); + /* */test("S_T__feFooX__wBarYI_", new S_T__feFooX__wBarYI_[D], 4, "mix"); + /* */test("S_T__feFooX__wBarYIf", new S_T__feFooX__wBarYIf[D], 4, "mix"); + /* */test("S_T__feFooX_f ", new S_T__feFooX_f [D], 3, "mix"); + /* */test("S_T__feFooX_fwBar___", new S_T__feFooX_fwBar___[D], 4, "mix"); + /* */test("S_T__feFooX_fwBar__f", new S_T__feFooX_fwBar__f[D], 4, "mix"); + /* */test("S_T__feFooX_fwBar_I_", new S_T__feFooX_fwBar_I_[D], 4, "mix"); + /* */test("S_T__feFooX_fwBar_If", new S_T__feFooX_fwBar_If[D], 4, "mix"); + /* */test("S_T__feFooX_fwBarY__", new S_T__feFooX_fwBarY__[D], 4, "mix"); + /* */test("S_T__feFooX_fwBarY_f", new S_T__feFooX_fwBarY_f[D], 4, "mix"); + /* */test("S_T__feFooX_fwBarYI_", new S_T__feFooX_fwBarYI_[D], 4, "mix"); + /* */test("S_T__feFooX_fwBarYIf", new S_T__feFooX_fwBarYIf[D], 4, "mix"); + /* */test("S_T__feFooXI_ ", new S_T__feFooXI_ [D], 3, "mix"); + /* */test("S_T__feFooXI_wBar___", new S_T__feFooXI_wBar___[D], 4, "mix"); + /* */test("S_T__feFooXI_wBar__f", new S_T__feFooXI_wBar__f[D], 4, "mix"); + // */test("S_T__feFooXI_wBar_I_", new S_T__feFooXI_wBar_I_[D], 4, "mix"); + // */test("S_T__feFooXI_wBar_If", new S_T__feFooXI_wBar_If[D], 4, "mix"); + /* */test("S_T__feFooXI_wBarY__", new S_T__feFooXI_wBarY__[D], 4, "mix"); + /* */test("S_T__feFooXI_wBarY_f", new S_T__feFooXI_wBarY_f[D], 4, "mix"); + // */test("S_T__feFooXI_wBarYI_", new S_T__feFooXI_wBarYI_[D], 4, "mix"); + // */test("S_T__feFooXI_wBarYIf", new S_T__feFooXI_wBarYIf[D], 4, "mix"); + /* */test("S_T__feFooXIf ", new S_T__feFooXIf [D], 3, "mix"); + /* */test("S_T__feFooXIfwBar___", new S_T__feFooXIfwBar___[D], 4, "mix"); + /* */test("S_T__feFooXIfwBar__f", new S_T__feFooXIfwBar__f[D], 4, "mix"); + // */test("S_T__feFooXIfwBar_I_", new S_T__feFooXIfwBar_I_[D], 4, "mix"); + // */test("S_T__feFooXIfwBar_If", new S_T__feFooXIfwBar_If[D], 4, "mix"); + /* */test("S_T__feFooXIfwBarY__", new S_T__feFooXIfwBarY__[D], 4, "mix"); + /* */test("S_T__feFooXIfwBarY_f", new S_T__feFooXIfwBarY_f[D], 4, "mix"); + // */test("S_T__feFooXIfwBarYI_", new S_T__feFooXIfwBarYI_[D], 4, "mix"); + // */test("S_T__feFooXIfwBarYIf", new S_T__feFooXIfwBarYIf[D], 4, "mix"); + + /* */test("S_T_I_eFoo___ ", new S_T_I_eFoo___ [D], 3, "sub"); + /* */test("S_T_I_eFoo___wBar___", new S_T_I_eFoo___wBar___[D], 4, "sub"); + /* */test("S_T_I_eFoo___wBar__f", new S_T_I_eFoo___wBar__f[D], 4, "bar"); + // */test("S_T_I_eFoo___wBar_I_", new S_T_I_eFoo___wBar_I_[D], 4, "sub"); + // */test("S_T_I_eFoo___wBar_If", new S_T_I_eFoo___wBar_If[D], 4, "bar"); + /* */test("S_T_I_eFoo___wBarY__", new S_T_I_eFoo___wBarY__[D], 4, "sub"); + /* */test("S_T_I_eFoo___wBarY_f", new S_T_I_eFoo___wBarY_f[D], 4, "bar"); + // */test("S_T_I_eFoo___wBarYI_", new S_T_I_eFoo___wBarYI_[D], 4, "sub"); + // */test("S_T_I_eFoo___wBarYIf", new S_T_I_eFoo___wBarYIf[D], 4, "bar"); + /* */test("S_T_I_eFoo__f ", new S_T_I_eFoo__f [D], 3, "foo"); + /* */test("S_T_I_eFoo__fwBar___", new S_T_I_eFoo__fwBar___[D], 4, "foo"); + // */test("S_T_I_eFoo__fwBar__f", new S_T_I_eFoo__fwBar__f[D], 4, "bar"); + // */test("S_T_I_eFoo__fwBar_I_", new S_T_I_eFoo__fwBar_I_[D], 4, "foo"); + // */test("S_T_I_eFoo__fwBar_If", new S_T_I_eFoo__fwBar_If[D], 4, "bar"); + /* */test("S_T_I_eFoo__fwBarY__", new S_T_I_eFoo__fwBarY__[D], 4, "foo"); + // */test("S_T_I_eFoo__fwBarY_f", new S_T_I_eFoo__fwBarY_f[D], 4, "bar"); + // */test("S_T_I_eFoo__fwBarYI_", new S_T_I_eFoo__fwBarYI_[D], 4, "foo"); + // */test("S_T_I_eFoo__fwBarYIf", new S_T_I_eFoo__fwBarYIf[D], 4, "bar"); + // */test("S_T_I_eFoo_I_ ", new S_T_I_eFoo_I_ [D], 3, "sub"); + // */test("S_T_I_eFoo_I_wBar___", new S_T_I_eFoo_I_wBar___[D], 4, "sub"); + // */test("S_T_I_eFoo_I_wBar__f", new S_T_I_eFoo_I_wBar__f[D], 4, "bar"); + // */test("S_T_I_eFoo_I_wBar_I_", new S_T_I_eFoo_I_wBar_I_[D], 4, "sub"); + // */test("S_T_I_eFoo_I_wBar_If", new S_T_I_eFoo_I_wBar_If[D], 4, "bar"); + // */test("S_T_I_eFoo_I_wBarY__", new S_T_I_eFoo_I_wBarY__[D], 4, "sub"); + // */test("S_T_I_eFoo_I_wBarY_f", new S_T_I_eFoo_I_wBarY_f[D], 4, "bar"); + // */test("S_T_I_eFoo_I_wBarYI_", new S_T_I_eFoo_I_wBarYI_[D], 4, "sub"); + // */test("S_T_I_eFoo_I_wBarYIf", new S_T_I_eFoo_I_wBarYIf[D], 4, "bar"); + // */test("S_T_I_eFoo_If ", new S_T_I_eFoo_If [D], 3, "foo"); + // */test("S_T_I_eFoo_IfwBar___", new S_T_I_eFoo_IfwBar___[D], 4, "foo"); + // */test("S_T_I_eFoo_IfwBar__f", new S_T_I_eFoo_IfwBar__f[D], 4, "bar"); + // */test("S_T_I_eFoo_IfwBar_I_", new S_T_I_eFoo_IfwBar_I_[D], 4, "foo"); + // */test("S_T_I_eFoo_IfwBar_If", new S_T_I_eFoo_IfwBar_If[D], 4, "bar"); + // */test("S_T_I_eFoo_IfwBarY__", new S_T_I_eFoo_IfwBarY__[D], 4, "foo"); + // */test("S_T_I_eFoo_IfwBarY_f", new S_T_I_eFoo_IfwBarY_f[D], 4, "bar"); + // */test("S_T_I_eFoo_IfwBarYI_", new S_T_I_eFoo_IfwBarYI_[D], 4, "foo"); + // */test("S_T_I_eFoo_IfwBarYIf", new S_T_I_eFoo_IfwBarYIf[D], 4, "bar"); + /* */test("S_T_I_eFooX__ ", new S_T_I_eFooX__ [D], 3, "sub"); + /* */test("S_T_I_eFooX__wBar___", new S_T_I_eFooX__wBar___[D], 4, "sub"); + /* */test("S_T_I_eFooX__wBar__f", new S_T_I_eFooX__wBar__f[D], 4, "bar"); + // */test("S_T_I_eFooX__wBar_I_", new S_T_I_eFooX__wBar_I_[D], 4, "sub"); + // */test("S_T_I_eFooX__wBar_If", new S_T_I_eFooX__wBar_If[D], 4, "bar"); + /* */test("S_T_I_eFooX__wBarY__", new S_T_I_eFooX__wBarY__[D], 4, "sub"); + /* */test("S_T_I_eFooX__wBarY_f", new S_T_I_eFooX__wBarY_f[D], 4, "bar"); + // */test("S_T_I_eFooX__wBarYI_", new S_T_I_eFooX__wBarYI_[D], 4, "sub"); + // */test("S_T_I_eFooX__wBarYIf", new S_T_I_eFooX__wBarYIf[D], 4, "bar"); + /* */test("S_T_I_eFooX_f ", new S_T_I_eFooX_f [D], 3, "foo"); + /* */test("S_T_I_eFooX_fwBar___", new S_T_I_eFooX_fwBar___[D], 4, "foo"); + // */test("S_T_I_eFooX_fwBar__f", new S_T_I_eFooX_fwBar__f[D], 4, "bar"); + // */test("S_T_I_eFooX_fwBar_I_", new S_T_I_eFooX_fwBar_I_[D], 4, "foo"); + // */test("S_T_I_eFooX_fwBar_If", new S_T_I_eFooX_fwBar_If[D], 4, "bar"); + /* */test("S_T_I_eFooX_fwBarY__", new S_T_I_eFooX_fwBarY__[D], 4, "foo"); + // */test("S_T_I_eFooX_fwBarY_f", new S_T_I_eFooX_fwBarY_f[D], 4, "bar"); + // */test("S_T_I_eFooX_fwBarYI_", new S_T_I_eFooX_fwBarYI_[D], 4, "foo"); + // */test("S_T_I_eFooX_fwBarYIf", new S_T_I_eFooX_fwBarYIf[D], 4, "bar"); + // */test("S_T_I_eFooXI_ ", new S_T_I_eFooXI_ [D], 3, "sub"); + // */test("S_T_I_eFooXI_wBar___", new S_T_I_eFooXI_wBar___[D], 4, "sub"); + // */test("S_T_I_eFooXI_wBar__f", new S_T_I_eFooXI_wBar__f[D], 4, "bar"); + // */test("S_T_I_eFooXI_wBar_I_", new S_T_I_eFooXI_wBar_I_[D], 4, "sub"); + // */test("S_T_I_eFooXI_wBar_If", new S_T_I_eFooXI_wBar_If[D], 4, "bar"); + // */test("S_T_I_eFooXI_wBarY__", new S_T_I_eFooXI_wBarY__[D], 4, "sub"); + // */test("S_T_I_eFooXI_wBarY_f", new S_T_I_eFooXI_wBarY_f[D], 4, "bar"); + // */test("S_T_I_eFooXI_wBarYI_", new S_T_I_eFooXI_wBarYI_[D], 4, "sub"); + // */test("S_T_I_eFooXI_wBarYIf", new S_T_I_eFooXI_wBarYIf[D], 4, "bar"); + // */test("S_T_I_eFooXIf ", new S_T_I_eFooXIf [D], 3, "foo"); + // */test("S_T_I_eFooXIfwBar___", new S_T_I_eFooXIfwBar___[D], 4, "foo"); + // */test("S_T_I_eFooXIfwBar__f", new S_T_I_eFooXIfwBar__f[D], 4, "bar"); + // */test("S_T_I_eFooXIfwBar_I_", new S_T_I_eFooXIfwBar_I_[D], 4, "foo"); + // */test("S_T_I_eFooXIfwBar_If", new S_T_I_eFooXIfwBar_If[D], 4, "bar"); + // */test("S_T_I_eFooXIfwBarY__", new S_T_I_eFooXIfwBarY__[D], 4, "foo"); + // */test("S_T_I_eFooXIfwBarY_f", new S_T_I_eFooXIfwBarY_f[D], 4, "bar"); + // */test("S_T_I_eFooXIfwBarYI_", new S_T_I_eFooXIfwBarYI_[D], 4, "foo"); + // */test("S_T_I_eFooXIfwBarYIf", new S_T_I_eFooXIfwBarYIf[D], 4, "bar"); + + /* */test("S_T_IfeFoo___ ", new S_T_IfeFoo___ [D], 3, "mix"); + /* */test("S_T_IfeFoo___wBar___", new S_T_IfeFoo___wBar___[D], 4, "mix"); + /* */test("S_T_IfeFoo___wBar__f", new S_T_IfeFoo___wBar__f[D], 4, "mix"); + // */test("S_T_IfeFoo___wBar_I_", new S_T_IfeFoo___wBar_I_[D], 4, "mix"); + // */test("S_T_IfeFoo___wBar_If", new S_T_IfeFoo___wBar_If[D], 4, "mix"); + /* */test("S_T_IfeFoo___wBarY__", new S_T_IfeFoo___wBarY__[D], 4, "mix"); + /* */test("S_T_IfeFoo___wBarY_f", new S_T_IfeFoo___wBarY_f[D], 4, "mix"); + // */test("S_T_IfeFoo___wBarYI_", new S_T_IfeFoo___wBarYI_[D], 4, "mix"); + // */test("S_T_IfeFoo___wBarYIf", new S_T_IfeFoo___wBarYIf[D], 4, "mix"); + /* */test("S_T_IfeFoo__f ", new S_T_IfeFoo__f [D], 3, "mix"); + /* */test("S_T_IfeFoo__fwBar___", new S_T_IfeFoo__fwBar___[D], 4, "mix"); + /* */test("S_T_IfeFoo__fwBar__f", new S_T_IfeFoo__fwBar__f[D], 4, "mix"); + // */test("S_T_IfeFoo__fwBar_I_", new S_T_IfeFoo__fwBar_I_[D], 4, "mix"); + // */test("S_T_IfeFoo__fwBar_If", new S_T_IfeFoo__fwBar_If[D], 4, "mix"); + /* */test("S_T_IfeFoo__fwBarY__", new S_T_IfeFoo__fwBarY__[D], 4, "mix"); + /* */test("S_T_IfeFoo__fwBarY_f", new S_T_IfeFoo__fwBarY_f[D], 4, "mix"); + // */test("S_T_IfeFoo__fwBarYI_", new S_T_IfeFoo__fwBarYI_[D], 4, "mix"); + // */test("S_T_IfeFoo__fwBarYIf", new S_T_IfeFoo__fwBarYIf[D], 4, "mix"); + // */test("S_T_IfeFoo_I_ ", new S_T_IfeFoo_I_ [D], 3, "mix"); + // */test("S_T_IfeFoo_I_wBar___", new S_T_IfeFoo_I_wBar___[D], 4, "mix"); + // */test("S_T_IfeFoo_I_wBar__f", new S_T_IfeFoo_I_wBar__f[D], 4, "mix"); + // */test("S_T_IfeFoo_I_wBar_I_", new S_T_IfeFoo_I_wBar_I_[D], 4, "mix"); + // */test("S_T_IfeFoo_I_wBar_If", new S_T_IfeFoo_I_wBar_If[D], 4, "mix"); + // */test("S_T_IfeFoo_I_wBarY__", new S_T_IfeFoo_I_wBarY__[D], 4, "mix"); + // */test("S_T_IfeFoo_I_wBarY_f", new S_T_IfeFoo_I_wBarY_f[D], 4, "mix"); + // */test("S_T_IfeFoo_I_wBarYI_", new S_T_IfeFoo_I_wBarYI_[D], 4, "mix"); + // */test("S_T_IfeFoo_I_wBarYIf", new S_T_IfeFoo_I_wBarYIf[D], 4, "mix"); + // */test("S_T_IfeFoo_If ", new S_T_IfeFoo_If [D], 3, "mix"); + // */test("S_T_IfeFoo_IfwBar___", new S_T_IfeFoo_IfwBar___[D], 4, "mix"); + // */test("S_T_IfeFoo_IfwBar__f", new S_T_IfeFoo_IfwBar__f[D], 4, "mix"); + // */test("S_T_IfeFoo_IfwBar_I_", new S_T_IfeFoo_IfwBar_I_[D], 4, "mix"); + // */test("S_T_IfeFoo_IfwBar_If", new S_T_IfeFoo_IfwBar_If[D], 4, "mix"); + // */test("S_T_IfeFoo_IfwBarY__", new S_T_IfeFoo_IfwBarY__[D], 4, "mix"); + // */test("S_T_IfeFoo_IfwBarY_f", new S_T_IfeFoo_IfwBarY_f[D], 4, "mix"); + // */test("S_T_IfeFoo_IfwBarYI_", new S_T_IfeFoo_IfwBarYI_[D], 4, "mix"); + // */test("S_T_IfeFoo_IfwBarYIf", new S_T_IfeFoo_IfwBarYIf[D], 4, "mix"); + /* */test("S_T_IfeFooX__ ", new S_T_IfeFooX__ [D], 3, "mix"); + /* */test("S_T_IfeFooX__wBar___", new S_T_IfeFooX__wBar___[D], 4, "mix"); + /* */test("S_T_IfeFooX__wBar__f", new S_T_IfeFooX__wBar__f[D], 4, "mix"); + // */test("S_T_IfeFooX__wBar_I_", new S_T_IfeFooX__wBar_I_[D], 4, "mix"); + // */test("S_T_IfeFooX__wBar_If", new S_T_IfeFooX__wBar_If[D], 4, "mix"); + /* */test("S_T_IfeFooX__wBarY__", new S_T_IfeFooX__wBarY__[D], 4, "mix"); + /* */test("S_T_IfeFooX__wBarY_f", new S_T_IfeFooX__wBarY_f[D], 4, "mix"); + // */test("S_T_IfeFooX__wBarYI_", new S_T_IfeFooX__wBarYI_[D], 4, "mix"); + // */test("S_T_IfeFooX__wBarYIf", new S_T_IfeFooX__wBarYIf[D], 4, "mix"); + /* */test("S_T_IfeFooX_f ", new S_T_IfeFooX_f [D], 3, "mix"); + /* */test("S_T_IfeFooX_fwBar___", new S_T_IfeFooX_fwBar___[D], 4, "mix"); + /* */test("S_T_IfeFooX_fwBar__f", new S_T_IfeFooX_fwBar__f[D], 4, "mix"); + // */test("S_T_IfeFooX_fwBar_I_", new S_T_IfeFooX_fwBar_I_[D], 4, "mix"); + // */test("S_T_IfeFooX_fwBar_If", new S_T_IfeFooX_fwBar_If[D], 4, "mix"); + /* */test("S_T_IfeFooX_fwBarY__", new S_T_IfeFooX_fwBarY__[D], 4, "mix"); + /* */test("S_T_IfeFooX_fwBarY_f", new S_T_IfeFooX_fwBarY_f[D], 4, "mix"); + // */test("S_T_IfeFooX_fwBarYI_", new S_T_IfeFooX_fwBarYI_[D], 4, "mix"); + // */test("S_T_IfeFooX_fwBarYIf", new S_T_IfeFooX_fwBarYIf[D], 4, "mix"); + // */test("S_T_IfeFooXI_ ", new S_T_IfeFooXI_ [D], 3, "mix"); + // */test("S_T_IfeFooXI_wBar___", new S_T_IfeFooXI_wBar___[D], 4, "mix"); + // */test("S_T_IfeFooXI_wBar__f", new S_T_IfeFooXI_wBar__f[D], 4, "mix"); + // */test("S_T_IfeFooXI_wBar_I_", new S_T_IfeFooXI_wBar_I_[D], 4, "mix"); + // */test("S_T_IfeFooXI_wBar_If", new S_T_IfeFooXI_wBar_If[D], 4, "mix"); + // */test("S_T_IfeFooXI_wBarY__", new S_T_IfeFooXI_wBarY__[D], 4, "mix"); + // */test("S_T_IfeFooXI_wBarY_f", new S_T_IfeFooXI_wBarY_f[D], 4, "mix"); + // */test("S_T_IfeFooXI_wBarYI_", new S_T_IfeFooXI_wBarYI_[D], 4, "mix"); + // */test("S_T_IfeFooXI_wBarYIf", new S_T_IfeFooXI_wBarYIf[D], 4, "mix"); + // */test("S_T_IfeFooXIf ", new S_T_IfeFooXIf [D], 3, "mix"); + // */test("S_T_IfeFooXIfwBar___", new S_T_IfeFooXIfwBar___[D], 4, "mix"); + // */test("S_T_IfeFooXIfwBar__f", new S_T_IfeFooXIfwBar__f[D], 4, "mix"); + // */test("S_T_IfeFooXIfwBar_I_", new S_T_IfeFooXIfwBar_I_[D], 4, "mix"); + // */test("S_T_IfeFooXIfwBar_If", new S_T_IfeFooXIfwBar_If[D], 4, "mix"); + // */test("S_T_IfeFooXIfwBarY__", new S_T_IfeFooXIfwBarY__[D], 4, "mix"); + // */test("S_T_IfeFooXIfwBarY_f", new S_T_IfeFooXIfwBarY_f[D], 4, "mix"); + // */test("S_T_IfeFooXIfwBarYI_", new S_T_IfeFooXIfwBarYI_[D], 4, "mix"); + // */test("S_T_IfeFooXIfwBarYIf", new S_T_IfeFooXIfwBarYIf[D], 4, "mix"); + + /* */test("S_TZ__eFoo___ ", new S_TZ__eFoo___ [D], 3, "sub"); + /* */test("S_TZ__eFoo___wBar___", new S_TZ__eFoo___wBar___[D], 4, "sub"); + /* */test("S_TZ__eFoo___wBar__f", new S_TZ__eFoo___wBar__f[D], 4, "bar"); + /* */test("S_TZ__eFoo___wBar_I_", new S_TZ__eFoo___wBar_I_[D], 4, "sub"); + /* */test("S_TZ__eFoo___wBar_If", new S_TZ__eFoo___wBar_If[D], 4, "bar"); + /* */test("S_TZ__eFoo___wBarY__", new S_TZ__eFoo___wBarY__[D], 4, "sub"); + /* */test("S_TZ__eFoo___wBarY_f", new S_TZ__eFoo___wBarY_f[D], 4, "bar"); + /* */test("S_TZ__eFoo___wBarYI_", new S_TZ__eFoo___wBarYI_[D], 4, "sub"); + /* */test("S_TZ__eFoo___wBarYIf", new S_TZ__eFoo___wBarYIf[D], 4, "bar"); + /* */test("S_TZ__eFoo__f ", new S_TZ__eFoo__f [D], 3, "foo"); + /* */test("S_TZ__eFoo__fwBar___", new S_TZ__eFoo__fwBar___[D], 4, "foo"); + // */test("S_TZ__eFoo__fwBar__f", new S_TZ__eFoo__fwBar__f[D], 4, "bar"); + /* */test("S_TZ__eFoo__fwBar_I_", new S_TZ__eFoo__fwBar_I_[D], 4, "foo"); + // */test("S_TZ__eFoo__fwBar_If", new S_TZ__eFoo__fwBar_If[D], 4, "bar"); + /* */test("S_TZ__eFoo__fwBarY__", new S_TZ__eFoo__fwBarY__[D], 4, "foo"); + // */test("S_TZ__eFoo__fwBarY_f", new S_TZ__eFoo__fwBarY_f[D], 4, "bar"); + /* */test("S_TZ__eFoo__fwBarYI_", new S_TZ__eFoo__fwBarYI_[D], 4, "foo"); + // */test("S_TZ__eFoo__fwBarYIf", new S_TZ__eFoo__fwBarYIf[D], 4, "bar"); + /* */test("S_TZ__eFoo_I_ ", new S_TZ__eFoo_I_ [D], 3, "sub"); + /* */test("S_TZ__eFoo_I_wBar___", new S_TZ__eFoo_I_wBar___[D], 4, "sub"); + /* */test("S_TZ__eFoo_I_wBar__f", new S_TZ__eFoo_I_wBar__f[D], 4, "bar"); + // */test("S_TZ__eFoo_I_wBar_I_", new S_TZ__eFoo_I_wBar_I_[D], 4, "sub"); + // */test("S_TZ__eFoo_I_wBar_If", new S_TZ__eFoo_I_wBar_If[D], 4, "bar"); + /* */test("S_TZ__eFoo_I_wBarY__", new S_TZ__eFoo_I_wBarY__[D], 4, "sub"); + /* */test("S_TZ__eFoo_I_wBarY_f", new S_TZ__eFoo_I_wBarY_f[D], 4, "bar"); + // */test("S_TZ__eFoo_I_wBarYI_", new S_TZ__eFoo_I_wBarYI_[D], 4, "sub"); + // */test("S_TZ__eFoo_I_wBarYIf", new S_TZ__eFoo_I_wBarYIf[D], 4, "bar"); + /* */test("S_TZ__eFoo_If ", new S_TZ__eFoo_If [D], 3, "foo"); + /* */test("S_TZ__eFoo_IfwBar___", new S_TZ__eFoo_IfwBar___[D], 4, "foo"); + // */test("S_TZ__eFoo_IfwBar__f", new S_TZ__eFoo_IfwBar__f[D], 4, "bar"); + // */test("S_TZ__eFoo_IfwBar_I_", new S_TZ__eFoo_IfwBar_I_[D], 4, "foo"); + // */test("S_TZ__eFoo_IfwBar_If", new S_TZ__eFoo_IfwBar_If[D], 4, "bar"); + /* */test("S_TZ__eFoo_IfwBarY__", new S_TZ__eFoo_IfwBarY__[D], 4, "foo"); + // */test("S_TZ__eFoo_IfwBarY_f", new S_TZ__eFoo_IfwBarY_f[D], 4, "bar"); + // */test("S_TZ__eFoo_IfwBarYI_", new S_TZ__eFoo_IfwBarYI_[D], 4, "foo"); + // */test("S_TZ__eFoo_IfwBarYIf", new S_TZ__eFoo_IfwBarYIf[D], 4, "bar"); + /* */test("S_TZ__eFooX__ ", new S_TZ__eFooX__ [D], 3, "sub"); + /* */test("S_TZ__eFooX__wBar___", new S_TZ__eFooX__wBar___[D], 4, "sub"); + /* */test("S_TZ__eFooX__wBar__f", new S_TZ__eFooX__wBar__f[D], 4, "bar"); + /* */test("S_TZ__eFooX__wBar_I_", new S_TZ__eFooX__wBar_I_[D], 4, "sub"); + /* */test("S_TZ__eFooX__wBar_If", new S_TZ__eFooX__wBar_If[D], 4, "bar"); + /* */test("S_TZ__eFooX__wBarY__", new S_TZ__eFooX__wBarY__[D], 4, "sub"); + /* */test("S_TZ__eFooX__wBarY_f", new S_TZ__eFooX__wBarY_f[D], 4, "bar"); + /* */test("S_TZ__eFooX__wBarYI_", new S_TZ__eFooX__wBarYI_[D], 4, "sub"); + /* */test("S_TZ__eFooX__wBarYIf", new S_TZ__eFooX__wBarYIf[D], 4, "bar"); + /* */test("S_TZ__eFooX_f ", new S_TZ__eFooX_f [D], 3, "foo"); + /* */test("S_TZ__eFooX_fwBar___", new S_TZ__eFooX_fwBar___[D], 4, "foo"); + // */test("S_TZ__eFooX_fwBar__f", new S_TZ__eFooX_fwBar__f[D], 4, "bar"); + /* */test("S_TZ__eFooX_fwBar_I_", new S_TZ__eFooX_fwBar_I_[D], 4, "foo"); + // */test("S_TZ__eFooX_fwBar_If", new S_TZ__eFooX_fwBar_If[D], 4, "bar"); + /* */test("S_TZ__eFooX_fwBarY__", new S_TZ__eFooX_fwBarY__[D], 4, "foo"); + // */test("S_TZ__eFooX_fwBarY_f", new S_TZ__eFooX_fwBarY_f[D], 4, "bar"); + /* */test("S_TZ__eFooX_fwBarYI_", new S_TZ__eFooX_fwBarYI_[D], 4, "foo"); + // */test("S_TZ__eFooX_fwBarYIf", new S_TZ__eFooX_fwBarYIf[D], 4, "bar"); + /* */test("S_TZ__eFooXI_ ", new S_TZ__eFooXI_ [D], 3, "sub"); + /* */test("S_TZ__eFooXI_wBar___", new S_TZ__eFooXI_wBar___[D], 4, "sub"); + /* */test("S_TZ__eFooXI_wBar__f", new S_TZ__eFooXI_wBar__f[D], 4, "bar"); + // */test("S_TZ__eFooXI_wBar_I_", new S_TZ__eFooXI_wBar_I_[D], 4, "sub"); + // */test("S_TZ__eFooXI_wBar_If", new S_TZ__eFooXI_wBar_If[D], 4, "bar"); + /* */test("S_TZ__eFooXI_wBarY__", new S_TZ__eFooXI_wBarY__[D], 4, "sub"); + /* */test("S_TZ__eFooXI_wBarY_f", new S_TZ__eFooXI_wBarY_f[D], 4, "bar"); + // */test("S_TZ__eFooXI_wBarYI_", new S_TZ__eFooXI_wBarYI_[D], 4, "sub"); + // */test("S_TZ__eFooXI_wBarYIf", new S_TZ__eFooXI_wBarYIf[D], 4, "bar"); + /* */test("S_TZ__eFooXIf ", new S_TZ__eFooXIf [D], 3, "foo"); + /* */test("S_TZ__eFooXIfwBar___", new S_TZ__eFooXIfwBar___[D], 4, "foo"); + // */test("S_TZ__eFooXIfwBar__f", new S_TZ__eFooXIfwBar__f[D], 4, "bar"); + // */test("S_TZ__eFooXIfwBar_I_", new S_TZ__eFooXIfwBar_I_[D], 4, "foo"); + // */test("S_TZ__eFooXIfwBar_If", new S_TZ__eFooXIfwBar_If[D], 4, "bar"); + /* */test("S_TZ__eFooXIfwBarY__", new S_TZ__eFooXIfwBarY__[D], 4, "foo"); + // */test("S_TZ__eFooXIfwBarY_f", new S_TZ__eFooXIfwBarY_f[D], 4, "bar"); + // */test("S_TZ__eFooXIfwBarYI_", new S_TZ__eFooXIfwBarYI_[D], 4, "foo"); + // */test("S_TZ__eFooXIfwBarYIf", new S_TZ__eFooXIfwBarYIf[D], 4, "bar"); + + /* */test("S_TZ_feFoo___ ", new S_TZ_feFoo___ [D], 3, "mix"); + /* */test("S_TZ_feFoo___wBar___", new S_TZ_feFoo___wBar___[D], 4, "mix"); + /* */test("S_TZ_feFoo___wBar__f", new S_TZ_feFoo___wBar__f[D], 4, "mix"); + /* */test("S_TZ_feFoo___wBar_I_", new S_TZ_feFoo___wBar_I_[D], 4, "mix"); + /* */test("S_TZ_feFoo___wBar_If", new S_TZ_feFoo___wBar_If[D], 4, "mix"); + /* */test("S_TZ_feFoo___wBarY__", new S_TZ_feFoo___wBarY__[D], 4, "mix"); + /* */test("S_TZ_feFoo___wBarY_f", new S_TZ_feFoo___wBarY_f[D], 4, "mix"); + /* */test("S_TZ_feFoo___wBarYI_", new S_TZ_feFoo___wBarYI_[D], 4, "mix"); + /* */test("S_TZ_feFoo___wBarYIf", new S_TZ_feFoo___wBarYIf[D], 4, "mix"); + /* */test("S_TZ_feFoo__f ", new S_TZ_feFoo__f [D], 3, "mix"); + /* */test("S_TZ_feFoo__fwBar___", new S_TZ_feFoo__fwBar___[D], 4, "mix"); + /* */test("S_TZ_feFoo__fwBar__f", new S_TZ_feFoo__fwBar__f[D], 4, "mix"); + /* */test("S_TZ_feFoo__fwBar_I_", new S_TZ_feFoo__fwBar_I_[D], 4, "mix"); + /* */test("S_TZ_feFoo__fwBar_If", new S_TZ_feFoo__fwBar_If[D], 4, "mix"); + /* */test("S_TZ_feFoo__fwBarY__", new S_TZ_feFoo__fwBarY__[D], 4, "mix"); + /* */test("S_TZ_feFoo__fwBarY_f", new S_TZ_feFoo__fwBarY_f[D], 4, "mix"); + /* */test("S_TZ_feFoo__fwBarYI_", new S_TZ_feFoo__fwBarYI_[D], 4, "mix"); + /* */test("S_TZ_feFoo__fwBarYIf", new S_TZ_feFoo__fwBarYIf[D], 4, "mix"); + /* */test("S_TZ_feFoo_I_ ", new S_TZ_feFoo_I_ [D], 3, "mix"); + /* */test("S_TZ_feFoo_I_wBar___", new S_TZ_feFoo_I_wBar___[D], 4, "mix"); + /* */test("S_TZ_feFoo_I_wBar__f", new S_TZ_feFoo_I_wBar__f[D], 4, "mix"); + // */test("S_TZ_feFoo_I_wBar_I_", new S_TZ_feFoo_I_wBar_I_[D], 4, "mix"); + // */test("S_TZ_feFoo_I_wBar_If", new S_TZ_feFoo_I_wBar_If[D], 4, "mix"); + /* */test("S_TZ_feFoo_I_wBarY__", new S_TZ_feFoo_I_wBarY__[D], 4, "mix"); + /* */test("S_TZ_feFoo_I_wBarY_f", new S_TZ_feFoo_I_wBarY_f[D], 4, "mix"); + // */test("S_TZ_feFoo_I_wBarYI_", new S_TZ_feFoo_I_wBarYI_[D], 4, "mix"); + // */test("S_TZ_feFoo_I_wBarYIf", new S_TZ_feFoo_I_wBarYIf[D], 4, "mix"); + /* */test("S_TZ_feFoo_If ", new S_TZ_feFoo_If [D], 3, "mix"); + /* */test("S_TZ_feFoo_IfwBar___", new S_TZ_feFoo_IfwBar___[D], 4, "mix"); + /* */test("S_TZ_feFoo_IfwBar__f", new S_TZ_feFoo_IfwBar__f[D], 4, "mix"); + // */test("S_TZ_feFoo_IfwBar_I_", new S_TZ_feFoo_IfwBar_I_[D], 4, "mix"); + // */test("S_TZ_feFoo_IfwBar_If", new S_TZ_feFoo_IfwBar_If[D], 4, "mix"); + /* */test("S_TZ_feFoo_IfwBarY__", new S_TZ_feFoo_IfwBarY__[D], 4, "mix"); + /* */test("S_TZ_feFoo_IfwBarY_f", new S_TZ_feFoo_IfwBarY_f[D], 4, "mix"); + // */test("S_TZ_feFoo_IfwBarYI_", new S_TZ_feFoo_IfwBarYI_[D], 4, "mix"); + // */test("S_TZ_feFoo_IfwBarYIf", new S_TZ_feFoo_IfwBarYIf[D], 4, "mix"); + /* */test("S_TZ_feFooX__ ", new S_TZ_feFooX__ [D], 3, "mix"); + /* */test("S_TZ_feFooX__wBar___", new S_TZ_feFooX__wBar___[D], 4, "mix"); + /* */test("S_TZ_feFooX__wBar__f", new S_TZ_feFooX__wBar__f[D], 4, "mix"); + /* */test("S_TZ_feFooX__wBar_I_", new S_TZ_feFooX__wBar_I_[D], 4, "mix"); + /* */test("S_TZ_feFooX__wBar_If", new S_TZ_feFooX__wBar_If[D], 4, "mix"); + /* */test("S_TZ_feFooX__wBarY__", new S_TZ_feFooX__wBarY__[D], 4, "mix"); + /* */test("S_TZ_feFooX__wBarY_f", new S_TZ_feFooX__wBarY_f[D], 4, "mix"); + /* */test("S_TZ_feFooX__wBarYI_", new S_TZ_feFooX__wBarYI_[D], 4, "mix"); + /* */test("S_TZ_feFooX__wBarYIf", new S_TZ_feFooX__wBarYIf[D], 4, "mix"); + /* */test("S_TZ_feFooX_f ", new S_TZ_feFooX_f [D], 3, "mix"); + /* */test("S_TZ_feFooX_fwBar___", new S_TZ_feFooX_fwBar___[D], 4, "mix"); + /* */test("S_TZ_feFooX_fwBar__f", new S_TZ_feFooX_fwBar__f[D], 4, "mix"); + /* */test("S_TZ_feFooX_fwBar_I_", new S_TZ_feFooX_fwBar_I_[D], 4, "mix"); + /* */test("S_TZ_feFooX_fwBar_If", new S_TZ_feFooX_fwBar_If[D], 4, "mix"); + /* */test("S_TZ_feFooX_fwBarY__", new S_TZ_feFooX_fwBarY__[D], 4, "mix"); + /* */test("S_TZ_feFooX_fwBarY_f", new S_TZ_feFooX_fwBarY_f[D], 4, "mix"); + /* */test("S_TZ_feFooX_fwBarYI_", new S_TZ_feFooX_fwBarYI_[D], 4, "mix"); + /* */test("S_TZ_feFooX_fwBarYIf", new S_TZ_feFooX_fwBarYIf[D], 4, "mix"); + /* */test("S_TZ_feFooXI_ ", new S_TZ_feFooXI_ [D], 3, "mix"); + /* */test("S_TZ_feFooXI_wBar___", new S_TZ_feFooXI_wBar___[D], 4, "mix"); + /* */test("S_TZ_feFooXI_wBar__f", new S_TZ_feFooXI_wBar__f[D], 4, "mix"); + // */test("S_TZ_feFooXI_wBar_I_", new S_TZ_feFooXI_wBar_I_[D], 4, "mix"); + // */test("S_TZ_feFooXI_wBar_If", new S_TZ_feFooXI_wBar_If[D], 4, "mix"); + /* */test("S_TZ_feFooXI_wBarY__", new S_TZ_feFooXI_wBarY__[D], 4, "mix"); + /* */test("S_TZ_feFooXI_wBarY_f", new S_TZ_feFooXI_wBarY_f[D], 4, "mix"); + // */test("S_TZ_feFooXI_wBarYI_", new S_TZ_feFooXI_wBarYI_[D], 4, "mix"); + // */test("S_TZ_feFooXI_wBarYIf", new S_TZ_feFooXI_wBarYIf[D], 4, "mix"); + /* */test("S_TZ_feFooXIf ", new S_TZ_feFooXIf [D], 3, "mix"); + /* */test("S_TZ_feFooXIfwBar___", new S_TZ_feFooXIfwBar___[D], 4, "mix"); + /* */test("S_TZ_feFooXIfwBar__f", new S_TZ_feFooXIfwBar__f[D], 4, "mix"); + // */test("S_TZ_feFooXIfwBar_I_", new S_TZ_feFooXIfwBar_I_[D], 4, "mix"); + // */test("S_TZ_feFooXIfwBar_If", new S_TZ_feFooXIfwBar_If[D], 4, "mix"); + /* */test("S_TZ_feFooXIfwBarY__", new S_TZ_feFooXIfwBarY__[D], 4, "mix"); + /* */test("S_TZ_feFooXIfwBarY_f", new S_TZ_feFooXIfwBarY_f[D], 4, "mix"); + // */test("S_TZ_feFooXIfwBarYI_", new S_TZ_feFooXIfwBarYI_[D], 4, "mix"); + // */test("S_TZ_feFooXIfwBarYIf", new S_TZ_feFooXIfwBarYIf[D], 4, "mix"); + + /* */test("S_TZI_eFoo___ ", new S_TZI_eFoo___ [D], 3, "sub"); + /* */test("S_TZI_eFoo___wBar___", new S_TZI_eFoo___wBar___[D], 4, "sub"); + /* */test("S_TZI_eFoo___wBar__f", new S_TZI_eFoo___wBar__f[D], 4, "bar"); + // */test("S_TZI_eFoo___wBar_I_", new S_TZI_eFoo___wBar_I_[D], 4, "sub"); + // */test("S_TZI_eFoo___wBar_If", new S_TZI_eFoo___wBar_If[D], 4, "bar"); + /* */test("S_TZI_eFoo___wBarY__", new S_TZI_eFoo___wBarY__[D], 4, "sub"); + /* */test("S_TZI_eFoo___wBarY_f", new S_TZI_eFoo___wBarY_f[D], 4, "bar"); + // */test("S_TZI_eFoo___wBarYI_", new S_TZI_eFoo___wBarYI_[D], 4, "sub"); + // */test("S_TZI_eFoo___wBarYIf", new S_TZI_eFoo___wBarYIf[D], 4, "bar"); + /* */test("S_TZI_eFoo__f ", new S_TZI_eFoo__f [D], 3, "foo"); + /* */test("S_TZI_eFoo__fwBar___", new S_TZI_eFoo__fwBar___[D], 4, "foo"); + // */test("S_TZI_eFoo__fwBar__f", new S_TZI_eFoo__fwBar__f[D], 4, "bar"); + // */test("S_TZI_eFoo__fwBar_I_", new S_TZI_eFoo__fwBar_I_[D], 4, "foo"); + // */test("S_TZI_eFoo__fwBar_If", new S_TZI_eFoo__fwBar_If[D], 4, "bar"); + /* */test("S_TZI_eFoo__fwBarY__", new S_TZI_eFoo__fwBarY__[D], 4, "foo"); + // */test("S_TZI_eFoo__fwBarY_f", new S_TZI_eFoo__fwBarY_f[D], 4, "bar"); + // */test("S_TZI_eFoo__fwBarYI_", new S_TZI_eFoo__fwBarYI_[D], 4, "foo"); + // */test("S_TZI_eFoo__fwBarYIf", new S_TZI_eFoo__fwBarYIf[D], 4, "bar"); + // */test("S_TZI_eFoo_I_ ", new S_TZI_eFoo_I_ [D], 3, "sub"); + // */test("S_TZI_eFoo_I_wBar___", new S_TZI_eFoo_I_wBar___[D], 4, "sub"); + // */test("S_TZI_eFoo_I_wBar__f", new S_TZI_eFoo_I_wBar__f[D], 4, "bar"); + // */test("S_TZI_eFoo_I_wBar_I_", new S_TZI_eFoo_I_wBar_I_[D], 4, "sub"); + // */test("S_TZI_eFoo_I_wBar_If", new S_TZI_eFoo_I_wBar_If[D], 4, "bar"); + // */test("S_TZI_eFoo_I_wBarY__", new S_TZI_eFoo_I_wBarY__[D], 4, "sub"); + // */test("S_TZI_eFoo_I_wBarY_f", new S_TZI_eFoo_I_wBarY_f[D], 4, "bar"); + // */test("S_TZI_eFoo_I_wBarYI_", new S_TZI_eFoo_I_wBarYI_[D], 4, "sub"); + // */test("S_TZI_eFoo_I_wBarYIf", new S_TZI_eFoo_I_wBarYIf[D], 4, "bar"); + // */test("S_TZI_eFoo_If ", new S_TZI_eFoo_If [D], 3, "foo"); + // */test("S_TZI_eFoo_IfwBar___", new S_TZI_eFoo_IfwBar___[D], 4, "foo"); + // */test("S_TZI_eFoo_IfwBar__f", new S_TZI_eFoo_IfwBar__f[D], 4, "bar"); + // */test("S_TZI_eFoo_IfwBar_I_", new S_TZI_eFoo_IfwBar_I_[D], 4, "foo"); + // */test("S_TZI_eFoo_IfwBar_If", new S_TZI_eFoo_IfwBar_If[D], 4, "bar"); + // */test("S_TZI_eFoo_IfwBarY__", new S_TZI_eFoo_IfwBarY__[D], 4, "foo"); + // */test("S_TZI_eFoo_IfwBarY_f", new S_TZI_eFoo_IfwBarY_f[D], 4, "bar"); + // */test("S_TZI_eFoo_IfwBarYI_", new S_TZI_eFoo_IfwBarYI_[D], 4, "foo"); + // */test("S_TZI_eFoo_IfwBarYIf", new S_TZI_eFoo_IfwBarYIf[D], 4, "bar"); + /* */test("S_TZI_eFooX__ ", new S_TZI_eFooX__ [D], 3, "sub"); + /* */test("S_TZI_eFooX__wBar___", new S_TZI_eFooX__wBar___[D], 4, "sub"); + /* */test("S_TZI_eFooX__wBar__f", new S_TZI_eFooX__wBar__f[D], 4, "bar"); + // */test("S_TZI_eFooX__wBar_I_", new S_TZI_eFooX__wBar_I_[D], 4, "sub"); + // */test("S_TZI_eFooX__wBar_If", new S_TZI_eFooX__wBar_If[D], 4, "bar"); + /* */test("S_TZI_eFooX__wBarY__", new S_TZI_eFooX__wBarY__[D], 4, "sub"); + /* */test("S_TZI_eFooX__wBarY_f", new S_TZI_eFooX__wBarY_f[D], 4, "bar"); + // */test("S_TZI_eFooX__wBarYI_", new S_TZI_eFooX__wBarYI_[D], 4, "sub"); + // */test("S_TZI_eFooX__wBarYIf", new S_TZI_eFooX__wBarYIf[D], 4, "bar"); + /* */test("S_TZI_eFooX_f ", new S_TZI_eFooX_f [D], 3, "foo"); + /* */test("S_TZI_eFooX_fwBar___", new S_TZI_eFooX_fwBar___[D], 4, "foo"); + // */test("S_TZI_eFooX_fwBar__f", new S_TZI_eFooX_fwBar__f[D], 4, "bar"); + // */test("S_TZI_eFooX_fwBar_I_", new S_TZI_eFooX_fwBar_I_[D], 4, "foo"); + // */test("S_TZI_eFooX_fwBar_If", new S_TZI_eFooX_fwBar_If[D], 4, "bar"); + /* */test("S_TZI_eFooX_fwBarY__", new S_TZI_eFooX_fwBarY__[D], 4, "foo"); + // */test("S_TZI_eFooX_fwBarY_f", new S_TZI_eFooX_fwBarY_f[D], 4, "bar"); + // */test("S_TZI_eFooX_fwBarYI_", new S_TZI_eFooX_fwBarYI_[D], 4, "foo"); + // */test("S_TZI_eFooX_fwBarYIf", new S_TZI_eFooX_fwBarYIf[D], 4, "bar"); + // */test("S_TZI_eFooXI_ ", new S_TZI_eFooXI_ [D], 3, "sub"); + // */test("S_TZI_eFooXI_wBar___", new S_TZI_eFooXI_wBar___[D], 4, "sub"); + // */test("S_TZI_eFooXI_wBar__f", new S_TZI_eFooXI_wBar__f[D], 4, "bar"); + // */test("S_TZI_eFooXI_wBar_I_", new S_TZI_eFooXI_wBar_I_[D], 4, "sub"); + // */test("S_TZI_eFooXI_wBar_If", new S_TZI_eFooXI_wBar_If[D], 4, "bar"); + // */test("S_TZI_eFooXI_wBarY__", new S_TZI_eFooXI_wBarY__[D], 4, "sub"); + // */test("S_TZI_eFooXI_wBarY_f", new S_TZI_eFooXI_wBarY_f[D], 4, "bar"); + // */test("S_TZI_eFooXI_wBarYI_", new S_TZI_eFooXI_wBarYI_[D], 4, "sub"); + // */test("S_TZI_eFooXI_wBarYIf", new S_TZI_eFooXI_wBarYIf[D], 4, "bar"); + // */test("S_TZI_eFooXIf ", new S_TZI_eFooXIf [D], 3, "foo"); + // */test("S_TZI_eFooXIfwBar___", new S_TZI_eFooXIfwBar___[D], 4, "foo"); + // */test("S_TZI_eFooXIfwBar__f", new S_TZI_eFooXIfwBar__f[D], 4, "bar"); + // */test("S_TZI_eFooXIfwBar_I_", new S_TZI_eFooXIfwBar_I_[D], 4, "foo"); + // */test("S_TZI_eFooXIfwBar_If", new S_TZI_eFooXIfwBar_If[D], 4, "bar"); + // */test("S_TZI_eFooXIfwBarY__", new S_TZI_eFooXIfwBarY__[D], 4, "foo"); + // */test("S_TZI_eFooXIfwBarY_f", new S_TZI_eFooXIfwBarY_f[D], 4, "bar"); + // */test("S_TZI_eFooXIfwBarYI_", new S_TZI_eFooXIfwBarYI_[D], 4, "foo"); + // */test("S_TZI_eFooXIfwBarYIf", new S_TZI_eFooXIfwBarYIf[D], 4, "bar"); + + /* */test("S_TZIfeFoo___ ", new S_TZIfeFoo___ [D], 3, "mix"); + /* */test("S_TZIfeFoo___wBar___", new S_TZIfeFoo___wBar___[D], 4, "mix"); + /* */test("S_TZIfeFoo___wBar__f", new S_TZIfeFoo___wBar__f[D], 4, "mix"); + // */test("S_TZIfeFoo___wBar_I_", new S_TZIfeFoo___wBar_I_[D], 4, "mix"); + // */test("S_TZIfeFoo___wBar_If", new S_TZIfeFoo___wBar_If[D], 4, "mix"); + /* */test("S_TZIfeFoo___wBarY__", new S_TZIfeFoo___wBarY__[D], 4, "mix"); + /* */test("S_TZIfeFoo___wBarY_f", new S_TZIfeFoo___wBarY_f[D], 4, "mix"); + // */test("S_TZIfeFoo___wBarYI_", new S_TZIfeFoo___wBarYI_[D], 4, "mix"); + // */test("S_TZIfeFoo___wBarYIf", new S_TZIfeFoo___wBarYIf[D], 4, "mix"); + /* */test("S_TZIfeFoo__f ", new S_TZIfeFoo__f [D], 3, "mix"); + /* */test("S_TZIfeFoo__fwBar___", new S_TZIfeFoo__fwBar___[D], 4, "mix"); + /* */test("S_TZIfeFoo__fwBar__f", new S_TZIfeFoo__fwBar__f[D], 4, "mix"); + // */test("S_TZIfeFoo__fwBar_I_", new S_TZIfeFoo__fwBar_I_[D], 4, "mix"); + // */test("S_TZIfeFoo__fwBar_If", new S_TZIfeFoo__fwBar_If[D], 4, "mix"); + /* */test("S_TZIfeFoo__fwBarY__", new S_TZIfeFoo__fwBarY__[D], 4, "mix"); + /* */test("S_TZIfeFoo__fwBarY_f", new S_TZIfeFoo__fwBarY_f[D], 4, "mix"); + // */test("S_TZIfeFoo__fwBarYI_", new S_TZIfeFoo__fwBarYI_[D], 4, "mix"); + // */test("S_TZIfeFoo__fwBarYIf", new S_TZIfeFoo__fwBarYIf[D], 4, "mix"); + // */test("S_TZIfeFoo_I_ ", new S_TZIfeFoo_I_ [D], 3, "mix"); + // */test("S_TZIfeFoo_I_wBar___", new S_TZIfeFoo_I_wBar___[D], 4, "mix"); + // */test("S_TZIfeFoo_I_wBar__f", new S_TZIfeFoo_I_wBar__f[D], 4, "mix"); + // */test("S_TZIfeFoo_I_wBar_I_", new S_TZIfeFoo_I_wBar_I_[D], 4, "mix"); + // */test("S_TZIfeFoo_I_wBar_If", new S_TZIfeFoo_I_wBar_If[D], 4, "mix"); + // */test("S_TZIfeFoo_I_wBarY__", new S_TZIfeFoo_I_wBarY__[D], 4, "mix"); + // */test("S_TZIfeFoo_I_wBarY_f", new S_TZIfeFoo_I_wBarY_f[D], 4, "mix"); + // */test("S_TZIfeFoo_I_wBarYI_", new S_TZIfeFoo_I_wBarYI_[D], 4, "mix"); + // */test("S_TZIfeFoo_I_wBarYIf", new S_TZIfeFoo_I_wBarYIf[D], 4, "mix"); + // */test("S_TZIfeFoo_If ", new S_TZIfeFoo_If [D], 3, "mix"); + // */test("S_TZIfeFoo_IfwBar___", new S_TZIfeFoo_IfwBar___[D], 4, "mix"); + // */test("S_TZIfeFoo_IfwBar__f", new S_TZIfeFoo_IfwBar__f[D], 4, "mix"); + // */test("S_TZIfeFoo_IfwBar_I_", new S_TZIfeFoo_IfwBar_I_[D], 4, "mix"); + // */test("S_TZIfeFoo_IfwBar_If", new S_TZIfeFoo_IfwBar_If[D], 4, "mix"); + // */test("S_TZIfeFoo_IfwBarY__", new S_TZIfeFoo_IfwBarY__[D], 4, "mix"); + // */test("S_TZIfeFoo_IfwBarY_f", new S_TZIfeFoo_IfwBarY_f[D], 4, "mix"); + // */test("S_TZIfeFoo_IfwBarYI_", new S_TZIfeFoo_IfwBarYI_[D], 4, "mix"); + // */test("S_TZIfeFoo_IfwBarYIf", new S_TZIfeFoo_IfwBarYIf[D], 4, "mix"); + /* */test("S_TZIfeFooX__ ", new S_TZIfeFooX__ [D], 3, "mix"); + /* */test("S_TZIfeFooX__wBar___", new S_TZIfeFooX__wBar___[D], 4, "mix"); + /* */test("S_TZIfeFooX__wBar__f", new S_TZIfeFooX__wBar__f[D], 4, "mix"); + // */test("S_TZIfeFooX__wBar_I_", new S_TZIfeFooX__wBar_I_[D], 4, "mix"); + // */test("S_TZIfeFooX__wBar_If", new S_TZIfeFooX__wBar_If[D], 4, "mix"); + /* */test("S_TZIfeFooX__wBarY__", new S_TZIfeFooX__wBarY__[D], 4, "mix"); + /* */test("S_TZIfeFooX__wBarY_f", new S_TZIfeFooX__wBarY_f[D], 4, "mix"); + // */test("S_TZIfeFooX__wBarYI_", new S_TZIfeFooX__wBarYI_[D], 4, "mix"); + // */test("S_TZIfeFooX__wBarYIf", new S_TZIfeFooX__wBarYIf[D], 4, "mix"); + /* */test("S_TZIfeFooX_f ", new S_TZIfeFooX_f [D], 3, "mix"); + /* */test("S_TZIfeFooX_fwBar___", new S_TZIfeFooX_fwBar___[D], 4, "mix"); + /* */test("S_TZIfeFooX_fwBar__f", new S_TZIfeFooX_fwBar__f[D], 4, "mix"); + // */test("S_TZIfeFooX_fwBar_I_", new S_TZIfeFooX_fwBar_I_[D], 4, "mix"); + // */test("S_TZIfeFooX_fwBar_If", new S_TZIfeFooX_fwBar_If[D], 4, "mix"); + /* */test("S_TZIfeFooX_fwBarY__", new S_TZIfeFooX_fwBarY__[D], 4, "mix"); + /* */test("S_TZIfeFooX_fwBarY_f", new S_TZIfeFooX_fwBarY_f[D], 4, "mix"); + // */test("S_TZIfeFooX_fwBarYI_", new S_TZIfeFooX_fwBarYI_[D], 4, "mix"); + // */test("S_TZIfeFooX_fwBarYIf", new S_TZIfeFooX_fwBarYIf[D], 4, "mix"); + // */test("S_TZIfeFooXI_ ", new S_TZIfeFooXI_ [D], 3, "mix"); + // */test("S_TZIfeFooXI_wBar___", new S_TZIfeFooXI_wBar___[D], 4, "mix"); + // */test("S_TZIfeFooXI_wBar__f", new S_TZIfeFooXI_wBar__f[D], 4, "mix"); + // */test("S_TZIfeFooXI_wBar_I_", new S_TZIfeFooXI_wBar_I_[D], 4, "mix"); + // */test("S_TZIfeFooXI_wBar_If", new S_TZIfeFooXI_wBar_If[D], 4, "mix"); + // */test("S_TZIfeFooXI_wBarY__", new S_TZIfeFooXI_wBarY__[D], 4, "mix"); + // */test("S_TZIfeFooXI_wBarY_f", new S_TZIfeFooXI_wBarY_f[D], 4, "mix"); + // */test("S_TZIfeFooXI_wBarYI_", new S_TZIfeFooXI_wBarYI_[D], 4, "mix"); + // */test("S_TZIfeFooXI_wBarYIf", new S_TZIfeFooXI_wBarYIf[D], 4, "mix"); + // */test("S_TZIfeFooXIf ", new S_TZIfeFooXIf [D], 3, "mix"); + // */test("S_TZIfeFooXIfwBar___", new S_TZIfeFooXIfwBar___[D], 4, "mix"); + // */test("S_TZIfeFooXIfwBar__f", new S_TZIfeFooXIfwBar__f[D], 4, "mix"); + // */test("S_TZIfeFooXIfwBar_I_", new S_TZIfeFooXIfwBar_I_[D], 4, "mix"); + // */test("S_TZIfeFooXIfwBar_If", new S_TZIfeFooXIfwBar_If[D], 4, "mix"); + // */test("S_TZIfeFooXIfwBarY__", new S_TZIfeFooXIfwBarY__[D], 4, "mix"); + // */test("S_TZIfeFooXIfwBarY_f", new S_TZIfeFooXIfwBarY_f[D], 4, "mix"); + // */test("S_TZIfeFooXIfwBarYI_", new S_TZIfeFooXIfwBarYI_[D], 4, "mix"); + // */test("S_TZIfeFooXIfwBarYIf", new S_TZIfeFooXIfwBarYIf[D], 4, "mix"); + + + + /* */test("S_T___wFoo___ ", new S_T___wFoo___ [D], 3, "sub"); + /* */test("S_T___wFoo___wBar___", new S_T___wFoo___wBar___[D], 4, "sub"); + /* */test("S_T___wFoo___wBar__f", new S_T___wFoo___wBar__f[D], 4, "bar"); + /* */test("S_T___wFoo___wBar_I_", new S_T___wFoo___wBar_I_[D], 4, "sub"); + /* */test("S_T___wFoo___wBar_If", new S_T___wFoo___wBar_If[D], 4, "bar"); + /* */test("S_T___wFoo___wBarY__", new S_T___wFoo___wBarY__[D], 4, "sub"); + /* */test("S_T___wFoo___wBarY_f", new S_T___wFoo___wBarY_f[D], 4, "bar"); + /* */test("S_T___wFoo___wBarYI_", new S_T___wFoo___wBarYI_[D], 4, "sub"); + /* */test("S_T___wFoo___wBarYIf", new S_T___wFoo___wBarYIf[D], 4, "bar"); + /* */test("S_T___wFoo__f ", new S_T___wFoo__f [D], 3, "foo"); + /* */test("S_T___wFoo__fwBar___", new S_T___wFoo__fwBar___[D], 4, "foo"); + // */test("S_T___wFoo__fwBar__f", new S_T___wFoo__fwBar__f[D], 4, "bar"); + /* */test("S_T___wFoo__fwBar_I_", new S_T___wFoo__fwBar_I_[D], 4, "foo"); + // */test("S_T___wFoo__fwBar_If", new S_T___wFoo__fwBar_If[D], 4, "bar"); + /* */test("S_T___wFoo__fwBarY__", new S_T___wFoo__fwBarY__[D], 4, "foo"); + // */test("S_T___wFoo__fwBarY_f", new S_T___wFoo__fwBarY_f[D], 4, "bar"); + /* */test("S_T___wFoo__fwBarYI_", new S_T___wFoo__fwBarYI_[D], 4, "foo"); + // */test("S_T___wFoo__fwBarYIf", new S_T___wFoo__fwBarYIf[D], 4, "bar"); + /* */test("S_T___wFoo_I_ ", new S_T___wFoo_I_ [D], 3, "sub"); + /* */test("S_T___wFoo_I_wBar___", new S_T___wFoo_I_wBar___[D], 4, "sub"); + /* */test("S_T___wFoo_I_wBar__f", new S_T___wFoo_I_wBar__f[D], 4, "bar"); + // */test("S_T___wFoo_I_wBar_I_", new S_T___wFoo_I_wBar_I_[D], 4, "sub"); + // */test("S_T___wFoo_I_wBar_If", new S_T___wFoo_I_wBar_If[D], 4, "bar"); + /* */test("S_T___wFoo_I_wBarY__", new S_T___wFoo_I_wBarY__[D], 4, "sub"); + /* */test("S_T___wFoo_I_wBarY_f", new S_T___wFoo_I_wBarY_f[D], 4, "bar"); + // */test("S_T___wFoo_I_wBarYI_", new S_T___wFoo_I_wBarYI_[D], 4, "sub"); + // */test("S_T___wFoo_I_wBarYIf", new S_T___wFoo_I_wBarYIf[D], 4, "bar"); + /* */test("S_T___wFoo_If ", new S_T___wFoo_If [D], 3, "foo"); + /* */test("S_T___wFoo_IfwBar___", new S_T___wFoo_IfwBar___[D], 4, "foo"); + // */test("S_T___wFoo_IfwBar__f", new S_T___wFoo_IfwBar__f[D], 4, "bar"); + // */test("S_T___wFoo_IfwBar_I_", new S_T___wFoo_IfwBar_I_[D], 4, "foo"); + // */test("S_T___wFoo_IfwBar_If", new S_T___wFoo_IfwBar_If[D], 4, "bar"); + /* */test("S_T___wFoo_IfwBarY__", new S_T___wFoo_IfwBarY__[D], 4, "foo"); + // */test("S_T___wFoo_IfwBarY_f", new S_T___wFoo_IfwBarY_f[D], 4, "bar"); + // */test("S_T___wFoo_IfwBarYI_", new S_T___wFoo_IfwBarYI_[D], 4, "foo"); + // */test("S_T___wFoo_IfwBarYIf", new S_T___wFoo_IfwBarYIf[D], 4, "bar"); + /* */test("S_T___wFooX__ ", new S_T___wFooX__ [D], 3, "sub"); + /* */test("S_T___wFooX__wBar___", new S_T___wFooX__wBar___[D], 4, "sub"); + /* */test("S_T___wFooX__wBar__f", new S_T___wFooX__wBar__f[D], 4, "bar"); + /* */test("S_T___wFooX__wBar_I_", new S_T___wFooX__wBar_I_[D], 4, "sub"); + /* */test("S_T___wFooX__wBar_If", new S_T___wFooX__wBar_If[D], 4, "bar"); + /* */test("S_T___wFooX__wBarY__", new S_T___wFooX__wBarY__[D], 4, "sub"); + /* */test("S_T___wFooX__wBarY_f", new S_T___wFooX__wBarY_f[D], 4, "bar"); + /* */test("S_T___wFooX__wBarYI_", new S_T___wFooX__wBarYI_[D], 4, "sub"); + /* */test("S_T___wFooX__wBarYIf", new S_T___wFooX__wBarYIf[D], 4, "bar"); + /* */test("S_T___wFooX_f ", new S_T___wFooX_f [D], 3, "foo"); + /* */test("S_T___wFooX_fwBar___", new S_T___wFooX_fwBar___[D], 4, "foo"); + // */test("S_T___wFooX_fwBar__f", new S_T___wFooX_fwBar__f[D], 4, "bar"); + /* */test("S_T___wFooX_fwBar_I_", new S_T___wFooX_fwBar_I_[D], 4, "foo"); + // */test("S_T___wFooX_fwBar_If", new S_T___wFooX_fwBar_If[D], 4, "bar"); + /* */test("S_T___wFooX_fwBarY__", new S_T___wFooX_fwBarY__[D], 4, "foo"); + // */test("S_T___wFooX_fwBarY_f", new S_T___wFooX_fwBarY_f[D], 4, "bar"); + /* */test("S_T___wFooX_fwBarYI_", new S_T___wFooX_fwBarYI_[D], 4, "foo"); + // */test("S_T___wFooX_fwBarYIf", new S_T___wFooX_fwBarYIf[D], 4, "bar"); + /* */test("S_T___wFooXI_ ", new S_T___wFooXI_ [D], 3, "sub"); + /* */test("S_T___wFooXI_wBar___", new S_T___wFooXI_wBar___[D], 4, "sub"); + /* */test("S_T___wFooXI_wBar__f", new S_T___wFooXI_wBar__f[D], 4, "bar"); + // */test("S_T___wFooXI_wBar_I_", new S_T___wFooXI_wBar_I_[D], 4, "sub"); + // */test("S_T___wFooXI_wBar_If", new S_T___wFooXI_wBar_If[D], 4, "bar"); + /* */test("S_T___wFooXI_wBarY__", new S_T___wFooXI_wBarY__[D], 4, "sub"); + /* */test("S_T___wFooXI_wBarY_f", new S_T___wFooXI_wBarY_f[D], 4, "bar"); + // */test("S_T___wFooXI_wBarYI_", new S_T___wFooXI_wBarYI_[D], 4, "sub"); + // */test("S_T___wFooXI_wBarYIf", new S_T___wFooXI_wBarYIf[D], 4, "bar"); + /* */test("S_T___wFooXIf ", new S_T___wFooXIf [D], 3, "foo"); + /* */test("S_T___wFooXIfwBar___", new S_T___wFooXIfwBar___[D], 4, "foo"); + // */test("S_T___wFooXIfwBar__f", new S_T___wFooXIfwBar__f[D], 4, "bar"); + // */test("S_T___wFooXIfwBar_I_", new S_T___wFooXIfwBar_I_[D], 4, "foo"); + // */test("S_T___wFooXIfwBar_If", new S_T___wFooXIfwBar_If[D], 4, "bar"); + /* */test("S_T___wFooXIfwBarY__", new S_T___wFooXIfwBarY__[D], 4, "foo"); + // */test("S_T___wFooXIfwBarY_f", new S_T___wFooXIfwBarY_f[D], 4, "bar"); + // */test("S_T___wFooXIfwBarYI_", new S_T___wFooXIfwBarYI_[D], 4, "foo"); + // */test("S_T___wFooXIfwBarYIf", new S_T___wFooXIfwBarYIf[D], 4, "bar"); + + /* */test("S_T__fwFoo___ ", new S_T__fwFoo___ [D], 3, "mix"); + /* */test("S_T__fwFoo___wBar___", new S_T__fwFoo___wBar___[D], 4, "mix"); + /* */test("S_T__fwFoo___wBar__f", new S_T__fwFoo___wBar__f[D], 4, "mix"); + /* */test("S_T__fwFoo___wBar_I_", new S_T__fwFoo___wBar_I_[D], 4, "mix"); + /* */test("S_T__fwFoo___wBar_If", new S_T__fwFoo___wBar_If[D], 4, "mix"); + /* */test("S_T__fwFoo___wBarY__", new S_T__fwFoo___wBarY__[D], 4, "mix"); + /* */test("S_T__fwFoo___wBarY_f", new S_T__fwFoo___wBarY_f[D], 4, "mix"); + /* */test("S_T__fwFoo___wBarYI_", new S_T__fwFoo___wBarYI_[D], 4, "mix"); + /* */test("S_T__fwFoo___wBarYIf", new S_T__fwFoo___wBarYIf[D], 4, "mix"); + /* */test("S_T__fwFoo__f ", new S_T__fwFoo__f [D], 3, "mix"); + /* */test("S_T__fwFoo__fwBar___", new S_T__fwFoo__fwBar___[D], 4, "mix"); + /* */test("S_T__fwFoo__fwBar__f", new S_T__fwFoo__fwBar__f[D], 4, "mix"); + /* */test("S_T__fwFoo__fwBar_I_", new S_T__fwFoo__fwBar_I_[D], 4, "mix"); + /* */test("S_T__fwFoo__fwBar_If", new S_T__fwFoo__fwBar_If[D], 4, "mix"); + /* */test("S_T__fwFoo__fwBarY__", new S_T__fwFoo__fwBarY__[D], 4, "mix"); + /* */test("S_T__fwFoo__fwBarY_f", new S_T__fwFoo__fwBarY_f[D], 4, "mix"); + /* */test("S_T__fwFoo__fwBarYI_", new S_T__fwFoo__fwBarYI_[D], 4, "mix"); + /* */test("S_T__fwFoo__fwBarYIf", new S_T__fwFoo__fwBarYIf[D], 4, "mix"); + /* */test("S_T__fwFoo_I_ ", new S_T__fwFoo_I_ [D], 3, "mix"); + /* */test("S_T__fwFoo_I_wBar___", new S_T__fwFoo_I_wBar___[D], 4, "mix"); + /* */test("S_T__fwFoo_I_wBar__f", new S_T__fwFoo_I_wBar__f[D], 4, "mix"); + // */test("S_T__fwFoo_I_wBar_I_", new S_T__fwFoo_I_wBar_I_[D], 4, "mix"); + // */test("S_T__fwFoo_I_wBar_If", new S_T__fwFoo_I_wBar_If[D], 4, "mix"); + /* */test("S_T__fwFoo_I_wBarY__", new S_T__fwFoo_I_wBarY__[D], 4, "mix"); + /* */test("S_T__fwFoo_I_wBarY_f", new S_T__fwFoo_I_wBarY_f[D], 4, "mix"); + // */test("S_T__fwFoo_I_wBarYI_", new S_T__fwFoo_I_wBarYI_[D], 4, "mix"); + // */test("S_T__fwFoo_I_wBarYIf", new S_T__fwFoo_I_wBarYIf[D], 4, "mix"); + /* */test("S_T__fwFoo_If ", new S_T__fwFoo_If [D], 3, "mix"); + /* */test("S_T__fwFoo_IfwBar___", new S_T__fwFoo_IfwBar___[D], 4, "mix"); + /* */test("S_T__fwFoo_IfwBar__f", new S_T__fwFoo_IfwBar__f[D], 4, "mix"); + // */test("S_T__fwFoo_IfwBar_I_", new S_T__fwFoo_IfwBar_I_[D], 4, "mix"); + // */test("S_T__fwFoo_IfwBar_If", new S_T__fwFoo_IfwBar_If[D], 4, "mix"); + /* */test("S_T__fwFoo_IfwBarY__", new S_T__fwFoo_IfwBarY__[D], 4, "mix"); + /* */test("S_T__fwFoo_IfwBarY_f", new S_T__fwFoo_IfwBarY_f[D], 4, "mix"); + // */test("S_T__fwFoo_IfwBarYI_", new S_T__fwFoo_IfwBarYI_[D], 4, "mix"); + // */test("S_T__fwFoo_IfwBarYIf", new S_T__fwFoo_IfwBarYIf[D], 4, "mix"); + /* */test("S_T__fwFooX__ ", new S_T__fwFooX__ [D], 3, "mix"); + /* */test("S_T__fwFooX__wBar___", new S_T__fwFooX__wBar___[D], 4, "mix"); + /* */test("S_T__fwFooX__wBar__f", new S_T__fwFooX__wBar__f[D], 4, "mix"); + /* */test("S_T__fwFooX__wBar_I_", new S_T__fwFooX__wBar_I_[D], 4, "mix"); + /* */test("S_T__fwFooX__wBar_If", new S_T__fwFooX__wBar_If[D], 4, "mix"); + /* */test("S_T__fwFooX__wBarY__", new S_T__fwFooX__wBarY__[D], 4, "mix"); + /* */test("S_T__fwFooX__wBarY_f", new S_T__fwFooX__wBarY_f[D], 4, "mix"); + /* */test("S_T__fwFooX__wBarYI_", new S_T__fwFooX__wBarYI_[D], 4, "mix"); + /* */test("S_T__fwFooX__wBarYIf", new S_T__fwFooX__wBarYIf[D], 4, "mix"); + /* */test("S_T__fwFooX_f ", new S_T__fwFooX_f [D], 3, "mix"); + /* */test("S_T__fwFooX_fwBar___", new S_T__fwFooX_fwBar___[D], 4, "mix"); + /* */test("S_T__fwFooX_fwBar__f", new S_T__fwFooX_fwBar__f[D], 4, "mix"); + /* */test("S_T__fwFooX_fwBar_I_", new S_T__fwFooX_fwBar_I_[D], 4, "mix"); + /* */test("S_T__fwFooX_fwBar_If", new S_T__fwFooX_fwBar_If[D], 4, "mix"); + /* */test("S_T__fwFooX_fwBarY__", new S_T__fwFooX_fwBarY__[D], 4, "mix"); + /* */test("S_T__fwFooX_fwBarY_f", new S_T__fwFooX_fwBarY_f[D], 4, "mix"); + /* */test("S_T__fwFooX_fwBarYI_", new S_T__fwFooX_fwBarYI_[D], 4, "mix"); + /* */test("S_T__fwFooX_fwBarYIf", new S_T__fwFooX_fwBarYIf[D], 4, "mix"); + /* */test("S_T__fwFooXI_ ", new S_T__fwFooXI_ [D], 3, "mix"); + /* */test("S_T__fwFooXI_wBar___", new S_T__fwFooXI_wBar___[D], 4, "mix"); + /* */test("S_T__fwFooXI_wBar__f", new S_T__fwFooXI_wBar__f[D], 4, "mix"); + // */test("S_T__fwFooXI_wBar_I_", new S_T__fwFooXI_wBar_I_[D], 4, "mix"); + // */test("S_T__fwFooXI_wBar_If", new S_T__fwFooXI_wBar_If[D], 4, "mix"); + /* */test("S_T__fwFooXI_wBarY__", new S_T__fwFooXI_wBarY__[D], 4, "mix"); + /* */test("S_T__fwFooXI_wBarY_f", new S_T__fwFooXI_wBarY_f[D], 4, "mix"); + // */test("S_T__fwFooXI_wBarYI_", new S_T__fwFooXI_wBarYI_[D], 4, "mix"); + // */test("S_T__fwFooXI_wBarYIf", new S_T__fwFooXI_wBarYIf[D], 4, "mix"); + /* */test("S_T__fwFooXIf ", new S_T__fwFooXIf [D], 3, "mix"); + /* */test("S_T__fwFooXIfwBar___", new S_T__fwFooXIfwBar___[D], 4, "mix"); + /* */test("S_T__fwFooXIfwBar__f", new S_T__fwFooXIfwBar__f[D], 4, "mix"); + // */test("S_T__fwFooXIfwBar_I_", new S_T__fwFooXIfwBar_I_[D], 4, "mix"); + // */test("S_T__fwFooXIfwBar_If", new S_T__fwFooXIfwBar_If[D], 4, "mix"); + /* */test("S_T__fwFooXIfwBarY__", new S_T__fwFooXIfwBarY__[D], 4, "mix"); + /* */test("S_T__fwFooXIfwBarY_f", new S_T__fwFooXIfwBarY_f[D], 4, "mix"); + // */test("S_T__fwFooXIfwBarYI_", new S_T__fwFooXIfwBarYI_[D], 4, "mix"); + // */test("S_T__fwFooXIfwBarYIf", new S_T__fwFooXIfwBarYIf[D], 4, "mix"); + + /* */test("S_T_I_wFoo___ ", new S_T_I_wFoo___ [D], 3, "sub"); + /* */test("S_T_I_wFoo___wBar___", new S_T_I_wFoo___wBar___[D], 4, "sub"); + /* */test("S_T_I_wFoo___wBar__f", new S_T_I_wFoo___wBar__f[D], 4, "bar"); + // */test("S_T_I_wFoo___wBar_I_", new S_T_I_wFoo___wBar_I_[D], 4, "sub"); + // */test("S_T_I_wFoo___wBar_If", new S_T_I_wFoo___wBar_If[D], 4, "bar"); + /* */test("S_T_I_wFoo___wBarY__", new S_T_I_wFoo___wBarY__[D], 4, "sub"); + /* */test("S_T_I_wFoo___wBarY_f", new S_T_I_wFoo___wBarY_f[D], 4, "bar"); + // */test("S_T_I_wFoo___wBarYI_", new S_T_I_wFoo___wBarYI_[D], 4, "sub"); + // */test("S_T_I_wFoo___wBarYIf", new S_T_I_wFoo___wBarYIf[D], 4, "bar"); + /* */test("S_T_I_wFoo__f ", new S_T_I_wFoo__f [D], 3, "foo"); + /* */test("S_T_I_wFoo__fwBar___", new S_T_I_wFoo__fwBar___[D], 4, "foo"); + // */test("S_T_I_wFoo__fwBar__f", new S_T_I_wFoo__fwBar__f[D], 4, "bar"); + // */test("S_T_I_wFoo__fwBar_I_", new S_T_I_wFoo__fwBar_I_[D], 4, "foo"); + // */test("S_T_I_wFoo__fwBar_If", new S_T_I_wFoo__fwBar_If[D], 4, "bar"); + /* */test("S_T_I_wFoo__fwBarY__", new S_T_I_wFoo__fwBarY__[D], 4, "foo"); + // */test("S_T_I_wFoo__fwBarY_f", new S_T_I_wFoo__fwBarY_f[D], 4, "bar"); + // */test("S_T_I_wFoo__fwBarYI_", new S_T_I_wFoo__fwBarYI_[D], 4, "foo"); + // */test("S_T_I_wFoo__fwBarYIf", new S_T_I_wFoo__fwBarYIf[D], 4, "bar"); + // */test("S_T_I_wFoo_I_ ", new S_T_I_wFoo_I_ [D], 3, "sub"); + // */test("S_T_I_wFoo_I_wBar___", new S_T_I_wFoo_I_wBar___[D], 4, "sub"); + // */test("S_T_I_wFoo_I_wBar__f", new S_T_I_wFoo_I_wBar__f[D], 4, "bar"); + // */test("S_T_I_wFoo_I_wBar_I_", new S_T_I_wFoo_I_wBar_I_[D], 4, "sub"); + // */test("S_T_I_wFoo_I_wBar_If", new S_T_I_wFoo_I_wBar_If[D], 4, "bar"); + // */test("S_T_I_wFoo_I_wBarY__", new S_T_I_wFoo_I_wBarY__[D], 4, "sub"); + // */test("S_T_I_wFoo_I_wBarY_f", new S_T_I_wFoo_I_wBarY_f[D], 4, "bar"); + // */test("S_T_I_wFoo_I_wBarYI_", new S_T_I_wFoo_I_wBarYI_[D], 4, "sub"); + // */test("S_T_I_wFoo_I_wBarYIf", new S_T_I_wFoo_I_wBarYIf[D], 4, "bar"); + // */test("S_T_I_wFoo_If ", new S_T_I_wFoo_If [D], 3, "foo"); + // */test("S_T_I_wFoo_IfwBar___", new S_T_I_wFoo_IfwBar___[D], 4, "foo"); + // */test("S_T_I_wFoo_IfwBar__f", new S_T_I_wFoo_IfwBar__f[D], 4, "bar"); + // */test("S_T_I_wFoo_IfwBar_I_", new S_T_I_wFoo_IfwBar_I_[D], 4, "foo"); + // */test("S_T_I_wFoo_IfwBar_If", new S_T_I_wFoo_IfwBar_If[D], 4, "bar"); + // */test("S_T_I_wFoo_IfwBarY__", new S_T_I_wFoo_IfwBarY__[D], 4, "foo"); + // */test("S_T_I_wFoo_IfwBarY_f", new S_T_I_wFoo_IfwBarY_f[D], 4, "bar"); + // */test("S_T_I_wFoo_IfwBarYI_", new S_T_I_wFoo_IfwBarYI_[D], 4, "foo"); + // */test("S_T_I_wFoo_IfwBarYIf", new S_T_I_wFoo_IfwBarYIf[D], 4, "bar"); + /* */test("S_T_I_wFooX__ ", new S_T_I_wFooX__ [D], 3, "sub"); + /* */test("S_T_I_wFooX__wBar___", new S_T_I_wFooX__wBar___[D], 4, "sub"); + /* */test("S_T_I_wFooX__wBar__f", new S_T_I_wFooX__wBar__f[D], 4, "bar"); + // */test("S_T_I_wFooX__wBar_I_", new S_T_I_wFooX__wBar_I_[D], 4, "sub"); + // */test("S_T_I_wFooX__wBar_If", new S_T_I_wFooX__wBar_If[D], 4, "bar"); + /* */test("S_T_I_wFooX__wBarY__", new S_T_I_wFooX__wBarY__[D], 4, "sub"); + /* */test("S_T_I_wFooX__wBarY_f", new S_T_I_wFooX__wBarY_f[D], 4, "bar"); + // */test("S_T_I_wFooX__wBarYI_", new S_T_I_wFooX__wBarYI_[D], 4, "sub"); + // */test("S_T_I_wFooX__wBarYIf", new S_T_I_wFooX__wBarYIf[D], 4, "bar"); + /* */test("S_T_I_wFooX_f ", new S_T_I_wFooX_f [D], 3, "foo"); + /* */test("S_T_I_wFooX_fwBar___", new S_T_I_wFooX_fwBar___[D], 4, "foo"); + // */test("S_T_I_wFooX_fwBar__f", new S_T_I_wFooX_fwBar__f[D], 4, "bar"); + // */test("S_T_I_wFooX_fwBar_I_", new S_T_I_wFooX_fwBar_I_[D], 4, "foo"); + // */test("S_T_I_wFooX_fwBar_If", new S_T_I_wFooX_fwBar_If[D], 4, "bar"); + /* */test("S_T_I_wFooX_fwBarY__", new S_T_I_wFooX_fwBarY__[D], 4, "foo"); + // */test("S_T_I_wFooX_fwBarY_f", new S_T_I_wFooX_fwBarY_f[D], 4, "bar"); + // */test("S_T_I_wFooX_fwBarYI_", new S_T_I_wFooX_fwBarYI_[D], 4, "foo"); + // */test("S_T_I_wFooX_fwBarYIf", new S_T_I_wFooX_fwBarYIf[D], 4, "bar"); + // */test("S_T_I_wFooXI_ ", new S_T_I_wFooXI_ [D], 3, "sub"); + // */test("S_T_I_wFooXI_wBar___", new S_T_I_wFooXI_wBar___[D], 4, "sub"); + // */test("S_T_I_wFooXI_wBar__f", new S_T_I_wFooXI_wBar__f[D], 4, "bar"); + // */test("S_T_I_wFooXI_wBar_I_", new S_T_I_wFooXI_wBar_I_[D], 4, "sub"); + // */test("S_T_I_wFooXI_wBar_If", new S_T_I_wFooXI_wBar_If[D], 4, "bar"); + // */test("S_T_I_wFooXI_wBarY__", new S_T_I_wFooXI_wBarY__[D], 4, "sub"); + // */test("S_T_I_wFooXI_wBarY_f", new S_T_I_wFooXI_wBarY_f[D], 4, "bar"); + // */test("S_T_I_wFooXI_wBarYI_", new S_T_I_wFooXI_wBarYI_[D], 4, "sub"); + // */test("S_T_I_wFooXI_wBarYIf", new S_T_I_wFooXI_wBarYIf[D], 4, "bar"); + // */test("S_T_I_wFooXIf ", new S_T_I_wFooXIf [D], 3, "foo"); + // */test("S_T_I_wFooXIfwBar___", new S_T_I_wFooXIfwBar___[D], 4, "foo"); + // */test("S_T_I_wFooXIfwBar__f", new S_T_I_wFooXIfwBar__f[D], 4, "bar"); + // */test("S_T_I_wFooXIfwBar_I_", new S_T_I_wFooXIfwBar_I_[D], 4, "foo"); + // */test("S_T_I_wFooXIfwBar_If", new S_T_I_wFooXIfwBar_If[D], 4, "bar"); + // */test("S_T_I_wFooXIfwBarY__", new S_T_I_wFooXIfwBarY__[D], 4, "foo"); + // */test("S_T_I_wFooXIfwBarY_f", new S_T_I_wFooXIfwBarY_f[D], 4, "bar"); + // */test("S_T_I_wFooXIfwBarYI_", new S_T_I_wFooXIfwBarYI_[D], 4, "foo"); + // */test("S_T_I_wFooXIfwBarYIf", new S_T_I_wFooXIfwBarYIf[D], 4, "bar"); + + /* */test("S_T_IfwFoo___ ", new S_T_IfwFoo___ [D], 3, "mix"); + /* */test("S_T_IfwFoo___wBar___", new S_T_IfwFoo___wBar___[D], 4, "mix"); + /* */test("S_T_IfwFoo___wBar__f", new S_T_IfwFoo___wBar__f[D], 4, "mix"); + // */test("S_T_IfwFoo___wBar_I_", new S_T_IfwFoo___wBar_I_[D], 4, "mix"); + // */test("S_T_IfwFoo___wBar_If", new S_T_IfwFoo___wBar_If[D], 4, "mix"); + /* */test("S_T_IfwFoo___wBarY__", new S_T_IfwFoo___wBarY__[D], 4, "mix"); + /* */test("S_T_IfwFoo___wBarY_f", new S_T_IfwFoo___wBarY_f[D], 4, "mix"); + // */test("S_T_IfwFoo___wBarYI_", new S_T_IfwFoo___wBarYI_[D], 4, "mix"); + // */test("S_T_IfwFoo___wBarYIf", new S_T_IfwFoo___wBarYIf[D], 4, "mix"); + /* */test("S_T_IfwFoo__f ", new S_T_IfwFoo__f [D], 3, "mix"); + /* */test("S_T_IfwFoo__fwBar___", new S_T_IfwFoo__fwBar___[D], 4, "mix"); + /* */test("S_T_IfwFoo__fwBar__f", new S_T_IfwFoo__fwBar__f[D], 4, "mix"); + // */test("S_T_IfwFoo__fwBar_I_", new S_T_IfwFoo__fwBar_I_[D], 4, "mix"); + // */test("S_T_IfwFoo__fwBar_If", new S_T_IfwFoo__fwBar_If[D], 4, "mix"); + /* */test("S_T_IfwFoo__fwBarY__", new S_T_IfwFoo__fwBarY__[D], 4, "mix"); + /* */test("S_T_IfwFoo__fwBarY_f", new S_T_IfwFoo__fwBarY_f[D], 4, "mix"); + // */test("S_T_IfwFoo__fwBarYI_", new S_T_IfwFoo__fwBarYI_[D], 4, "mix"); + // */test("S_T_IfwFoo__fwBarYIf", new S_T_IfwFoo__fwBarYIf[D], 4, "mix"); + // */test("S_T_IfwFoo_I_ ", new S_T_IfwFoo_I_ [D], 3, "mix"); + // */test("S_T_IfwFoo_I_wBar___", new S_T_IfwFoo_I_wBar___[D], 4, "mix"); + // */test("S_T_IfwFoo_I_wBar__f", new S_T_IfwFoo_I_wBar__f[D], 4, "mix"); + // */test("S_T_IfwFoo_I_wBar_I_", new S_T_IfwFoo_I_wBar_I_[D], 4, "mix"); + // */test("S_T_IfwFoo_I_wBar_If", new S_T_IfwFoo_I_wBar_If[D], 4, "mix"); + // */test("S_T_IfwFoo_I_wBarY__", new S_T_IfwFoo_I_wBarY__[D], 4, "mix"); + // */test("S_T_IfwFoo_I_wBarY_f", new S_T_IfwFoo_I_wBarY_f[D], 4, "mix"); + // */test("S_T_IfwFoo_I_wBarYI_", new S_T_IfwFoo_I_wBarYI_[D], 4, "mix"); + // */test("S_T_IfwFoo_I_wBarYIf", new S_T_IfwFoo_I_wBarYIf[D], 4, "mix"); + // */test("S_T_IfwFoo_If ", new S_T_IfwFoo_If [D], 3, "mix"); + // */test("S_T_IfwFoo_IfwBar___", new S_T_IfwFoo_IfwBar___[D], 4, "mix"); + // */test("S_T_IfwFoo_IfwBar__f", new S_T_IfwFoo_IfwBar__f[D], 4, "mix"); + // */test("S_T_IfwFoo_IfwBar_I_", new S_T_IfwFoo_IfwBar_I_[D], 4, "mix"); + // */test("S_T_IfwFoo_IfwBar_If", new S_T_IfwFoo_IfwBar_If[D], 4, "mix"); + // */test("S_T_IfwFoo_IfwBarY__", new S_T_IfwFoo_IfwBarY__[D], 4, "mix"); + // */test("S_T_IfwFoo_IfwBarY_f", new S_T_IfwFoo_IfwBarY_f[D], 4, "mix"); + // */test("S_T_IfwFoo_IfwBarYI_", new S_T_IfwFoo_IfwBarYI_[D], 4, "mix"); + // */test("S_T_IfwFoo_IfwBarYIf", new S_T_IfwFoo_IfwBarYIf[D], 4, "mix"); + /* */test("S_T_IfwFooX__ ", new S_T_IfwFooX__ [D], 3, "mix"); + /* */test("S_T_IfwFooX__wBar___", new S_T_IfwFooX__wBar___[D], 4, "mix"); + /* */test("S_T_IfwFooX__wBar__f", new S_T_IfwFooX__wBar__f[D], 4, "mix"); + // */test("S_T_IfwFooX__wBar_I_", new S_T_IfwFooX__wBar_I_[D], 4, "mix"); + // */test("S_T_IfwFooX__wBar_If", new S_T_IfwFooX__wBar_If[D], 4, "mix"); + /* */test("S_T_IfwFooX__wBarY__", new S_T_IfwFooX__wBarY__[D], 4, "mix"); + /* */test("S_T_IfwFooX__wBarY_f", new S_T_IfwFooX__wBarY_f[D], 4, "mix"); + // */test("S_T_IfwFooX__wBarYI_", new S_T_IfwFooX__wBarYI_[D], 4, "mix"); + // */test("S_T_IfwFooX__wBarYIf", new S_T_IfwFooX__wBarYIf[D], 4, "mix"); + /* */test("S_T_IfwFooX_f ", new S_T_IfwFooX_f [D], 3, "mix"); + /* */test("S_T_IfwFooX_fwBar___", new S_T_IfwFooX_fwBar___[D], 4, "mix"); + /* */test("S_T_IfwFooX_fwBar__f", new S_T_IfwFooX_fwBar__f[D], 4, "mix"); + // */test("S_T_IfwFooX_fwBar_I_", new S_T_IfwFooX_fwBar_I_[D], 4, "mix"); + // */test("S_T_IfwFooX_fwBar_If", new S_T_IfwFooX_fwBar_If[D], 4, "mix"); + /* */test("S_T_IfwFooX_fwBarY__", new S_T_IfwFooX_fwBarY__[D], 4, "mix"); + /* */test("S_T_IfwFooX_fwBarY_f", new S_T_IfwFooX_fwBarY_f[D], 4, "mix"); + // */test("S_T_IfwFooX_fwBarYI_", new S_T_IfwFooX_fwBarYI_[D], 4, "mix"); + // */test("S_T_IfwFooX_fwBarYIf", new S_T_IfwFooX_fwBarYIf[D], 4, "mix"); + // */test("S_T_IfwFooXI_ ", new S_T_IfwFooXI_ [D], 3, "mix"); + // */test("S_T_IfwFooXI_wBar___", new S_T_IfwFooXI_wBar___[D], 4, "mix"); + // */test("S_T_IfwFooXI_wBar__f", new S_T_IfwFooXI_wBar__f[D], 4, "mix"); + // */test("S_T_IfwFooXI_wBar_I_", new S_T_IfwFooXI_wBar_I_[D], 4, "mix"); + // */test("S_T_IfwFooXI_wBar_If", new S_T_IfwFooXI_wBar_If[D], 4, "mix"); + // */test("S_T_IfwFooXI_wBarY__", new S_T_IfwFooXI_wBarY__[D], 4, "mix"); + // */test("S_T_IfwFooXI_wBarY_f", new S_T_IfwFooXI_wBarY_f[D], 4, "mix"); + // */test("S_T_IfwFooXI_wBarYI_", new S_T_IfwFooXI_wBarYI_[D], 4, "mix"); + // */test("S_T_IfwFooXI_wBarYIf", new S_T_IfwFooXI_wBarYIf[D], 4, "mix"); + // */test("S_T_IfwFooXIf ", new S_T_IfwFooXIf [D], 3, "mix"); + // */test("S_T_IfwFooXIfwBar___", new S_T_IfwFooXIfwBar___[D], 4, "mix"); + // */test("S_T_IfwFooXIfwBar__f", new S_T_IfwFooXIfwBar__f[D], 4, "mix"); + // */test("S_T_IfwFooXIfwBar_I_", new S_T_IfwFooXIfwBar_I_[D], 4, "mix"); + // */test("S_T_IfwFooXIfwBar_If", new S_T_IfwFooXIfwBar_If[D], 4, "mix"); + // */test("S_T_IfwFooXIfwBarY__", new S_T_IfwFooXIfwBarY__[D], 4, "mix"); + // */test("S_T_IfwFooXIfwBarY_f", new S_T_IfwFooXIfwBarY_f[D], 4, "mix"); + // */test("S_T_IfwFooXIfwBarYI_", new S_T_IfwFooXIfwBarYI_[D], 4, "mix"); + // */test("S_T_IfwFooXIfwBarYIf", new S_T_IfwFooXIfwBarYIf[D], 4, "mix"); + + /* */test("S_TZ__wFoo___ ", new S_TZ__wFoo___ [D], 3, "sub"); + /* */test("S_TZ__wFoo___wBar___", new S_TZ__wFoo___wBar___[D], 4, "sub"); + /* */test("S_TZ__wFoo___wBar__f", new S_TZ__wFoo___wBar__f[D], 4, "bar"); + /* */test("S_TZ__wFoo___wBar_I_", new S_TZ__wFoo___wBar_I_[D], 4, "sub"); + /* */test("S_TZ__wFoo___wBar_If", new S_TZ__wFoo___wBar_If[D], 4, "bar"); + /* */test("S_TZ__wFoo___wBarY__", new S_TZ__wFoo___wBarY__[D], 4, "sub"); + /* */test("S_TZ__wFoo___wBarY_f", new S_TZ__wFoo___wBarY_f[D], 4, "bar"); + /* */test("S_TZ__wFoo___wBarYI_", new S_TZ__wFoo___wBarYI_[D], 4, "sub"); + /* */test("S_TZ__wFoo___wBarYIf", new S_TZ__wFoo___wBarYIf[D], 4, "bar"); + /* */test("S_TZ__wFoo__f ", new S_TZ__wFoo__f [D], 3, "foo"); + /* */test("S_TZ__wFoo__fwBar___", new S_TZ__wFoo__fwBar___[D], 4, "foo"); + // */test("S_TZ__wFoo__fwBar__f", new S_TZ__wFoo__fwBar__f[D], 4, "bar"); + /* */test("S_TZ__wFoo__fwBar_I_", new S_TZ__wFoo__fwBar_I_[D], 4, "foo"); + // */test("S_TZ__wFoo__fwBar_If", new S_TZ__wFoo__fwBar_If[D], 4, "bar"); + /* */test("S_TZ__wFoo__fwBarY__", new S_TZ__wFoo__fwBarY__[D], 4, "foo"); + // */test("S_TZ__wFoo__fwBarY_f", new S_TZ__wFoo__fwBarY_f[D], 4, "bar"); + /* */test("S_TZ__wFoo__fwBarYI_", new S_TZ__wFoo__fwBarYI_[D], 4, "foo"); + // */test("S_TZ__wFoo__fwBarYIf", new S_TZ__wFoo__fwBarYIf[D], 4, "bar"); + /* */test("S_TZ__wFoo_I_ ", new S_TZ__wFoo_I_ [D], 3, "sub"); + /* */test("S_TZ__wFoo_I_wBar___", new S_TZ__wFoo_I_wBar___[D], 4, "sub"); + /* */test("S_TZ__wFoo_I_wBar__f", new S_TZ__wFoo_I_wBar__f[D], 4, "bar"); + // */test("S_TZ__wFoo_I_wBar_I_", new S_TZ__wFoo_I_wBar_I_[D], 4, "sub"); + // */test("S_TZ__wFoo_I_wBar_If", new S_TZ__wFoo_I_wBar_If[D], 4, "bar"); + /* */test("S_TZ__wFoo_I_wBarY__", new S_TZ__wFoo_I_wBarY__[D], 4, "sub"); + /* */test("S_TZ__wFoo_I_wBarY_f", new S_TZ__wFoo_I_wBarY_f[D], 4, "bar"); + // */test("S_TZ__wFoo_I_wBarYI_", new S_TZ__wFoo_I_wBarYI_[D], 4, "sub"); + // */test("S_TZ__wFoo_I_wBarYIf", new S_TZ__wFoo_I_wBarYIf[D], 4, "bar"); + /* */test("S_TZ__wFoo_If ", new S_TZ__wFoo_If [D], 3, "foo"); + /* */test("S_TZ__wFoo_IfwBar___", new S_TZ__wFoo_IfwBar___[D], 4, "foo"); + // */test("S_TZ__wFoo_IfwBar__f", new S_TZ__wFoo_IfwBar__f[D], 4, "bar"); + // */test("S_TZ__wFoo_IfwBar_I_", new S_TZ__wFoo_IfwBar_I_[D], 4, "foo"); + // */test("S_TZ__wFoo_IfwBar_If", new S_TZ__wFoo_IfwBar_If[D], 4, "bar"); + /* */test("S_TZ__wFoo_IfwBarY__", new S_TZ__wFoo_IfwBarY__[D], 4, "foo"); + // */test("S_TZ__wFoo_IfwBarY_f", new S_TZ__wFoo_IfwBarY_f[D], 4, "bar"); + // */test("S_TZ__wFoo_IfwBarYI_", new S_TZ__wFoo_IfwBarYI_[D], 4, "foo"); + // */test("S_TZ__wFoo_IfwBarYIf", new S_TZ__wFoo_IfwBarYIf[D], 4, "bar"); + /* */test("S_TZ__wFooX__ ", new S_TZ__wFooX__ [D], 3, "sub"); + /* */test("S_TZ__wFooX__wBar___", new S_TZ__wFooX__wBar___[D], 4, "sub"); + /* */test("S_TZ__wFooX__wBar__f", new S_TZ__wFooX__wBar__f[D], 4, "bar"); + /* */test("S_TZ__wFooX__wBar_I_", new S_TZ__wFooX__wBar_I_[D], 4, "sub"); + /* */test("S_TZ__wFooX__wBar_If", new S_TZ__wFooX__wBar_If[D], 4, "bar"); + /* */test("S_TZ__wFooX__wBarY__", new S_TZ__wFooX__wBarY__[D], 4, "sub"); + /* */test("S_TZ__wFooX__wBarY_f", new S_TZ__wFooX__wBarY_f[D], 4, "bar"); + /* */test("S_TZ__wFooX__wBarYI_", new S_TZ__wFooX__wBarYI_[D], 4, "sub"); + /* */test("S_TZ__wFooX__wBarYIf", new S_TZ__wFooX__wBarYIf[D], 4, "bar"); + /* */test("S_TZ__wFooX_f ", new S_TZ__wFooX_f [D], 3, "foo"); + /* */test("S_TZ__wFooX_fwBar___", new S_TZ__wFooX_fwBar___[D], 4, "foo"); + // */test("S_TZ__wFooX_fwBar__f", new S_TZ__wFooX_fwBar__f[D], 4, "bar"); + /* */test("S_TZ__wFooX_fwBar_I_", new S_TZ__wFooX_fwBar_I_[D], 4, "foo"); + // */test("S_TZ__wFooX_fwBar_If", new S_TZ__wFooX_fwBar_If[D], 4, "bar"); + /* */test("S_TZ__wFooX_fwBarY__", new S_TZ__wFooX_fwBarY__[D], 4, "foo"); + // */test("S_TZ__wFooX_fwBarY_f", new S_TZ__wFooX_fwBarY_f[D], 4, "bar"); + /* */test("S_TZ__wFooX_fwBarYI_", new S_TZ__wFooX_fwBarYI_[D], 4, "foo"); + // */test("S_TZ__wFooX_fwBarYIf", new S_TZ__wFooX_fwBarYIf[D], 4, "bar"); + /* */test("S_TZ__wFooXI_ ", new S_TZ__wFooXI_ [D], 3, "sub"); + /* */test("S_TZ__wFooXI_wBar___", new S_TZ__wFooXI_wBar___[D], 4, "sub"); + /* */test("S_TZ__wFooXI_wBar__f", new S_TZ__wFooXI_wBar__f[D], 4, "bar"); + // */test("S_TZ__wFooXI_wBar_I_", new S_TZ__wFooXI_wBar_I_[D], 4, "sub"); + // */test("S_TZ__wFooXI_wBar_If", new S_TZ__wFooXI_wBar_If[D], 4, "bar"); + /* */test("S_TZ__wFooXI_wBarY__", new S_TZ__wFooXI_wBarY__[D], 4, "sub"); + /* */test("S_TZ__wFooXI_wBarY_f", new S_TZ__wFooXI_wBarY_f[D], 4, "bar"); + // */test("S_TZ__wFooXI_wBarYI_", new S_TZ__wFooXI_wBarYI_[D], 4, "sub"); + // */test("S_TZ__wFooXI_wBarYIf", new S_TZ__wFooXI_wBarYIf[D], 4, "bar"); + /* */test("S_TZ__wFooXIf ", new S_TZ__wFooXIf [D], 3, "foo"); + /* */test("S_TZ__wFooXIfwBar___", new S_TZ__wFooXIfwBar___[D], 4, "foo"); + // */test("S_TZ__wFooXIfwBar__f", new S_TZ__wFooXIfwBar__f[D], 4, "bar"); + // */test("S_TZ__wFooXIfwBar_I_", new S_TZ__wFooXIfwBar_I_[D], 4, "foo"); + // */test("S_TZ__wFooXIfwBar_If", new S_TZ__wFooXIfwBar_If[D], 4, "bar"); + /* */test("S_TZ__wFooXIfwBarY__", new S_TZ__wFooXIfwBarY__[D], 4, "foo"); + // */test("S_TZ__wFooXIfwBarY_f", new S_TZ__wFooXIfwBarY_f[D], 4, "bar"); + // */test("S_TZ__wFooXIfwBarYI_", new S_TZ__wFooXIfwBarYI_[D], 4, "foo"); + // */test("S_TZ__wFooXIfwBarYIf", new S_TZ__wFooXIfwBarYIf[D], 4, "bar"); + + /* */test("S_TZ_fwFoo___ ", new S_TZ_fwFoo___ [D], 3, "mix"); + /* */test("S_TZ_fwFoo___wBar___", new S_TZ_fwFoo___wBar___[D], 4, "mix"); + /* */test("S_TZ_fwFoo___wBar__f", new S_TZ_fwFoo___wBar__f[D], 4, "mix"); + /* */test("S_TZ_fwFoo___wBar_I_", new S_TZ_fwFoo___wBar_I_[D], 4, "mix"); + /* */test("S_TZ_fwFoo___wBar_If", new S_TZ_fwFoo___wBar_If[D], 4, "mix"); + /* */test("S_TZ_fwFoo___wBarY__", new S_TZ_fwFoo___wBarY__[D], 4, "mix"); + /* */test("S_TZ_fwFoo___wBarY_f", new S_TZ_fwFoo___wBarY_f[D], 4, "mix"); + /* */test("S_TZ_fwFoo___wBarYI_", new S_TZ_fwFoo___wBarYI_[D], 4, "mix"); + /* */test("S_TZ_fwFoo___wBarYIf", new S_TZ_fwFoo___wBarYIf[D], 4, "mix"); + /* */test("S_TZ_fwFoo__f ", new S_TZ_fwFoo__f [D], 3, "mix"); + /* */test("S_TZ_fwFoo__fwBar___", new S_TZ_fwFoo__fwBar___[D], 4, "mix"); + /* */test("S_TZ_fwFoo__fwBar__f", new S_TZ_fwFoo__fwBar__f[D], 4, "mix"); + /* */test("S_TZ_fwFoo__fwBar_I_", new S_TZ_fwFoo__fwBar_I_[D], 4, "mix"); + /* */test("S_TZ_fwFoo__fwBar_If", new S_TZ_fwFoo__fwBar_If[D], 4, "mix"); + /* */test("S_TZ_fwFoo__fwBarY__", new S_TZ_fwFoo__fwBarY__[D], 4, "mix"); + /* */test("S_TZ_fwFoo__fwBarY_f", new S_TZ_fwFoo__fwBarY_f[D], 4, "mix"); + /* */test("S_TZ_fwFoo__fwBarYI_", new S_TZ_fwFoo__fwBarYI_[D], 4, "mix"); + /* */test("S_TZ_fwFoo__fwBarYIf", new S_TZ_fwFoo__fwBarYIf[D], 4, "mix"); + /* */test("S_TZ_fwFoo_I_ ", new S_TZ_fwFoo_I_ [D], 3, "mix"); + /* */test("S_TZ_fwFoo_I_wBar___", new S_TZ_fwFoo_I_wBar___[D], 4, "mix"); + /* */test("S_TZ_fwFoo_I_wBar__f", new S_TZ_fwFoo_I_wBar__f[D], 4, "mix"); + // */test("S_TZ_fwFoo_I_wBar_I_", new S_TZ_fwFoo_I_wBar_I_[D], 4, "mix"); + // */test("S_TZ_fwFoo_I_wBar_If", new S_TZ_fwFoo_I_wBar_If[D], 4, "mix"); + /* */test("S_TZ_fwFoo_I_wBarY__", new S_TZ_fwFoo_I_wBarY__[D], 4, "mix"); + /* */test("S_TZ_fwFoo_I_wBarY_f", new S_TZ_fwFoo_I_wBarY_f[D], 4, "mix"); + // */test("S_TZ_fwFoo_I_wBarYI_", new S_TZ_fwFoo_I_wBarYI_[D], 4, "mix"); + // */test("S_TZ_fwFoo_I_wBarYIf", new S_TZ_fwFoo_I_wBarYIf[D], 4, "mix"); + /* */test("S_TZ_fwFoo_If ", new S_TZ_fwFoo_If [D], 3, "mix"); + /* */test("S_TZ_fwFoo_IfwBar___", new S_TZ_fwFoo_IfwBar___[D], 4, "mix"); + /* */test("S_TZ_fwFoo_IfwBar__f", new S_TZ_fwFoo_IfwBar__f[D], 4, "mix"); + // */test("S_TZ_fwFoo_IfwBar_I_", new S_TZ_fwFoo_IfwBar_I_[D], 4, "mix"); + // */test("S_TZ_fwFoo_IfwBar_If", new S_TZ_fwFoo_IfwBar_If[D], 4, "mix"); + /* */test("S_TZ_fwFoo_IfwBarY__", new S_TZ_fwFoo_IfwBarY__[D], 4, "mix"); + /* */test("S_TZ_fwFoo_IfwBarY_f", new S_TZ_fwFoo_IfwBarY_f[D], 4, "mix"); + // */test("S_TZ_fwFoo_IfwBarYI_", new S_TZ_fwFoo_IfwBarYI_[D], 4, "mix"); + // */test("S_TZ_fwFoo_IfwBarYIf", new S_TZ_fwFoo_IfwBarYIf[D], 4, "mix"); + /* */test("S_TZ_fwFooX__ ", new S_TZ_fwFooX__ [D], 3, "mix"); + /* */test("S_TZ_fwFooX__wBar___", new S_TZ_fwFooX__wBar___[D], 4, "mix"); + /* */test("S_TZ_fwFooX__wBar__f", new S_TZ_fwFooX__wBar__f[D], 4, "mix"); + /* */test("S_TZ_fwFooX__wBar_I_", new S_TZ_fwFooX__wBar_I_[D], 4, "mix"); + /* */test("S_TZ_fwFooX__wBar_If", new S_TZ_fwFooX__wBar_If[D], 4, "mix"); + /* */test("S_TZ_fwFooX__wBarY__", new S_TZ_fwFooX__wBarY__[D], 4, "mix"); + /* */test("S_TZ_fwFooX__wBarY_f", new S_TZ_fwFooX__wBarY_f[D], 4, "mix"); + /* */test("S_TZ_fwFooX__wBarYI_", new S_TZ_fwFooX__wBarYI_[D], 4, "mix"); + /* */test("S_TZ_fwFooX__wBarYIf", new S_TZ_fwFooX__wBarYIf[D], 4, "mix"); + /* */test("S_TZ_fwFooX_f ", new S_TZ_fwFooX_f [D], 3, "mix"); + /* */test("S_TZ_fwFooX_fwBar___", new S_TZ_fwFooX_fwBar___[D], 4, "mix"); + /* */test("S_TZ_fwFooX_fwBar__f", new S_TZ_fwFooX_fwBar__f[D], 4, "mix"); + /* */test("S_TZ_fwFooX_fwBar_I_", new S_TZ_fwFooX_fwBar_I_[D], 4, "mix"); + /* */test("S_TZ_fwFooX_fwBar_If", new S_TZ_fwFooX_fwBar_If[D], 4, "mix"); + /* */test("S_TZ_fwFooX_fwBarY__", new S_TZ_fwFooX_fwBarY__[D], 4, "mix"); + /* */test("S_TZ_fwFooX_fwBarY_f", new S_TZ_fwFooX_fwBarY_f[D], 4, "mix"); + /* */test("S_TZ_fwFooX_fwBarYI_", new S_TZ_fwFooX_fwBarYI_[D], 4, "mix"); + /* */test("S_TZ_fwFooX_fwBarYIf", new S_TZ_fwFooX_fwBarYIf[D], 4, "mix"); + /* */test("S_TZ_fwFooXI_ ", new S_TZ_fwFooXI_ [D], 3, "mix"); + /* */test("S_TZ_fwFooXI_wBar___", new S_TZ_fwFooXI_wBar___[D], 4, "mix"); + /* */test("S_TZ_fwFooXI_wBar__f", new S_TZ_fwFooXI_wBar__f[D], 4, "mix"); + // */test("S_TZ_fwFooXI_wBar_I_", new S_TZ_fwFooXI_wBar_I_[D], 4, "mix"); + // */test("S_TZ_fwFooXI_wBar_If", new S_TZ_fwFooXI_wBar_If[D], 4, "mix"); + /* */test("S_TZ_fwFooXI_wBarY__", new S_TZ_fwFooXI_wBarY__[D], 4, "mix"); + /* */test("S_TZ_fwFooXI_wBarY_f", new S_TZ_fwFooXI_wBarY_f[D], 4, "mix"); + // */test("S_TZ_fwFooXI_wBarYI_", new S_TZ_fwFooXI_wBarYI_[D], 4, "mix"); + // */test("S_TZ_fwFooXI_wBarYIf", new S_TZ_fwFooXI_wBarYIf[D], 4, "mix"); + /* */test("S_TZ_fwFooXIf ", new S_TZ_fwFooXIf [D], 3, "mix"); + /* */test("S_TZ_fwFooXIfwBar___", new S_TZ_fwFooXIfwBar___[D], 4, "mix"); + /* */test("S_TZ_fwFooXIfwBar__f", new S_TZ_fwFooXIfwBar__f[D], 4, "mix"); + // */test("S_TZ_fwFooXIfwBar_I_", new S_TZ_fwFooXIfwBar_I_[D], 4, "mix"); + // */test("S_TZ_fwFooXIfwBar_If", new S_TZ_fwFooXIfwBar_If[D], 4, "mix"); + /* */test("S_TZ_fwFooXIfwBarY__", new S_TZ_fwFooXIfwBarY__[D], 4, "mix"); + /* */test("S_TZ_fwFooXIfwBarY_f", new S_TZ_fwFooXIfwBarY_f[D], 4, "mix"); + // */test("S_TZ_fwFooXIfwBarYI_", new S_TZ_fwFooXIfwBarYI_[D], 4, "mix"); + // */test("S_TZ_fwFooXIfwBarYIf", new S_TZ_fwFooXIfwBarYIf[D], 4, "mix"); + + /* */test("S_TZI_wFoo___ ", new S_TZI_wFoo___ [D], 3, "sub"); + /* */test("S_TZI_wFoo___wBar___", new S_TZI_wFoo___wBar___[D], 4, "sub"); + /* */test("S_TZI_wFoo___wBar__f", new S_TZI_wFoo___wBar__f[D], 4, "bar"); + // */test("S_TZI_wFoo___wBar_I_", new S_TZI_wFoo___wBar_I_[D], 4, "sub"); + // */test("S_TZI_wFoo___wBar_If", new S_TZI_wFoo___wBar_If[D], 4, "bar"); + /* */test("S_TZI_wFoo___wBarY__", new S_TZI_wFoo___wBarY__[D], 4, "sub"); + /* */test("S_TZI_wFoo___wBarY_f", new S_TZI_wFoo___wBarY_f[D], 4, "bar"); + // */test("S_TZI_wFoo___wBarYI_", new S_TZI_wFoo___wBarYI_[D], 4, "sub"); + // */test("S_TZI_wFoo___wBarYIf", new S_TZI_wFoo___wBarYIf[D], 4, "bar"); + /* */test("S_TZI_wFoo__f ", new S_TZI_wFoo__f [D], 3, "foo"); + /* */test("S_TZI_wFoo__fwBar___", new S_TZI_wFoo__fwBar___[D], 4, "foo"); + // */test("S_TZI_wFoo__fwBar__f", new S_TZI_wFoo__fwBar__f[D], 4, "bar"); + // */test("S_TZI_wFoo__fwBar_I_", new S_TZI_wFoo__fwBar_I_[D], 4, "foo"); + // */test("S_TZI_wFoo__fwBar_If", new S_TZI_wFoo__fwBar_If[D], 4, "bar"); + /* */test("S_TZI_wFoo__fwBarY__", new S_TZI_wFoo__fwBarY__[D], 4, "foo"); + // */test("S_TZI_wFoo__fwBarY_f", new S_TZI_wFoo__fwBarY_f[D], 4, "bar"); + // */test("S_TZI_wFoo__fwBarYI_", new S_TZI_wFoo__fwBarYI_[D], 4, "foo"); + // */test("S_TZI_wFoo__fwBarYIf", new S_TZI_wFoo__fwBarYIf[D], 4, "bar"); + // */test("S_TZI_wFoo_I_ ", new S_TZI_wFoo_I_ [D], 3, "sub"); + // */test("S_TZI_wFoo_I_wBar___", new S_TZI_wFoo_I_wBar___[D], 4, "sub"); + // */test("S_TZI_wFoo_I_wBar__f", new S_TZI_wFoo_I_wBar__f[D], 4, "bar"); + // */test("S_TZI_wFoo_I_wBar_I_", new S_TZI_wFoo_I_wBar_I_[D], 4, "sub"); + // */test("S_TZI_wFoo_I_wBar_If", new S_TZI_wFoo_I_wBar_If[D], 4, "bar"); + // */test("S_TZI_wFoo_I_wBarY__", new S_TZI_wFoo_I_wBarY__[D], 4, "sub"); + // */test("S_TZI_wFoo_I_wBarY_f", new S_TZI_wFoo_I_wBarY_f[D], 4, "bar"); + // */test("S_TZI_wFoo_I_wBarYI_", new S_TZI_wFoo_I_wBarYI_[D], 4, "sub"); + // */test("S_TZI_wFoo_I_wBarYIf", new S_TZI_wFoo_I_wBarYIf[D], 4, "bar"); + // */test("S_TZI_wFoo_If ", new S_TZI_wFoo_If [D], 3, "foo"); + // */test("S_TZI_wFoo_IfwBar___", new S_TZI_wFoo_IfwBar___[D], 4, "foo"); + // */test("S_TZI_wFoo_IfwBar__f", new S_TZI_wFoo_IfwBar__f[D], 4, "bar"); + // */test("S_TZI_wFoo_IfwBar_I_", new S_TZI_wFoo_IfwBar_I_[D], 4, "foo"); + // */test("S_TZI_wFoo_IfwBar_If", new S_TZI_wFoo_IfwBar_If[D], 4, "bar"); + // */test("S_TZI_wFoo_IfwBarY__", new S_TZI_wFoo_IfwBarY__[D], 4, "foo"); + // */test("S_TZI_wFoo_IfwBarY_f", new S_TZI_wFoo_IfwBarY_f[D], 4, "bar"); + // */test("S_TZI_wFoo_IfwBarYI_", new S_TZI_wFoo_IfwBarYI_[D], 4, "foo"); + // */test("S_TZI_wFoo_IfwBarYIf", new S_TZI_wFoo_IfwBarYIf[D], 4, "bar"); + /* */test("S_TZI_wFooX__ ", new S_TZI_wFooX__ [D], 3, "sub"); + /* */test("S_TZI_wFooX__wBar___", new S_TZI_wFooX__wBar___[D], 4, "sub"); + /* */test("S_TZI_wFooX__wBar__f", new S_TZI_wFooX__wBar__f[D], 4, "bar"); + // */test("S_TZI_wFooX__wBar_I_", new S_TZI_wFooX__wBar_I_[D], 4, "sub"); + // */test("S_TZI_wFooX__wBar_If", new S_TZI_wFooX__wBar_If[D], 4, "bar"); + /* */test("S_TZI_wFooX__wBarY__", new S_TZI_wFooX__wBarY__[D], 4, "sub"); + /* */test("S_TZI_wFooX__wBarY_f", new S_TZI_wFooX__wBarY_f[D], 4, "bar"); + // */test("S_TZI_wFooX__wBarYI_", new S_TZI_wFooX__wBarYI_[D], 4, "sub"); + // */test("S_TZI_wFooX__wBarYIf", new S_TZI_wFooX__wBarYIf[D], 4, "bar"); + /* */test("S_TZI_wFooX_f ", new S_TZI_wFooX_f [D], 3, "foo"); + /* */test("S_TZI_wFooX_fwBar___", new S_TZI_wFooX_fwBar___[D], 4, "foo"); + // */test("S_TZI_wFooX_fwBar__f", new S_TZI_wFooX_fwBar__f[D], 4, "bar"); + // */test("S_TZI_wFooX_fwBar_I_", new S_TZI_wFooX_fwBar_I_[D], 4, "foo"); + // */test("S_TZI_wFooX_fwBar_If", new S_TZI_wFooX_fwBar_If[D], 4, "bar"); + /* */test("S_TZI_wFooX_fwBarY__", new S_TZI_wFooX_fwBarY__[D], 4, "foo"); + // */test("S_TZI_wFooX_fwBarY_f", new S_TZI_wFooX_fwBarY_f[D], 4, "bar"); + // */test("S_TZI_wFooX_fwBarYI_", new S_TZI_wFooX_fwBarYI_[D], 4, "foo"); + // */test("S_TZI_wFooX_fwBarYIf", new S_TZI_wFooX_fwBarYIf[D], 4, "bar"); + // */test("S_TZI_wFooXI_ ", new S_TZI_wFooXI_ [D], 3, "sub"); + // */test("S_TZI_wFooXI_wBar___", new S_TZI_wFooXI_wBar___[D], 4, "sub"); + // */test("S_TZI_wFooXI_wBar__f", new S_TZI_wFooXI_wBar__f[D], 4, "bar"); + // */test("S_TZI_wFooXI_wBar_I_", new S_TZI_wFooXI_wBar_I_[D], 4, "sub"); + // */test("S_TZI_wFooXI_wBar_If", new S_TZI_wFooXI_wBar_If[D], 4, "bar"); + // */test("S_TZI_wFooXI_wBarY__", new S_TZI_wFooXI_wBarY__[D], 4, "sub"); + // */test("S_TZI_wFooXI_wBarY_f", new S_TZI_wFooXI_wBarY_f[D], 4, "bar"); + // */test("S_TZI_wFooXI_wBarYI_", new S_TZI_wFooXI_wBarYI_[D], 4, "sub"); + // */test("S_TZI_wFooXI_wBarYIf", new S_TZI_wFooXI_wBarYIf[D], 4, "bar"); + // */test("S_TZI_wFooXIf ", new S_TZI_wFooXIf [D], 3, "foo"); + // */test("S_TZI_wFooXIfwBar___", new S_TZI_wFooXIfwBar___[D], 4, "foo"); + // */test("S_TZI_wFooXIfwBar__f", new S_TZI_wFooXIfwBar__f[D], 4, "bar"); + // */test("S_TZI_wFooXIfwBar_I_", new S_TZI_wFooXIfwBar_I_[D], 4, "foo"); + // */test("S_TZI_wFooXIfwBar_If", new S_TZI_wFooXIfwBar_If[D], 4, "bar"); + // */test("S_TZI_wFooXIfwBarY__", new S_TZI_wFooXIfwBarY__[D], 4, "foo"); + // */test("S_TZI_wFooXIfwBarY_f", new S_TZI_wFooXIfwBarY_f[D], 4, "bar"); + // */test("S_TZI_wFooXIfwBarYI_", new S_TZI_wFooXIfwBarYI_[D], 4, "foo"); + // */test("S_TZI_wFooXIfwBarYIf", new S_TZI_wFooXIfwBarYIf[D], 4, "bar"); + + /* */test("S_TZIfwFoo___ ", new S_TZIfwFoo___ [D], 3, "mix"); + /* */test("S_TZIfwFoo___wBar___", new S_TZIfwFoo___wBar___[D], 4, "mix"); + /* */test("S_TZIfwFoo___wBar__f", new S_TZIfwFoo___wBar__f[D], 4, "mix"); + // */test("S_TZIfwFoo___wBar_I_", new S_TZIfwFoo___wBar_I_[D], 4, "mix"); + // */test("S_TZIfwFoo___wBar_If", new S_TZIfwFoo___wBar_If[D], 4, "mix"); + /* */test("S_TZIfwFoo___wBarY__", new S_TZIfwFoo___wBarY__[D], 4, "mix"); + /* */test("S_TZIfwFoo___wBarY_f", new S_TZIfwFoo___wBarY_f[D], 4, "mix"); + // */test("S_TZIfwFoo___wBarYI_", new S_TZIfwFoo___wBarYI_[D], 4, "mix"); + // */test("S_TZIfwFoo___wBarYIf", new S_TZIfwFoo___wBarYIf[D], 4, "mix"); + /* */test("S_TZIfwFoo__f ", new S_TZIfwFoo__f [D], 3, "mix"); + /* */test("S_TZIfwFoo__fwBar___", new S_TZIfwFoo__fwBar___[D], 4, "mix"); + /* */test("S_TZIfwFoo__fwBar__f", new S_TZIfwFoo__fwBar__f[D], 4, "mix"); + // */test("S_TZIfwFoo__fwBar_I_", new S_TZIfwFoo__fwBar_I_[D], 4, "mix"); + // */test("S_TZIfwFoo__fwBar_If", new S_TZIfwFoo__fwBar_If[D], 4, "mix"); + /* */test("S_TZIfwFoo__fwBarY__", new S_TZIfwFoo__fwBarY__[D], 4, "mix"); + /* */test("S_TZIfwFoo__fwBarY_f", new S_TZIfwFoo__fwBarY_f[D], 4, "mix"); + // */test("S_TZIfwFoo__fwBarYI_", new S_TZIfwFoo__fwBarYI_[D], 4, "mix"); + // */test("S_TZIfwFoo__fwBarYIf", new S_TZIfwFoo__fwBarYIf[D], 4, "mix"); + // */test("S_TZIfwFoo_I_ ", new S_TZIfwFoo_I_ [D], 3, "mix"); + // */test("S_TZIfwFoo_I_wBar___", new S_TZIfwFoo_I_wBar___[D], 4, "mix"); + // */test("S_TZIfwFoo_I_wBar__f", new S_TZIfwFoo_I_wBar__f[D], 4, "mix"); + // */test("S_TZIfwFoo_I_wBar_I_", new S_TZIfwFoo_I_wBar_I_[D], 4, "mix"); + // */test("S_TZIfwFoo_I_wBar_If", new S_TZIfwFoo_I_wBar_If[D], 4, "mix"); + // */test("S_TZIfwFoo_I_wBarY__", new S_TZIfwFoo_I_wBarY__[D], 4, "mix"); + // */test("S_TZIfwFoo_I_wBarY_f", new S_TZIfwFoo_I_wBarY_f[D], 4, "mix"); + // */test("S_TZIfwFoo_I_wBarYI_", new S_TZIfwFoo_I_wBarYI_[D], 4, "mix"); + // */test("S_TZIfwFoo_I_wBarYIf", new S_TZIfwFoo_I_wBarYIf[D], 4, "mix"); + // */test("S_TZIfwFoo_If ", new S_TZIfwFoo_If [D], 3, "mix"); + // */test("S_TZIfwFoo_IfwBar___", new S_TZIfwFoo_IfwBar___[D], 4, "mix"); + // */test("S_TZIfwFoo_IfwBar__f", new S_TZIfwFoo_IfwBar__f[D], 4, "mix"); + // */test("S_TZIfwFoo_IfwBar_I_", new S_TZIfwFoo_IfwBar_I_[D], 4, "mix"); + // */test("S_TZIfwFoo_IfwBar_If", new S_TZIfwFoo_IfwBar_If[D], 4, "mix"); + // */test("S_TZIfwFoo_IfwBarY__", new S_TZIfwFoo_IfwBarY__[D], 4, "mix"); + // */test("S_TZIfwFoo_IfwBarY_f", new S_TZIfwFoo_IfwBarY_f[D], 4, "mix"); + // */test("S_TZIfwFoo_IfwBarYI_", new S_TZIfwFoo_IfwBarYI_[D], 4, "mix"); + // */test("S_TZIfwFoo_IfwBarYIf", new S_TZIfwFoo_IfwBarYIf[D], 4, "mix"); + /* */test("S_TZIfwFooX__ ", new S_TZIfwFooX__ [D], 3, "mix"); + /* */test("S_TZIfwFooX__wBar___", new S_TZIfwFooX__wBar___[D], 4, "mix"); + /* */test("S_TZIfwFooX__wBar__f", new S_TZIfwFooX__wBar__f[D], 4, "mix"); + // */test("S_TZIfwFooX__wBar_I_", new S_TZIfwFooX__wBar_I_[D], 4, "mix"); + // */test("S_TZIfwFooX__wBar_If", new S_TZIfwFooX__wBar_If[D], 4, "mix"); + /* */test("S_TZIfwFooX__wBarY__", new S_TZIfwFooX__wBarY__[D], 4, "mix"); + /* */test("S_TZIfwFooX__wBarY_f", new S_TZIfwFooX__wBarY_f[D], 4, "mix"); + // */test("S_TZIfwFooX__wBarYI_", new S_TZIfwFooX__wBarYI_[D], 4, "mix"); + // */test("S_TZIfwFooX__wBarYIf", new S_TZIfwFooX__wBarYIf[D], 4, "mix"); + /* */test("S_TZIfwFooX_f ", new S_TZIfwFooX_f [D], 3, "mix"); + /* */test("S_TZIfwFooX_fwBar___", new S_TZIfwFooX_fwBar___[D], 4, "mix"); + /* */test("S_TZIfwFooX_fwBar__f", new S_TZIfwFooX_fwBar__f[D], 4, "mix"); + // */test("S_TZIfwFooX_fwBar_I_", new S_TZIfwFooX_fwBar_I_[D], 4, "mix"); + // */test("S_TZIfwFooX_fwBar_If", new S_TZIfwFooX_fwBar_If[D], 4, "mix"); + /* */test("S_TZIfwFooX_fwBarY__", new S_TZIfwFooX_fwBarY__[D], 4, "mix"); + /* */test("S_TZIfwFooX_fwBarY_f", new S_TZIfwFooX_fwBarY_f[D], 4, "mix"); + // */test("S_TZIfwFooX_fwBarYI_", new S_TZIfwFooX_fwBarYI_[D], 4, "mix"); + // */test("S_TZIfwFooX_fwBarYIf", new S_TZIfwFooX_fwBarYIf[D], 4, "mix"); + // */test("S_TZIfwFooXI_ ", new S_TZIfwFooXI_ [D], 3, "mix"); + // */test("S_TZIfwFooXI_wBar___", new S_TZIfwFooXI_wBar___[D], 4, "mix"); + // */test("S_TZIfwFooXI_wBar__f", new S_TZIfwFooXI_wBar__f[D], 4, "mix"); + // */test("S_TZIfwFooXI_wBar_I_", new S_TZIfwFooXI_wBar_I_[D], 4, "mix"); + // */test("S_TZIfwFooXI_wBar_If", new S_TZIfwFooXI_wBar_If[D], 4, "mix"); + // */test("S_TZIfwFooXI_wBarY__", new S_TZIfwFooXI_wBarY__[D], 4, "mix"); + // */test("S_TZIfwFooXI_wBarY_f", new S_TZIfwFooXI_wBarY_f[D], 4, "mix"); + // */test("S_TZIfwFooXI_wBarYI_", new S_TZIfwFooXI_wBarYI_[D], 4, "mix"); + // */test("S_TZIfwFooXI_wBarYIf", new S_TZIfwFooXI_wBarYIf[D], 4, "mix"); + // */test("S_TZIfwFooXIf ", new S_TZIfwFooXIf [D], 3, "mix"); + // */test("S_TZIfwFooXIfwBar___", new S_TZIfwFooXIfwBar___[D], 4, "mix"); + // */test("S_TZIfwFooXIfwBar__f", new S_TZIfwFooXIfwBar__f[D], 4, "mix"); + // */test("S_TZIfwFooXIfwBar_I_", new S_TZIfwFooXIfwBar_I_[D], 4, "mix"); + // */test("S_TZIfwFooXIfwBar_If", new S_TZIfwFooXIfwBar_If[D], 4, "mix"); + // */test("S_TZIfwFooXIfwBarY__", new S_TZIfwFooXIfwBarY__[D], 4, "mix"); + // */test("S_TZIfwFooXIfwBarY_f", new S_TZIfwFooXIfwBarY_f[D], 4, "mix"); + // */test("S_TZIfwFooXIfwBarYI_", new S_TZIfwFooXIfwBarYI_[D], 4, "mix"); + // */test("S_TZIfwFooXIfwBarYIf", new S_TZIfwFooXIfwBarYIf[D], 4, "mix"); + + if (errors > 0) { + Console.println; + Console.println(errors + " error" + (if (errors > 1) "s" else "")); + } + } +} diff --git a/test/files/run/bug457.check b/test/files/run/bug457.check new file mode 100644 index 0000000000..e69de29bb2 --- /dev/null +++ b/test/files/run/bug457.check diff --git a/test/files/run/bug457.scala b/test/files/run/bug457.scala new file mode 100644 index 0000000000..98983a2fa2 --- /dev/null +++ b/test/files/run/bug457.scala @@ -0,0 +1,44 @@ + + +object Test { + + def method1() = { + val x = "Hello, world"; + val y = 100; + + y match { + case _: Int + if (x match { case t => t.trim().length() > 0 }) => + false; + case _ => true; + } + } + + def method2(): scala.Boolean = { + val x: java.lang.String = "Hello, world"; + val y: scala.Int = 100; + { + var temp1: scala.Int = y; + var result: scala.Boolean = false; + if ( + { + var result1: scala.Boolean = true; + if (y == 100) + result1 + else + scala.MatchError.fail("crazybox.scala", 11) + } && (y > 90) + ) + result + else + scala.MatchError.fail("crazybox.scala", 9); + } + } + + def main(args: Array[String]): Unit = { + method1(); + method2(); + } + +} + diff --git a/test/files/run/bug508.check b/test/files/run/bug508.check new file mode 100644 index 0000000000..4539bbf2d2 --- /dev/null +++ b/test/files/run/bug508.check @@ -0,0 +1,3 @@ +0 +1 +2 diff --git a/test/files/run/bug508.scala b/test/files/run/bug508.scala new file mode 100644 index 0000000000..80485371ea --- /dev/null +++ b/test/files/run/bug508.scala @@ -0,0 +1,20 @@ +object Test { + case class Operator(x: Int); + val EQ = new Operator(2); + + def main(args: Array[String]): Unit = { + val x = Pair(EQ, 0); + analyze(x); // should print "0" + val y = Pair(EQ, 1); + analyze(y); // should print "1" + val z = Pair(EQ, 2); + analyze(z); // should print "2" + } + + def analyze(x: Pair[Operator, Int]) = x match { + case Pair(EQ, 0) => Console.println("0") + case Pair(EQ, 1) => Console.println("1") + case Pair(EQ, 2) => Console.println("2") + case _ => Console.println("undefined on " + x) + } +} diff --git a/test/files/run/bugs.check b/test/files/run/bugs.check new file mode 100644 index 0000000000..206d0e9e48 --- /dev/null +++ b/test/files/run/bugs.check @@ -0,0 +1,97 @@ +<<< bug 98 +mycase +>>> bug 98 + +<<< bug 120 +one +A +B +C +>>> bug 120 + +<<< bug 135 +Some(The answer) +>>> bug 135 + +<<< bug 142 +ok +ok +ok +ok +ok +ok +ok +ok +>>> bug 142 + +<<< bug 166 +>>> bug 166 + +<<< bug 167 +>>> bug 167 + +<<< bug 168 +>>> bug 168 + +<<< bug 174 +>>> bug 174 + +<<< bug 176 +1 +>>> bug 176 + +<<< bug 199 +>>> bug 199 + +<<< bug 213 +Exception in thread "Thread[main,5,main]" java.lang.ClassCastException +>>> bug 213 + +<<< bug 217 +>>> bug 217 + +<<< bug 222 +>>> bug 222 + +<<< bug 225 +>>> bug 225 + +<<< bug 226 +>>> bug 226 + +<<< bug 233 +true +>>> bug 233 + +<<< bug 250 +>>> bug 250 + +<<< bug 257 +I should come 1st and 2nd +I should come 1st and 2nd +I should come last +>>> bug 257 + +<<< bug 266 +hello +4 +>>> bug 266 + +<<< bug 316 +>>> bug 316 + +<<< bug 328 +>>> bug 328 + +<<< bug 396 +A +B +C +>>> bug 396 + +<<< bug 399 +a +>>> bug 399 + + +1 error diff --git a/test/files/run/bugs.scala b/test/files/run/bugs.scala new file mode 100644 index 0000000000..2398f23d13 --- /dev/null +++ b/test/files/run/bugs.scala @@ -0,0 +1,490 @@ +//############################################################################ +// Bugs +//############################################################################ +// $Id$ + +//############################################################################ +// serves as an entry point with the MSIL backend + +object TestMain { + def main(args: Array[String]): Unit = { + Test.main(args); + } +} + +//############################################################################ +// Bug 98 + +object Bug98Test { + object MyCase { def name = "mycase" }; + def main(args: Array[String]) = { + Console.println(MyCase.name); + } +} + +//############################################################################ +// Bug 120 + +class Bug120A(x: Int) { + Console.println("A"); +} + +trait Bug120B { + System.out.println("B"); +} +class Bug120C(x: Int) + extends Bug120A(Bug120Test.print("one", 1)) + with Bug120B { + System.out.println("C"); +} +object Bug120Test { + def print[A](str: String, res: A): A = { + Console.println(str); res + } + def main(args: Array[String]) = { + val c = new Bug120C(1); + } +} + +//############################################################################ +// Bug 135 + +object Bug135Test { + + import scala.collection.immutable.TreeMap; + + def main(args: Array[String]): Unit = { + val myMap:TreeMap[int,String] = new TreeMap; + val map1 = myMap + 42 -> "The answer"; + Console.println(map1.get(42)); + } + +} + +//############################################################################ +// Bug 142 + +abstract class Bug142Foo1 { class Inner; def foo: Inner; foo; } +abstract class Bug142Foo2 { class Inner; def foo: Inner = {Console.println("ok"); null};} +abstract class Bug142Foo3 { type Inner; def foo: Inner; foo; } +abstract class Bug142Foo4 { type Inner; def foo: Inner = {Console.println("ok"); null.asInstanceOf[Inner]}; } + +trait Bug142Bar1 { type Inner; def foo: Inner = {System.out.println("ok"); null.asInstanceOf[Inner]}; } +trait Bug142Bar2 { type Inner; def foo: Inner; foo; } +trait Bug142Bar3 { class Inner; def foo: Inner = {System.out.println("ok"); null}; } +trait Bug142Bar4 { class Inner; def foo: Inner; foo; } + +object Bug142Test1 extends Bug142Foo1 with Bug142Bar1 {def main(args:Array[String]):Unit=();} +object Bug142Test2 extends Bug142Foo2 with Bug142Bar2 {def main(args:Array[String]):Unit=();} +object Bug142Test3 extends Bug142Foo3 with Bug142Bar3 {def main(args:Array[String]):Unit=();} +object Bug142Test4 extends Bug142Foo4 with Bug142Bar4 {def main(args:Array[String]):Unit=();} +object Bug142Test5 extends Bug142Foo1 with Bug142Bar1 {def main(args:Array[String]):Unit=();} +object Bug142Test6 extends Bug142Foo2 with Bug142Bar2 {def main(args:Array[String]):Unit=();} +object Bug142Test7 extends Bug142Foo3 with Bug142Bar3 {def main(args:Array[String]):Unit=();} +object Bug142Test8 extends Bug142Foo4 with Bug142Bar4 {def main(args:Array[String]):Unit=();} + +object Bug142Test { + def main(args:Array[String]): Unit = { + Bug142Test1; + Bug142Test2; + Bug142Test3; + Bug142Test4; + Bug142Test5; + Bug142Test6; + Bug142Test7; + Bug142Test8; + () + } +} + +//############################################################################ +// Bug 166 + +object Bug166Test { + import scala.collection.mutable.HashMap ; + def main(args:Array[String]) = { + val m:HashMap[String,String] = new HashMap[String,String]; + m.update("foo","bar"); + } +} + +//############################################################################ +// Bug 167 + +class Bug167Node(bar:Int) { + val foo = { + val bar = 1; + bar + } +} + +object Bug167Test { + def main(args: Array[String]): Unit = { + if (new Bug167Node(0).foo != 1) Console.println("bug 167"); + } +} + +//############################################################################ +// Bug 168 + +class Bug168Foo { + class Bar; + def foo = new Bar; +} + +object Bug168Test { + def main(args: Array[String]): Unit = { + (new Bug168Foo).foo; + () + } +} + +//############################################################################ +// Bug 174 + +class Bug174Foo[X] { + + class Tree; + class Node extends Tree; + + + val inner:Inner = new SubInner; + + trait Inner { + def test: Bug174Foo[X]#Tree ; + } + + class SubInner extends Inner { + def test = new Node; + } + +} + +object Bug174Test { + def main(args: Array[String]): Unit = { + (new Bug174Foo[Int]).inner.test; + () + } +} + + +//############################################################################ +// Bug 176 + +trait Bug176A { + type T; + def foo(x: T): Int; + def bar: T; + def test = foo(bar); +} +trait Bug176B { + type S <: Object; + type T = S; + def foo(x: S): Int; + def bar: S; +} +class Bug176C extends Bug176A with Bug176B { + class S; + def foo(x: S) = 1; + def bar = new S; +} +object Bug176Test { + def main(args: Array[String]): Unit = { + val x: Bug176A = new Bug176C; + Console.println(x.test); + } +} + +//############################################################################ +// Bug 199 + +class Bug199C { object o; } +object Bug199Test { + def main(args: Array[String]) = { + (new Bug199C).o; () + } +} + +//############################################################################ +// Bug 213 + +trait Bug213Foo { + def testAll: Unit; + def testAllRef: String; +} + +class Bug213Bar extends Bug213Foo { + def testAll = (().asInstanceOf[All] : All); + def testAllRef = ("".asInstanceOf[AllRef] : AllRef); +} + +object Bug213Test { + def main(args: Array[String]): Unit = { + val foo: Bug213Foo = new Bug213Bar; + foo.testAll; + foo.testAllRef; + () + } +} + +//############################################################################ +// Bug 217 + +object Bug217Test { + def foo[t](fun: Function0[t]): t = fun(); + def bar(x: Int): Unit = { + foo(() => 0); + () + } + def main(args: Array[String]): Unit = bar(32); +} + +//############################################################################ +// Bug 222 + +object Bug222Test { + def main(args:Array[String]): Unit = { + val array: Array[String] = new Array(16); + () + } +} + +//############################################################################ +// Bug 225 + +case class Bug225C(); + +object Bug225Test { + + def main(args: Array[String]): Unit = { + val a = new Array[Array[Bug225C]](2); + a(0) = new Array[Bug225C](2); + a(0)(0) = new Bug225C(); + } +} + +//############################################################################ +// Bug 226 + +object Bug226Test { + + def id[a](xs: Array[a]): Array[a] = xs; + + def main(args: Array[String]): Unit = { + var xs = new Array[Int](1); + class X { xs }; + xs = id(xs); + id(xs); + () + } + +} + +//############################################################################ +// Bug 233 + +object Bug233Test { + val b: Array[String] = null; + def main(args: Array[String]): Unit = + Console.println(b == null); +} + +//############################################################################ +// Bug 250 + +object Bug250Test { + def main(args: Array[String]): Unit = { + if (true) null; + () + } +} + +//############################################################################ +// Bug 257 + +object Bug257Test { + def sayhello(): Unit = { Console.println("I should come 1st and 2nd"); }; + def sayhi(): Unit = { Console.println("I should come last"); }; + + def f1(x: Unit): Unit = (); + def f2(x: Unit)(y: Unit): Unit = (); + + def f(x: => Unit) = { + f1(x); + f2(x); + } + + def main(args: Array[String]): Unit = { + f(sayhello())(sayhi()) + } +} + +//############################################################################ +// Bug 266 + +// version - A + +abstract class Bug266AFoo { + type T <: AnyRef; + abstract class I0 { def f(x: T): Unit; f(null); } +} + +object Bug266ATest extends Bug266AFoo { + type T = String; + class I1 extends I0 { def f(x: String): Unit = { Console.println("hello"); ();} } + def main(args: Array[String]): Unit = { new I1; () } +} + +// version - B + +abstract class Bug266BA { + type t; + abstract class P { + def f(x: t): unit; + } +} + +abstract class Bug266BA1 extends Bug266BA { + def mkP: Bug266BA1.this.P; + val in: t; +} + +trait Bug266BB extends Bug266BA { + type t = int; + class P1 extends Bug266BB.this.P { + def f(x: int): unit = Console.println(x + 1); + } + def mkP = new P1; + val in = 3; +} + +object Bug266BTest extends Application { + val a: Bug266BA1 = new Bug266BA1 with Bug266BB; + a.mkP.f(a.in); +} + +// main + +object Bug266Test { + def main(args: Array[String]): Unit = { + Bug266ATest.main(args); + Bug266BTest.main(args); + } +} + +//############################################################################ +// Bug 316 + +class Bug316MyIterator extends Iterator[Int] { + def hasNext = false; + def next = 42; +} + +object Bug316Test { + def main(args: Array[String]): Unit = + (new Bug316MyIterator) filter { x: Int => x == 1 }; +} + +//############################################################################ +// Bug 328 + +object Bug328Test { + def test(f: Function1[Int,String]): Unit = (); + def main(args: Array[String]): Unit = test(args); +} + +//############################################################################ +// Bug 396 + +trait Bug396A { + class I { + def run = Console.println("A"); + } +} +trait Bug396B extends Bug396A { + class I extends super.I { + override def run = { super.run; Console.println("B"); } + } +} +trait Bug396C extends Bug396A { + trait I extends super.I { + override def run = { super.run; System.out.println("C"); } + } +} +object Bug396Test extends Application with Bug396B with Bug396C { + class I2 extends super[Bug396B].I with super[Bug396C].I; + (new I2).run +} + +//############################################################################ +// Bug 399 + +object Bug399Test { + def f(x: String): String = { + trait C { def f: String = x; } + class D extends C; + trait F extends C; + class G extends D with F; + (new G).f + } + + def main(args: Array[String]): Unit = { + Console.println(f("a")); + } +} + +//############################################################################ +// Main + +object Test { + var errors: Int = 0; + def test(bug: Int, test: => Unit): Unit = { + Console.println("<<< bug " + bug); + try { + test; + } catch { + case exception => { + val curr: String = scala.runtime.compat.Platform.currentThread.toString(); + Console.print("Exception in thread \"" + curr + "\" " + exception); + Console.println; + errors = errors + 1; + } + } + Console.println(">>> bug " + bug); + Console.println; + } + + def main(args: Array[String]): Unit = { + + test( 98, Bug98Test.main(args)); + test(120, Bug120Test.main(args)); + test(135, Bug135Test.main(args)); + test(142, Bug142Test.main(args)); + test(166, Bug166Test.main(args)); + test(167, Bug167Test.main(args)); + test(168, Bug168Test.main(args)); + test(174, Bug174Test.main(args)); + test(176, Bug176Test.main(args)); + test(199, Bug199Test.main(args)); + test(213, Bug213Test.main(args)); + test(217, Bug217Test.main(args)); + test(222, Bug222Test.main(args)); + test(225, Bug225Test.main(args)); + test(226, Bug226Test.main(args)); + test(233, Bug233Test.main(args)); + test(250, Bug250Test.main(args)); + test(257, Bug257Test.main(args)); + test(266, Bug266Test.main(args)); + test(316, Bug316Test.main(args)); + test(328, Bug328Test.main(args)); + test(396, Bug396Test.main(args)); + test(399, Bug399Test.main(args)); + + if (errors > 0) { + Console.println; + Console.println(errors + " error" + (if (errors > 1) "s" else "")); + } + } +} + +//############################################################################ diff --git a/test/files/run/constructors.check b/test/files/run/constructors.check new file mode 100644 index 0000000000..0743b7e296 --- /dev/null +++ b/test/files/run/constructors.check @@ -0,0 +1,5 @@ +x=1 y=2 +x=3 y=3 +x=1 y=1 +x=1 y=2 a=1 b=2 c=a +x=3 y=3 a=3 b=3 c=b diff --git a/test/files/run/constructors.scala b/test/files/run/constructors.scala new file mode 100644 index 0000000000..e85f3b8667 --- /dev/null +++ b/test/files/run/constructors.scala @@ -0,0 +1,29 @@ +// $Id$ + +// Test constructors, including multiple ones. + +class A(x: Int, y: Int) { + def this(x: Int) = this(x, x); + def this() = this(1); + override def toString() = "x=" + x + " y=" + y; + class B(a: Int, b: Int, c: String) { + def this(str: String) = this(x, y, str); + override def toString() = + "x=" + x + " y=" + y + " a=" + a + " b=" + b + " c=" + c; + } +} + +object Test { + def main(args: Array[String]): Unit = { + val a1 = new A(1,2); + val a2 = new A(3); + val a3 = new A(); + val b1 = new a1.B(1,2,"a"); + val b2 = new a2.B("b"); + Console.println(a1); + Console.println(a2); + Console.println(a3); + Console.println(b1); + Console.println(b2); + } +} diff --git a/test/files/run/ctor-order.check b/test/files/run/ctor-order.check new file mode 100644 index 0000000000..b2f7f08c17 --- /dev/null +++ b/test/files/run/ctor-order.check @@ -0,0 +1,2 @@ +10 +10 diff --git a/test/files/run/ctor-order.scala b/test/files/run/ctor-order.scala new file mode 100644 index 0000000000..73c1a08164 --- /dev/null +++ b/test/files/run/ctor-order.scala @@ -0,0 +1,28 @@ + +/** Test that constructor operations are reordered correctly. */ +class Outer { + + object global { + val x = 10; + } + + class X extends AnyRef with M1 { + /* The constructor of X should set this.$outer to the outer instance + * *before* calling the super constructors. This is tested by + * mixin M1, which tries to access global from the enclosing class. + */ + val outer = Outer.this; + } + + trait M1: X { + Console.println(global.x); + Console.println(outer.global.x); + } + +} + +object Test extends AnyRef with Application { + val o = new Outer; + + new o.X; +} diff --git a/test/files/run/enums.check b/test/files/run/enums.check new file mode 100644 index 0000000000..b76705b9dd --- /dev/null +++ b/test/files/run/enums.check @@ -0,0 +1,4 @@ +test Test1 was successful +test Test2 was successful +test Test3 was successful + diff --git a/test/files/run/enums.scala b/test/files/run/enums.scala new file mode 100644 index 0000000000..2332fb87d4 --- /dev/null +++ b/test/files/run/enums.scala @@ -0,0 +1,80 @@ +//############################################################################ +// Enumerations +//############################################################################ +// $Id$ + +object Test1 { + + object WeekDays extends Enumeration { + val Mon, Tue, Wed, Thu, Fri, Sat, Sun = Value + } + + def isWorkingDay(d: WeekDays.Value) = + ! (d == WeekDays.Sat || d == WeekDays.Sun); + + def run: Int = { + val it = WeekDays filter (isWorkingDay); + it.toList.length + } +} + +object Test2 { + + object ThreadState extends Enumeration { + val New = Value("NEW"); + val Runnable = Value("RUNNABLE"); + val Blocked = Value("BLOCKED"); + val Waiting = Value("WAITING"); + val TimedWaiting = Value("TIMED_WAITING"); + val Terminated = Value("TERMINATED"); + } + + def run: Int = { + val it = for (val s <- ThreadState; s.id != 0) yield s; + it.toList.length + } +} + +object Test3 { + + object Direction extends Enumeration("North", "South", "East", "West") { + val North, South, East, West = Value; + } + + def run: Int = { + val it = for (val d <- Direction; d.toString() startsWith "N") yield d; + it.toList.length + } +} + +//############################################################################ +// Test code + +object Test { + + def check_success(name: String, closure: => Int, expected: Int): Unit = { + Console.print("test " + name); + try { + val actual: Int = closure; + if (actual == expected) { + Console.print(" was successful"); + } else { + Console.print(" failed: expected "+ expected +", found "+ actual); + } + } catch { + case exception: Throwable => { + Console.print(" raised exception " + exception); + } + } + Console.println; + } + + def main(args: Array[String]): Unit = { + check_success("Test1", Test1.run, 5); + check_success("Test2", Test2.run, 5); + check_success("Test3", Test3.run, 1); + Console.println; + } +} + +//############################################################################ diff --git a/test/files/run/exceptions.check b/test/files/run/exceptions.check new file mode 100644 index 0000000000..b959df29ed --- /dev/null +++ b/test/files/run/exceptions.check @@ -0,0 +1 @@ +ok: lookup(2000) = KO diff --git a/test/files/run/exceptions.scala b/test/files/run/exceptions.scala new file mode 100644 index 0000000000..04fc4a1a85 --- /dev/null +++ b/test/files/run/exceptions.scala @@ -0,0 +1,53 @@ +//############################################################################ +// Exceptions +//############################################################################ +// $Id$ + +//############################################################################ + +abstract class IntMap[A] { + def lookup(key: Int): A = this match { + case Empty() => error("KO") + case _ => error("ok") + } +} + +case class Empty[A]() extends IntMap[A]; + +object exceptions { + + def check(what: String, actual: Any, expected: Any): Unit = { + val success: Boolean = actual == expected; + Console.print(if (success) "ok" else "KO"); + var value: String = if (actual == null) "null" else actual.toString(); + if (value == "\u0000") value = "\\u0000"; + Console.print(": " + what + " = " + value); + if (!success) Console.print(" != " + expected); + Console.println; + Console.flush; + } + + def test: Unit = { + val key = 2000; + val map: IntMap[String] = new Empty[String]; + val value = try { + map.lookup(key) + } catch { + case e => scala.runtime.compat.Platform.getMessage(e) + } + check("lookup(" + key + ")", value, "KO"); + } + +} + +//############################################################################ + +object Test { + + def main(args: Array[String]): Unit = { + exceptions.test; + } + +} + +//############################################################################ diff --git a/test/files/run/imports.check b/test/files/run/imports.check new file mode 100644 index 0000000000..56f5e23d45 --- /dev/null +++ b/test/files/run/imports.check @@ -0,0 +1,12 @@ +In C_ico, v_ico .toString() returns C_ico -> ok +In C_ico, field .toString() returns C_ico -> ok +In C_ico, method.toString() returns C_ico -> ok + +In C_ioc, v_ioc .toString() returns C_ioc -> ok +In C_ioc, field .toString() returns C_ioc -> ok +In C_ioc, method.toString() returns C_ioc -> ok + +In C_oic, v_oic .toString() returns C_oic -> ok +In C_oic, field .toString() returns C_oic -> ok +In C_oic, method.toString() returns C_oic -> ok + diff --git a/test/files/run/imports.scala b/test/files/run/imports.scala new file mode 100644 index 0000000000..d976478d8b --- /dev/null +++ b/test/files/run/imports.scala @@ -0,0 +1,97 @@ +//############################################################################ +// Import statements +//############################################################################ +// $Id$ + +//############################################################################ + +object checker { + def check(where: String, what: String, value: Any): Unit = { + Console.print("In " + where + ", " + what + ".toString() returns "); + Console.flush; + val string: String = if (value == null) "null" else value.toString(); + val test = if (string == where) "ok" else "KO"; + Console.println(string + " -> " + test); + Console.flush; + } +} + +import checker.check; + +//############################################################################ + +//import o_ico.v_ico; + +class C_ico() { + o_ico.v_ico = this; + import o_ico.v_ico; + override def toString(): String = "C_ico"; + def method: C_ico = v_ico; + val field: C_ico = v_ico; + + check("C_ico", "v_ico ", v_ico); + check("C_ico", "field ", field); + check("C_ico", "method", method); + Console.println; +} + +object o_ico { + var v_ico: C_ico = null; + new C_ico(); +} + +//############################################################################ + +object o_ioc { + var v_ioc: C_ioc = null; + new C_ioc(); +} + +import o_ioc.v_ioc; + + +class C_ioc() { + o_ioc.v_ioc = this; + override def toString(): String = "C_ioc"; + def method: C_ioc = v_ioc; + val field: C_ioc = v_ioc; + + check("C_ioc", "v_ioc ", v_ioc); + check("C_ioc", "field ", field); + check("C_ioc", "method", method); + Console.println; +} + +//############################################################################ + +object o_oic { + var v_oic: C_oic = null; + new C_oic(); +} + +import o_oic.v_oic; + +class C_oic() { + o_oic.v_oic = this; + override def toString(): String = "C_oic"; + def method: C_oic = v_oic; + val field: C_oic = v_oic; + + check("C_oic", "v_oic ", v_oic); + check("C_oic", "field ", field); + check("C_oic", "method", method); + Console.println; +} + +//############################################################################ + +object Test { + def main(args: Array[String]): Unit = { + o_ico; + o_ioc; + o_oic; + () + } +} + +//############################################################################ diff --git a/test/files/run/iq-msil.check b/test/files/run/iq-msil.check new file mode 100644 index 0000000000..08f9fc755e --- /dev/null +++ b/test/files/run/iq-msil.check @@ -0,0 +1,12 @@ +Empty +Head: 42 +q5: Queue(0,1,2,3,4,5,6,7,8,9) +q5[5]: 5 +q5 == q5c: True +q5c == q5: True +q8: Queue(2,3,4,5,6,7,8,9,10,11) +q8 == q9: True +Elements: 1 2 3 4 5 6 7 8 9 +String: <1-2-3-4-5-6-7-8-9> +Length: 9 +Front: 1 diff --git a/test/files/run/iq.check b/test/files/run/iq.check new file mode 100644 index 0000000000..8e794a8629 --- /dev/null +++ b/test/files/run/iq.check @@ -0,0 +1,12 @@ +Empty +Head: 42 +q5: Queue(0,1,2,3,4,5,6,7,8,9) +q5[5]: 5 +q5 == q5c: true +q5c == q5: true +q8: Queue(2,3,4,5,6,7,8,9,10,11) +q8 == q9: true +Elements: 1 2 3 4 5 6 7 8 9 +String: <1-2-3-4-5-6-7-8-9> +Length: 9 +Front: 1 diff --git a/test/files/run/iq.scala b/test/files/run/iq.scala new file mode 100644 index 0000000000..87bbe45cd7 --- /dev/null +++ b/test/files/run/iq.scala @@ -0,0 +1,100 @@ +/* $Id$ + * Test file for immutable queues. + */ + +import scala.collection.immutable.Queue; + +object iq { + def main = { + /* Create an empty queue. */ + val q:Queue[Int] = Queue.Empty; + + /* Test isEmpty. + * Expected: Empty + */ + if(q.isEmpty) { + Console.println("Empty"); + } + + /* Test infix enqueing. */ + val q2 = q + 42 + 0; + + /* Test is empty and dequeue. + * Expected: Head: 42 + */ + val q4 = + if(q2.isEmpty) { + Console.println("Empty"); + q2; + } else { + val Pair(head,q3) = q2.dequeue; + Console.println("Head: " + head); + q3; + }; + + /* Test sequence enqueing. */ + val q5:Queue[Any] = q4.enqueue(1,2,3,4,5,6,7,8,9); + /* Test toString. + * Expected: Head: q5: Queue(0,1,2,3,4,5,6,7,8,9) + */ + Console.println("q5: " + q5); + /* Test apply + * Expected: q5[5]: 5 + */ + Console.println("q5[5]: " + q5(5)); + + + + val q5c:Queue[int] = Queue.Empty.enqueue(0, 1, 2, 3, 4, 5, 6, 7, 8, 9); + + /* Testing == + * Expected: q5 == q9: true + * q9 == q5: true + */ + Console.println("q5 == q5c: " + (q5 == q5c)); + Console.println("q5c == q5: " + (q5c == q5)); + + val Pair(_,q6) = q5.dequeue; + val Pair(_,q7) = q6.dequeue; + val q8 = q7 + 10 + 11; + /* Test dequeu + * Expected: q8: Queue(2,3,4,5,6,7,8,9,10,11) + */ + Console.println("q8: " + q8); + val q9 = new Queue(2,3,4,5,6,7,8,9,10,11); + + /* Testing == + * Expected: q8 == q9: true + */ + Console.println("q8 == q9: " + (q8 == q9)); + + /* Testing elements + * Expected: Elements: 1 2 3 4 5 6 7 8 9 + */ + Console.print("Elements: "); + q6.elements.foreach(e => Console.print(" "+ e + " ")); + Console.println; + + /* Testing mkString + * Expected: String: <1-2-3-4-5-6-7-8-9> + */ + Console.println("String: " + q6.mkString("<","-",">")); + + /* Testing length + * Expected: Length: 9 + */ + Console.println("Length: " + q6.length); + + /* Testing front + * Expected: Front: 1 + */ + Console.println("Front: " + q6.front); + } +} + +object Test { + def main(args: Array[String]): Unit = { + iq.main; + (); + } +} diff --git a/test/files/run/iterators.check b/test/files/run/iterators.check new file mode 100644 index 0000000000..a4b1053577 --- /dev/null +++ b/test/files/run/iterators.check @@ -0,0 +1,7 @@ +test check_from was successful +test check_range was successful +test check_take was successful +test check_drop was successful +test check_foreach was successful +test check_forall was successful + diff --git a/test/files/run/iterators.scala b/test/files/run/iterators.scala new file mode 100644 index 0000000000..7d1e44a0df --- /dev/null +++ b/test/files/run/iterators.scala @@ -0,0 +1,79 @@ +//############################################################################ +// Iterators +//############################################################################ +// $Id$ + +//############################################################################ + +object Test { + + def check_from: Int = { + val it1 = Iterator.from(-1); + val it2 = Iterator.from(0, -1); + it1.next + it2.next + } + + def check_range: Int = { + val xs1 = Iterator.range(0, 10, 2) toList; + val xs2 = Iterator.range(0, 10, -2) toList; + val xs3 = Iterator.range(10, 0, -2) toList; + val xs4 = Iterator.range(10, 0, 2) toList; + xs1.length + xs2.length + xs3.length + xs4.length + } + + def check_take: Int = { + val it1 = Iterator.from(0); + val xs1 = it1 take 10 toList; + xs1.length + } + + def check_drop: Int = { + val it1 = Iterator.from(0); + val it2 = it1 map { x => 2 * x }; + val n1 = it1 drop 2 next; + val n2 = it2 drop 2 next; + n1 + n2 + } + + def check_foreach: Int = { + val it1 = Iterator.from(0) take 20; + var n = 0; + it1 foreach { x => n = n + x } + n + } + + def check_forall: Int = { + val it1 = Iterator.from(0); + val it2 = Iterator.from(1); + 0 + } + + def check_success[A](name: String, closure: => A, expected: A): Unit = { + Console.print("test " + name); + try { + val actual: A = closure; + if (actual == expected) + Console.print(" was successful"); + else + Console.print(" failed: expected "+ expected +", found "+ actual); + } + catch { + case exception: Throwable => { + Console.print(" raised exception " + exception); + } + } + Console.println; + } + + def main(args: Array[String]): Unit = { + check_success("check_from", check_from, -1); + check_success("check_range", check_range, 10); + check_success("check_take", check_take, 10); + check_success("check_drop", check_drop, 12); + check_success("check_foreach", check_foreach, 190); + check_success("check_forall", check_forall, 0); + Console.println; + } +} + +//############################################################################ diff --git a/test/files/run/lisp.check b/test/files/run/lisp.check new file mode 100644 index 0000000000..8a61dd7315 --- /dev/null +++ b/test/files/run/lisp.check @@ -0,0 +1,26 @@ +(lambda (x) (+ (* x x) 1)) +(lambda (x) (+ (* x x) 1)) + +( '(1 2 3)) = (1 2 3) +(car '(1 2 3)) = 1 +(cdr '(1 2 3)) = (2 3) +(null? '(2 3)) = 0 +(null? '()) = 1 + +faculty(10) = 3628800 +faculty(10) = 3628800 +foobar = ("a" "bc" "def" "z") + +List('lambda,List('x),List('+,List('*,'x,'x),1)) +(lambda (x) (+ (* x x) 1)) + +( '(1 2 3)) = (1 2 3) +(car '(1 2 3)) = 1 +(cdr '(1 2 3)) = (2 3) +(null? '(2 3)) = 0 +(null? '()) = 1 + +faculty(10) = 3628800 +faculty(10) = 3628800 +foobar = ("a" "bc" "def" "z") + diff --git a/test/files/run/lisp.scala b/test/files/run/lisp.scala new file mode 100644 index 0000000000..34c4e7c7cc --- /dev/null +++ b/test/files/run/lisp.scala @@ -0,0 +1,522 @@ +//############################################################################ +// Lisp interpreter +//############################################################################ +// $Id$ + +//############################################################################ +// Lisp Scanner + +class LispTokenizer(s: String) extends Iterator[String] { + private var i = 0; + private def isDelimiter(ch: Char) = ch <= ' ' || ch == '(' || ch == ')'; + def hasNext: Boolean = { + while (i < s.length() && s.charAt(i) <= ' ') { i = i + 1 } + i < s.length() + } + def next: String = + if (hasNext) { + val start = i; + var ch = s.charAt(i); i = i + 1; + if (ch == '(') "(" + else if (ch == ')') ")" + else { + while (i < s.length() && !isDelimiter(s.charAt(i))){ i = i + 1 } + s.substring(start, i) + } + } else error("premature end of string") +} + +//############################################################################ +// Lisp Interface + +trait Lisp { + type Data; + + def string2lisp(s: String): Data; + def lisp2string(s: Data): String; + + def evaluate(d: Data): Data; + // !!! def evaluate(s: String): Data = evaluate(string2lisp(s)); + def evaluate(s: String): Data; +} + +//############################################################################ +// Lisp Implementation Using Case Classes + +object LispCaseClasses extends Lisp { + + import List.range; + + trait Data { + def elemsToString(): String = toString(); + } + case class CONS(car: Data, cdr: Data) extends Data { + override def toString() = "(" + elemsToString() + ")"; + override def elemsToString() = car.toString() + (cdr match { + case NIL() => "" + case _ => " " + cdr.elemsToString(); + }) + } + case class NIL() extends Data { // !!! use case object + override def toString() = "()"; + } + case class SYM(name: String) extends Data { + override def toString() = name; + } + case class NUM(x: Int) extends Data { + override def toString() = x.toString(); + } + case class STR(x: String) extends Data { + override def toString() = "\"" + x + "\""; + } + case class FUN(f: List[Data] => Data) extends Data { + override def toString() = "<fn>"; + } + + def list(): Data = + NIL(); + def list(x0: Data): Data = + CONS(x0, NIL()); + def list(x0: Data, x1: Data): Data = + CONS(x0, list(x1)); + def list(x0: Data, x1: Data, x2: Data): Data = + CONS(x0, list(x1, x2)); + def list(x0: Data, x1: Data, x2: Data, x3: Data): Data = + CONS(x0, list(x1, x2, x3)); + def list(x0: Data, x1: Data, x2: Data, x3: Data, x4: Data): Data = + CONS(x0, list(x1, x2, x3, x4)); + def list(x0: Data, x1: Data, x2: Data, x3: Data, x4: Data, x5: Data): Data = + CONS(x0, list(x1, x2, x3, x4, x5)); + def list(x0: Data, x1: Data, x2: Data, x3: Data, x4: Data, x5: Data, + x6: Data): Data = + CONS(x0, list(x1, x2, x3, x4, x5, x6)); + def list(x0: Data, x1: Data, x2: Data, x3: Data, x4: Data, x5: Data, + x6: Data, x7: Data): Data = + CONS(x0, list(x1, x2, x3, x4, x5, x6, x7)); + def list(x0: Data, x1: Data, x2: Data, x3: Data, x4: Data, x5: Data, + x6: Data, x7: Data, x8: Data): Data = + CONS(x0, list(x1, x2, x3, x4, x5, x6, x7, x8)); + def list(x0: Data, x1: Data, x2: Data, x3: Data, x4: Data, x5: Data, + x6: Data, x7: Data, x8: Data, x9: Data): Data = + CONS(x0, list(x1, x2, x3, x4, x5, x6, x7, x8, x9)); + + var curexp: Data = null; + var trace: Boolean = false; + var indent: Int = 0; + + def lispError[a](msg: String): a = + error("error: " + msg + "\n" + curexp); + + trait Environment { + def lookup(n: String): Data; + def extendRec(name: String, expr: Environment => Data) = + new Environment { + def lookup(n: String): Data = + if (n == name) expr(this) else Environment.this.lookup(n); + } + def extend(name: String, v: Data) = extendRec(name, (env1 => v)); + } + val EmptyEnvironment = new Environment { + def lookup(n: String): Data = lispError("undefined: " + n); + } + + def toList(x: Data): List[Data] = x match { + case NIL() => List() + case CONS(y, ys) => y :: toList(ys) + case _ => lispError("malformed list: " + x); + } + + def toBoolean(x: Data) = x match { + case NUM(0) => false + case _ => true + } + + def normalize(x: Data): Data = x match { + case CONS(SYM("def"), + CONS(CONS(SYM(name), args), CONS(body, CONS(expr, NIL())))) => + normalize(list(SYM("def"), + SYM(name), list(SYM("lambda"), args, body), expr)) + case CONS(SYM("cond"), CONS(CONS(SYM("else"), CONS(expr, NIL())),NIL())) => + normalize(expr) + case CONS(SYM("cond"), CONS(CONS(test, CONS(expr, NIL())), rest)) => + normalize(list(SYM("if"), test, expr, CONS(SYM("cond"), rest))) + case CONS(h, t) => CONS(normalize(h), normalize(t)) + case _ => x + } + + def eval(x: Data, env: Environment): Data = { + val prevexp = curexp; + curexp = x; + if (trace) { + for (val x <- range(1, indent)) Console.print(" "); + Console.println("===> " + x); + indent = indent + 1; + } + val result = eval1(x, env); + if (trace) { + indent = indent - 1; + for (val x <- range(1, indent)) Console.print(" "); + Console.println("<=== " + result); + } + curexp = prevexp; + result + } + + def eval1(x: Data, env: Environment): Data = x match { + case SYM(name) => + env lookup name + case CONS(SYM("def"), CONS(SYM(name), CONS(y, CONS(z, NIL())))) => + eval(z, env.extendRec(name, (env1 => eval(y, env1)))) + case CONS(SYM("val"), CONS(SYM(name), CONS(y, CONS(z, NIL())))) => + eval(z, env.extend(name, eval(y, env))) + case CONS(SYM("lambda"), CONS(params, CONS(y, NIL()))) => + mkLambda(params, y, env) + case CONS(SYM("if"), CONS(c, CONS(t, CONS(e, NIL())))) => + if (toBoolean(eval(c, env))) eval(t, env) else eval(e, env) + case CONS(SYM("quote"), CONS(x, NIL())) => + x + case CONS(y, xs) => + apply(eval(y, env), toList(xs) map (x => eval(x, env))) + case NUM(_) => x + case STR(_) => x + case FUN(_) => x + case _ => + lispError("illegal term") + } + + def apply(fn: Data, args: List[Data]): Data = fn match { + case FUN(f) => f(args); + case _ => lispError("application of non-function: " + fn); + } + + def mkLambda(params: Data, expr: Data, env: Environment): Data = { + + def extendEnv(env: Environment, + ps: List[String], args: List[Data]): Environment = + Pair(ps, args) match { + case Pair(List(), List()) => + env + case Pair(p :: ps1, arg :: args1) => + extendEnv(env.extend(p, arg), ps1, args1) + case _ => + lispError("wrong number of arguments") + } + + val ps: List[String] = toList(params) map { + case SYM(name) => name + case _ => error("illegal parameter list"); + } + + FUN(args => eval(expr, extendEnv(env, ps, args))) + } + + val globalEnv = EmptyEnvironment + .extend("=", FUN({ + case List(NUM(arg1),NUM(arg2)) => NUM(if (arg1 == arg2) 1 else 0) + case List(STR(arg1),STR(arg2)) => NUM(if (arg1 == arg2) 1 else 0)})) + .extend("+", FUN({ + case List(NUM(arg1),NUM(arg2)) => NUM(arg1 + arg2) + case List(STR(arg1),STR(arg2)) => STR(arg1 + arg2)})) + .extend("-", FUN({ + case List(NUM(arg1),NUM(arg2)) => NUM(arg1 - arg2)})) + .extend("*", FUN({ + case List(NUM(arg1),NUM(arg2)) => NUM(arg1 * arg2)})) + .extend("/", FUN({ + case List(NUM(arg1),NUM(arg2)) => NUM(arg1 / arg2)})) + .extend("car", FUN({ + case List(CONS(x, xs)) => x})) + .extend("cdr", FUN({ + case List(CONS(x, xs)) => xs})) + .extend("null?", FUN({ + case List(NIL()) => NUM(1) + case _ => NUM(0)})) + .extend("cons", FUN({ + case List(x, y) => CONS(x, y)})); + + def evaluate(x: Data): Data = eval(normalize(x), globalEnv); + def evaluate(s: String): Data = evaluate(string2lisp(s)); + + def string2lisp(s: String): Data = { + val it = new LispTokenizer(s); + def parseExpr(token: String): Data = { + if (token == "(") parseList + else if (token == ")") error("unbalanced parentheses") + else if ('0' <= token.charAt(0) && token.charAt(0) <= '9') + NUM(scala.runtime.compat.Platform.parseInt(token)) + else if (token.charAt(0) == '\"' && token.charAt(token.length()-1)=='\"') + STR(token.substring(1,token.length() - 1)) + else SYM(token) + } + def parseList: Data = { + val token = it.next; + if (token == ")") NIL() else CONS(parseExpr(token), parseList) + } + parseExpr(it.next) + } + + def lisp2string(d: Data): String = d.toString(); +} + +//############################################################################ +// Lisp Implementation Using Any + +object LispAny extends Lisp { + + import List._; + + type Data = Any; + + case class Lambda(f: List[Data] => Data); + + var curexp: Data = null; + var trace: boolean = false; + var indent: int = 0; + + def lispError[a](msg: String): a = + error("error: " + msg + "\n" + curexp); + + trait Environment { + def lookup(n: String): Data; + def extendRec(name: String, expr: Environment => Data) = + new Environment { + def lookup(n: String): Data = + if (n == name) expr(this) else Environment.this.lookup(n); + } + def extend(name: String, v: Data) = extendRec(name, (env1 => v)); + } + val EmptyEnvironment = new Environment { + def lookup(n: String): Data = lispError("undefined: " + n); + } + + def asList(x: Data): List[Data] = x match { + case y: List[Data] => y + case _ => lispError("malformed list: " + x) + } + + def asInt(x: Data): int = x match { + case y: int => y + case _ => lispError("not an integer: " + x) + } + + def asString(x: Data): String = x match { + case y: String => y + case _ => lispError("not a string: " + x) + } + + def asBoolean(x: Data): boolean = + if (x == 0) false else true; + + def normalize(x: Data): Data = x match { + case 'and :: x :: y :: Nil => + normalize('if :: x :: y :: 0 :: Nil) + case 'or :: x :: y :: Nil => + normalize('if :: x :: 1 :: y :: Nil) + case 'def :: (name :: args) :: body :: expr :: Nil => + normalize('def :: name :: ('lambda :: args :: body :: Nil) :: expr :: Nil) + case 'cond :: ('else :: expr :: Nil) :: rest => + normalize(expr); + case 'cond :: (test :: expr :: Nil) :: rest => + normalize('if :: test :: expr :: ('cond :: rest) :: Nil) + case 'cond :: 'else :: expr :: Nil => + normalize(expr) + case h :: t => + normalize(h) :: asList(normalize(t)) + case _ => + x + } + + def eval(x: Data, env: Environment): Data = { + val prevexp = curexp; + curexp = x; + if (trace) { + for (val x <- range(1, indent)) Console.print(" "); + Console.println("===> " + x); + indent = indent + 1; + } + val result = eval1(x, env); + if (trace) { + indent = indent - 1; + for (val x <- range(1, indent)) Console.print(" "); + Console.println("<=== " + result); + } + curexp = prevexp; + result + } + + def eval1(x: Data, env: Environment): Data = x match { + case Symbol(name) => + env lookup name + case 'def :: Symbol(name) :: y :: z :: Nil => + eval(z, env.extendRec(name, (env1 => eval(y, env1)))) + case 'val :: Symbol(name) :: y :: z :: Nil => + eval(z, env.extend(name, eval(y, env))) + case 'lambda :: params :: y :: Nil => + mkLambda(params, y, env) + case 'if :: c :: y :: z :: Nil => + if (asBoolean(eval(c, env))) eval(y, env) else eval(z, env) + case 'quote :: y :: Nil => + y + case y :: z => + apply(eval(y, env), z map (x => eval(x, env))) + case Lambda(_) => x + case y: String => x + case y: int => x + case y => lispError("illegal term") + } + + def lisp2string(x: Data): String = x match { + case Symbol(name) => name + case Nil => "()" + case y :: ys => + def list2string(xs: List[Data]): String = xs match { + case List() => "" + case y :: ys => " " + lisp2string(y) + list2string(ys) + } + "(" + lisp2string(y) + list2string(ys) + ")" + case _ => if (x.isInstanceOf[String]) "\"" + x + "\""; else x.toString() + } + + def apply(fn: Data, args: List[Data]): Data = fn match { + case Lambda(f) => f(args); + case _ => lispError("application of non-function: " + fn + " to " + args); + } + + def mkLambda(params: Data, expr: Data, env: Environment): Data = { + + def extendEnv(env: Environment, + ps: List[String], args: List[Data]): Environment = + Pair(ps, args) match { + case Pair(List(), List()) => + env + case Pair(p :: ps1, arg :: args1) => + extendEnv(env.extend(p, arg), ps1, args1) + case _ => + lispError("wrong number of arguments") + } + + val ps: List[String] = asList(params) map { + case Symbol(name) => name + case _ => error("illegal parameter list"); + } + + Lambda(args => eval(expr, extendEnv(env, ps, args))) + } + + val globalEnv = EmptyEnvironment + .extend("=", Lambda{ + case List(arg1, arg2) => if(arg1 == arg2) 1 else 0}) + .extend("+", Lambda{ + case List(arg1: int, arg2: int) => arg1 + arg2 + case List(arg1: String, arg2: String) => arg1 + arg2}) + .extend("-", Lambda{ + case List(arg1: int, arg2: int) => arg1 - arg2}) + .extend("*", Lambda{ + case List(arg1: int, arg2: int) => arg1 * arg2}) + .extend("/", Lambda{ + case List(arg1: int, arg2: int) => arg1 / arg2}) + .extend("nil", Nil) + .extend("cons", Lambda{ + case List(arg1, arg2) => arg1 :: asList(arg2)}) + .extend("car", Lambda{ + case List(x :: xs) => x}) + .extend("cdr", Lambda{ + case List(x :: xs) => xs}) + .extend("null?", Lambda{ + case List(Nil) => 1 + case _ => 0}); + + def evaluate(x: Data): Data = eval(normalize(x), globalEnv); + def evaluate(s: String): Data = evaluate(string2lisp(s)); + + def string2lisp(s: String): Data = { + val it = new LispTokenizer(s); + def parseExpr(token: String): Data = { + if (token == "(") parseList + else if (token == ")") error("unbalanced parentheses") + //else if (Character.isDigit(token.charAt(0))) + else if (scala.runtime.compat.Platform.isDigit(token.charAt(0))) + scala.runtime.compat.Platform.parseInt(token) + else if (token.charAt(0) == '\"' && token.charAt(token.length()-1)=='\"') + token.substring(1,token.length() - 1) + else Symbol(token) + } + def parseList: List[Data] = { + val token = it.next; + if (token == ")") Nil else parseExpr(token) :: parseList + } + parseExpr(it.next) + } +} + +//############################################################################ +// List User + +class LispUser(lisp: Lisp) { + + import lisp._; + + def evaluate(s: String) = lisp2string(lisp.evaluate(s)); + + def run = { + + Console.println(string2lisp("(lambda (x) (+ (* x x) 1))").asInstanceOf[Object]); + Console.println(lisp2string(string2lisp("(lambda (x) (+ (* x x) 1))"))); + Console.println; + + Console.println("( '(1 2 3)) = " + evaluate(" (quote(1 2 3))")); + Console.println("(car '(1 2 3)) = " + evaluate("(car (quote(1 2 3)))")); + Console.println("(cdr '(1 2 3)) = " + evaluate("(cdr (quote(1 2 3)))")); + Console.println("(null? '(2 3)) = " + evaluate("(null? (quote(2 3)))")); + Console.println("(null? '()) = " + evaluate("(null? (quote()))")); + Console.println; + + Console.println("faculty(10) = " + evaluate( + "(def (faculty n) " + + "(if (= n 0) " + + "1 " + + "(* n (faculty (- n 1)))) " + + "(faculty 10))")); + Console.println("faculty(10) = " + evaluate( + "(def (faculty n) " + + "(cond " + + "((= n 0) 1) " + + "(else (* n (faculty (- n 1))))) " + + "(faculty 10))")); + Console.println("foobar = " + evaluate( + "(def (foo n) " + + "(cond " + + "((= n 0) \"a\")" + + "((= n 1) \"b\")" + + "((= (/ n 2) 1) " + + "(cond " + + "((= n 2) \"c\")" + + "(else \"d\")))" + + "(else " + + "(def (bar m) " + + "(cond " + + "((= m 0) \"e\")" + + "((= m 1) \"f\")" + + "(else \"z\"))" + + "(bar (- n 4)))))" + + "(val nil (quote ())" + + "(val v1 (foo 0) " + + "(val v2 (+ (foo 1) (foo 2)) " + + "(val v3 (+ (+ (foo 3) (foo 4)) (foo 5)) " + + "(val v4 (foo 6) " + + "(cons v1 (cons v2 (cons v3 (cons v4 nil))))))))))")); + Console.println; + } +} + +//############################################################################ +// Main + +object Test { + def main(args: Array[String]): Unit = { + new LispUser(LispCaseClasses).run; + new LispUser(LispAny).run; + () + } +} + +//############################################################################ diff --git a/test/files/run/lists.check b/test/files/run/lists.check new file mode 100644 index 0000000000..1da0075273 --- /dev/null +++ b/test/files/run/lists.check @@ -0,0 +1,12 @@ +test check_count was successful +test check_diff was successful +test check_exists was successful +test check_filter was successful +test check_foldLeft was successful +test check_forall was successful +test check_intersect was successful +test check_remove was successful +test check_union was successful +test check_zip was successful +test check_zipAll was successful + diff --git a/test/files/run/lists.scala b/test/files/run/lists.scala new file mode 100644 index 0000000000..3791828a1c --- /dev/null +++ b/test/files/run/lists.scala @@ -0,0 +1,115 @@ +//############################################################################ +// Lists +//############################################################################ +// $Id$ + +//############################################################################ + +object Test { + + val xs1 = List(1, 2, 3); + val xs2 = List('a', 'b'); + val xs3 = List(List(1, 2), List(4, 5)); + val xs4 = List(2, 4, 6, 8); + val xs5 = List(List(3, 4), List(3), List(4, 5)); + + def check_count: int = { + val n1 = xs1 count { e => e % 2 != 0 }; + val n2 = xs4 count { e => e < 5 }; + n1 + n2 + } + + def check_diff: int = { + val ys1 = xs1 diff xs4; + val ys2 = xs3 diff xs5; + ys1.length + ys2.length + } + + def check_exists: boolean = { + val b1 = xs1 exists { e => e % 2 == 0 }; + val b2 = xs4 exists { e => e == 5 }; + b1 & b2 + } + + def check_filter: int = { + val ys1 = xs1 filter { e => e % 2 == 0 }; + val ys2 = xs4 filter { e => e < 5 }; + ys1.length + ys2.length + } + + def check_foldLeft: int = { + val n1 = xs1.foldLeft(0)((e1, e2) => e1 + e2); + val ys1 = xs4.foldLeft(List[Int]())((e1, e2) => e2 :: e1); + n1 + ys1.length + } + + def check_forall: boolean = { + val b1 = xs1 forall { e => e < 10}; + val b2 = xs4 forall { e => e % 2 == 0 }; + b1 & b2 + } + + def check_intersect: int = { + val ys1 = xs1 intersect xs4; + val ys2 = xs3 intersect xs5; + ys1.length + ys2.length + } + + def check_remove: int = { + val ys1 = xs1 remove { e => e % 2 != 0 }; + val ys2 = xs4 remove { e => e < 5 }; + ys1.length + ys2.length + } + + def check_union: int = { + val ys1 = xs1 union xs4; + val ys2 = xs3 union xs5; + ys1.length + ys2.length + } + + def check_zip: int = { + val ys1 = xs1 zip xs2; + val ys2 = xs1 zip xs3; + ys1.length + ys2.length + } + + def check_zipAll: int = { + val ys1 = xs1.zipAll(xs2, 0, '_'); + val ys2 = xs1.zipAll(xs3, 0, List(-1)); + ys1.length + ys2.length + } + + def check_success[A](name: String, closure: => A, expected: A): Unit = { + Console.print("test " + name); + try { + val actual: A = closure; + if (actual == expected) + Console.print(" was successful"); + else + Console.print(" failed: expected "+ expected +", found "+ actual); + } + catch { + case exception: Throwable => { + Console.print(" raised exception " + exception); + } + } + Console.println; + } + + def main(args: Array[String]): Unit = { + check_success("check_count", check_count, 4); + check_success("check_diff", check_diff, 3); + check_success("check_exists", check_exists, false); + check_success("check_filter", check_filter, 3); + check_success("check_foldLeft", check_foldLeft, 10); + check_success("check_forall", check_forall, true); + check_success("check_intersect", check_intersect, 2); + check_success("check_remove", check_remove, 3); + check_success("check_union", check_union, 10); + check_success("check_zip", check_zip, 4); + check_success("check_zipAll", check_zipAll, 6); + Console.println; + } +} + +//############################################################################ diff --git a/test/files/run/literals.check b/test/files/run/literals.check new file mode 100644 index 0000000000..5e848f9a47 --- /dev/null +++ b/test/files/run/literals.check @@ -0,0 +1,65 @@ +test '\u0024' == '$' was successful +test '\u005f' == '_' was successful +test 65.asInstanceOf[char] == 'A' was successful +test "\141\142" == "ab" was successful +test "\0x61\0x62".trim() == "x61\0x62" was successful + +test 01 == 1 was successful +test 010 == 8 was successful +test 0X01 == 1 was successful +test 0x01 == 1 was successful +test 0x10 == 16 was successful +test 0xa == 10 was successful +test 0x0a == 10 was successful +test +01 == 1 was successful +test +010 == 8 was successful +test +0x01 == 1 was successful +test +0x10 == 16 was successful +test +0xa == 10 was successful +test +0x0a == 10 was successful +test -01 == -1 was successful +test -010 == -8 was successful +test -0x01 == -1 was successful +test -0x10 == -16 was successful +test -0xa == -10 was successful +test -0x0a == -10 was successful +test 017777777777 == 2147483647 was successful +test 020000000000 == -2147483648 was successful +test 037777777777 == -1 was successful +test 0x7fffffff == 2147483647 was successful +test 0x80000000 == -2147483648 was successful +test 0xffffffff == -1 was successful + +test 1l == 1L was successful +test 1L == 1l was successful +test 1.asInstanceOf[long] == 1l was successful +test 0777777777777777777777L == 9223372036854775807L was successful +test 01000000000000000000000L == -9223372036854775808L was successful +test 01777777777777777777777L == -1L was successful +test 0x7fffffffffffffffL == 9223372036854775807L was successful +test 0x8000000000000000L == -9223372036854775808L was successful +test 0xffffffffffffffffL == -1L was successful + +test 1e1f == 10.0f was successful +test 2.f == 2.0f was successful +test .3f == 0.3f was successful +test 0f == 0.0f was successful +test 3.14f == 3.14f was successful +test 6.022e23f == 6.022e23f was successful +test 09f == 9.0f was successful +test 1.asInstanceOf[float] == 1.0 was successful +test 1l.asInstanceOf[float] == 1.0 was successful + +test 1e1 == 10.0 was successful +test 2. == 2.0 was successful +test 2.d == 2.0 was successful +test .3 == 0.3 was successful +test 0.0 == 0.0 was successful +test 0d == 0.0 was successful +test 3.14 == 3.14 was successful +test 1e-9d == 1.0e-9 was successful +test 1e137 == 1.0e137 was successful +test 1.asInstanceOf[double] == 1.0 was successful +test 1l.asInstanceOf[double] == 1.0 was successful + +test "".length() was successful diff --git a/test/files/run/literals.scala b/test/files/run/literals.scala new file mode 100644 index 0000000000..b0077aec9d --- /dev/null +++ b/test/files/run/literals.scala @@ -0,0 +1,136 @@ +//############################################################################ +// Literals +//############################################################################ +// $Id$ + +//############################################################################ + +object Test { + + /* I add a couple of Unicode identifier tests here temporarily */ + + def \u03b1\u03c1\u03b5\u03c4\u03b7 = "alpha rho epsilon tau eta"; + + case class GGG(i:int) { + def \u21a1\u21a1( that:GGG ) = that; + } + def check_success[a](name: String, closure: => a, expected: a): Unit = { + Console.print("test " + name); + try { + val actual: a = closure; + if (actual == expected) { + Console.print(" was successful"); + } else { + Console.print(" failed: expected "+ expected +", found "+ actual); + } + } catch { + case exception: Throwable => { + Console.print(" raised exception " + exception); + } + } + Console.println; + } + + def main(args: Array[String]) = { + // char + check_success("'\\u0024' == '$'", '\u0024', '$'); + check_success("'\\u005f' == '_'", '\u005f', '_'); + check_success("65.asInstanceOf[char] == 'A'", 65.asInstanceOf[char], 'A'); + check_success("\"\\141\\142\" == \"ab\"", "\141\142", "ab"); + check_success("\"\\0x61\\0x62\".trim() == \"x61\\0x62\"", "\0x61\0x62".trim(), "x61\0x62"); + + Console.println; + + // int + check_success("01 == 1", 01, 1); + check_success("010 == 8", 010, 8); + check_success("0X01 == 1", 0X01, 1); + check_success("0x01 == 1", 0x01, 1); + check_success("0x10 == 16", 0x10, 16); + check_success("0xa == 10", 0xa, 10); + check_success("0x0a == 10", 0x0a, 10); + + check_success("+01 == 1", +01, 1); + check_success("+010 == 8", +010, 8); + check_success("+0x01 == 1", +0x01, 1); + check_success("+0x10 == 16", +0x10, 16); + check_success("+0xa == 10", +0xa, 10); + check_success("+0x0a == 10", +0x0a, 10); + + check_success("-01 == -1", -01, -1); + check_success("-010 == -8", -010, -8); + check_success("-0x01 == -1", -0x01, -1); + check_success("-0x10 == -16", -0x10, -16); + check_success("-0xa == -10", -0xa, -10); + check_success("-0x0a == -10", -0x0a, -10); + + check_success("017777777777 == 2147483647", 017777777777, 2147483647); + check_success("020000000000 == -2147483648", 020000000000, -2147483648); + check_success("037777777777 == -1", 037777777777, -1); + + check_success("0x7fffffff == 2147483647", 0x7fffffff, 2147483647); + check_success("0x80000000 == -2147483648", 0x80000000, -2147483648); + check_success("0xffffffff == -1", 0xffffffff, -1); + + Console.println; + + // long + check_success("1l == 1L", 1l, 1L); + check_success("1L == 1l", 1L, 1l); + check_success("1.asInstanceOf[long] == 1l", 1.asInstanceOf[long], 1l); + + check_success("0777777777777777777777L == 9223372036854775807L", + 0777777777777777777777L, 9223372036854775807L); + check_success("01000000000000000000000L == -9223372036854775808L", + 01000000000000000000000L, -9223372036854775808L); + check_success("01777777777777777777777L == -1L", + 01777777777777777777777L, -1L); + + check_success("0x7fffffffffffffffL == 9223372036854775807L", + 0x7fffffffffffffffL, 9223372036854775807L); + check_success("0x8000000000000000L == -9223372036854775808L", + 0x8000000000000000L, -9223372036854775808L); + check_success("0xffffffffffffffffL == -1L", + 0xffffffffffffffffL, -1L); + + Console.println; + + // see JLS at address: + // http://java.sun.com/docs/books/jls/second_edition/html/lexical.doc.html#230798 + + // float + check_success("1e1f == 10.0f", 1e1f, 10.0f); + check_success("2.f == 2.0f", 2.f, 2.0f); + check_success(".3f == 0.3f", .3f, 0.3f); + check_success("0f == 0.0f", 0f, 0.0f); + check_success("3.14f == 3.14f", 3.14f, 3.14f); + check_success("6.022e23f == 6.022e23f", 6.022e23f, 6.022e23f); + check_success("09f == 9.0f", 09f, 9.0f); + check_success("1.asInstanceOf[float] == 1.0", 1.asInstanceOf[float], 1.0f); + check_success("1l.asInstanceOf[float] == 1.0", 1l.asInstanceOf[float], 1.0f); + + Console.println; + + // double + check_success("1e1 == 10.0", 1e1, 10.0); + check_success("2. == 2.0", 2., 2.0); + check_success("2.d == 2.0", 2.d, 2.0); + check_success(".3 == 0.3", .3, 0.3); + check_success("0.0 == 0.0", 0.0, 0.0); + check_success("0d == 0.0", 0d, 0.0); + check_success("3.14 == 3.14", 3.14, 3.14); + check_success("1e-9d == 1.0e-9", 1e-9d, 1.0e-9); + check_success("1e137 == 1.0e137", 1e137, 1.0e137); + check_success("1.asInstanceOf[double] == 1.0", 1.asInstanceOf[double], 1.0); + check_success("1l.asInstanceOf[double] == 1.0", 1l.asInstanceOf[double], 1.0); + + Console.println; + check_success("\"\".length()", "\u001a".length(), 1); +/* + val ggg = GGG( 1 ) \u21a1\u21a1 GGG( 2 ); + check_success("ggg == GGG( 2 )", ggg, GGG( 2 )); +*/ + } +} + +//############################################################################ diff --git a/test/files/run/map_test.check b/test/files/run/map_test.check new file mode 100644 index 0000000000..a788c0fbca --- /dev/null +++ b/test/files/run/map_test.check @@ -0,0 +1,3 @@ +0->0 1->1 2->2 3->3 4->4 5->5 6->6 7->7 8->8 9->9 10->10 11->11 12->12 13->13 14->14 15->15 16->16 17->17 18->18 19->19 20->20 21->21 22->22 23->23 24->24 25->25 26->26 27->27 28->28 29->29 30->30 31->31 32->32 33->33 34->34 35->35 36->36 37->37 38->38 39->39 40->40 41->41 42->42 666->A bigger random number 4711->A big random number +0->0 1->1 2->2 3->3 4->4 5->5 6->6 7->7 8->8 9->9 10->10 11->11 12->12 13->13 14->14 15->15 16->16 17->17 18->18 19->19 20->20 21->21 22->22 23->23 24->24 25->25 26->26 27->27 28->28 29->29 30->30 31->31 32->32 33->33 34->34 35->35 36->36 37->37 38->38 39->39 40->40 41->41 42->42 666->A bigger random number 4711->A big random number +OK diff --git a/test/files/run/map_test.scala b/test/files/run/map_test.scala new file mode 100644 index 0000000000..53ee416367 --- /dev/null +++ b/test/files/run/map_test.scala @@ -0,0 +1,42 @@ +import scala.collection.immutable.Map; +import scala.collection.immutable.TreeMap; +import scala.collection.immutable.ListMap; + +object Test extends Application { + test1(); + test2(); + Console.println("OK"); + + + + def test1() = { + val myMap:TreeMap[int,String] = new TreeMap; + test_map(myMap); + } + + def test2() = { + val myMap:ListMap[int,String] = new ListMap; + test_map(myMap); + } + + def test_map(myMap:Map[int,String]) = { + val map1 = myMap.update(42,"The answer"); + val map2 = map1.update(17,"A small random number"); + val map3 = map2.update(666,"A bigger random number"); + val map4 = map3.update(4711,"A big random number"); + map1 == myMap + 42 -> "The answer"; + var i = 0; + var map = map4; + while(i < 43) { + map = map.update(i,i.toString()); + i = i + 1; + } + i = 0; + while(i < 4712) { + if(map.isDefinedAt(i)) + Console.print(i + "->" + map(i) + " "); + i = i + 1; + } + Console.println(""); + } +} diff --git a/test/files/run/misc.check b/test/files/run/misc.check new file mode 100644 index 0000000000..9fa7b72d50 --- /dev/null +++ b/test/files/run/misc.check @@ -0,0 +1,33 @@ +### Hello +### 17 +### Bye + +### fib(0) = 1 +### fib(1) = 1 +### fib(2) = 2 +### fib(3) = 3 +### fib(4) = 5 +=== MyClass::toString === +=== MySubclass::toString === +=== MyClass::test === + +identity + +A.a = 1 +B.a = 5 +B.b = 2 + +X.a = 4 +Y.a = 11 +Y.b = 5 +Y.b = 5 + +X::foo + +Y::foo +X::foo + +3 +3 + +true diff --git a/test/files/run/misc.scala b/test/files/run/misc.scala new file mode 100644 index 0000000000..900139e1cd --- /dev/null +++ b/test/files/run/misc.scala @@ -0,0 +1,239 @@ +// $Id$ + +object Test { + +def fac(n: Int): Int = if (n < 2) 1 else fac(n - 1) * n; + +// Fibonacci + + +def fib(n: Int): Int = if (n < 2) 1 else fib(n - 1) + fib(n - 2); + +def show_fib(n: Int): Int = { + Console.print("### fib("); + Console.print(n); + Console.print(") = "); + Console.flush; + val v = fib(n); + Console.print(v); + Console.println; + Console.flush; + v +} + +def id[X](x: X): X = x; + +def apply[X](f: X => X, x: X): X = f(x); + +def id_obj(x: Object): Object = x; + +def apply_obj(f: Object => Object, x: Object): Object = f(x); + +def id_any(x: scala.Any): scala.Any = x; + +def apply_any(f: scala.Any => scala.Any, x: scala.Any): scala.Any = f(x); + +def id_int(x: Int): Int = x; + +def apply_int(f: Int => Int, x: Int): Int = f(x); + +class MyClass() { + override def toString() = "=== MyClass::toString ==="; + def test() = Console.println("=== MyClass::test ==="); +} + +class MySubclass() extends MyClass() { + override def toString() = "=== MySubclass::toString ==="; +} + +def foobar = { + 42; + 42l; + 23.5f; + 23.5; + "Hello"; + 32 + 45; + // !!! System + // java; // !!! why is this legal ? what does it return ? + // java.lang; + //System.out; + Console.println("### Hello"); + Console.print("### "); + Console.println(17); + Console.println("### Bye"); + Console.println; + val x = 13; + x; + // !!! why are DefDef replaced by Block(Tree[0])? we should use Empty! + def f = 19; + f; + def f0() = 11; + f0(); + def f1(x: Int) = x; + f1(7); + def f2(x: Int, y: Int) = x + y; + f2(3,5); + def f11(x: Int)(y: Int) = x + y; + f11(23)(2); + 1 < 2; + if (1 < 2) 3 else 4; + + + show_fib(0); + show_fib(1); + show_fib(2); + show_fib(3); + show_fib(4); + + // !!! show_fib(id[Int](4)); + +/* + show_fib(5); + show_fib(6); + show_fib(7); + show_fib(8); + show_fib(9); + show_fib(10); + show_fib(11); + show_fib(12); +*/ + + val myObj = new MyClass(); + Console.println(myObj); + val mySub = new MySubclass(); + Console.println(mySub); + myObj.test(); + Console.println; + + Console.println(apply_any(id_any, "identity").toString()); + Console.println; +}; + +foobar; + +//############################################################################ + +class A(a: Int) { + def getA = a; +} + +class B(b: Int, c: Int) extends A(b + c) { + def getB = b; +} + +class X(x: Int) { + def getX = x; +} +case class Y(y: Int, z: Int) extends X(y + z) { + def getY = y; + def getAA = this.y; +} + +{ + val a: A = new A(1); + val b: B = new B(2,3); + + val x: X = new X(4); + val y: Y = new Y(5,6); + + Console.println("A.a = " + a.getA); + Console.println("B.a = " + b.getA); + Console.println("B.b = " + b.getB); + Console.println; + + Console.println("X.a = " + x.getX); + Console.println("Y.a = " + y.getX); + Console.println("Y.b = " + y.getY); + Console.println("Y.b = " + y.y); + Console.println; +} + +//############################################################################ + +{ +class X() { + + def foo = { + Console.println("X::foo"); + } + +} + +class Y() extends X() { + + override def foo = { + Console.println("Y::foo"); + super.foo; + } + +} + +val x: X = new X(); +val y: X = new Y(); + +x.foo; +Console.println; + +y.foo; +Console.println; +} + +//############################################################################ + +{ +class X() {} + +class O(a: Int) { + + + case class Y(b: Int) extends X() { + override def toString() = ""; + def bar = a + b; + } + + def foo = Y(2).bar +} + +Console.println(new O(1).foo) +} + +{ + +class O(a: Int) { + + class X() {} + + case class Y(b: Int) extends X() { + override def toString() = ""; + def bar = a + b; + } + + def foo = Y(2).bar +} + +Console.println(new O(1).foo) +} + +Console.println; + + case class Bar(); + + case class Foo(i:int, j:char, c:Bar) ; + + Console.println( + Foo(3,'a',Bar()).caseElement( -1 ) == null + && Foo(3,'a',Bar()).caseElement( 0 ) == 3 + && Foo(3,'a',Bar()).caseElement( 1 ) == 'a' + && Foo(3,'a',Bar()).caseElement( 2 ) == Bar() + && Foo(3,'a',Bar()).caseElement( 3 ) == null + && Bar().caseArity == 0 + && Foo(3,'a',Bar()).caseArity == 3); + +//############################################################################ + + def main(args: Array[String]): Unit = { + () + } + +//############################################################################ +} diff --git a/test/files/run/mixins.check b/test/files/run/mixins.check new file mode 100644 index 0000000000..59a2c1d3f3 --- /dev/null +++ b/test/files/run/mixins.check @@ -0,0 +1,7 @@ +M1::B::f +M1::f M2::f M3::f +one +two +A +B +C diff --git a/test/files/run/mixins.scala b/test/files/run/mixins.scala new file mode 100644 index 0000000000..bbc20d33d2 --- /dev/null +++ b/test/files/run/mixins.scala @@ -0,0 +1,85 @@ +// $Id$ + +// Test 1: "super" coming from mixins + +import Console._; + +object Test1 { + class A { + def f = "A::f"; + } + + class B extends A { + override def f = "B::f"; + } + + trait M1 extends A { + override def f = "M1::" + super.f; + } + + class C extends B with M1 { + override def f = super[M1].f; + } + + def test(): Unit = { + val c = new C; + Console.println(c.f); + } +} + +// Test 2: qualified "super" inside of the host class + +object Test2 { + class M1 { + def f = "M1::f"; + } + + trait M2 { + def f = "M2::f"; + } + + trait M3 { + def f = "M3::f"; + } + + class Host extends M1 with M2 with M3 { + override def f = super[M1].f + " " + super[M2].f + " " + super[M3].f + } + + def test(): Unit = { + val h = new Host; + Console.println(h.f) + } +} + +// Test 3: mixin evaluation order (bug 120) + +object Test3 { + + class A(x: Unit, y: Unit) { + Console.println("A"); + } + + trait B { + println("B"); + } + + class C extends A({ println("one"); }, { println("two"); }) + with B { + println("C"); + } + + def test() = { + val c = new C(); + } +} + +// Main testing function + +object Test { + def main(args: Array[String]): Unit = { + Test1.test(); + Test2.test(); + Test3.test(); + } +} diff --git a/test/files/run/ok.lst b/test/files/run/ok.lst new file mode 100644 index 0000000000..b8d709a476 --- /dev/null +++ b/test/files/run/ok.lst @@ -0,0 +1,30 @@ +arrays.scala +boolexprs.scala +bugs.scala +constructors.scala +Course-2002-01.scala +Course-2002-02.scala +Course-2002-03.scala +Course-2002-04.scala +Course-2002-05.scala +Course-2002-06.scala +Course-2002-07.scala +Course-2002-08.scala +Course-2002-09.scala +Course-2002-10.scala +Course-2002-13.scala +enums.scala +exceptions.scala +imports.scala +iq.scala +iterators.scala +lisp.scala +lists.scala +map_test.scala +misc.scala +mixins.scala +NestedClasses.scala +overloads.scala +runtime.scala +literals.scala +bridges.scala diff --git a/test/files/run/overloads.check b/test/files/run/overloads.check new file mode 100644 index 0000000000..7d294870f6 --- /dev/null +++ b/test/files/run/overloads.check @@ -0,0 +1,15 @@ +ok: -('a') = -97 +ok: -(97) = -97 +ok: Ops.-('a') = a +ok: Ops.-(97) = 97 +ok: -- = 0 +ok: --('a') = a +ok: --(97) = 97 +ok: Ops.-- = 0 +ok: Ops.--('a') = a +ok: Ops.--(97) = 97 +ok: Funcs.foo = 0 +ok: Funcs.foo('a') = 2 +ok: Funcs.foo(97) = 3 +ok: M1.f(3) = 11 +ok: M2.f(3) = 22 diff --git a/test/files/run/overloads.scala b/test/files/run/overloads.scala new file mode 100644 index 0000000000..31664b2ea6 --- /dev/null +++ b/test/files/run/overloads.scala @@ -0,0 +1,96 @@ +//############################################################################ +// Overloads +//############################################################################ +// $Id$ + +//############################################################################ + +object Ops { + def - = 0; + def -(c: Char) = c; + def -(i: Int) = i; + + def -- = 0; + def --(c: Char) = c; + def --(i: Int) = i; +} + +object Funcs { + def foo = 0; +// def foo() = 1; + def foo(c: Char) = 2; + def foo(i: Int) = 3; +} + +object M1 { + def f[A](x: A) = 11; + def f[A <: Ordered[A]](x: A) = 12; +} + +object M2 { + def f[A <: Ordered[A]](x: A) = 21; + def f[A](x: A) = 22; +} + +object overloads { + + def check(what: String, actual: Any, expected: Any): Unit = { + val success: Boolean = actual == expected; + Console.print(if (success) "ok" else "KO"); + var value: String = if (actual == null) "null" else actual.toString(); + if (value == "\u0000") value = "\\u0000"; + Console.print(": " + what + " = " + value); + if (!success) Console.print(" != " + expected); + Console.println; + Console.flush; + } + + def - = 0; + def -(c: Char) = c; + def -(i: Int) = i; + + def -- = 0; + def --(c: Char) = c; + def --(i: Int) = i; + + def test: Unit = { + check("-('a')", -('a'), -97); + check("-(97)", -(97), -97); + + check("Ops.-('a')", Ops.-('a'), 'a'); + check("Ops.-(97)", Ops.-(97), 97); + + check("--", --, 0); + check("--('a')", --('a'), 'a'); + check("--(97)", --(97), 97); + + check("Ops.--", Ops.--, 0); + check("Ops.--('a')", Ops.--('a'), 'a'); + check("Ops.--(97)", Ops.--(97), 97); + + check("Funcs.foo", Funcs.foo, 0); +// check("Funcs.foo()", Funcs.foo(), 1); + check("Funcs.foo('a')", Funcs.foo('a'), 2); + check("Funcs.foo(97)", Funcs.foo(97), 3); + + val x = 3; + check("M1.f(" + x +")", M1.f(x), 11); + check("M2.f(" + x +")", M2.f(x), 22); +// val y = new scala.collection.mutable.Stack[Int]; +// check("M1.f(" + y +")", M1.f(y), 12); +// check("M2.f(" + y +")", M2.f(y), 21); + } + +} + +//############################################################################ + +object Test { + + def main(args: Array[String]): Unit = { + overloads.test; + } + +} + +//############################################################################ diff --git a/test/files/run/regularpatmat.check b/test/files/run/regularpatmat.check new file mode 100644 index 0000000000..3417d9a98a --- /dev/null +++ b/test/files/run/regularpatmat.check @@ -0,0 +1,126 @@ +pretest +passed ok +testWR_1 +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +testWR_2 +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +testWR_3 +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +testWR_4 +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +testWR_5 +passed ok +passed ok +passed ok +testWR_6 +passed ok +passed ok +testWR_7 +passed ok +testWR_8 +passed ok +testWS +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +testWT +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +testWV +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +testBK +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +testBM +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +BN preTest: true +testBN +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +testBO +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +testMZ - bugs #132 #133b #180 #195 #196 #398 #406 #441 +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok +passed ok diff --git a/test/files/run/regularpatmat.scala b/test/files/run/regularpatmat.scala new file mode 100644 index 0000000000..4d1ac796e0 --- /dev/null +++ b/test/files/run/regularpatmat.scala @@ -0,0 +1,809 @@ +// Burak's test suite for regular pattern matching + +//import java.lang.System; // to avoid name clash with .NET's library + +object Test { + def main(args: Array[String]): Unit = { + Console.println("pretest"); + val L = List(1,2,3); + scala.testing.UnitTest.assertEquals( L, L match { case List(xs@_*) => xs; } ) ; + + testWR.main( args ); + testWS.main( args ); + testWT.main( args ); + testWV.main( args ); + //testWW.main( args ); + testBK.main( args ); + testBL.main( args ); + testBM.main( args ); + testBN.main( args ); + testBO.main( args ); + testMZ.main; + //testNN.main; + //testBugSequenceApply.main; + } +} + +// contains 17 visitors plus X + +// analyzer related (no execution) +object bug179 { + case class One(); + object Foo { + def test(xs: List[Any]) = xs match { + case List(((((One(), One())*) | (One(), One())), One())) => + Console.println("case") + case _ => + Console.println("default"); + } + } +} +// testW? are for recognition only ( no variables ) +// testB? are for variables binding + +object values { // test values reused in nearly all test cases + + val s0:List[Char] = Nil ; + val s1:List[Char] = 'a'::'b'::'c'::Nil ; + val s2:List[Char] = 'a'::'b'::'c'::s1 ; + val s3:List[Char] = 'a'::'a'::'a'::Nil ; + val s4:List[Char] = 'b'::'c'::Nil ; + val s5:List[Char] = 'b'::Nil ; + val s6:List[Char] = 'b'::'a'::'a'::'a'::Nil ; + + val s7:List[Int] = 1::2::7::Nil ; + val s8:List[Int] = 1::0::1::0::Nil; + val s9:List[Int] = Nil ; + + val s10:List[Char] = '7'::'0'::'1'::'.'::'2'::'4'::Nil ; + +} + +// matching without binding + +// 2do case [ 'a'; x; y ] => 100 +// case [ z @ ('a'; x; y) ] => 100 +// 2do case [ 'a'*; x @ ( _;('a'; 'b')* ); y @ 'b'* ] => 100 +// case _ => 321 // 20022 // this never happens + +object testBK { + + import values._ ; + + import scala.testing.UnitTest._ ; + + def doit1(e: List[Char]):Int = e match { + + case List( 'a'*, x @ ( 'a',('a', 'b')* ), y @ ('b'*) ) => { 100 } + + case List( _ * ) => 321 + }; + + def test1:Unit = { + Console.println("testBK"); + //test[List[Char],Int]( doit1, s0, 321); + assertEquals( doit1( s0 ), 321); + assertEquals( doit1( s1 ),321); + assertEquals( doit1( s2 ),321); + assertEquals( doit1( s3 ),100); + assertEquals( doit1( s4 ),321); + assertEquals( doit1( s5 ),321); + assertEquals( doit1( s6 ),321) + }; + + def main( args:Array[ String ] ) = { + test1; + } + +} + +// tests with binding + +object testBL { + + import scala.testing.UnitTest._ ; + + def preTest(a:String,b:String):boolean = (a==b); + + def doit( x:List[String] ):String = x match { + + case List( z @ "John" ) => z + + } + + // BEWARE: main type should be specified... + // often, last thing is not () then you have a problem + + def main(args:Array[String]):Unit = { + + val a = "John"; + val b = "John"; + + assertEquals( a == b, true ); + assertEquals( doit( List( b ) ), "John" ) + + } +} +object testBM { + + import scala.testing.UnitTest._ ; + import values._ ; + + def doit1(e: List[Char]):List[Char] = e match { + + case List( 'a'*, x @ ( 'a',('a', 'b')* ), y @ ('b'*) ) + + => { x.toList } + + case List( 'a'*, x @ (('a', 'b')*) , y @ (('a','b','c') *) ) + + => { y.toList } + + case List( _ * ) + + => Nil + }; + + def test1:Unit = { + Console.println("testBM"); + assertEquals( doit1( s0 ), Nil); + assertEquals( doit1( s1 ), s1); + assertEquals( doit1( s2 ), s2); + + assertEquals( doit1( s3 ), List('a')); + assertEquals( doit1( s4 ), Nil); + assertEquals( doit1( s5 ), Nil); + assertEquals( doit1( s6 ), Nil); + + val t7:List[Char] = 'a'::'a'::'a'::'b'::'b'::'b'::Nil; + //val t7ex:List[Char] = 'a'::'a'::'b'::Nil; // with longest match policy + + assertEquals( doit1( t7 ), List('a') ); + }; + + def main( args:Array[ String ] ) = { + test1; + } + +} +object testBN { + + import scala.testing.UnitTest._ ; + import values._ ; + + class testClass; + + case class testA( arg:List[Char] ) extends testClass; + + def doit1(e: testClass):List[Char] = e match { + case testA(List( 'a', x, y )) => x::y::Nil + case _ => Nil + }; + + def test1:Unit = { + Console.print("BN preTest: "); + Console.println( Nil == Nil ); + Console.println("testBN"); + + assertEquals + ( doit1( testA(s0)), Nil); + + assertEquals + ( doit1( testA(s1)), 'b'::'c'::Nil); + + assertEquals + ( doit1( testA(s2)), Nil); + + assertEquals + ( doit1( testA(s3)), 'a'::'a'::Nil); + + assertEquals + ( doit1( testA(s4)), Nil); + + assertEquals + ( doit1( testA(s5)), Nil); + + assertEquals + ( doit1( testA(s6)), Nil); + + }; + + + def main( args:Array[String] ) = { + + test1 + + } + +} + +object testBO { + + // example suggested by Matthias + import scala.testing.UnitTest._ ; + + + case class Person( firstname:String, lastname:String ); + + def onlyJohn( db:List[ Person ] ):List[ String ] = { + + db match { + + case List( Person( "John", lastname ) ) + + => lastname::Nil + + case _ + => Nil + + } + + } + + /** first longest match policy -> the star is greedy/hungry/... + */ + + def searchFirstJohn( db:List[ Person ] ):String = { + + db match { + + case List( _ *, Person( "John", lastname ), _ * ) + => lastname + + case _ + => "<not found>" + + } + + } + + /** first longest match policy -> star is a greedy/hungry + */ + + def searchJohns( db:List[Person]):List[String] = { + + db match { + + case List( _ *, Person( "John", lastname ), rest@(_ *) ) + => { //Console.print("before is : "+before ); + lastname::searchJohns( rest.toList ) + } + + case _ + => Nil + + } + + } + + def main( args:Array[String] ) = { + + val p1 = Person("Albert", "Camus"); + val p2 = Person("Henry", "Miller"); + val p3 = Person("John", "Le Carre"); + val p4 = Person("Herbert", "Franke"); + val p5 = Person("John", "Smith"); + val p6 = Person("William", "Gibson"); + + val db:List[Person] = p1::p2::p3::p4::p5::p6::Nil; + + val db2:List[Person] = p3::Nil; + + Console.println("testBO"); + + assertEquals + ( onlyJohn( db ), Nil ); + + assertEquals + ( onlyJohn( db2 ), "Le Carre"::Nil ); + + assertEquals + ( searchFirstJohn( db ), "Le Carre" ); + + assertEquals + ( searchFirstJohn( db2 ), "Le Carre" ); + + assertEquals + ( searchJohns( db ), "Le Carre"::"Smith"::Nil ); + + assertEquals + ( searchJohns( db2 ), "Le Carre"::Nil ); + + } + +} +object testWR { + + import values._ ; + + import scala.testing.UnitTest._ ; + + def doit1(e: List[Char]):Int = e match { + case List( 'a', 'b', 'c' ) => 100 + case _ => 321 + }; + + def test1:Unit = { + Console.println("testWR_1"); + assertEquals( doit1( s0 ),321); + assertEquals( doit1( s1 ),100); + assertEquals( doit1( s2 ),321); + assertEquals( doit1( s3 ),321); + assertEquals( doit1( s4 ),321); + assertEquals( doit1( s5 ),321); + assertEquals( doit1( s6 ),321) + }; + + def doit2(e: List[Char]):Int = e match { + case List( ('a', 'b','c')? ) => 1000 + case _ => 321 + } + + def test2:Unit = { + Console.println("testWR_2"); + assertEquals( doit2( s0 ),1000); + assertEquals( doit2( s1 ),1000); + assertEquals( doit2( s2 ),321); + assertEquals( doit2( s3 ),321); + assertEquals( doit2( s4 ),321); + assertEquals( doit2( s5 ),321); + assertEquals( doit2( s6 ),321); + } + + + def doit3(e: List[Char]):String = e match { + case List( ('a', 'a','a')? ) => "ok" + case _ => "fail" + } + + def test3:Unit = { + Console.println("testWR_3"); + assertEquals( doit3( s0 ), "ok"); + assertEquals( doit3( s1 ),"fail"); + assertEquals( doit3( s2 ), "fail"); + assertEquals( doit3( s3 ),"ok"); + assertEquals( doit3( s4 ),"fail"); + assertEquals( doit3( s5 ),"fail"); + assertEquals( doit3( s6 ),"fail"); + } + + def doit4(e: List[Char]):String = e match { + case List( ('a'|'b')*,('a'|'b'|'c')+ ) => "ga!!!!" + case _ => "gu" + } + + def test4:Unit = { + Console.println("testWR_4"); + assertEquals( doit4( s0 ), "gu"); + assertEquals( doit4( s1 ), "ga!!!!"); + assertEquals( doit4( s2 ), "ga!!!!"); + assertEquals( doit4( s3 ), "ga!!!!"); + assertEquals( doit4( s4 ), "ga!!!!"); + assertEquals( doit4( s5 ), "ga!!!!"); + assertEquals( doit4( s6 ), "ga!!!!"); + } + + def doit5(e: List[Int]):String = e match { + case List( (0|1)+ ) => "binary" + case _ => "not binary" + } + + def test5:Unit = { + Console.println("testWR_5"); + assertEquals( doit5( s7 ), "not binary"); + assertEquals( doit5( s8 ), "binary"); + assertEquals( doit5( s9 ), "not binary"); + } + + // { ('0'..'9')*;'.';('0'..'9');('0'..'9')* ] + def doit6(e: List[Char]):String = e match { + case List( ('0'|'1'|'2'|'3'|'4'|'5'|'6'|'7'|'8'|'9')*, + '.', + ('0'|'1'|'2'|'3'|'4'|'5'|'6'|'7'|'8'|'9'), + ('0'|'1'|'2'|'3'|'4'|'5'|'6'|'7'|'8'|'9')* ) + + => "decimal number" + case _ => "not decimal" + } + + def test6:Unit = { + Console.println("testWR_6"); + assertEquals( doit6( s3 ), "not decimal"); + assertEquals( doit6( s10 ), "decimal number"); + } + + def test8: Unit = { + Console.println("testWR_8"); + + assertTrue( List('d','c') match { + case List('a'*, 'd'|'e', 'c'*) => true + case _ => false + }); + } + + def test7:Unit = { + Console.println("testWR_7"); + assertEquals( List(1,2) match { + case List(1,(3*,2))=> true; // test normalization (pattern normalizer) + case _ => false; + }, true); + } + def main( args:Array[String] ) = { + test1; + test2; + test3; + test4; + test5; + test6; + test7; + test8; + } + + + +} +object testWS { + + import values._ ; + + import scala.testing.UnitTest._ ; + + /* strings: + + "blabla" == [ "bla";"bla" ] == [ 'b';'l';'a';'b';'l';'a' ] + + [ "blabla";'x';'y'? ] == [ ('b';'l';'a';'b';'l';'a'); 'x'; 'y'? ] + + */ + + /* + def isIdentifierStart(c:char) ; + + case [ ... ; _isIdentifierStart_ ; ... ] + + calls method is..., needs to have type (elementType)Boolean + + translated to pattern + + [ ... ; Apply(is..., Tree.Empty) ; ... ] + + */ + + /* for tree automata: + + [ t0; t1; ...; tn ] with ti = labeli ( argsi ) + + gets translated to + + [ _isTree$0_ ; _isTree$1_ ; ... ; _isTree$n_ ] + + where isTree$i( t ) = t.is[ labeli ] ... (algebraic matcher) + + special case: sequences + + [ ...; seq ; ... ] where seq = [ ... ] + + gets translated to + + [ ...; _seq$0_ ; ...] with seq$0( s ) = t.is[ Sequence ] and + seq$0match( s.newIterator ) + + subroutines return + 1) d'abord true or false, + 2) later ( true|false, environment ) + assume order on variables, enviroment is a tuple/sequence + */ + + def doit1(e: List[Char]):Int = e match { + case List( 'a', 'b', 'c' ) => 100 + case List( ('a', 'b','c')? ) => 1004 + case List( ('a', 'a','a')? ) => 50 + case List( ('a'|'b')*,('a'|'b') ) => 700 + case _ => 321 + }; + + def test1:Unit = { + Console.println("testWS"); + assertEquals( doit1( s0 ),1004); + assertEquals( doit1( s1 ),100); + assertEquals( doit1( s2 ),321); + assertEquals( doit1( s3 ),50); + assertEquals( doit1( s4 ),321); + assertEquals( doit1( s5 ),700); + assertEquals( doit1( s6 ),700); + }; + + def main( args:Array[String] ) = { + test1; + } + + + +} +object testWT { + + import values._ ; + + import scala.testing.UnitTest._ ; + + def doit1(e: List[Char]):Int = e match { + case List( 'a', _, _ ) => 100 + case List( _ * ) => 321 + case _ => 20022 // this never happens + }; + + def test1:Unit = { + Console.println("testWT"); + assertEquals( doit1( s0 ),321); + assertEquals( doit1( s1 ),100); + assertEquals( doit1( s2 ),321); + assertEquals( doit1( s3 ),100); + assertEquals( doit1( s4 ),321); + assertEquals( doit1( s5 ),321); + assertEquals( doit1( s6 ),321) + }; + + def main( args:Array[ String ] ) = { + test1; + } + +} +object testWV { + + import values._ ; + + import scala.testing.UnitTest._ ; + + class testClass; + + case class testA( arg:List[Char] ) extends testClass; + + def doit1( e: testClass ):Int = e match { + + case testA( List( 'a', 'b', 'c' )) => 100 + case testA( List( ('a', 'b','c')? )) => 1004 + case testA( List( ('a', 'a','a')? )) => 50 + case testA( List( ('a'|'b')*,('a'|'b') )) => 700 + case testA( _ ) => 321 + + }; + + def test1:Unit = { + Console.println("testWV"); + assertEquals( doit1( testA(s0) ),1004); + assertEquals( doit1( testA(s1) ),100); + assertEquals( doit1( testA(s2) ),321); + assertEquals( doit1( testA(s3) ),50); + assertEquals( doit1( testA(s4) ),321); + assertEquals( doit1( testA(s5) ),700); + assertEquals( doit1( testA(s6) ),700); + }; + + + def main( args:Array[String] ) = { + + test1 + + } + +} +/* +object testWW { + + import values._ ; + + import scala.testing.UnitTest._ ; + + class testClass; + case class testA( arg:List[Char] ) extends testClass; + + def doit1(e: List[testClass]):Int = e match { + + case List( testA(List()), testA( List( 'a', 'b' )) ) => 100 + case _ => 321 + + }; + + def test1:Unit = { + val x1 = List( testA(s0) ); + + Console.println("testWW"); + + assertEquals( doit1( x1 ), 321 ); + + val x2 = List( testA(Nil), testA('a'::'b'::Nil) ); + + assertEquals( doit1( x2 ), 100 ); + + } + + def main( args:Array[String] ) = { + test1; + } + +} +*/ +object testMZ { + import scala.testing.UnitTest.assertEquals ; + class Expr; + case class One(xs: List[Expr]) extends Expr; + case class Two() extends Expr; + def testFoo(xs: List[Expr]) = xs match { //bug#132 + case List(Two()?,a,Two()?) => "a = " + a; + case List(Two()*,b,Two()*) => "b = " + b; + case List(_*) => "no match"; + } + case class OneN(); + def bind(xs: List[Any]):String = xs match { // bug#133b + case List(x@(OneN()*), y@(OneN())) => "case"; + case _ => "default"; + } + case class On(); + case class Tw(); + def testBar(xs: List[Any]) = xs match { // bug#180 + case List(((On(), Tw())* | (On(), On())), On()) => "caseBar" + case _ => "default"; + } + + + def mat195(x:Expr) = x match { // bug#195 + case One(x@List(_*)) => + "x = " + x; + + case _ =>"default"; + + } + + def mat196(xs: List[Any]) = xs match { // bug#196 + case List(b@(()|())) => + "case, b = " + b; + + case _ =>"default"; + + } + + def mat398(xs:List[Any]) = xs match { // bug#398 + case List(1) => "one" + case x::xs => "two" + } + + def mat406() = { + class Type; + case class A() extends Type; + case class B() extends Type; + case class C() extends Type; + + def foo(x: Type, y: Type): String = Pair(x, y) match { + case Pair(A(), A()) + | Pair(A(), B()) + | Pair(B(), A()) + | Pair(B(), B()) => "3" + case Pair(C(), C()) => "4" + case Pair(A(), _) + | Pair(B(), _) => "7" + case _ => "8" + } + + foo(A(), C()) + } + + def mat441() = { + val tata = 1; + val titi = 0.8 + Math.random(); + try { + tata match { + case 1 if (titi < 0.5) => "a" + case 0 | 1 => "b" + } + } catch { + case _ => "c" + } + } + + /* this will crash + def matSymbolCloning = { + 2 match { + case 3 | 4 => + class Foo extends scala.xml.Atom[Int](3) { + def bar = 7; + } + null + } + } + */ + + def main:Unit = { + Console.println("testMZ - bugs #132 #133b #180 #195 #196 #398 #406 #441"); + assertEquals(testFoo( List(Two(),Two(),Two(),Two()) ),"b = Two"); + assertEquals(testFoo( List(Two(),Two(),Two()) ),"a = Two"); + assertEquals(testFoo( List(Two(),Two()) ),"a = Two"); + assertEquals(testFoo( List(Two()) ),"a = Two"); + assertEquals(testFoo( List() ),"no match"); + assertEquals(bind( List(OneN(),OneN()) ),"case"); + assertEquals(testBar( List() ),"default"); + assertEquals(testBar( List(On()) ),"caseBar"); + assertEquals(testBar( List(On(), On())), "default"); + assertEquals(testBar( List(On(), On(), On()) ),"caseBar"); + assertEquals(testBar( List(On(), On(), On(), On()) ),"default"); + assertEquals(testBar( List(On(), On(), On(), On(), On()) ),"default"); + assertEquals(mat195( One(List(Two(),Two())) ),"x = List(Two,Two)"); + assertEquals(mat195( One(List()) ),"x = List()"); + assertEquals(mat195( Two() ),"default"); + assertEquals(mat196( List(1) ),"default"); + assertEquals(mat196( List() ),"case, b = List()"); + assertEquals(mat398( List(2) ),"two"); + assertEquals(mat398( List(2) ),"two"); + assertEquals(mat406(), "7"); + assertEquals(mat441(), "b"); + () + } + +} +/* +object testNN { + import scala.testing.UnitTest._ ; + abstract class K; + case class F(x:K*) extends K; + case class G() extends K; + + def mtch(k:K):boolean = k match { + case F(F(G()*),G(),F(G()*)) => true; + case _ => false; + } + + def main:Unit = { + Console.println("testNN"); + assertEquals(mtch( F(F(G()),G(),F(G()))), true); + assertEquals(mtch( F(F(),G(),F(G(),G(),G(),G())) ), true); + assertEquals(mtch( G() ), false); + assertEquals(mtch( F(G()) ), false); + } +} +*/ +object testNO { // this does not need to be run, only compiled + + trait Operator; + case class Increment() extends Operator; + case class Decrement() extends Operator; + + trait Expression { + def eval = this match { + case Operation (v: Value, o: Increment) => v + case Operation (v: Value, d: Decrement) => v + } + } + + case class Value() extends Expression; + case class Operation (e: Expression, o: Operator) extends Expression; + + +} + +/** see comments in scala.tools.scalac.transformer.matching.PatternMatcher::isSeqApply 2005-02-17 + */ + +/* +object testBugSequenceApply { + + val x = List(1,2,3); + + case class ThreeBars extends Seq[Int] { + override def length = 3; + def elements = x.elements; + def apply(i:Int) = x.apply(i); + } + + // this works + def main:Unit = { + Console.print("testBugSequenceApply "); + val z: Seq[Int] = new ThreeBars(); + Console.print(z match { + case Seq(1,2,3) => "hello" // but ThreeBars is a case class... + }); + + Console.print(ThreeBars() match { + case Seq(1,2,3) => " hello" // but ThreeBars is a case class... + }); + } +} +*/ diff --git a/test/files/run/runtime.check b/test/files/run/runtime.check new file mode 100644 index 0000000000..990a087da0 --- /dev/null +++ b/test/files/run/runtime.check @@ -0,0 +1,64 @@ +<<< Test0 +[false,true] +[0,1,2] +[3,4,5] +[a,b,c] +[6,7,8] +[9,10,11] +[12.0,13.0] +[14.0,15.0] +[string] +>>> Test0 + +<<< Test1 +10 +14 +15 +16 +20 +23 +24 +25 +26 +>>> Test1 + +<<< Test2 +A +M0 +N0 + +A +N0 +M0 + +A +M0 +M1 +N0 + +A +N0 +N1 +M0 + +>>> Test2 + +<<< Test3 +Ok +Ok +Ok +Ok +Ok +Ok +Ok +Ok +Ok +Ok +Ok +Ok +Ok +Ok +Ok +Ok +>>> Test3 + diff --git a/test/files/run/runtime.scala b/test/files/run/runtime.scala new file mode 100644 index 0000000000..30f32b7cba --- /dev/null +++ b/test/files/run/runtime.scala @@ -0,0 +1,209 @@ +//############################################################################ +// Run Time Bugs & Test Cases +//############################################################################ +// $Id$ + +//############################################################################ +// serves as an entry point with the MSIL backend + +object TestMain { + def main(args: Array[String]): Unit = { + Test.main(args); + } +} + +//############################################################################ +// Test 0 - Array creation + +object Test0Test { + def println[A](xs: Array[A]): Unit = { + var i = 0; + Console.print("["); + while (i < xs.length) { + if (i > 0) Console.print(","); + Console.print(xs(i)); + i = i + 1; + } + Console.print("]"); + Console.println; + } + + def main(args: Array[String]): Unit = { + val zs: Array[Boolean] = Array(false, true); + val bs: Array[Byte ] = Array(0, 1, 2); + val ss: Array[Short ] = Array(3, 4, 5); + val cs: Array[Char ] = Array('a', 'b', 'c'); + val is: Array[Int ] = Array(6, 7, 8); + val ls: Array[Long ] = Array(9l, 10l, 11l); + val fs: Array[Float ] = Array(12.0f, 13.0f); + val ds: Array[Double ] = Array(14.0d, 15.0d); + val os: Array[AnyRef ] = Array("string"); + println(zs); + println(bs); + println(ss); + println(cs); + println(is); + println(ls); + println(fs); + println(ds); + println(os); + } +} + +//############################################################################ +// Test 1 - Block Qualifiers + +package test1.bar { + + object System { + val out: PrintStream = new PrintStream(); + } + + class PrintStream() { + def println(): Unit = { + Console.println; + } + } + +} + +object Test1Test { + + def main(args: Array[String]): Unit = { + {Console.print(10)}; Console.println; + // {System.out.print(11); java}.lang.System.out.println(); + // {System.out.print(12); java.lang}.System.out.println(); + // {System.out.print(13); java.lang.System}.out.println(); + {Console.print(14); Console}.println; + {Console.print(15); (() => Console.println):(() => Unit)}(); + {Console.print(16); Console.println}; + + {Console.print(20)}; test1.bar.System.out.println(); + // {System.out.print(21); test1}.bar.System.out.println(); + // {System.out.print(22); test1.bar}.System.out.println(); + {Console.print(23); test1.bar.System}.out.println(); + {Console.print(24); test1.bar.System.out}.println(); + {Console.print(25); test1.bar.System.out.println:(() => Unit)}(); + {Console.print(26); test1.bar.System.out.println()}; + } + +} + +//############################################################################ +// Test 2 - Super Calls with Mixins + +package test2 { + + class A { + def run = Console.println("A"); + } + + trait M0 extends A { + override def run = { super.run; System.out.println("M0"); } + } + + class M1 extends M0 { + override def run = { super.run; Console.println("M1"); } + } + + trait N0 extends A { + override def run = { super.run; System.out.println("N0"); } + } + + class N1 extends N0 { + override def run = { super.run; Console.println("N1"); } + } + + object M0N0 extends M0 with N0; + object N0M0 extends N0 with M0; + object M1N0 extends M1 with N0; + object N1M0 extends N1 with M0; + +} + +object Test2Test { + def main(args: Array[String]): Unit = { + test2.M0N0.run; Console.println; + test2.N0M0.run; Console.println; + test2.M1N0.run; Console.println; + test2.N1M0.run; Console.println; + } +} + +//############################################################################ +// Test 3 - Methods eq and ne + +object Test3Test { + + class Foo { override def equals(that: Any) = error("abort"); } + + def check(expected: Boolean, actual1: Boolean, actual2: Boolean): Unit = + Console.println( + if ((actual1 == expected) && (actual2 == !expected)) "Ok" else "KO: " + + "expected: " + expected + " - " + (!expected) + ", " + + "found: " + actual1 + " - " + actual1); + + def main(args: Array[String]): Unit = { + val foo1: AnyRef = null; + val foo2: AnyRef = new Foo(); + val foo3: AnyRef = new Foo(); + + check(true , null eq null, null ne null); + check(true , null eq foo1, null ne foo1); + check(false, null eq foo2, null ne foo2); + check(false, null eq foo3, null ne foo3); + + check(true , foo1 eq null, foo1 ne null); + check(true , foo1 eq foo1, foo1 ne foo1); + check(false, foo1 eq foo2, foo1 ne foo2); + check(false, foo1 eq foo3, foo1 ne foo3); + + check(false, foo2 eq null, foo2 ne null); + check(false, foo2 eq foo1, foo2 ne foo1); + check(true , foo2 eq foo2, foo2 ne foo2); + check(false, foo2 eq foo3, foo2 ne foo3); + + check(false, foo3 eq null, foo3 ne null); + check(false, foo3 eq foo1, foo3 ne foo1); + check(false, foo3 eq foo2, foo3 ne foo2); + check(true , foo3 eq foo3, foo3 ne foo3); + } + +} + +//############################################################################ +// Main + +object Test { + var errors: Int = 0; + def test(name: String, test: => Unit): Unit = { + Console.println("<<< " + name); + try { + test; + } catch { + case exception => { + //val name: String = Thread.currentThread().getName(); + Console.print("Exception in thread \"" + name + "\" " + exception); + Console.println; + errors = errors + 1; + } + } + Console.println(">>> " + name); + Console.println; + } + + def main(args: Array[String]): Unit = { + + test("Test0" , Test0Test.main(args)); + test("Test1" , Test1Test.main(args)); + test("Test2" , Test2Test.main(args)); + test("Test3" , Test3Test.main(args)); + + if (errors > 0) { + Console.println; + Console.println(errors + " error" + (if (errors > 1) "s" else "")); + } + } +} + +//############################################################################ diff --git a/test/files/run/tailcalls.check b/test/files/run/tailcalls.check new file mode 100644 index 0000000000..73d86cd2d2 --- /dev/null +++ b/test/files/run/tailcalls.check @@ -0,0 +1,46 @@ +test Object .f was successful +test Final .f was successful +test Class .f raised exception java.lang.StackOverflowError +test SubClass .f was successful +test Sealed .f raised exception java.lang.StackOverflowError +test SubSealed.f was successful + +test O .f was successful +test c .f was successful +test O.O .f was successful +test O.c .f was successful +test c.O .f was successful +test c.c .f was successful +test O.O.O .f was successful +test O.O.c .f was successful +test O.c.O .f was successful +test O.c.c .f was successful +test c.O.O .f was successful +test c.O.c .f was successful +test c.c.O .f was successful +test c.c.c .f was successful +test O.O.O.O.f was successful +test O.O.O.c.f was successful +test O.O.c.O.f was successful +test O.O.c.c.f was successful +test O.c.O.O.f was successful +test O.c.O.c.f was successful +test O.c.c.O.f was successful +test O.c.c.c.f was successful +test c.O.O.O.f was successful +test c.O.O.c.f was successful +test c.O.c.O.f was successful +test c.O.c.c.f was successful +test c.c.O.O.f was successful +test c.c.O.c.f was successful +test c.c.c.O.f was successful +test c.c.c.c.f was successful + +test TailCall.f1 was successful +test TailCall.f2 was successful +test TailCall.f3 was successful +test TailCall.g1 was successful +test TailCall.g2 was successful +test TailCall.g3 was successful +test TailCall.h1 was successful + diff --git a/test/files/run/tailcalls.scala b/test/files/run/tailcalls.scala new file mode 100644 index 0000000000..3279e6bf64 --- /dev/null +++ b/test/files/run/tailcalls.scala @@ -0,0 +1,290 @@ +//############################################################################ +// Tail Calls +//############################################################################ +// $Id$ + +//############################################################################ +// Calibration + +class Calibrator { + def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); +} + +//############################################################################ +// Tail calls in different contexts + +class Class { + def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); +} + +class SubClass extends Class { + override def f(n: Int, v: Int): Int = v; +} + +sealed class Sealed { + def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); +} + +class SubSealed extends Sealed { + override def f(n: Int, v: Int): Int = v; +} + +final class Final { + def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); +} + +object Object { + def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); +} + +//############################################################################ +// Tail calls in nested objects/classes + +object O { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + object O { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + object O { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + object O { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + } + class C { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + } + val c: C = new C; + } + class C { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + object O { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + } + class C { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + } + val c: C = new C; + } + val c: C = new C; + } + class C { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + object O { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + object O { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + } + class C { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + } + val c: C = new C; + } + class C { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + object O { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + } + class C { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + } + val c: C = new C; + } + val c: C = new C; + } + val c: C = new C; +} + +class C { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + object O { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + object O { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + object O { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + } + class C { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + } + val c: C = new C; + } + class C { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + object O { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + } + class C { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + } + val c: C = new C; + } + val c: C = new C; + } + class C { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + object O { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + object O { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + } + class C { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + } + val c: C = new C; + } + class C { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + object O { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + } + class C { + final def f(n: Int, v: Int): Int = if (n == 0) v else f(n - 1, v - 1); + } + val c: C = new C; + } + val c: C = new C; + } + val c: C = new C; +} + +//############################################################################ +// Tail calls with different signatures + +class TailCall[S](s: S) { + def getS: S = s; + + final def f1(n: Int, v: Int): Int = + if (n == 0) v else f1(n - 1, v - 1); + final def f2[T](n: Int, v: Int): Int = + if (n == 0) v else f2[T](n - 1, v - 1); + final def f3[T](n: Int, v: Int, ls: List[T]): Int = + if (n == 0) v else f3(n - 1, v - 1, ls); + + final def g1(x: Int, y: Int): Int = { + def aux(n: Int, v: Int): Int = + if (n == 0) v else aux(n - 1, v - 1); + aux(x, y); + } + final def g2[T](x: Int, y: Int): Int = { + def aux[U](n: Int, v: Int): Int = + if (n == 0) v else aux[U](n - 1, v - 1); + aux[T](x, y); + } + final def g3[T](x: Int, y: Int, zs: List[T]): Int = { + def aux[U](n: Int, v: Int, ls: List[Pair[T,U]]): Int = + if (n == 0) v else aux(n - 1, v - 1, ls); + aux(x, y, Nil); + } + + def h1(n: Int, v: Int): Int = hP(n, v); + private def hP(n: Int, v: Int): Int = if (n == 0) v else hP(n - 1, v - 1); + + // !!! test return in non-tail-call position + // !!! test non-same-instance calls + // !!! test non-same-type calls + +} + +//############################################################################ +// Test code + +object Test { + def check_success(name: String, closure: => Int, expected: Int): Unit = { + Console.print("test " + name); + try { + val actual: Int = closure; + if (actual == expected) { + Console.print(" was successful"); + } else { + Console.print(" failed: expected "+ expected +", found "+ actual); + } + } catch { + case exception: Throwable => { + Console.print(" raised exception " + exception); + } + } + Console.println; + } + + def calibrate: Int = { + val calibrator = new Calibrator(); + var stop = false; + var n = 1; + while (!stop) { + try { + calibrator.f(n, n); + if (n >= scala.runtime.compat.Math.MAX_INT / 2) error("calibration failure"); + n = 2 * n; + } catch { + case exception: StackOverflowError => stop = true + } + } + 4 * n; + } + + def main(args: Array[String]): Unit = { + // compute min and max iteration number + val min = 16; + val max = calibrate; + + // test tail calls in different contexts + val Final = new Final(); + val Class = new Class(); + val SubClass = new SubClass(); + val Sealed = new Sealed(); + val SubSealed = new SubSealed(); + check_success("Object .f", Object .f(max, max), 0); + check_success("Final .f", Final .f(max, max), 0); + check_success("Class .f", Class .f(max, max), 0); + check_success("SubClass .f", SubClass .f(max, max), max); + check_success("Sealed .f", Sealed .f(max, max), 0); + check_success("SubSealed.f", SubSealed.f(max, max), max); + Console.println; + + // test tail calls in nested classes/objects + val c: C = new C; + check_success("O .f", O .f(max, max), 0); + check_success("c .f", c .f(max, max), 0); + check_success("O.O .f", O.O .f(max, max), 0); + check_success("O.c .f", O.c .f(max, max), 0); + check_success("c.O .f", c.O .f(max, max), 0); + check_success("c.c .f", c.c .f(max, max), 0); + check_success("O.O.O .f", O.O.O .f(max, max), 0); + check_success("O.O.c .f", O.O.c .f(max, max), 0); + check_success("O.c.O .f", O.c.O .f(max, max), 0); + check_success("O.c.c .f", O.c.c .f(max, max), 0); + check_success("c.O.O .f", c.O.O .f(max, max), 0); + check_success("c.O.c .f", c.O.c .f(max, max), 0); + check_success("c.c.O .f", c.c.O .f(max, max), 0); + check_success("c.c.c .f", c.c.c .f(max, max), 0); + check_success("O.O.O.O.f", O.O.O.O.f(max, max), 0); + check_success("O.O.O.c.f", O.O.O.c.f(max, max), 0); + check_success("O.O.c.O.f", O.O.c.O.f(max, max), 0); + check_success("O.O.c.c.f", O.O.c.c.f(max, max), 0); + check_success("O.c.O.O.f", O.c.O.O.f(max, max), 0); + check_success("O.c.O.c.f", O.c.O.c.f(max, max), 0); + check_success("O.c.c.O.f", O.c.c.O.f(max, max), 0); + check_success("O.c.c.c.f", O.c.c.c.f(max, max), 0); + check_success("c.O.O.O.f", c.O.O.O.f(max, max), 0); + check_success("c.O.O.c.f", c.O.O.c.f(max, max), 0); + check_success("c.O.c.O.f", c.O.c.O.f(max, max), 0); + check_success("c.O.c.c.f", c.O.c.c.f(max, max), 0); + check_success("c.c.O.O.f", c.c.O.O.f(max, max), 0); + check_success("c.c.O.c.f", c.c.O.c.f(max, max), 0); + check_success("c.c.c.O.f", c.c.c.O.f(max, max), 0); + check_success("c.c.c.c.f", c.c.c.c.f(max, max), 0); + Console.println; + + // test tail calls with different signatures + val TailCall = new TailCall("S"); + check_success("TailCall.f1", TailCall.f1(max, max ), 0); + check_success("TailCall.f2", TailCall.f2(max, max ), 0); + check_success("TailCall.f3", TailCall.f3(max, max, Nil), 0); + check_success("TailCall.g1", TailCall.g1(max, max ), 0); + check_success("TailCall.g2", TailCall.g2(max, max ), 0); + check_success("TailCall.g3", TailCall.g3(max, max, Nil), 0); + check_success("TailCall.h1", TailCall.h1(max, max ), 0); + Console.println; + } +} + +//############################################################################ diff --git a/test/files/run/try.check b/test/files/run/try.check new file mode 100644 index 0000000000..3983e26060 --- /dev/null +++ b/test/files/run/try.check @@ -0,0 +1,6 @@ +1 + 1 = 2 +1 + 1 = 2 +1 + 1 = 2 +1 + 1 = 2 + +1 + 1 = 2 diff --git a/test/files/run/try.scala b/test/files/run/try.scala new file mode 100644 index 0000000000..fca6bf5c55 --- /dev/null +++ b/test/files/run/try.scala @@ -0,0 +1,110 @@ +object Test extends AnyRef with Application { + val x = 1; + + def try1 = { + Console.print("1 + 1 = "); + Console.println(1 + ( + try { + x; + } catch { + case _: Error => 1; + } + )); + } + + def try2 = { + Console.print("1 + 1 = "); + Console.println( + (try { x } catch { + case _: Error => 1; + }) + + + (try { x } catch { + case _: Error => 1; + }) + ); + } + + var n = 0; + + def try3 = { + Console.print("1 + 1 = "); + val x = try { 1 } catch { + case e: Error => 1; + } + this.n = try { 1 } catch { + case e: Error => 1; + } + Console.println(x + n); + } + + var instance: AnyRef = null; + + def try4 = { + if (instance == null) { + instance = try { + new String(); + } catch { + case _ => + val cs = "aaa"; + if (cs.length() > 0) { + new String(); + } else { + throw new Error("fatal error"); + null + } + } + } + } + + def try5 = try { + Console.print("1 + 1 = "); + try { + if (true) + error("exit"); + 1+1; + () + } catch { + case _ => + Console.println("2"); + error("for good"); + } + Console.println("a"); + } catch { + case _ => (); + } + + class A { + private val result = { + val y = try { x } catch { + case _: Error => 1; + }; + x + y + } + Console.print("1 + 1 = "); + Console.println(result); + } + +/* + def finally1 = { + Console.print("1 + 1 = "); + Console.println(1 + ( + try { + x + } finally { + () + } + )); + } + +*/ + + try1; + try2; + try3; + try4; + try5; + Console.println; + new A(); + () +} |